| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000386857 uM | Activity at 0.0001060182 uM | Activity at 0.0001896372 uM | Activity at 0.0004510146 uM | Activity at 0.0007501981 uM | Activity at 0.0009728036 uM | Activity at 0.00288 uM | Activity at 0.00508 uM | Activity at 0.00871 uM | Activity at 0.015 uM | Activity at 0.026 uM | Activity at 0.053 uM | Activity at 0.079 uM | Activity at 0.232 uM | Activity at 0.457 uM | Activity at 0.692 uM | Activity at 1.068 uM | Activity at 2.292 uM | Activity at 3.859 uM | Activity at 11.39 uM | Activity at 17.02 uM | Activity at 25.62 uM | Activity at 57.25 uM | Activity at 87.55 uM | Activity at 183.4 uM | Activity at 286.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6.75 | 4.9549 | 0.9727 | 0.0901 | 17.5 | 4 | 0 0 0 1 | 8.9408 | 15.9527 | -1.5916 | 1.4969 | 8.9408 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.3 | 4.095 | 0.9996 | 5.5 | -7.7823 | 4 | 0 0 0 1 | -11.1081 | -7.5736 | -7.7353 | 5.034 | -11.1081 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.15 | 4.9549 | 0.907 | -15.9207 | 9.5 | 4 | 0 0 0 1 | 17.8725 | 5.2874 | 13.9021 | -13.6839 | 17.8725 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 35.4813 | 46.4095 | 0 | Single point of activity | -4.45 | 2.5884 | 1 | 45.9404 | -0.4691 | 3 | 1 0 0 0 | 35.593 | 40.1678 | -0.3909 | 1.933 | 35.593 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 39.8107 | 72.2646 | 0 | Single point of activity | -4.4 | 4.9549 | 0.9515 | 68.1912 | -4.0733 | 3 | 0 0 0 0 | 58.0117 | 5.8738 | -9.2278 | -8.5224 | 58.0117 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 14.1254 | 45.3319 | 0 | Partial curve; partial efficacy; poor fit | -4.85 | 2.4064 | 0.9982 | 40.7728 | -4.5591 | 2.4 | 1 0 0 0 | 40.0933 | -24.9557 | -3.8845 | 11.5254 | 40.0933 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -5.75 | 4.9549 | 0.9291 | -20.6086 | 33.1545 | 4 | 1 0 0 0 | -12.8464 | 45.4569 | 28.2161 | -28.42 | -12.8464 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.35 | 4.9549 | 0.855 | -24.2184 | -0.5 | 4 | 0 0 0 0 | -18.932 | -3.6477 | -2.409 | 4.988 | -18.932 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 3.6272 | 0.8625 | 15 | -8.5523 | 4 | 0 0 0 0 | 14.477 | -2.951 | -13.7936 | -5.9646 | 14.477 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.7 | 4.9549 | 0.6637 | 3 | -16.864 | 4 | 0 0 0 0 | 8.8169 | -15.72 | 6.3794 | -6.3599 | 8.8169 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 2.4064 | 0.9999 | 21.5 | -2.4101 | 4 | 1 0 0 0 | 20.2184 | 33.3778 | -2.4251 | 3.5771 | 20.2184 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.8117 | 2.5 | -8.345 | 4 | 0 0 0 0 | 1.096 | -8.966 | -5.5054 | -11.1209 | 1.096 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 39.8107 | 38.7945 | 0 | Single point of activity | -4.4 | 4.9549 | 0.6241 | 41.7557 | 2.9612 | 3 | 0 0 0 0 | 36.2039 | 21.355 | -6.3904 | -4.5325 | 36.2039 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -6.05 | 4.095 | 0.9994 | -6.0518 | 20 | 4 | 0 0 0 1 | 20.5156 | 19.7377 | 1.4122 | -6.2932 | 20.5156 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.2 | 4.095 | 1 | 10.5 | -10.1683 | 4 | 1 0 0 1 | -15.9884 | 36.1362 | -10.1402 | 8.7939 | -15.9884 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.5 | 1.3905 | 0.9999 | -24.241 | 0.2745 | 4 | 0 0 0 1 | -5.5981 | -4.3546 | -20.7587 | -23.9509 | -5.5981 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.711 | -2.4459 | 21 | 4 | 0 0 0 0 | -3.3453 | 17.3219 | -9.9549 | 5.5495 | -3.3453 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 39.8107 | 47.809 | 0 | Partial curve; partial efficacy; poor fit | -4.4 | 4.9549 | 0.5212 | 50.2399 | 2.4309 | 2.4 | 0 0 0 0 | 43.4722 | 30.2363 | -10.9855 | -11.5143 | 43.4722 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 22.3872 | 75.5081 | 0 | Partial curve; high efficacy; poor fit | -4.65 | 1.9673 | 0.9829 | 96.5324 | 21.0243 | 2.3 | 0 0 0 0 | 86.4985 | 26.0932 | 16.3365 | 36.2613 | 86.4985 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.7429 | -1 | -13.0738 | 4 | 0 0 0 0 | 1.8063 | -11.3115 | 0.8702 | -5.1757 | 1.8063 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0118 | 90.0897 | 87 | Complete curve; high efficacy | -7.9292 | 2.4729 | 0.969 | 42.5966 | 132.6862 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 57.466 | 123.2938 | 140.8388 | 112.241 | 60.9016 | 44.0896 | 39.7677 | 36.4785 | 40.206 | 39.1769 | 41.4618 | 57.466 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.4176 | 75.8509 | 87 | Complete curve; high efficacy | -6.3792 | 1.5386 | 0.9498 | 72.4265 | 148.2774 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 61.5626 | 139.2774 | 158.5971 | 143.0204 | 144.9664 | 147.8567 | 136.0151 | 91.8156 | 92.9505 | 75.6746 | 74.6768 | 61.5626 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.1482 | 94.4192 | 87 | Complete curve; high efficacy | -6.8292 | 1.1 | 0.9517 | 59.4372 | 153.8564 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 55.0456 | 164.8354 | 134.704 | 151.2303 | 143.6834 | 134.7615 | 95.6484 | 70.0621 | 67.3056 | 76.1055 | 55.6924 | 55.0456 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1663 | 94.1023 | 86 | Complete curve; high efficacy | -6.7792 | 2.7202 | 0.9729 | 50.0751 | 144.1775 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 56.0568 | 132.0924 | 142.9387 | 160.1371 | 137.1338 | 142.2899 | 85.8931 | 48.2002 | 45.0417 | 52.6033 | 54.1832 | 56.0568 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.0332 | 121.0752 | 86 | Complete curve; high efficacy | -7.4792 | 1 | 0.9841 | 42.1192 | 163.1944 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 35.7472 | 158.2854 | 158.4708 | 139.505 | 123.3406 | 71.5741 | 65.2589 | 55.0718 | 50.0867 | 42.1782 | 37.1955 | 35.7472 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.7427 | 78.6716 | 85 | Complete curve; high efficacy | -6.1292 | 1.8851 | 0.9834 | 63.6148 | 142.2865 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 58.2475 | 142.1116 | 146.4992 | 135.5304 | 145.8795 | 136.7066 | 141.0466 | 113.8331 | 74.386 | 65.1288 | 71.8868 | 58.2475 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.8333 | 86.2191 | 85 | Complete curve; high efficacy | -6.0792 | 1 | 0.9302 | 67.549 | 153.7681 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 69.8532 | 158.4753 | 142.7847 | 153.7541 | 141.7507 | 166.925 | 141.693 | 105.2958 | 104.6674 | 77.2217 | 76.1652 | 69.8532 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 3.7221 | 64.4935 | 85 | Complete curve; high efficacy | -5.4292 | 4.9549 | 0.792 | 112.0642 | 176.5577 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 89.6942 | 158.9633 | 166.2699 | 180.3984 | 167.1951 | 174.9654 | 191.2964 | 181.3214 | 193.1909 | 122.0222 | 135.5388 | 89.6942 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0526 | 123.2368 | 85 | Complete curve; high efficacy | -7.2792 | 0.6 | 0.9724 | 33.4065 | 156.6433 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 35.7651 | 153.6951 | 126.1364 | 142.4363 | 103.2491 | 92.5951 | 73.1478 | 60.6143 | 43.3887 | 40.0313 | 37.8821 | 35.7651 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0066 | 77.5262 | 84 | Complete curve; high efficacy | -8.1792 | 0.8 | 0.9753 | 21.6969 | 99.2231 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.2627 | 91.552 | 76.4137 | 56.5612 | 42.1934 | 34.0283 | 31.1809 | 27.3506 | 26.0778 | 20.6343 | 20.2144 | 13.2627 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.5258 | 123.4599 | 84 | Complete curve; high efficacy | -6.2792 | 1.3987 | 0.9682 | 42.1223 | 165.5821 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.7016 | 164.86 | 160.7689 | 152.0063 | 170.1205 | 168.2257 | 149.3034 | 88.2138 | 74.0696 | 51.7982 | 49.7901 | 25.7016 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 1.8655 | 82.3759 | 84 | Complete curve; high efficacy | -5.7292 | 2.3332 | 0.9291 | 61.702 | 144.078 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.7606 | 136.01 | 140.2451 | 152.6106 | 148.0124 | 143.6336 | 147.0904 | 134.4052 | 111.2842 | 54.4794 | 84.3712 | 51.7606 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 2.3485 | 101.9247 | 84 | Complete curve; high efficacy | -5.6292 | 0.6 | 0.9558 | 71.9549 | 173.8795 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 91.649 | 176.6761 | 171.0851 | 177.7813 | 159.9071 | 159.3009 | 150.4576 | 153.7054 | 126.8633 | 116.4271 | 84.8154 | 91.649 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0187 | 90.9237 | 84 | Complete curve; high efficacy | -7.7292 | 0.7 | 0.9959 | 26.7347 | 117.6584 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.5723 | 109.5774 | 101.7596 | 83.7496 | 73.3799 | 52.6521 | 41.57 | 35.4354 | 30.2412 | 26.6759 | 25.3877 | 29.5723 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0132 | 127.3735 | 83 | Complete curve; high efficacy | -7.8792 | 0.7 | 0.9722 | 17.3385 | 144.712 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.7384 | 132.8301 | 113.2475 | 89.3417 | 75.7175 | 55.4002 | 27.7414 | 22.1078 | 14.4402 | 14.0116 | 16.7785 | 33.7384 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 3.7221 | 86.0142 | 83 | Complete curve; high efficacy | -5.4292 | 1.21 | 0.9721 | 65.5416 | 151.5558 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 66.7748 | 154.8648 | 146.5307 | 153.6238 | 147.9405 | 153.7843 | 144.2907 | 154.4262 | 119.8728 | 100.2565 | 83.0111 | 66.7748 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.3722 | 105.7898 | 83 | Complete curve; high efficacy | -6.4292 | 2.8473 | 0.984 | 36.148 | 141.9378 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.8052 | 141.9378 | 142.9518 | 145.1156 | 141.0583 | 137.6217 | 130.5085 | 57.9133 | 51.2669 | 41.3882 | 33.0007 | 22.8052 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 1.6626 | 102.3144 | 83 | Complete curve; high efficacy | -5.7792 | 1 | 0.9242 | 40.9668 | 143.2813 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.0105 | 152.3961 | 124.7264 | 140.9824 | 142.6059 | 141.9566 | 147.0368 | 112.3972 | 81.2873 | 85.0891 | 38.4602 | 47.0105 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0118 | 140.013 | 83 | Complete curve; high efficacy | -7.9292 | 2.5884 | 0.9982 | 17.9926 | 158.0057 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.8749 | 156.5885 | 154.4434 | 130.94 | 45.1268 | 15.3104 | 17.3742 | 18.8144 | 19.4156 | 21.1886 | 21.2708 | 14.8749 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4686 | 118.6089 | 83 | Complete curve; high efficacy | -6.3292 | 1.8579 | 0.9872 | 28.1061 | 146.7151 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.0205 | 138.0525 | 155.3457 | 144.6536 | 140.3247 | 148.8544 | 132.2913 | 70.3553 | 46.413 | 33.1335 | 22.0753 | 27.0205 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0166 | 75.7054 | 99 | Complete curve; high efficacy | -7.7792 | 1.6259 | 0.8287 | 113.3664 | 189.0718 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 76.415 | 189.0718 | 184.1323 | 176.4162 | 143.7765 | 121.3848 | 112.8196 | 136.1769 | 124.1622 | 121.4205 | 110.849 | 76.415 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.0148 | 78.3238 | 95 | Complete curve; high efficacy | -7.8292 | 1.8851 | 0.8849 | 90.161 | 168.4848 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 67.4943 | 179.706 | 152.1469 | 156.7226 | 115.951 | 90.8871 | 81.2427 | 94.0684 | 108.6438 | 92.5891 | 100.3562 | 67.4943 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0093 | 193.2895 | 93 | Complete curve; high efficacy | -8.0292 | 0.5 | 0.8666 | 72.6851 | 265.9745 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 105.1458 | 244.5929 | 174.7663 | 172.838 | 154.9069 | 132.1222 | 117.3729 | 90.5899 | 87.8655 | 85.6705 | 30.7772 | 105.1458 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0021 | 162.7839 | 89 | Complete curve; high efficacy | -8.6792 | 2.2526 | 0.9095 | 41.4972 | 204.2812 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.0569 | 187.9512 | 112.2831 | 54.6119 | 32.4006 | 43.042 | 48.5635 | 47.4689 | 74.453 | 40.5481 | 25.5935 | 16.0569 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0037 | 168.1839 | 89 | Complete curve; high efficacy | -8.4292 | 1.9887 | 0.954 | 44.8326 | 213.0165 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.7704 | 206.3802 | 163.4097 | 86.4546 | 36.0223 | 49.8397 | 39.3597 | 43.2938 | 52.6884 | 61.3728 | 57.8548 | 16.7704 | QC'd by Waterstone | |||||||||||||||
