alpha-Dihydroartemisinin structure
|
Common Name | alpha-Dihydroartemisinin | ||
|---|---|---|---|---|
| CAS Number | 81496-81-3 | Molecular Weight | 284.348 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 375.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H24O5 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 181.0±27.9 °C | |
| Name | 3,6,9-trimethyldecahydro-12H-3,12-epoxy[1,2]dioxepino[4,3-i]isochromen-10-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.6±42.0 °C at 760 mmHg |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.348 |
| Flash Point | 181.0±27.9 °C |
| Exact Mass | 284.162384 |
| PSA | 57.15000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | BJDCWCLMFKKGEE-KDTBHNEXSA-N |
| SMILES | CC1CCC2C(C)C(O)OC3OC4(C)CCC1C32OO4 |
| Storage condition | 2-8°C |
|
~%
alpha-Dihydroar... CAS#:81496-81-3 |
| Literature: Organic Letters, , vol. 7, # 8 p. 1561 - 1564 |
|
~%
alpha-Dihydroar... CAS#:81496-81-3 |
| Literature: Organic Process Research and Development, , vol. 16, # 5 p. 1039 - 1042 |
|
~%
alpha-Dihydroar... CAS#:81496-81-3 |
| Literature: Journal of Organic Chemistry, , vol. 76, # 6 p. 1751 - 1758 |
| Dihydroartemisinin |
| alpha-Dihydroartemisinin |
| artenimol |
| (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-Trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.0.0]hexadecan-10-ol |
| (5aS,6R,8aS,9R,10S,12R,12aR)-3,6,9-trimethyldecahydro-3,12-epoxy[1,2]dioxepino[4,3-i]isochromen-10-ol |
| (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-Trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.0.0]hexadecan-10-ol |
| (3R,5aS,6R,8aS,9R,10S,12R,12aR)-3,6,9-trimethyldecahydro-3,12-epoxy[1,2]dioxepino[4,3-i]isochromen-10-ol |
| (3R,5aS,6R,8aS,9R,10R,12R,12aR)-Decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-ol |