5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic acid
![5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic acid Structure](https://image.chemsrc.com/caspic/015/376592-58-4.png)
5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic acid structure
|
Common Name | 5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 376592-58-4 | Molecular Weight | 293.659 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 467.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.5±28.7 °C | |
| Name | 3-(5-chloro-2-hydroxy-3-nitrophenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.4±45.0 °C at 760 mmHg |
| Molecular Formula | C13H8ClNO5 |
| Molecular Weight | 293.659 |
| Flash Point | 236.5±28.7 °C |
| Exact Mass | 293.009094 |
| PSA | 103.35000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | PGNTVCRTPYDGRN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(-c2cc(Cl)cc([N+](=O)[O-])c2O)c1 |
| HS Code | 2918199090 |
|---|
|
~90%
5'-chloro-2'-hy... CAS#:376592-58-4 |
| Literature: ASSIA CHEMICAL INDUSTRIES LTD.; TEVA PHARMACEUTICAL USA, INC.; AVDAGIC, Amir; BARAN, Phil, S. Patent: WO2013/49605 A1, 2013 ; Location in patent: Paragraph 0052 ; |
|
~%
5'-chloro-2'-hy... CAS#:376592-58-4 |
| Literature: WO2013/49605 A1, ; Paragraph 0055 ; |
|
~%
5'-chloro-2'-hy... CAS#:376592-58-4 |
| Literature: WO2013/49605 A1, ; |
|
~%
5'-chloro-2'-hy... CAS#:376592-58-4 |
| Literature: WO2013/49605 A1, ; |
|
~%
5'-chloro-2'-hy... CAS#:376592-58-4 |
| Literature: WO2013/49605 A1, ; |
CAS#:376592-93-7| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5'-Chloro-2'-hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid |
| [1,1'-Biphenyl]-3-carboxylic acid, 5'-chloro-2'-hydroxy-3'-nitro- |
| 5'-chloro-2'-hydroxy-3'-nitrobiphenyl-3-carboxylic acid |
| 5'-Chloro-2'-hydroxy-3'-nitro-3-biphenylcarboxylic acid |