| Cytotoxic | 0.0469 | 148.8106 | 89 | Complete curve; high efficacy | -7.3292 | 2.4064 | 0.85 | 61.7336 | 210.5442 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.2046 | 222.3206 | 202.2319 | 203.978 | 192.1974 | 118.2623 | 35.924 | 46.0477 | 60.9187 | 116.7207 | 98.8749 | 8.2046 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0026 | 113.2709 | 89 | Complete curve; high efficacy | -8.5792 | 3.132 | 0.8977 | 42.9988 | 156.2697 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.2361 | 152.3367 | 113.4138 | 40.5936 | 38.1277 | 40.3624 | 43.6023 | 34.1379 | 43.8713 | 64.7368 | 64.0648 | 21.2361 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0017 | 114.4953 | 89 | Complete curve; high efficacy | -8.7792 | 4.095 | 0.8416 | 43.8532 | 158.3484 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.1898 | 152.8039 | 67.852 | 54.5193 | 52.3593 | 57.3458 | 49.824 | 62.0593 | 47.5054 | 30.8367 | 28.4655 | 14.1898 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0026 | 72.7342 | 89 | Complete curve; high efficacy | -8.5792 | 2.7202 | 0.9074 | 41.83 | 114.5643 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 49.3766 | 112.1875 | 83.5951 | 46.535 | 30.9547 | 33.4355 | 32.3129 | 43.2452 | 44.0893 | 44.7978 | 56.0035 | 49.3766 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0743 | 128.2241 | 89 | Complete curve; high efficacy | -7.1292 | 0.3 | 0.8073 | 65.0905 | 193.3146 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 71.5247 | 186.4209 | 158.6743 | 129.1227 | 120.8146 | 138.5824 | 133.4969 | 104.1228 | 120.2992 | 101.9603 | 77.7756 | 71.5247 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0662 | 125.7204 | 89 | Complete curve; high efficacy | -7.1792 | 1.8265 | 0.9719 | 67.5385 | 193.259 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 52.5197 | 186.6163 | 181.5655 | 200.1337 | 192.1342 | 128.2412 | 83.3632 | 87.4098 | 64.6315 | 70.6854 | 65.1161 | 52.5197 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.6619 | 78.2859 | 88 | Complete curve; high efficacy | -6.1792 | 1.8851 | 0.9469 | 96.3016 | 174.5875 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 101.3711 | 171.7651 | 176.8613 | 184.4702 | 181.7039 | 154.2237 | 171.0284 | 143.1726 | 100.5791 | 90.9185 | 104.0348 | 101.3711 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0935 | 125.7312 | 88 | Complete curve; high efficacy | -7.0292 | 3.99 | 0.9702 | 62.9518 | 188.683 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 71.3789 | 173.2237 | 176.4213 | 202.4283 | 200.5745 | 169.0569 | 72.0679 | 47.8354 | 55.5118 | 65.1828 | 73.8404 | 71.3789 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0743 | 119.1274 | 88 | Complete curve; high efficacy | -7.1292 | 0.7 | 0.988 | 58.8412 | 177.9686 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 65.4007 | 172.7284 | 171.0856 | 155.1599 | 146.3776 | 116.5859 | 99.7792 | 91.9843 | 65.4198 | 64.0028 | 56.2793 | 65.4007 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.3317 | 103.9102 | 88 | Complete curve; high efficacy | -6.4792 | 0.3 | 0.8436 | 77.4858 | 181.396 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 101.3477 | 161.302 | 177.473 | 153.8803 | 133.2684 | 139.1275 | 144.3925 | 135.8497 | 117.6086 | 91.5334 | 104.8313 | 101.3477 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.1321 | 123.717 | 88 | Complete curve; high efficacy | -6.8792 | 1 | 0.9623 | 67.9127 | 191.6297 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 45.8939 | 178.5371 | 199.9241 | 184.0193 | 181.5655 | 149.5884 | 112.029 | 94.7629 | 81.7313 | 73.6169 | 83.2052 | 45.8939 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0066 | 144.591 | 88 | Complete curve; high efficacy | -8.1792 | 2.7202 | 0.9318 | 43.5813 | 188.1723 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.9675 | 169.8483 | 200.8523 | 105.2569 | 49.6054 | 42.5185 | 45.3031 | 52.1456 | 50.6329 | 56.7946 | 49.5143 | 7.9675 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.935 | 111.4763 | 87 | Complete curve; high efficacy | -6.0292 | 1.4641 | 0.9072 | 88.9886 | 200.4649 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 65.9282 | 174.089 | 200.6763 | 211.7975 | 212.4609 | 203.6327 | 185.8171 | 171.8065 | 108.7421 | 105.1811 | 115.1818 | 65.9282 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0118 | 148.7473 | 87 | Complete curve; high efficacy | -7.9292 | 1.8851 | 0.9147 | 41.9403 | 190.6876 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.0822 | 198.2962 | 171.9006 | 154.0321 | 74.6922 | 45.6818 | 59.0941 | 62.6281 | 63.4243 | 50.9038 | 13.2956 | 8.0822 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.6626 | 84.6257 | 87 | Complete curve; high efficacy | -5.7792 | 2.7202 | 0.9593 | 106.2986 | 190.9242 | -1.1 | 0 1 0 0 0 0 0 0 0 0 0 | 104.8088 | 197.9176 | 147.6744 | 188.5439 | 182.4788 | 196.4457 | 175.6724 | 199.742 | 148.305 | 107.0547 | 110.4851 | 104.8088 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0418 | 88.8779 | 85 | Complete curve; high efficacy | -7.3792 | 1.21 | 0.839 | 31.4966 | 120.3746 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.7124 | 132.8926 | 100.4487 | 96.9022 | 107.9527 | 67.4229 | 23.2321 | 38.2547 | 30.0741 | 55.7633 | 43.3453 | 7.7124 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0148 | 116.4503 | 85 | Complete curve; high efficacy | -7.8292 | 0.4 | 0.8832 | 27.623 | 144.0733 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 23.9089 | 133.1493 | 84.9856 | 90.6764 | 88.2038 | 80.5475 | 48.9343 | 46.7949 | 39.8461 | 48.3702 | 38.3265 | 23.9089 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.003 | 63.5074 | 84 | Complete curve; high efficacy | -8.5292 | 1.2475 | 0.8462 | 22.0615 | 85.5689 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.6855 | 78.4448 | 56.9012 | 38.378 | 27.1259 | 24.862 | 30.8508 | 33.1754 | 27.3561 | 22.2582 | 11.8504 | 4.6855 | QC'd by AG Scientific | |||||||||||||||
| Cytotoxic | 0.0662 | 81.5347 | 84 | Complete curve; high efficacy | -7.1792 | 0.5 | 0.9352 | 26.2812 | 107.8158 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 41.7013 | 104.64 | 91.6911 | 85.7103 | 74.9925 | 66.2502 | 63.8289 | 47.1436 | 40.116 | 32.6453 | 16.3981 | 41.7013 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0053 | 88.8579 | 83 | Complete curve; high efficacy | -8.2792 | 0.7 | 0.9187 | 15.3166 | 104.1745 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.2739 | 95.77 | 55.0437 | 66.1767 | 37.4873 | 30.627 | 23.9238 | 16.0289 | 19.5529 | 17.4589 | 9.8155 | 17.2739 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.2093 | 87.7813 | 83 | Complete curve; high efficacy | -6.6792 | 3.0654 | 0.986 | 28.7833 | 116.5646 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.0348 | 105.4018 | 124.2663 | 111.216 | 120.9286 | 117.8293 | 82.7937 | 30.9384 | 30.8224 | 27.5221 | 30.012 | 28.0348 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.0166 | 84.332 | 83 | Complete curve; high efficacy | -7.7792 | 2.7202 | 0.9842 | 17.1644 | 101.4964 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.8094 | 92.1572 | 111.7148 | 93.8225 | 44.8797 | 23.291 | 16.7021 | 14.9312 | 16.052 | 18.3141 | 17.4498 | 16.8094 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0372 | 78.6204 | 83 | Complete curve; high efficacy | -7.4292 | 2.5884 | 0.9846 | 18.7979 | 97.4182 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.8885 | 92.4206 | 95.8169 | 102.9354 | 82.0365 | 34.5038 | 24.1642 | 19.1575 | 13.7712 | 16.3222 | 26.4683 | 12.8885 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.049 | 96.4977 | 83 | Complete curve; high efficacy | -5.9792 | 0.5 | 0.9575 | 36.2422 | 132.7399 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.2766 | 130.3979 | 127.8742 | 134.2077 | 109.0067 | 109.1952 | 107.7131 | 99.926 | 78.5711 | 59.9369 | 52.6284 | 54.2766 | QC'd by LINCS | |||||||||||||||
| Cytotoxic | 0.0469 | 113.59 | 83 | Complete curve; high efficacy | -7.3292 | 1.9282 | 0.9776 | 20.8655 | 134.4556 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.4008 | 136.3735 | 118.7418 | 147.5619 | 108.8524 | 67.2042 | 21.0092 | 24.2011 | 24.5388 | 19.6988 | 20.3003 | 21.4008 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0059 | 134.114 | 83 | Complete curve; high efficacy | -8.2292 | 0.9 | 0.9582 | 14.3732 | 148.4872 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.7187 | 135.69 | 94.2555 | 92.2912 | 35.674 | 27.573 | 26.6103 | 23.4479 | 18.963 | 13.1392 | 11.2803 | 7.7187 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0166 | 82.999 | 83 | Complete curve; high efficacy | -7.7792 | 4.4495 | 0.9148 | 18.7882 | 101.7872 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 1.3065 | 89.3692 | 109.2888 | 105.2809 | 39.2597 | 12.5607 | 8.631 | 17.2452 | 27.9372 | 41.2907 | 25.0218 | 1.3065 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0026 | 124.1313 | 82 | Complete curve; high efficacy | -8.5792 | 1.4781 | 0.9864 | 11.3246 | 135.4559 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.9487 | 124.2782 | 72.555 | 39.0972 | 13.7633 | 18.1604 | 10.3035 | 10.5661 | 10.7649 | 8.9075 | 6.6182 | 14.9487 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0209 | 112.543 | 82 | Complete curve; high efficacy | -7.6792 | 1.9673 | 0.9326 | 14.5764 | 127.1195 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 0.7959 | 123.8363 | 116.6866 | 132.1224 | 62.1868 | 31.224 | 17.3277 | 13.6245 | 6.9603 | 45.141 | 5.1024 | 0.7959 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.1049 | 80.7622 | 82 | Complete curve; high efficacy | -6.9792 | 3.99 | 0.9314 | 16.2149 | 96.9771 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.1195 | 101.3823 | 75.2262 | 112.2489 | 99.8696 | 87.6321 | 24.0005 | 28.4571 | 25.408 | 16.8793 | 8.9066 | 2.1195 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.2348 | 92.6555 | 82 | Complete curve; high efficacy | -6.6292 | 0.9 | 0.9866 | 16.7612 | 109.4167 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.3983 | 112.3077 | 99.4639 | 110.1605 | 99.6185 | 92.2501 | 63.4128 | 43.1169 | 34.9892 | 25.2037 | 20.2211 | 13.3983 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.0264 | 105.2236 | 82 | Complete curve; high efficacy | -7.5792 | 2.7868 | 0.9881 | 10.1409 | 115.3645 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.3828 | 108.8197 | 112.7123 | 124.3794 | 75.0669 | 19.9744 | 11.7475 | 17.4558 | 8.7452 | 8.5941 | 7.961 | 5.3828 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.935 | 88.2613 | 82 | Complete curve; high efficacy | -6.0292 | 1.7885 | 0.8556 | 20.4336 | 108.6949 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.8527 | 85.5635 | 121.1104 | 117.0961 | 94.6507 | 99.9913 | 137.0322 | 69.8118 | 48.8332 | 29.7948 | 29.9699 | 4.8527 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0059 | 119.8687 | 82 | Complete curve; high efficacy | -8.2292 | 0.9 | 0.989 | 10.4647 | 130.3334 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 9.7544 | 119.7206 | 88.0559 | 68.5619 | 35.4928 | 30.3765 | 16.1901 | 10.809 | 12.1062 | 11.2172 | 8.007 | 9.7544 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.4176 | 152.6521 | 82 | Complete curve; high efficacy | -6.3792 | 0.4 | 0.9686 | -18.9995 | 133.6526 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.9146 | 127.427 | 102.6532 | 123.6296 | 93.0935 | 83.8593 | 62.241 | 55.7714 | 44.3209 | 18.4384 | 6.137 | 2.9146 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0118 | 64.88 | 87 | Complete curve; high efficacy | -7.9292 | 3.99 | 0.9065 | 42.9911 | 107.8711 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 75.9379 | 117.1662 | 98.059 | 101.6667 | 44.5432 | 37.9315 | 51.796 | 45.545 | 45.898 | 55.6965 | 24.215 | 75.9379 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 86 | Complete curve; high efficacy | -9 | 0 | 0.87 | 27.003 | 27.003 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.714 | 116.1096 | 51.7823 | 38.4774 | 38.149 | 32.5763 | 27.003 | 21.7125 | 13.6562 | 8.2494 | 4.8318 | 11.714 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0148 | 87.33 | 85 | Complete curve; high efficacy | -7.8292 | 2.7202 | 0.8394 | 28.2225 | 115.5525 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.7164 | 112.6565 | 118.5558 | 105.2086 | 50.4614 | 32.8964 | 56.1238 | 44.2032 | 45.6856 | 13.0527 | 3.9671 | 2.7164 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0743 | 81.0479 | 85 | Complete curve; high efficacy | -7.1292 | 2.4064 | 0.9877 | 36.057 | 117.1048 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.612 | 118.1815 | 112.941 | 121.7674 | 108.9169 | 87.1333 | 42.591 | 31.0005 | 32.051 | 39.1543 | 43.5926 | 36.612 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0132 | 95.1834 | 85 | Complete curve; high efficacy | -7.8792 | 2.5884 | 0.9789 | 30.3117 | 125.4951 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.3434 | 119.5176 | 131.0238 | 109.7688 | 49.1996 | 41.2323 | 39.0944 | 29.1842 | 32.4499 | 24.9502 | 25.8886 | 22.3434 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0372 | 96.9526 | 84 | Complete curve; high efficacy | -7.4292 | 3.6772 | 0.9439 | 26.3959 | 123.3485 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 20.4921 | 101.7407 | 120.2132 | 147.5217 | 112.7694 | 37.9374 | 39.3171 | 24.3812 | 25.0767 | 27.6942 | 20.4173 | 20.4921 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1147 | 102.0262 | 84 | Complete curve; high efficacy | -6.9404 | 0.4 | 0.9457 | 28.8277 | 130.8539 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 108.0014 | 122.9006 | 125.5314 | 115.9246 | 89.8709 | 95.6128 | 75.4206 | 75.6584 | 66.6692 | 45.0649 | 45.6837 | 108.0014 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0093 | 90.1584 | 84 | Complete curve; high efficacy | -8.0292 | 1.7137 | 0.9625 | 24.1405 | 114.2989 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 20.1633 | 106.7519 | 116.4044 | 75.807 | 42.4604 | 31.6448 | 37.5173 | 19.1166 | 17.3457 | 30.1096 | 18.8668 | 20.1633 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.4686 | 69.6091 | 84 | Complete curve; high efficacy | -6.3292 | 1.6924 | 0.8276 | 47.7156 | 117.3247 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 95.3248 | 99.0689 | 105.4815 | 112.5472 | 134.071 | 139.2948 | 95.8636 | 78.075 | 56.205 | 61.3157 | 34.976 | 95.3248 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.2957 | 85.2258 | 83 | Complete curve; high efficacy | -6.5292 | 4.9549 | 0.9055 | 30.0023 | 115.2281 | -1.1 | 0 0 0 0 0 0 0 0 0 1 0 | 45.1208 | 102.1961 | 108.7224 | 107.4279 | 107.404 | 145.4631 | 114.1746 | 21.3489 | 22.648 | 33.1896 | 77.556 | 45.1208 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.0118 | 107.3878 | 83 | Complete curve; high efficacy | -7.9292 | 4.4495 | 0.9946 | 18.1514 | 125.5392 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 103.6539 | 130.2388 | 120.1313 | 117.1341 | 24.7883 | 21.8042 | 12.7468 | 20.2894 | 19.912 | 21.3667 | 15.3748 | 103.6539 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 78.3333 | 83 | Complete curve; high efficacy | -7.4792 | 4.4495 | 0.9575 | 20.8089 | 99.1422 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 105.6776 | 94.562 | 86.401 | 118.7673 | 88.3883 | 24.5215 | 23.7163 | 18.8594 | 23.3229 | 22.5677 | 16.9857 | 105.6776 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 0.0118 | 86.291 | 83 | Complete curve; high efficacy | -7.9292 | 0.91 | 0.9712 | 20.4028 | 106.6938 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.9907 | 98.3598 | 100.6509 | 70.7724 | 45.8849 | 40.9594 | 33.2184 | 25.0445 | 19.1657 | 23.312 | 17.8226 | 13.9907 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2348 | 84.5422 | 83 | Complete curve; high efficacy | -6.6292 | 1.1 | 0.9547 | 25.2427 | 109.7849 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 114.3833 | 102.02 | 113.1558 | 103.8422 | 121.0743 | 81.3283 | 72.6842 | 51.9205 | 31.8121 | 26.3723 | 28.0582 | 114.3833 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.0148 | 86.12 | 83 | Complete curve; high efficacy | -7.8292 | 2.1876 | 0.9725 | 16.3085 | 102.4286 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.9507 | 102.9261 | 98.7333 | 90.7778 | 42.922 | 22.2997 | 23.2007 | 30.2306 | 11.6539 | 10.6579 | 13.0824 | 7.9507 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1482 | 77.0938 | 83 | Complete curve; high efficacy | -6.8292 | 4.9549 | 0.9553 | 22.4128 | 99.5066 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 9.87 | 102.0967 | 92.5449 | 98.6527 | 90.3526 | 113.4727 | 42.0252 | 28.6434 | 31.54 | 24.9793 | 14.7719 | 9.87 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 0.4176 | 91.3736 | 83 | Complete curve; high efficacy | -6.3792 | 1.6924 | 0.9858 | 29.7282 | 121.1017 | -1.1 | 0 0 1 0 0 0 0 0 0 0 0 | 21.3801 | 116.2452 | 129.3034 | 186.5441 | 118.5918 | 113.5565 | 105.0881 | 62.7854 | 35.7629 | 34.745 | 35.3537 | 21.3801 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.049 | 87.3616 | 83 | Complete curve; high efficacy | -5.9792 | 1 | 0.8772 | 36.1973 | 123.5589 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.1491 | 117.4289 | 109.6638 | 131.7472 | 129.0154 | 136.5777 | 93.9336 | 88.9455 | 83.6425 | 43.4572 | 25.123 | 54.1491 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.1482 | 113.9905 | 83 | Complete curve; high efficacy | -6.8292 | 1.2876 | 0.8888 | 23.8075 | 137.7981 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.0453 | 114.2505 | 119.5624 | 176.2421 | 137.6679 | 106.6825 | 59.0284 | 55.2507 | 38.1823 | 24.8371 | 27.4067 | 8.0453 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 1.177 | 85.4963 | 83 | Complete curve; high efficacy | -5.9292 | 3.6272 | 0.9149 | 39.2135 | 124.7097 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.6517 | 113.2381 | 135.3021 | 111.0564 | 135.5045 | 142.3677 | 111.5001 | 118.8115 | 56.8306 | 33.2042 | 57.6372 | 27.6517 | QC'd by Microsource |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0148 | 138.4172 | 92 | Complete curve; high efficacy | -7.8292 | 0.8 | 0.9854 | 73.4473 | 211.8645 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 76.0615 | 206.4576 | 176.3477 | 160.675 | 143.036 | 102.2156 | 87.4586 | 76.3866 | 75.9423 | 81.5132 | 71.2845 | 76.0615 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1865 | 129.7094 | 92 | Complete curve; high efficacy | -6.7292 | 2.4729 | 0.9102 | 104.5908 | 234.3002 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 97.9499 | 212.7695 | 199.584 | 247.0735 | 277.3731 | 227.6905 | 162.5507 | 123.8591 | 102.5004 | 104.1059 | 104.3989 | 97.9499 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.5258 | 72.9609 | 91 | Complete curve; high efficacy | -6.2792 | 2.7202 | 0.9263 | 121.6641 | 194.625 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 182.846 | 196.2276 | 201.2704 | 206.5478 | 177.6678 | 187.1047 | 193.8819 | 153.4274 | 124.7553 | 110.5225 | 133.7805 | 182.846 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.0469 | 134.7266 | 91 | Complete curve; high efficacy | -7.3292 | 2.3332 | 0.9427 | 79.2711 | 213.9977 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 74.524 | 225.8348 | 183.7696 | 233.1661 | 192.207 | 130.2439 | 74.8439 | 101.4578 | 75.213 | 88.158 | 64.0647 | 74.524 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 91 | Complete curve; high efficacy | -9 | 0 | 0.9736 | 48.7803 | 48.7803 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.83 | 166.158 | 106.5335 | 67.3448 | 35.2031 | 47.2803 | 44.6563 | 48.7803 | 46.7036 | 51.7045 | 56.8882 | 47.83 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 90 | Complete curve; high efficacy | -9 | 0 | 0.8207 | 46.4226 | 46.4226 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.4032 | 205.1041 | 113.3989 | 45.0423 | 60.9659 | 55.9706 | 82.4919 | 46.4226 | 18.2592 | 10.6648 | 8.4697 | 5.4032 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 1.4818 | 67.8056 | 89 | Complete curve; high efficacy | -5.8292 | 4.9549 | 0.7621 | 141.433 | 209.2386 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 116.0869 | 187.3686 | 222.298 | 199.2101 | 217.5801 | 185.2508 | 221.0682 | 234.3031 | 161.6854 | 158.4572 | 150.9575 | 116.0869 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 89 | Complete curve; high efficacy | -9 | 0 | 0.9591 | 38.8706 | 38.8706 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 39.1109 | 165.4745 | 147.9893 | 92.1226 | 38.8706 | 47.6528 | 15.9643 | 14.5577 | 9.1645 | 7.8078 | 7.0708 | 39.1109 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 89 | Complete curve; high efficacy | -9 | 0 | 0.9388 | 41.1421 | 41.1421 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 3.8961 | 184.0933 | 141.733 | 91.783 | 118.6691 | 84.4271 | 41.1421 | 40.4161 | 26.2497 | 18.5223 | 5.7273 | 3.8961 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 89 | Complete curve; high efficacy | -9 | 0 | 0.9888 | 40.8379 | 40.8379 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 26.1407 | 121.6554 | 195.8384 | 155.5113 | 88.1063 | 68.0947 | 37.7656 | 40.8379 | 40.0991 | 27.9716 | 31.773 | 26.1407 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0382 | 92.5734 | 88 | Complete curve; high efficacy | -7.418 | 0.4 | 0.8897 | 52.7945 | 145.3679 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.9291 | 116.2057 | 136.3435 | 103.0924 | 91.9654 | 79.4739 | 82.0269 | 83.1013 | 67.373 | 61.555 | 57.4999 | 51.9291 | QC'd by ChemPacific | |||||||||||||||
| Cytotoxic | 0.0743 | 134.5354 | 88 | Complete curve; high efficacy | -7.1292 | 1.21 | 0.9307 | 57.9113 | 192.4467 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 49.7147 | 175.8519 | 207.2976 | 185.8686 | 162.8742 | 143.0486 | 63.0491 | 99.1074 | 67.3805 | 57.9379 | 49.2515 | 49.7147 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 88 | Complete curve; high efficacy | -9 | 0 | 0.8758 | 33.7212 | 33.7212 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.1324 | 152.4612 | 97.5893 | 68.7499 | 32.2642 | 58.8159 | 47.2578 | 33.7212 | 8.8049 | 4.8186 | 3.5433 | 4.1324 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 3.7221 | 85.2239 | 87 | Complete curve; high efficacy | -5.4292 | 4.9549 | 0.891 | 150.0271 | 235.251 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 154.7033 | 204.9209 | 231.691 | 212.9559 | 243.8102 | 227.9286 | 234.025 | 230.2626 | 264.0915 | 159.589 | 149.6383 | 154.7033 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 1.3207 | 106.1003 | 87 | Complete curve; high efficacy | -5.8792 | 1.8265 | 0.9417 | 105.4088 | 211.509 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 114.0374 | 223.8378 | 192.8578 | 196.2457 | 228.3532 | 212.5214 | 209.5506 | 192.8647 | 146.6919 | 120.1282 | 91.3668 | 114.0374 | QC'd by XcessBio | |||||||||||||||
