3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid
3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid structure
|
Common Name | 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 376592-93-7 | Molecular Weight | 229.231 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 474.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.0±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-amino-2-hydroxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 474.8±45.0 °C at 760 mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.231 |
| Flash Point | 241.0±28.7 °C |
| Exact Mass | 229.073898 |
| PSA | 83.55000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | ZXLYSSHNDUXXIN-UHFFFAOYSA-N |
| SMILES | Nc1cccc(-c2cccc(C(=O)O)c2)c1O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922509090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: ASSIA CHEMICAL INDUSTRIES LTD.; TEVA PHARMACEUTICAL USA, INC.; AVDAGIC, Amir; BARAN, Phil, S. Patent: WO2013/49605 A1, 2013 ; Location in patent: Paragraph 0058 ; |
|
~52%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: PLIVA HRVATSKA D.O.O. Patent: US2010/256212 A1, 2010 ; Location in patent: Page/Page column 16 ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
![5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic acid structure](https://image.chemsrc.com/caspic/015/376592-58-4.png)
![2'-Hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid structure](https://image.chemsrc.com/caspic/147/376591-95-6.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bip030 |
| 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid |
| 3'-amino-2'-hydroxy-biphenyl-3-carboxylic acid |
| 3'-amino-2'-hydroxybiphenyl-3-carboxylic acid |
| Eltrombopag olamine Intermediate 1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: LogP of 3-(3-amino-2-hydroxyphenyl)benzoic acid is 1.48. |
| Q: What is the InChIKey of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: InChIKey of 3-(3-amino-2-hydroxyphenyl)benzoic acid is ZXLYSSHNDUXXIN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: SMILES notation of 3-(3-amino-2-hydroxyphenyl)benzoic acid is Nc1cccc(-c2cccc(C(=O)O)c2)c1O. |
| Q: What is the molecular weight of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: Molecular weight of 3-(3-amino-2-hydroxyphenyl)benzoic acid is 229.231. |
| Q: What are the upstream materials of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: Related upstream materials(CAS) of 3-(3-amino-2-hydroxyphenyl)benzoic acid: 376592-58-4;376591-95-6;695-96-5;25487-66-5;376592-57-3;89-64-5;15969-10-5. |
| Q: What is the boiling point of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: Boiling point of 3-(3-amino-2-hydroxyphenyl)benzoic acid is 474.8±45.0 °C at 760 mmHg. |
| Q: What is the CAS number of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: CAS number of 3-(3-amino-2-hydroxyphenyl)benzoic acid is 376592-93-7. |
| Q: What is the English name of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: The English name of 3-(3-amino-2-hydroxyphenyl)benzoic acid is 3-(3-amino-2-hydroxyphenyl)benzoic acid. |
| Q: What is the molecular formula of 3-(3-amino-2-hydroxyphenyl)benzoic acid? |
| A: Molecular formula of 3-(3-amino-2-hydroxyphenyl)benzoic acid is C13H11NO3. |
| Q: What English synonyms does 3-(3-amino-2-hydroxyphenyl)benzoic acid have? |
| A: English synonyms of 3-(3-amino-2-hydroxyphenyl)benzoic acid: bip030, 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid, 3'-amino-2'-hydroxy-biphenyl-3-carboxylic acid, 3'-amino-2'-hydroxybiphenyl-3-carboxylic acid, Eltrombopag olamine Intermediate 1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |