(R)-3-Amino-3-(4-nitrophenyl)propanoic acid structure
|
Common Name | (R)-3-Amino-3-(4-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 501120-99-6 | Molecular Weight | 210.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 409.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.1±27.3 °C | |
| Name | (3R)-3-amino-3-(4-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.0±40.0 °C at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.187 |
| Flash Point | 201.1±27.3 °C |
| Exact Mass | 210.064056 |
| PSA | 109.14000 |
| LogP | 0.68 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | JVQPVKJZKRICRR-MRVPVSSYSA-N |
| SMILES | NC(CC(=O)O)c1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922499990 |
|
~7%
(R)-3-Amino-3-(... CAS#:501120-99-6 |
| Literature: Angewandte Chemie - International Edition, , vol. 51, # 2 p. 482 - 486 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (2R)-3-Amino-2-(4-nitrophenyl)propanoic acid |
| 3-Amino-3-(4-nitrophenyl)propanoic acid |
| (R)-3-(p-Nitrophenyl)-beta-alanine |
| (R)-3-Amino-3-(4-nitrophenyl)propanoic acid |
| (R)-3-Amino-3-(4-nitro-phenyl)-propionic acid |