| Cytotoxic | 0.1482 | 151.4987 | 87 | Complete curve; high efficacy | -6.8292 | 0.7 | 0.98 | 56.0265 | 207.5252 | -1.1 | 0 1 0 0 0 0 0 0 0 0 0 | 51.814 | 202.2596 | 122.7624 | 197.3713 | 167.7834 | 153.3308 | 139.0984 | 85.596 | 79.1403 | 68.5178 | 69.5035 | 51.814 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0935 | 70.6056 | 87 | Complete curve; high efficacy | -7.0292 | 4.5045 | 0.9613 | 52.9846 | 123.5901 | -1.1 | 0 1 0 0 0 0 0 0 0 0 0 | 41.374 | 115.1832 | 175.7294 | 133.236 | 122.1014 | 112.515 | 54.2553 | 57.0952 | 63.7337 | 53.567 | 50.7817 | 41.374 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 87 | Complete curve; high efficacy | -9 | 0 | 0.9576 | 30.2511 | 30.2511 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.7137 | 142.2621 | 159.7504 | 41.7891 | 40.524 | 22.5735 | 21.9929 | 37.0563 | 30.2511 | 15.9156 | 14.2865 | 7.7137 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 87 | Complete curve; high efficacy | -9 | 0 | 0.9353 | 30.6525 | 30.6525 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 10.0983 | 153.4905 | 88.4577 | 56.6365 | 28.9731 | 43.3437 | 33.8307 | 30.6525 | 18.3845 | 11.7562 | 11.5903 | 10.0983 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2635 | 171.4641 | 86 | Complete curve; high efficacy | -6.5792 | 4.9549 | 0.903 | 55.2524 | 226.7165 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 87.6192 | 224.0953 | 196.7275 | 198.1303 | 295.2794 | 221.4309 | 194.6875 | 46.5565 | 51.5148 | 33.1518 | 58.5883 | 87.6192 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0093 | 104.6527 | 88 | Complete curve; high efficacy | -8.0292 | 1.9673 | 0.9946 | 43.2871 | 147.9397 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 46.9856 | 151.2515 | 136.3124 | 112.1568 | 60.3474 | 41.2891 | 43.6006 | 45.5367 | 40.8584 | 41.4875 | 44.248 | 46.9856 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0526 | 90.7291 | 87 | Complete curve; high efficacy | -7.2792 | 1.2475 | 0.969 | 49.3002 | 140.0293 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.2116 | 136.8931 | 136.6639 | 140.7519 | 111.5654 | 96.3382 | 58.163 | 55.064 | 58.6659 | 57.3681 | 48.8529 | 36.2116 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1865 | 111.0998 | 86 | Complete curve; high efficacy | -6.7292 | 1.5579 | 0.9597 | 58.0636 | 169.1634 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 30.8392 | 165.6134 | 164.7399 | 166.9572 | 172.8379 | 153.7472 | 111.4217 | 72.2937 | 71.4323 | 70.5615 | 64.8202 | 30.8392 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.1049 | 99.2537 | 86 | Complete curve; high efficacy | -6.9792 | 3.132 | 0.8788 | 51.4415 | 150.6952 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.3763 | 133.6762 | 159.094 | 152.6324 | 154.4225 | 134.3854 | 64.9851 | 70.6294 | 68.5418 | 58.5559 | 55.5813 | 4.3763 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.3317 | 94.9929 | 84 | Complete curve; high efficacy | -6.4792 | 0.3 | 0.9521 | 37.641 | 132.6338 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 50.4436 | 114.4568 | 123.9845 | 113.8331 | 96.152 | 92.1624 | 89.6664 | 81.8815 | 79.9224 | 68.1558 | 59.6137 | 50.4436 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.7427 | 84.9044 | 84 | Complete curve; high efficacy | -6.1292 | 2.2526 | 0.933 | 45.6644 | 130.5688 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.4643 | 134.3384 | 115.1991 | 125.3701 | 119.0101 | 144.1666 | 143.8172 | 97.9891 | 50.7825 | 53.0518 | 54.3899 | 36.4643 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.8333 | 75.354 | 84 | Complete curve; high efficacy | -6.0792 | 3.99 | 0.9614 | 46.5835 | 121.9376 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.0973 | 124.2208 | 119.0164 | 110.2614 | 120.2463 | 126.3612 | 130.9298 | 108.8859 | 50.9325 | 50.2586 | 56.0536 | 33.0973 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.3722 | 88.0762 | 84 | Complete curve; high efficacy | -6.4292 | 4.4495 | 0.9703 | 37.6549 | 125.7311 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 44.0074 | 106.5992 | 127.2247 | 130.6238 | 138.3415 | 127.8948 | 120.6987 | 48.2184 | 35.9135 | 36.3641 | 34.926 | 44.0074 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0093 | 130.6425 | 84 | Complete curve; high efficacy | -8.0292 | 0.9 | 0.9867 | 24.621 | 155.2635 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 18.1076 | 143.3641 | 125.7098 | 98.5685 | 66.0334 | 36.9882 | 37.4695 | 36.8721 | 31.0273 | 25.0064 | 19.2735 | 18.1076 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.4686 | 84.3499 | 83 | Complete curve; high efficacy | -6.3292 | 3.0654 | 0.8927 | 37.763 | 122.1129 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.9174 | 100.9718 | 133.1095 | 113.0152 | 128.6977 | 133.2765 | 119.5843 | 64.2784 | 53.3781 | 48.5286 | 44.75 | 8.9174 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.3317 | 88.6774 | 83 | Complete curve; high efficacy | -6.4792 | 1.6259 | 0.9909 | 34.1483 | 122.8257 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 32.8455 | 112.8257 | 122.9968 | 126.477 | 124.3559 | 121.5352 | 96.4604 | 60.3971 | 43.4033 | 34.0922 | 32.8733 | 32.8455 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.2957 | 104.4395 | 83 | Complete curve; high efficacy | -6.5292 | 0.6 | 0.9636 | 33.4657 | 137.9052 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 30.41 | 139.5422 | 127.9789 | 115.7906 | 133.779 | 110.193 | 87.9596 | 73.5955 | 58.1049 | 55.3613 | 47.9141 | 30.41 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 2.3485 | 86.6758 | 83 | Complete curve; high efficacy | -5.6292 | 4.095 | 0.9684 | 53.6121 | 140.2879 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.2528 | 135.5146 | 146.9511 | 127.3268 | 148.5202 | 130.0159 | 143.2286 | 148.4195 | 122.3701 | 57.6127 | 55.7427 | 51.2528 | QC'd by LINCS | |||||||||||||||
| Cytotoxic | 0.5899 | 78.4815 | 83 | Complete curve; high efficacy | -6.2292 | 1 | 0.962 | 39.6422 | 118.1236 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.8849 | 113.0988 | 105.5924 | 123.1519 | 126.3882 | 114.8478 | 93.4484 | 78.3964 | 61.996 | 52.621 | 41.6161 | 36.8849 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 1.6626 | 85.9672 | 83 | Complete curve; high efficacy | -5.7792 | 2.4729 | 0.9295 | 40.7279 | 126.6952 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.4756 | 118.8121 | 112.7597 | 122.0662 | 124.4452 | 131.3159 | 149.7541 | 122.8382 | 80.2944 | 49.8125 | 50.9941 | 28.4756 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0743 | 90.7413 | 83 | Complete curve; high efficacy | -7.1292 | 1.9673 | 0.9464 | 25.6492 | 116.3905 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.9198 | 106.5785 | 111.2723 | 128.5693 | 109.6739 | 79.4144 | 37.1158 | 33.6722 | 41.618 | 29.6887 | 19.1474 | 5.9198 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4176 | 196.8504 | 83 | Complete curve; high efficacy | -6.3792 | 0.3 | 0.9606 | -31.7676 | 165.0828 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.8348 | 135.921 | 148.6439 | 123.1507 | 111.4731 | 78.5446 | 71.3085 | 64.7602 | 62.72 | 28.6854 | 14.0462 | 2.8348 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.5258 | 95.9955 | 83 | Complete curve; high efficacy | -6.2792 | 0.4 | 0.9753 | 35.9633 | 131.9588 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 50.6988 | 124.3759 | 129.0401 | 111.2096 | 110.6664 | 98.3191 | 99.2745 | 82.505 | 77.9575 | 59.8532 | 53.1365 | 50.6988 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.1865 | 153.2974 | 82 | Complete curve; high efficacy | -6.7292 | 0.4 | 0.9838 | -19.1976 | 134.0998 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 1.5971 | 128.3939 | 102.501 | 95.9576 | 90.3493 | 76.1127 | 59.6546 | 43.6414 | 25.0549 | 4.9279 | 1.7 | 1.5971 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.4686 | 112.6369 | 82 | Complete curve; high efficacy | -6.3292 | 0.7 | 0.966 | 16.772 | 129.4089 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.877 | 117.2722 | 122.3984 | 135.2437 | 130.0817 | 105.7415 | 80.3609 | 67.0393 | 51.7534 | 40.541 | 30.1694 | 13.877 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0132 | 78.8888 | 88 | Complete curve; high efficacy | -7.8792 | 3.5117 | 0.9951 | 47.2347 | 126.1235 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 42.2827 | 127.6613 | 122.708 | 120.2024 | 61.1126 | 51.2885 | 45.5161 | 47.7407 | 46.3578 | 47.5339 | 48.0543 | 42.2827 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.0187 | 94.4991 | 87 | Complete curve; high efficacy | -7.7292 | 1.9673 | 0.9923 | 43.1973 | 137.6963 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.5181 | 141.319 | 129.8171 | 127.5041 | 86.8076 | 49.0942 | 47.0499 | 42.277 | 40.9385 | 37.8151 | 44.8621 | 47.5181 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.5258 | 73.9868 | 87 | Complete curve; high efficacy | -6.2792 | 1.5386 | 0.9608 | 75.2185 | 149.2053 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 66.1566 | 142.7053 | 154.8249 | 147.903 | 146.0134 | 146.4254 | 144.006 | 104.2739 | 88.0969 | 90.9594 | 71.6495 | 66.1566 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.0059 | 140.4545 | 87 | Complete curve; high efficacy | -8.2292 | 1.4163 | 0.9687 | 36.1127 | 176.5672 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 10.8624 | 168.6765 | 147.5154 | 96.3491 | 54.2002 | 41.5445 | 37.5728 | 42.2093 | 41.7422 | 40.4833 | 43.4946 | 10.8624 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0132 | 79.7444 | 87 | Complete curve; high efficacy | -7.8792 | 0.6 | 0.8986 | 41.6151 | 121.3595 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.1462 | 113.0499 | 103.1376 | 82.2031 | 81.4852 | 58.6938 | 53.3145 | 53.6692 | 54.5379 | 37.1186 | 56.479 | 26.1462 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.1663 | 78.9427 | 86 | Complete curve; high efficacy | -6.7792 | 3.9295 | 0.9459 | 49.4968 | 128.4395 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 39.1638 | 119.9619 | 118.7114 | 121.8873 | 145.134 | 135.6602 | 77.5019 | 49.3716 | 42.7048 | 55.4887 | 60.9156 | 39.1638 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.1177 | 99.5229 | 86 | Complete curve; high efficacy | -6.9292 | 0.5 | 0.9784 | 53.5004 | 153.0233 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.2364 | 146.2425 | 146.4285 | 127.5196 | 118.6607 | 112.3725 | 102.0037 | 86.3517 | 70.5974 | 62.7254 | 70.1683 | 54.2364 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2348 | 79.9222 | 86 | Complete curve; high efficacy | -6.6292 | 1.4641 | 0.9791 | 58.9416 | 138.8638 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 62.4132 | 143.4278 | 135.9313 | 129.1028 | 144.3799 | 129.2524 | 105.2039 | 73.5025 | 70.4619 | 53.7397 | 57.6396 | 62.4132 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0187 | 133.2619 | 86 | Complete curve; high efficacy | -7.7292 | 0.6 | 0.9441 | 35.7906 | 169.0525 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.5582 | 156.1894 | 139.4018 | 135.4374 | 91.1086 | 61.2241 | 66.0949 | 67.7171 | 53.5961 | 42.5842 | 30.9652 | 27.5582 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.0296 | 79.812 | 85 | Complete curve; high efficacy | -7.5292 | 3.132 | 0.8367 | 30.4945 | 110.3065 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -0.4219 | 91.4427 | 118.502 | 121.2802 | 87.4178 | 39.06 | 30.3783 | 26.004 | 28.8116 | 31.886 | 64.9696 | -0.4219 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.4686 | 72.5584 | 85 | Complete curve; high efficacy | -6.3292 | 1.4781 | 0.898 | 58.4082 | 130.9666 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.5241 | 121.5091 | 138.67 | 123.1995 | 141.6082 | 124.8321 | 119.0843 | 85.2035 | 70.5438 | 62.7606 | 78.2039 | 36.5241 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.5749 | 89.3171 | 85 | Complete curve; high efficacy | -6.2404 | 3.5117 | 0.9381 | 53.4216 | 142.7387 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 42.1397 | 122.2594 | 133.5752 | 138.8262 | 155.9137 | 150.9759 | 155.3277 | 133.8332 | 70.1507 | 56.1404 | 64.459 | 42.1397 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1049 | 90.1126 | 85 | Complete curve; high efficacy | -6.9792 | 1.1 | 0.96 | 42.4601 | 132.5727 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 48.0597 | 134.7202 | 138.2028 | 122.4795 | 111.2704 | 105.466 | 77.8849 | 45.233 | 45.4972 | 30.8237 | 55.2725 | 48.0597 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0418 | 80.3578 | 85 | Complete curve; high efficacy | -7.3792 | 0.6 | 0.8511 | 33.6315 | 113.9892 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.0841 | 