DEPBT structure
|
Common Name | DEPBT | ||
|---|---|---|---|---|
| CAS Number | 165534-43-0 | Molecular Weight | 299.220 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 382.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N3O5P | Melting Point | 75-77°C | |
| MSDS | N/A | Flash Point | 184.9±23.2 °C | |
| Name | 3-(Diethoxyphosphoryloxy)-1,2,3-benzotriazin-4(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.1±25.0 °C at 760 mmHg |
| Melting Point | 75-77°C |
| Molecular Formula | C11H14N3O5P |
| Molecular Weight | 299.220 |
| Flash Point | 184.9±23.2 °C |
| Exact Mass | 299.067108 |
| PSA | 102.35000 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | AJDPNPAGZMZOMN-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)On1nnc2ccccc2c1=O |
| Storage condition | -15°C |
|
~83%
DEPBT CAS#:165534-43-0 |
| Literature: Li; Jiang; Ye; Fan; Romoff; Goodman Organic letters, 1999 , vol. 1, # 1 p. 91 - 93 |
|
~55%
DEPBT CAS#:165534-43-0 |
| Literature: Fan, Chong-Xu; Hao, Xiao-Lin; Ye, Yun-Hua Synthetic Communications, 1996 , vol. 26, # 7 p. 1455 - 1460 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 3-(Diethoxyphosphoryloxy)-1,2,3-benzotriazin-4-(3H)-one |
| MFCD01236967 |
| 3-(Diethoxyphosphoryloxy)-3H-benzo[d][1,2,3] triazin-4-one |
| Diethyl 4-oxo-3,4-dihydro-1,2,3-benzotriazin-3-yl phosphate |
| 3-(Diethoxyphosphoryloxy)-1,2,3-benzotrizin-4(3H)-one |
| 3-[(Diethoxyphosphoryl)oxy]-1,2,3-benzotriazin-4(3H)-one |
| T66 BNNNVJ DOPO&O2&O2 |
| 3-(Diethoxyphosphoryloxy)-1,2,3-benzotriazin-4(3H)-one |
| Diethyl 3,4-Dihydro-4-oxo-1,2,3-benzotriazin-3-yl Phosphate |
| diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate |
| Diethyl 4-oxobenzo[d]1,2,3-triazin-3-yl phosphate |
| Diethyl (4-oxobenzo[d][1,2,3]triazin-3(4H)-yl) phosphate |
| DEPBT |
| Diethyl (4-oxo-3,4-dihydro-1,2,3-benzotriazin-3-yl) phosphate |