101.2736 | 106.7715 | 96.7166 | 82.135 | 70.4809 | 40.1055 | 51.5054 | 51.4536 | 54.1375 | 41.9436 | 11.0841 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.6619 | 94.773 | 85 | Complete curve; high efficacy | -6.1792 | 1.4781 | 0.9803 | 53.7716 | 148.5446 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 55.0629 | 148.0214 | 138.5482 | 154.1536 | 143.4321 | 157.4598 | 136.5884 | 99.8634 | 77.2433 | 58.4344 | 52.8195 | 55.0629 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2093 | 116.5034 | 85 | Complete curve; high efficacy | -6.6792 | 1.331 | 0.9045 | 46.5044 | 163.0078 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.0869 | 143.6239 | 161.4686 | 168.1578 | 159.9801 | 164.4887 | 97.6706 | 64.7846 | 68.4913 | 71.4763 | 50.625 | 13.0869 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2957 | 96.4482 | 84 | Complete curve; high efficacy | -6.5292 | 1.8265 | 0.9793 | 36.1131 | 132.5613 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.7595 | 137.6757 | 133.1247 | 125.0579 | 141.4133 | 118.8792 | 106.6696 | 52.9758 | 40.6195 | 40.7565 | 44.3485 | 27.7595 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.3722 | 96.57 | 84 | Complete curve; high efficacy | -6.4292 | 1.4787 | 0.9808 | 40.3311 | 136.901 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 41.4841 | 141.6948 | 138.6029 | 123.988 | 145.2114 | 122.9084 | 114.8164 | 75.0526 | 46.3655 | 45.8328 | 38.6829 | 41.4841 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0132 | 99.5422 | 84 | Complete curve; high efficacy | -7.8792 | 0.5 | 0.8598 | 25.2368 | 124.779 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.6254 | 113.8403 | 106.9304 | 67.8854 | 57.7379 | 56.7173 | 56.0064 | 46.2734 | 43.489 | 29.1571 | 4.4532 | 33.6254 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 2.0931 | 75.0602 | 84 | Complete curve; high efficacy | -5.6792 | 4.9549 | 0.9483 | 60.3489 | 135.4091 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 60.7384 | 119.1757 | 138.3496 | 139.0789 | 136.1425 | 149.2097 | 137.4143 | 127.2154 | 116.9325 | 54.5422 | 66.8667 | 60.7384 | QC'd by ChemAxon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inconclusive | 2.0931 | 52.3778 | 10 | Complete curve; partial efficacy; poor fit | -5.6792 | 1.21 | 0.8868 | 207.717 | 155.3392 | 1.4 | 0 0 0 0 1 0 0 0 0 0 1 | 147.1 | 164.4833 | 155.0085 | 150.5868 | 148.3401 | 116.6514 | 156.9711 | 173.7174 | 168.6881 | 199.2135 | 202.8962 | 147.1 | QC'd by Microsource | |||||||||||||||
| Inconclusive | 0.0057 | 12.5196 | 10 | Complete curve; partial efficacy; poor fit | -8.2404 | 4.9549 | 0.312 | 131.5823 | 119.0627 | 1.4 | 0 0 0 0 0 0 0 0 0 0 1 | 127.1473 | 120.0823 | 122.1295 | 115.8993 | 137.6706 | 122.1335 | 127.163 | 123.7971 | 150.7316 | 133.1825 | 125.6113 | 127.1473 | QC'd by SIGMA | |||||||||||||||
| Inconclusive | 0.0019 | 21 | 10 | Complete curve; partial efficacy; poor fit | -8.7292 | 1.1 | 0.8356 | 134.2114 | 113.2114 | 1.4 | 0 0 0 0 0 0 0 0 0 0 1 | 119.1302 | 117.2114 | 127.4759 | 130.4637 | 129.9536 | 131.9164 | 134.6866 | 133.4534 | 131.6405 | 137.8111 | 137.2931 | 119.1302 | QC'd by Pharmeks | |||||||||||||||
| Inconclusive | 0.0662 | 21.5 | 10 | Complete curve; partial efficacy; poor fit | -7.1792 | 1.9673 | 0.9617 | 136.1907 | 114.6907 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 137.9456 | 114.6907 | 115.3457 | 114.9342 | 114.9118 | 125.4369 | 132.2852 | 136.9063 | 134.4597 | 139.5384 | 132.1379 | 137.9456 | QC'd by Sequoia | |||||||||||||||
| Inconclusive | 0.1482 | 21.0998 | 10 | Complete curve; partial efficacy; poor fit | -6.8292 | 0.8 | 0.8442 | 149.6919 | 128.5921 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 151.9116 | 131.6919 | 128.2754 | 129.76 | 129.967 | 133.7039 | 147.8377 | 137.7359 | 147.2819 | 148.9579 | 147.0679 | 151.9116 | QC'd by Tocris | |||||||||||||||
| Inconclusive | 0.0833 | 30.5 | 10 | Complete curve; partial efficacy; poor fit | -7.0792 | 0.3 | 0.9065 | 152.817 | 122.317 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 149.8479 | 126.317 | 131.9239 | 133.2597 | 133.1414 | 138.2988 | 138.8257 | 144.3744 | 142.6826 | 141.1244 | 150.4849 | 149.8479 | QC'd by APAC | |||||||||||||||
| Inconclusive | 0.003 | 23 | 10 | Complete curve; partial efficacy; poor fit | -8.5292 | 0.7 | 0.9042 | 116.6731 | 93.6731 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 115.0235 | 97.6731 | 106.1567 | 108.9656 | 113.5207 | 111.3295 | 114.3155 | 115.674 | 116.5526 | 117.8964 | 119.9437 | 115.0235 | QC'd by SigmaAldrich | |||||||||||||||
| Inconclusive | 0.0019 | 25.5 | 10 | Complete curve; partial efficacy | -8.7292 | 1.5579 | 0.7725 | 134.9997 | 109.4997 | 1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 138.6831 | 113.4997 | 125.8748 | 129.6566 | 135.9028 | 133.275 | 139.8144 | 131.171 | 127.5454 | 138.1274 | 135.3784 | 138.6831 | QC'd by SigmaAldrich | |||||||||||||||
| Inactive | 0 | -5.0292 | 0.8 | 0.4643 | 103.7426 | 121.9544 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 106.6946 | 111.4544 | 125.2432 | 128.5053 | 127.1929 | 113.4715 | 124.3917 | 121.815 | 114.296 | 116.6521 | 111.8738 | 106.6946 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | 4 | 125.6815 | 122.8795 | 130.2888 | 125.1136 | 125.6652 | 130.3074 | 128.7078 | 129.9384 | 126.7494 | 127.6785 | 129.7132 | 125.6815 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | 4 | 136.2326 | 163.4273 | 142.6615 | 146.3348 | 166.6634 | 150.6103 | 158.3404 | 165.0578 | 162.7658 | 150.3198 | 139.9664 | 136.2326 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -7.3792 | 0.8 | 0.6066 | 126.3684 | 141.9019 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 126.5818 | 144.4019 | 133.558 | 143.8479 | 137.0521 | 128.3337 | 135.1801 | 122.2906 | 134.5644 | 123.4653 | 125.8628 | 126.5818 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.9292 | 4.9549 | 0.7372 | 120.4574 | 134.0138 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 120.7168 | 134.5138 | 134.0383 | 138.0285 | 138.2397 | 129.2732 | 130.6596 | 135.9635 | 130.2877 | 134.4747 | 123.0085 | 120.7168 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -6.8792 | 3.132 | 0.4017 | 111.9315 | 106.5265 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 105.5505 | 105.9315 | 109.5176 | 101.4274 | 110.4744 | 106.5334 | 110.4821 | 115.977 | 107.3312 | 113.281 | 111.1989 | 105.5505 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.6792 | 4.5045 | 0.6481 | 132.5399 | 143.839 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 132.7564 | 143.839 | 141.5609 | 139.3268 | 147.1235 | 144.923 | 140.6337 | 146.4103 | 146.2306 | 145.3224 | 141.4193 | 132.7564 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.5792 | 0.9 | 0.6882 | 159.3525 | 129.3525 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 151.1525 | 125.3525 | 127.8444 | 130.5681 | 128.6677 | 140.8596 | 130.7582 | 127.8002 | 131.1106 | 130.9549 | 139.8805 | 151.1525 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -6.9792 | 0.4 | 0.9481 | 115.5257 | 97.0483 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 114.5356 | 99.5257 | 98.7112 | 102.3247 | 103.7206 | 107.7162 | 106.0966 | 108.4061 | 110.7209 | 110.6769 | 114.5412 | 114.5356 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -5.1792 | 2.4064 | 0.5201 | 113.1718 | 140.1235 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 115.0077 | 144.1235 | 142.7954 | 132.4372 | 151.4407 | 117.6804 | 133.3272 | 147.8257 | 140.0962 | 131.6466 | 114.5804 | 115.0077 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | 4 | 129.9994 | 131.8514 | 126.6454 | 132.768 | 130.4791 | 123.0823 | 132.8921 | 130.718 | 134.7376 | 125.1039 | 126.4003 | 129.9994 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -5.9792 | 3.5117 | 0.878 | 99.8725 | 117.8095 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 106.7355 | 120.8095 | 114.2948 | 118.894 | 116.6347 | 119.8485 | 116.4782 | 116.0413 | 102.2434 | 98.241 | 95.0287 | 106.7355 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0105 | 87.3903 | 86 | Complete curve; high efficacy | -7.9792 | 1.5579 | 0.9893 | 32.5525 | 119.9428 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 32.5973 | 120.122 | 108.6701 | 92.3587 | 49.688 | 44.8549 | 32.1314 | 33.6031 | 34.7632 | 28.33 | 32.0483 | 32.5973 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0083 | 76.0847 | 86 | Complete curve; high efficacy | -8.0792 | 2.4064 | 0.9788 | 34.0695 | 110.1542 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 24.173 | 108.041 | 107.7583 | 81.9136 | 39.5165 | 42.5568 | 37.701 | 32.5007 | 33.6579 | 37.0598 | 31.0166 | 24.173 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.0187 | 77.5428 | 86 | Complete curve; high efficacy | -7.7292 | 1.7885 | 0.9627 | 34.3529 | 111.8957 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.0008 | 112.3533 | 115.0658 | 89.9199 | 78.4117 | 30.4902 | 34.7307 | 34.3546 | 33.0928 | 38.5201 | 40.8034 | 33.0008 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.059 | 88.7005 | 85 | Complete curve; high efficacy | -7.2292 | 0.6 | 0.9694 | 36.3948 | 125.0953 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.5989 | 117.1885 | 119.5312 | 102.4696 | 90.6458 | 85.8623 | 60.6364 | 51.8299 | 52.2662 | 49.7345 | 41.1285 | 28.5989 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 77.1281 | 85 | Complete curve; high efficacy | -7.4792 | 0.7 | 0.9655 | 31.2029 | 108.331 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.5571 | 101.2018 | 101.2655 | 88.8456 | 70.1845 | 69.8422 | 43.6821 | 40.237 | 39.3066 | 37.258 | 36.4047 | 22.5571 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0187 | 79.8587 | 85 | Complete curve; high efficacy | -7.7292 | 3.5117 | 0.9584 | 32.0611 | 111.9199 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.2093 | 112.4294 | 107.1384 | 115.1252 | 60.4131 | 41.9245 | 37.3163 | 31.476 | 37.277 | 35.9287 | 30.8432 | 13.2093 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0935 | 86.4491 | 85 | Complete curve; high efficacy | -7.0292 | 1.1 | 0.9449 | 37.248 | 123.6972 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.2605 | 129.9165 | 117.2503 | 108.9438 | 120.538 | 91.5155 | 51.1197 | 56.1591 | 51.8607 | 42.0573 | 32.8998 | 26.2605 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0209 | 93.1293 | 85 | Complete curve; high efficacy | -7.6792 | 1.4641 | 0.9618 | 33.1188 | 126.2481 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.4794 | 117.474 | 125.7046 | 121.8447 | 67.9661 | 56.0556 | 41.3261 | 42.2157 | 33.9271 | 32.3517 | 29.6972 | 22.4794 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 100.485 | 85 | Complete curve; high efficacy | -7.4792 | 1 | 0.9707 | 31.2298 | 131.7149 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.5067 | 135.567 | 116.3384 | 110.9262 | 105.2526 | 53.9153 | 47.8749 | 42.0574 | 35.3066 | 32.79 | 30.9695 | 25.5067 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.0296 | 93.4421 | 84 | Complete curve; high efficacy | -7.5292 | 3.9295 | 0.9748 | 23.6719 | 117.114 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.7428 | 100 | 130.2442 | 120.833 | 97.5583 | 27.8225 | 21.548 | 19.8313 | 23.189 | 26.6834 | 24.6437 | 25.7428 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.3722 | 76.551 | 84 | Complete curve; high efficacy | -6.4292 | 1.21 | 0.9308 | 41.5458 | 118.0968 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.8735 | 126.0105 | 102.8329 | 112.503 | 124.3981 | 120.1789 | 87.8304 | 70.2014 | 54.1079 | 49.9172 | 50.885 | 26.8735 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.1321 | 81.2414 | 84 | Complete curve; high efficacy | -6.8792 | 4.9549 | 0.9422 | 34.404 | 115.6454 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.3475 | 111.8181 | 103.4247 | 109.6276 | 115.8533 | 135.6981 | 44.7754 | 39.681 | 48.6523 | 28.6518 | 29.1124 | 26.3475 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.1482 | 82.7015 | 84 | Complete curve; high efficacy | -6.8292 | 3.9295 | 0.9807 | 32.7831 | 115.4845 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.9601 | 112.1327 | 117.5155 | 121.9023 | 104.2805 | 119.0695 | 55.4553 | 42.5564 | 33.0266 | 30.9156 | 28.9386 | 29.9601 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.059 | 76.7002 | 84 | Complete curve; high efficacy | -7.2292 | 1.5095 | 0.9763 | 29.9655 | 106.6658 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.9818 | 106.9151 | 109.4753 | 101.0757 | 90.3292 | 71.8808 | 34.5614 | 30.8078 | 40.7566 | 34.0928 | 28.4921 | 21.9818 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.0209 | 88.8023 | 83 | Complete curve; high efficacy | -7.6792 | 3.5117 | 0.9512 | 16.2799 | 105.0822 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 3.7081 | 100.414 | 107.4471 | 102.6609 | 64.9713 | 4.9833 | 9.8401 | 14.9979 | 17.739 | 26.4967 | 34.0224 | 3.7081 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.0418 | 93.5745 | 83 | Complete curve; high efficacy | -7.3792 | 2.1876 | 0.9984 | 17.8156 | 111.39 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.4361 | 109.284 | 114.2073 | 106.6704 | 95.6714 | 45.8603 | 21.918 | 18.8834 | 16.5069 | 16.3283 | 16.9846 | 17.4361 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.0833 | 78.2328 | 83 | Complete curve; high efficacy | -7.0792 | 0.8 | 0.9055 | 21.999 | 100.2318 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.1095 | 90.1163 | 103.2646 | 89.0182 | 86.3226 | 67.7142 | 35.3475 | 39.8085 | 35.9143 | 36.9216 | 28.8365 | 2.1095 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0743 | 90.1373 | 83 | Complete curve; high efficacy | -7.1292 | 0.6 | 0.9394 | 23.0787 | 113.2161 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.6398 | 104.4157 | 102.1008 | 106.6361 | 85.9834 | 63.3333 | 50.6564 | 40.159 | 53.4023 | 31.9176 | 25.5587 | 14.6398 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.0418 | 84.7687 | 83 | Complete curve; high efficacy | -7.3792 | 1.2221 | 0.9654 | 21.7645 | 106.5332 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 18.8147 | 105.5736 | 99.2727 | 109.2188 | 68.5704 | 62.9029 | 25.883 | 28.2112 | 25.4089 | 22.8606 | 21.0498 | 18.8147 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0469 | 101.0674 | 83 | Complete curve; high efficacy | -7.3292 | 0.9 | 0.9567 | 22.9637 | 124.0311 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.6524 | 111.1073 | 130.7357 | 106.6193 | 90.5192 | 65.0382 | 38.8797 | 39.5498 | 34.1324 | 32.2425 | 24.9349 | 7.6524 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.2348 | 112.8849 | 84 | Complete curve; high efficacy | -6.6292 | 0.4 | 0.9392 | 37.0886 | 149.9734 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 47.4866 | 100.2991 | 140.8419 | 123.7999 | 110.5725 | 117.5645 | 87.8253 | 78.2498 | 85.5312 | 67.1052 | 48.088 | 47.4866 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.0332 | 135.8677 | 84 | Complete curve; high efficacy | -7.4792 | 0.4 | 0.8686 | 24.8504 | 160.7181 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 9.5856 | 132.6885 | 149.7338 | 116.7486 | 73.7789 | 73.9897 | 69.7305 | 68.0186 | 54.4158 | 55.9508 | 40.4479 | 9.5856 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 2.0931 | 100.1183 | 83 | Complete curve; high efficacy | -5.6792 | 0.4 | 0.9534 | 50.966 | 151.0844 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 67.4421 | 149.8224 | 143.8978 | 144.1774 | 136.6925 | 121.0787 | 121.338 | 115.4935 | 112.6965 | 98.7929 | 74.8281 | 67.4421 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0132 | 104.0082 | 83 | Complete curve; high efficacy | -7.8792 | 1.9282 | 0.9887 | 15.4484 | 119.4565 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.6572 | 119.4565 | 113.3958 | 98.0703 | 46.3447 | 19.7386 | 22.7636 | 17.9014 | 20.6219 | 15.882 | 12.5126 | 4.6572 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0235 | 123.0254 | 83 | Complete curve; high efficacy | -7.6292 | 0.4 | 0.8337 | 19.8641 | 142.8896 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.2641 | 131.0145 | 115.5436 | 90.2951 | 53.9052 | 71.2151 | 62.3387 | 57.1604 | 61.9695 | 14.8102 | 35.3827 | 12.2641 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.2093 | 85.2987 | 83 | Complete curve; high efficacy | -6.6792 | 0.7 | 0.9334 | 25.0186 | 110.3173 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.0991 | 109.8173 | 117.7375 | 96.0653 | 79.1894 | 96.8309 | 75.5364 | 51.6992 | 33.8263 | 28.1861 | 36.4133 | 27.0991 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 3.3173 | 81.3074 | 83 | Complete curve; high efficacy | -5.4792 | 2.3332 | 0.9315 | 57.6371 | 138.9446 | -1.1 | 0 0 0 0 1 0 0 0 0 0 0 | 49.2543 | 138.4338 | 143.9848 | 151.4142 | 126.0089 | 95.5126 | 125.5596 | 148.3456 | 124.313 | 78.153 | 69.7657 | 49.2543 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0059 | 36.9664 | 82 | Complete curve; partial efficacy | -8.2292 | 2.3332 | 0.9077 | 119.6572 | 156.6236 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 121.5044 | 156.5384 | 152.389 | 136.5428 | 116.1001 | 121.0618 | 114.6459 | 112.3913 | 119.9242 | 122.9008 | 128.5083 | 121.5044 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0235 | 114.2094 | 82 | Complete curve; high efficacy | -7.6292 | 0.5 | 0.9763 | 14.7696 | 128.979 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 10.4187 | 119.1896 | 95.7224 | 79.6245 | 80.2426 | 57.6913 | 43.0075 | 36.2366 | 30.0952 | 23.1099 | 20.651 | 10.4187 | QC'd by FLUKA | |||||||||||||||
| Cytotoxic | 3.7221 | 80.8703 | 82 | Complete curve; high efficacy | -5.4292 | 4.9549 | 0.9032 | 34.983 | 115.8532 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 31.7555 | 109.5885 | 98.898 | 113.8737 | 107.8306 | 136.1674 | 134.0604 | 103.0938 | 120.47 | 49.9278 | 37.4029 | 31.7555 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0935 | 90.5119 | 82 | Complete curve; high efficacy | -7.0292 | 2.4064 | 0.9076 | 11.9163 | 102.4282 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.6066 | 79.817 | 96.8282 | 103.1563 | 135.2423 | 67.228 | 33.4551 | 13.6779 | 9.6245 | 10.7757 | 11.223 | 12.6066 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1663 | 94.7615 | 82 | Complete curve; high efficacy | -6.7792 | 2.2526 | 0.986 | 16.386 | 111.1475 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.149 | 108.3556 | 124.8245 | 103.3906 | 106.2074 | 102.2469 | 58.7851 | 21.2153 | 18.0773 | 19.6772 | 16.0325 | 13.149 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.5258 | 104.1543 | 82 | Complete curve; high efficacy | -6.2792 | 1 | 0.9414 | 18.3838 | 122.5381 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.0314 | 104.3828 | 126.1461 | 116.2417 | 132.0669 | 128.1681 | 83.3544 | 61.5529 | 52.6567 | 32.9587 | 21.7534 | 11.0314 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.1321 | 103.7873 | 82 | Complete curve; high efficacy | -6.8792 | 0.9 | 0.966 | 14.4792 | 118.2664 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.9536 | 125.3305 | 107.6763 | 112.1488 | 100.7026 | 73.0699 | 75.9515 | 28.2884 | 18.6045 | 19.0646 | 16.6527 | 17.9536 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.0132 | 114.5121 | 82 | Complete curve; high efficacy | -7.8792 | 2.0479 | 0.9903 | 14.6838 | 129.1959 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.3585 | 136.7296 | 116.4775 | 107.7082 | 42.6989 | 23.6219 | 11.1681 | 15.7268 | 18.0954 | 13.3214 | 14.3346 | 13.3585 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.1321 | 156.0134 | 82 | Complete curve; high efficacy | -6.8792 | 0.4 | 0.9789 | -13.9595 | 142.0539 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.982 | 129.411 | 119.3857 | 103.9503 | 100.8911 | 63.908 | 56.4902 | 49.4204 | 32.4488 | 5.1022 | 3.5537 | 2.982 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 3.7221 | 84.0366 | 82 | Complete curve; high efficacy | -5.4292 | 1.9887 | 0.8892 | 33.1062 | 117.1428 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.583 | 104.9664 | 128.4651 | 118.0164 | 124.0429 | 93.0546 | 124.0918 | 125.7379 | 103.1971 | 56.4284 | 52.5045 | 22.583 | QC'd by XcessBio | |||||||||||||||
| Cytotoxic | 1.3207 | 84.3781 | 82 | Complete curve; high efficacy | -5.8792 | 4.4495 | 0.9108 | 28.6573 | 113.0354 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 50.6955 | 98.1375 | 111.271 | 125.1555 | 106.5195 | 116.7283 | 107.7109 | 122.3031 | 49.8241 | 27.9365 | 5.972 | 50.6955 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.5258 | 93.3798 | 82 | Complete curve; high efficacy | -6.2792 | 2.3332 | 0.983 | 19.1033 | 112.4831 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.8591 | 105.468 | 124.7832 | 114.5473 | 109.601 | 102.2654 | 109.9065 | 61.3632 | 23.8506 | 21.1462 | 20.5224 | 16.8591 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0526 | 98.0552 | 82 | Complete curve; high efficacy | -7.2792 | 1.5095 | 0.9868 | 15.7184 | 113.7736 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.9644 | 114.8405 | 118.2779 | 99.4879 | 95.3835 | 61.4123 | 21.1637 | 23.8746 | 15.9208 | 20.0472 | 11.5883 | 12.9644 | QC'd by Axon Medchem |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0105 | 76.7421 | 98 | Complete curve; high efficacy | -7.9792 | 0.4 | 0.8143 | 106.1488 | 182.891 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 97.0213 | 175.2098 | 149.2496 | 135.4049 | 151.407 | 123.166 | 130.2765 | 116.1855 | 114.3842 | 112.5027 | 122.7118 | 97.0213 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.0209 | 59.6064 | 90 | Complete curve; high efficacy | -7.6792 | 2.3332 | 0.8743 | 65.0446 | 124.6509 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 42.5491 | 114.2054 | 125.0887 | 133.6383 | 90.3996 | 69.0769 | 75.4333 | 62.8924 | 74.9842 | 66.9826 | 68.2413 | 42.5491 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0187 | 99.3872 | 89 | Complete curve; high efficacy | -7.7292 | 0.7 | 0.9809 | 54.5973 | 153.9845 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 52 | 144.7606 | 143.678 | 116.2189 | 96.5819 | 92.3133 | 70.1166 | 62.4789 | 59.1128 | 61.5841 | 52.5675 | 52 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.4176 | 68.9597 | 88 | Complete curve; high efficacy | -6.3792 | 3.5117 | 0.8951 | 89.8298 | 158.7896 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 95.9522 | 121.7497 | 145.5234 | 145.5172 | 164.4127 | 183.3401 | 150.4309 | 108.3356 | 77.5118 | 95.8824 | 89.8236 | 95.9522 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.5899 | 69.1819 | 88 | Complete curve; high efficacy | -6.2292 | 3.99 | 0.7629 | 95.3406 | 164.5224 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 109.573 | 149.3937 | 173.4718 | 129.8513 | 191.2497 | 150.3213 | 190.3378 | 133.8647 | 83.1872 | 96.4136 | 91.5262 | 109.573 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0743 | 107.0548 | 87 | Complete curve; high efficacy | -7.1292 | 0.8 | 0.9845 | 54.8206 | 161.8754 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 57.9387 | 151.8563 | 163.9611 | 143.7973 | 136.7288 | 112.9196 | 83.162 | 76.8733 | 68.1774 | 53.2269 | 52.6378 | 57.9387 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1482 | 83.5427 | 87 | Complete curve; high efficacy | -6.8292 | 4.4495 | 0.958 | 60.4745 | 144.0173 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 69.2734 | 130.5346 | 130.6652 | 147.3751 | 155.1668 | 153.9418 | 81.6955 | 63.296 | 59.2608 | 55.6163 | 55.5134 | 69.2734 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.177 | 117.976 | 87 | Complete curve; high efficacy | -5.9292 | 0.3 | 0.8809 | 103.6252 | 221.6012 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 124.3584 | 204.1012 | 213.7323 | 210.6584 | 195.2614 | 187.4914 | 165.4267 | 159.6533 | 180.5857 | 156.7486 | 132.0473 | 124.3584 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0059 | 86.112 | 87 | Complete curve; high efficacy | -8.2292 | 3.9295 | 0.9408 | 35.788 | 121.9 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.9728 | 119.2292 | 123.804 | 60.9061 | 49.6123 | 39.0107 | 36.6521 | 41.3552 | 44.3418 | 29.6223 | 31.9796 | 16.9728 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.6619 | 77.7986 | 87 | Complete curve; high efficacy | -6.1792 | 1.4641 | 0.9055 | 87.7533 | 165.5518 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 81.2811 | 136.4201 | 144.0668 | 155.7612 | 179.4399 | 178.5787 | 159.509 | 126.3915 | 103.3855 | 100.1929 | 87.1849 | 81.2811 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1321 | 89.8904 | 86 | Complete curve; high efficacy | -6.8792 | 0.8 | 0.951 | 49.0129 | 138.9033 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 40.8231 | 126.0203 | 148.1813 | 124.8099 | 131.8805 | 103.3715 | 79.0164 | 73.446 | 67.021 | 55.4405 | 53.3845 | 40.8231 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.4176 | 102.2587 | 86 | Complete curve; high efficacy | -6.3792 | 0.9 | 0.9558 | 64.4239 | 166.6826 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 62.0508 | 169.9186 | 163.4857 | 169.1241 | 146.548 | 155.8497 | 143.5232 | 95.5095 | 85.8266 | 89.7822 | 63.0216 | 62.0508 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 1.4818 | 76.0482 | 86 | Complete curve; high efficacy | -5.8292 | 1.6436 | 0.9611 | 86.8287 | 162.8769 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 82.8262 | 126.6031 | 167.7674 | 148.1546 | 170.4052 | 160.7596 | 163.2256 | 153.9322 | 115.8888 | 102.7391 | 87.3843 | 82.8262 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.935 | 70.2991 | 85 | Complete curve; high efficacy | -6.0292 | 1.1 | 0.9449 | 64.9721 | 135.2712 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.1264 | 136.8416 | 133.7919 | 124.0367 | 139.8306 | 136.3935 | 126.542 | 109.4313 | 83.562 | 79.4602 | 79.2579 | 54.1264 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1049 | 113.2337 | 85 | Complete curve; high efficacy | -6.9792 | 1.1 | 0.9467 | 39.4295 | 152.6631 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 32.5405 | 140.1803 | 150.363 | 153.1014 | 157.3692 | 94.8722 | 71.3759 | 73.0522 | 48.5931 | 36.3782 | 39.1494 | 32.5405 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0166 | 145.9135 | 85 | Complete curve; high efficacy | -7.7792 | 0.7 | 0.9824 | 29.6583 | 175.5718 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 34.6378 | 162.9357 | 140.528 | 136.1473 | 83.9944 | 77.3378 | 54.5051 | 36.9278 | 32.9789 | 33.614 | 29.9243 | 34.6378 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.7427 | 87.8078 | 85 | Complete curve; high efficacy | -6.1292 | 1.8265 | 0.89 | 61.3799 | 149.1877 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 43.6517 | 125.4482 | 151.4934 | 151.5693 | 138.7177 | 162.0934 | 165.3929 | 104.4842 | 85.5886 | 70.2374 | 69.1832 | 43.6517 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0026 | 72.1457 | 85 | Complete curve; high efficacy | -8.5792 | 1.2221 | 0.9437 | 24.7418 | 96.8875 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.2124 | 89.7403 | 60.5669 | 40.6941 | 33.8688 | 35.3476 | 27.5307 | 28.4133 | 21.9975 | 21.2917 | 22.4943 | 16.2124 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.935 | 100.6421 | 85 | Complete curve; high efficacy | -6.0292 | 0.7 | 0.923 | 61.7833 | 162.4254 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 57.3523 | 168.1282 | 144.1115 | 151.7026 | 171.4086 | 158.4019 | 133.5552 | 112.5955 | 103.3282 | 85.4669 | 88.3683 | 57.3523 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 2.6351 | 88.8323 | 85 | Complete curve; high efficacy | -5.5792 | 0.8 | 0.9009 | 92.8317 | 181.664 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 98.7032 | 172.664 | 175.775 | 187.4451 | 189.4966 | 178.714 | 170.8024 | 149.3555 | 161.8016 | 111.5356 | 120.777 | 98.7032 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0935 | 83.1337 | 87 | Complete curve; high efficacy | -7.0292 | 0.6 | 0.9732 | 52.9139 | 136.0477 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.7559 | 135.1374 | 118.648 | 125.1116 | 118.3367 | 96.3669 | 79.5974 | 75.1495 | 71.3903 | 59.6922 | 54.2396 | 54.7559 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 111.7251 | 86 | Complete curve; high efficacy | -7.4792 | 0.3 | 0.9262 | 42.1257 | 153.8508 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.7825 | 144.6362 | 112.8549 | 103.8285 | 95.2192 | 88.9231 | 87.265 | 80.9661 | 70.7181 | 65.5995 | 53.4647 | 51.7825 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0418 | 82.7514 | 85 | Complete curve; high efficacy | -7.3792 | 0.5 | 0.9759 | 33.8657 | 116.617 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.5726 | 108.622 | 98.6869 | 93.7987 | 83.8286 | 67.4168 | 56.4383 | 56.9697 | 48.1109 | 46.3428 | 37.7443 | 28.5726 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0296 | 92.0907 | 85 | Complete curve; high efficacy | -7.5292 | 0.5 | 0.9383 | 35.476 | 127.5667 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.5556 | 114.1336 | 120.8945 | 88.7261 | 81.5755 | 76.2025 | 54.6824 | 55.6484 | 57.3045 | 45.911 | 37.1374 | 29.5556 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.1865 | 70.3869 | 84 | Complete curve; high efficacy | -6.7292 | 2.7202 | 0.9761 | 38.0815 | 108.4684 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.1917 | 108.8739 | 108.2531 | 101.5408 | 112.4163 | 108.1385 | 70.3357 | 43.6652 | 34.5392 | 28.361 | 41.6648 | 47.1917 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.4176 | 71.6673 | 84 | Complete curve; high efficacy | -6.3792 | 2.4064 | 0.9479 | 43.4067 | 115.074 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.3089 | 105.574 | 126.981 | 118.3238 | 117.612 | 103.7019 | 109.6834 | 63.4438 | 52.5864 | 53.6306 | 39.1222 | 33.3089 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1049 | 108.1591 | 84 | Complete curve; high efficacy | -6.9792 | 0.3 | 0.955 | 31.5875 | 139.7466 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 43.3364 | 131.0144 | 114.5692 | 101.7563 | 97.1956 | 81.0289 | 79.2851 | 79.034 | 69.8399 | 55.065 | 52.7031 | 43.3364 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0166 | 112.884 | 83 | Complete curve; high efficacy | -7.7792 | 2.7202 | 0.9889 | 16.1533 | 129.0373 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.2676 | 116.3272 | 134.3166 | 126.0141 | 55.7945 | 23.8385 | 15.9339 | 16.9523 | 14.5303 | 14.2658 | 15.8321 | 13.2676 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.4686 | 94.7258 | 83 | Complete curve; high efficacy | -6.3292 | 0.6 | 0.9557 | 29.0284 | 123.7542 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 35.6827 | 133.5399 | 103.9822 | 117.9539 | 112.0859 | 105.559 | 83.2992 | 74.0842 | 64.5113 | 41.0297 | 41.6372 | 35.6827 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2635 | 100.8755 | 83 | Complete curve; high efficacy | -6.5792 | 0.9 | 0.8969 | 25.7615 | 126.637 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.542 | 104.9981 | 131.3946 | 122.3505 | 135.6872 | 112.05 | 66.0485 | 57.8396 | 53.7976 | 41.5332 | 37.9975 | 4.542 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0469 | 103.2658 | 83 | Complete curve; high efficacy | -7.3292 | 1.4787 | 0.9945 | 24.4756 | 127.7413 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.0142 | 133.8948 | 120.7681 | 119.4508 | 105.6156 | 65.7525 | 34.7398 | 31.8181 | 24.4769 | 24.1709 | 24.9208 | 22.0142 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4686 | 92.4712 | 83 | Complete curve; high efficacy | -6.3292 | 2.3332 | 0.972 | 28.9592 | 121.4304 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.8907 | 112.9759 | 141.5986 | 120.5517 | 113.8929 | 115.8225 | 112.4976 | 62.8706 | 33.5238 | 28.9592 | 28.8711 | 29.8907 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2348 | 89.2044 | 83 | Complete curve; high efficacy | -6.6292 | 1.4641 | 0.9775 | 29.1453 | 118.3497 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 30.577 | 122.3185 | 120.0124 | 103.9641 | 116.9025 | 116.6825 | 75.5785 | 53.397 | 29.7764 | 27.6303 | 31.594 | 30.577 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 2.6351 | 88.3639 | 83 | Complete curve; high efficacy | -5.5792 | 1 | 0.8333 | 53.4354 | 141.7993 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 69.1826 | 150.707 | 126.8073 | 140.1173 | 122.6532 | 128.5218 | 127.1755 | 136.3873 | 123.3444 | 63.4982 | 61.6305 | 69.1826 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 1.049 | 94.6969 | 82 | Complete curve; high efficacy | -5.9792 | 1.9282 | 0.9864 | 26.5166 | 121.2135 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.4036 | 111.8163 | 115.5011 | 118.7274 | 126.8177 | 125.7155 | 124.4111 | 99.2392 | 53.4896 | 34.1597 | 26.654 | 22.4036 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.1321 | 81.4391 | 82 | Complete curve; high efficacy | -6.8792 | 1 | 0.9705 | 13.2025 | 94.6416 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.2699 | 84.6416 | 100.2144 | 88.0054 | 89.8294 | 66.8701 | 45.1052 | 25.589 | 27.2655 | 21.168 | 10.1269 | 6.2699 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0833 | 92.8523 | 82 | Complete curve; high efficacy | -7.0792 | 0.4 | 0.9706 | 12.2421 | 105.0944 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 15.2318 | 97.3014 | 84.0705 | 87.115 | 64.4661 | 59.8416 | 48.8602 | 38.5001 | 40.2779 | 31.4269 | 21.9661 | 15.2318 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0235 | 80.8069 | 82 | Complete curve; high efficacy | -7.6292 | 0.6 | 0.9889 | 14.6909 | 95.4978 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.7976 | 88.1312 | 84.022 | 66.5827 | 54.9265 | 41.2161 | 33.272 | 29.0748 | 23.7083 | 16.2035 | 15.8475 | 11.7976 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0012 | 59.1239 | 82 | Complete curve; partial efficacy | -8.9292 | 4.9549 | 0.8587 | 99.4449 | 158.5687 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 103.2631 | 152.6148 | 94.4922 | 95.0001 | 94.3426 | 94.4109 | 100.4664 | 111.3588 | 107.5709 | 103.8685 | 92.1541 | 103.2631 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4176 | 94.6905 | 82 | Complete curve; high efficacy | -6.3792 | 2.1876 | 0.9861 | 24.3029 | 118.9934 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.4583 | 113.0531 | 121.9635 | 115.8336 | 128.0296 | 109.3466 | 109.2746 | 55.2918 | 34.1038 | 26.5126 | 20.0235 | 21.4583 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.1482 | 96.1905 | 85 | Complete curve; high efficacy | -6.8292 | 3.9295 | 0.9924 | 44.5048 | 140.6953 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 37.5464 | 136.9515 | 141.9942 | 144.5132 | 137.0086 | 139.2747 | 69.4708 | 50.2051 | 43.4747 | 41.4134 | 50.9304 | 37.5464 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.0129 | 83.5366 | 84 | Complete curve; high efficacy | -7.8904 | 1.4787 | 0.9978 | 23.8147 | 107.3513 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 23.9151 | 110.1823 | 102.3434 | 96.9951 | 70.7527 | 40.6202 | 28.66 | 25.8815 | 24.6553 | 21.8719 | 25.2135 | 23.9151 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 0.0235 | 92.4647 | 84 | Complete curve; high efficacy | -7.6292 | 1.9673 | 0.9567 | 23.2254 | 115.6902 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.0573 | 111.7434 | 116.8232 | 109.3919 | 75.4472 | 32.9909 | 33.7059 | 30.0263 | 30.2649 | 32.1706 | 12.7685 | 4.0573 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.2881 | 75.8805 | 84 | Complete curve; high efficacy | -6.5404 | 1.8265 | 0.9683 | 41.6685 | 117.5491 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.3204 | 119.5479 | 107.4971 | 113.5971 | 126.3084 | 112.3175 | 118.4846 | 79.9745 | 45.9661 | 45.1223 | 48.3071 | 36.3204 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2957 | 81.0096 | 84 | Complete curve; high efficacy | -6.5292 | 3.1925 | 0.9261 | 40.4734 | 121.483 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.322 | 115.4342 | 118.2478 | 121.3497 | 132.2979 | 117.0883 | 107.0927 | 49.9135 | 46.6548 | 51.6487 | 50.6374 | 11.322 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Cytotoxic | 0.2635 | 116.5095 | 84 | Complete curve; high efficacy | -6.5792 | 0.6 | 0.9706 | 41.249 | 157.7585 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 40.8193 | 148.2389 | 152.8144 | 145.5181 | 150.8832 | 117.9007 | 95.7355 | 82.3682 | 80.7695 | 61.7212 | 51.1085 | 40.8193 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.0526 | 88.208 | 83 | Complete curve; high efficacy | -7.2792 | 1.2876 | 0.9942 | 23.4223 | 111.6302 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.5003 | 110.0308 | 111.5061 | 103.8454 | 94.6012 | 59.3844 | 38.8394 | 30.8492 | 24.8325 | 26.4131 | 22.2217 | 17.5003 | QC'd by LC Labs | |||||||||||||||
| Cytotoxic | 0.0526 | 75.9024 | 83 | Complete curve; high efficacy | -7.2792 | 2.0479 | 0.9737 | 21.1749 | 97.0774 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 18.3476 | 101.8034 | 86.0254 | 99.4825 | 90.0803 | 50.3844 | 29.2288 | 30.8578 | 23.3748 | 16.2456 | 14.5431 | 18.3476 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0526 | 79.9256 | 83 | Complete curve; high efficacy | -7.2792 | 1.3723 | 0.9663 | 23.9977 | 103.9232 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.6139 | 98.4232 | 100.1087 | 114.2863 | 77.5004 | 61.6508 | 32.0154 | 31.6054 | 25.7323 | 23.8408 | 27.9084 | 17.6139 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0209 | 90.4807 | 83 | Complete curve; high efficacy | -7.6792 | 0.9 | 0.9775 | 17.1515 | 107.6322 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.4719 | 96.9766 | 103.3615 | 85.5749 | 58.3174 | 41.0676 | 31.1754 | 22.0076 | 23.023 | 21.4144 | 19.2811 | 6.4719 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0053 | 93.6423 | 83 | Complete curve; high efficacy | -8.2792 | 1 | 0.9697 | 14.5291 | 108.1714 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.1496 | 99.2849 | 81.9982 | 49.1336 | 31.0686 | 31.2874 | 22.5896 | 21.2096 | 13.4352 | 11.2475 | 10.2585 | 8.1496 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0148 | 94.6905 | 83 | Complete curve; high efficacy | -7.8292 | 1.1705 | 0.982 | 17.423 | 112.1135 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.0947 | 103.9614 | 109.0536 | 82.8529 | 55.0007 | 27.8871 | 30.3566 | 24.6009 | 18.1235 | 14.688 | 13.7931 | 12.0947 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0935 | 96.6424 | 83 | Complete curve; high efficacy | -7.0292 | 1.6604 | 0.9922 | 24.5734 | 121.2158 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.6091 | 121.7166 | 119.6038 | 122.5533 | 110.0231 | 90.718 | 41.6609 | 37.9316 | 22.3882 | 22.6779 | 22.4003 | 25.6091 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0469 | 82.9678 | 83 | Complete curve; high efficacy | -7.3292 | 4.9549 | 0.9179 | 22.6763 | 105.644 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.6388 | 101.9106 | 107.1814 | 103.9277 | 109.2884 | 34.5811 | 38.9659 | 38.5481 | 33.3514 | 23.3035 | 2.6195 | 2.6388 | QC'd by NCI | |||||||||||||||
| Cytotoxic | 0.0296 | 105.7871 | 83 | Complete curve; high efficacy | -7.5292 | 0.5 | 0.8834 | 22.0136 | 127.8007 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.7056 | 117.0952 | 117.3948 | 102.7791 | 58.6408 | 55.6178 | 51.2518 | 52.8649 | 46.0625 | 39.7928 | 25.4459 | 4.7056 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0209 | 126.3344 | 83 | Complete curve; high efficacy | -7.6792 | 0.8 | 0.989 | 17.1119 | 143.4463 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.0678 | 134.7593 | 122.167 | 111.5868 | 76.2473 | 54.6662 | 37.3452 | 23.489 | 31.1023 | 10.6587 | 18.9539 | 16.0678 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0074 | 100.2703 | 83 | Complete curve; high efficacy | -8.1292 | 2.0479 | 0.9936 | 16.8213 | 117.0916 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 23.4575 | 117.6101 | 105.1974 | 73.0401 | 25.8505 | 13.918 | 14.8472 | 15.0411 | 16.0162 | 16.5042 | 18.3596 | 23.4575 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0235 | 108.8889 | 82 | Complete curve; high efficacy | -7.6292 | 0.7 | 0.994 | 11.7255 | 120.6144 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.4791 | 114.5312 | 97.3221 | 86.1436 | 74.135 | 46.9964 | 29.7854 | 23.381 | 15.473 | 13.1449 | 13.4733 | 13.4791 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0235 | 110.596 | 82 | Complete curve; high efficacy | -7.6292 | 1.6266 | 0.9764 | 12.0566 | 122.6526 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.2889 | 128.4612 | 120.2462 | 94.575 | 86.249 | 20.7415 | 16.1119 | 13.6858 | 12.9514 | 13.591 | 13.5681 | 12.2889 | QC'd by FLUKA | |||||||||||||||
| Cytotoxic | 0.0418 | 84.2481 | 82 | Complete curve; high efficacy | -7.3792 | 0.8 | 0.9425 | 13.6326 | 97.8807 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.9077 | 82.5934 | 102.655 | 86.9085 | 64 | 41.114 | 32.793 | 28.1192 | 27.8185 | 19.7373 | 7.4804 | 6.9077 | QC'd by Otava |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|---|
| 2.8 | IC50 relative | = | 2800 | nM | Active |
| 8.5 | IC50 relative | = | 8500 | nM | Active |
| 8.2 | IC50 relative | = | 8200 | nM | Active |
| 8.7 | IC50 relative | = | 8700 | nM | Active |
| 15 | IC50 relative | = | 15000 | nM | Inactive |
| 1.1 | IC50 relative | = | 1100 | nM | Active |
| 8.3 | IC50 relative | = | 8300 | nM | Active |
| 7.8 | IC50 relative | = | 7800 | nM | Active |
| 5.3 | IC50 relative | = | 5300 | nM | Active |
| 4.5 | IC50 relative | = | 4500 | nM | Active |
| 2.5 | IC50 relative | = | 2500 | nM | Active |
| 12.5 | IC50 relative | = | 12500 | nM | Inactive |
| 1 | IC50 relative | = | 1000 | nM | Active |
| 0.7 | IC50 relative | = | 700 | nM | Active |
| 3.6 | IC50 relative | = | 3600 | nM | Active |
| 2.7 | IC50 relative | = | 2700 | nM | Active |
| 13.1 | IC50 relative | = | 13100 | nM | Active |
| 1.9 | IC50 relative | = | 1900 | nM | Active |
| 11.8 | IC50 relative | = | 11800 | nM | Inactive |
| 50 | IC50 relative | = | 50000 | nM | Inactive |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000040000 uM | Activity at 0.0000163452 uM | Activity at 0.0000320000 uM | Activity at 0.0000806082 uM | Activity at 0.0001439601 uM | Activity at 0.0003895389 uM | Activity at 0.0007288991 uM | Activity at 0.00154 uM | Activity at 0.00290 uM | Activity at 0.00454 uM | Activity at 0.00833 uM | Activity at 0.021 uM | Activity at 0.041 uM | Activity at 0.095 uM | Activity at 0.199 uM | Activity at 0.321 uM | Activity at 0.689 uM | Activity at 1.028 uM | Activity at 2.684 uM | Activity at 5.101 uM | Activity at 10.05 uM | Activity at 24.85 uM | Activity at 39.21 uM | Activity at 78.39 uM | Activity at 125.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 58.4116 | 43.5916 | 25.8843 | 33.4207 | 9.1109 | 21.6395 | 45.6886 | 10.8911 | 28.3955 | 31.3127 | 38.9914 | 41.6558 | 58.4116 | QC'd by Sytravon | |||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -12.6805 | -10.7548 | -9.5107 | -10.6418 | -15.9997 | -12.6805 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -7.1462 | -9.2235 | -11.8601 | -6.118 | -12.2196 | -7.1462 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 4.9549 | 0.6661 | -22.0013 | -2 | 4 | 0 0 0 0 0 | -18.751 | -10.987 | -0.9935 | 2.356 | 1.2583 | -18.751 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -11.1249 | -10.2692 | -11.5229 | -11.032 | -13.325 | -11.1249 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | -4.8 | 1.8851 | 0.5555 | -23.9168 | -5.4088 | 4 | 0 0 0 0 0 | -18.264 | -13.0121 | -2.8407 | -6.6548 | -7.1687 | -18.264 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | -6.35 | 4.9549 | 0.9083 | -3.1815 | -14.9283 | 4 | 0 0 0 0 1 | -10.2909 | -13.1276 | -17.0236 | -1.4012 | -4.6174 | -10.2909 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | -5.95 | 0.4 | 0.9812 | -20.7272 | -0.9942 | 4 | 0 0 0 0 0 | -16.0227 | -4.9952 | -8.1266 | -9.7286 | -14.3153 | -16.0227 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | -6.5 | 4.9549 | 0.6409 | -9.2158 | -16.6011 | 4 | 0 0 0 0 1 | -12.7654 | -16.3342 | -16.1896 | -6.0131 | -13.084 | -12.7654 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.975 | 2.6103 | 3.4198 | -3.4748 | 1.7624 | 1.975 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -8.2223 | -0.1456 | -4.3339 | -1.582 | -3.6253 | -8.2223 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | -7.25 | 4.9549 | 0.602 | -10.0715 | 2 | 4 | 0 0 0 0 0 | -12.6011 | 0.2325 | -14.2262 | -4.5441 | -8.7364 | -12.6011 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 4.5045 | 0.9809 | -24.6554 | -10.8442 | 4 | 0 0 0 0 0 | -22.2129 | -9.8702 | -10.3098 | -11.7375 | -10.6121 | -22.2129 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 4.9549 | 0.8409 | -13.5514 | 2 | 4 | 0 0 0 0 0 | -11.2928 | -1.9276 | 4.6106 | 1.3336 | 4.0275 | -11.2928 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | -5.2 | 0.5 | 0.9077 | -28.8252 | -9.4452 | 4 | 0 0 0 0 0 | -23.1876 | -10.7877 | -12.0613 | -16.7104 | -16.3414 | -23.1876 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -18.3436 | -16.2788 | -21.7212 | -19.8613 | -16.6894 | -18.3436 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -5.4025 | -9.518 | -0.1694 | 0.2848 | -4.8162 | -5.4025 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -23.1229 | -14.0834 | -13.5556 | -16.7644 | -18.8145 | -23.1229 | QC'd by Sytravon | ||||||||||||||||||||||||||||
| Inactive | 0 | -4.95 | 3.2975 | 0.9426 | -35.5663 | -15.2262 | 4 | 0 0 0 0 0 | -34.2687 | -12.6885 | -18.3414 | -14.0693 | -16.4909 | -34.2687 | QC'd by Sytravon | ||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 4.9549 | 0.7952 | -15.6253 | -4.8932 | 4 | 0 0 0 0 0 | -13.8544 | -4.3645 | -8.5252 | -3.661 | -3.9903 | -13.8544 | QC'd by Sytravon |
| Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|
| Delta TM | = | 0.05675 | C | Thermal Shift Assay |
| Delta TM | = | 0.06056 | C | Thermal Shift Assay |
| Delta TM | = | -0.26 | C | |
| Delta TM | = | 0.05 | C | Thermal Shift Assay |
| Delta TM | = | 0.2158 | C | Thermal Shift Assay |
| Delta TM | = | 0.1132 | C | Thermal Shift Assay |
| Delta TM | = | -0.21 | C | Thermal Shift Assay |
| Delta TM | = | 0.07973 | C | Thermal Shift Assay |
| Delta TM | = | 0.3724 | C | Thermal Shift Assay |
| Delta TM | = | -0.3 | C | |
| Delta TM | = | -0.04 | C | Thermal Shift Assay |
| Delta TM | = | -0.08 | C | Thermal Shift Assay |
| Delta TM | = | -0.49 | C | Thermal Shift Assay |
| Delta TM | = | 0.08515 | C | Thermal Shift Assay |
| Delta TM | = | 0.01057 | C | Thermal Shift Assay |
| Delta TM | = | 0 | C | Thermal Shift Assay |
| Delta TM | = | 0.1944 | C | Thermal Shift Assay |
| Delta TM | = | 2.51 | C | Thermal Shift Assay |
| Delta TM | = | -0.01 | C | Thermal Shift Assay |
| Delta TM | = | -0.24 | C | Thermal Shift Assay |
| Standard Type | Standard Relation | Standard Value |
|---|---|---|
| Growth Rate | = | -0.32 |
| Growth Rate | = | -0.85 |
| Growth Rate | = | 0.66 |
| Growth Rate | = | 0.58 |
| Growth Rate | = | 0.86 |
| Growth Rate | = | 0.06 |
| Growth Rate | = | 0.1 |
| Growth Rate | = | 0.63 |
| Growth Rate | = | 0.67 |
| Growth Rate | = | 0.46 |
| Growth Rate | = | 0.87 |
| Growth Rate | = | 0 |
| Growth Rate | = | 0.46 |
| Growth Rate | = | 0.87 |
| Growth Rate | = | -0.42 |
| Growth Rate | = | -0.57 |
| Growth Rate | = | -0.81 |
| Growth Rate | = | 0.2 |
| Growth Rate | = | 0.77 |
| Growth Rate | = | 0.4 |
| Standard Type | Standard Relation | Standard Value |
|---|---|---|
| Growth Rate | = | 0.66 |
| Growth Rate | = | 0.47 |
| Growth Rate | = | 0.81 |
| Growth Rate | = | 0.62 |
| Growth Rate | = | 0.92 |
| Growth Rate | = | 0.99 |
| Growth Rate | = | -0.15 |
| Growth Rate | = | -0.01 |
| Growth Rate | = | 0.69 |
| Growth Rate | = | 0.27 |
| Growth Rate | = | 0.71 |
| Growth Rate | = | 0.38 |
| Growth Rate | = | 0.78 |
| Growth Rate | = | 0.46 |
| Growth Rate | = | 0.9 |
| Growth Rate | = | 0.97 |
| Growth Rate | = | 0.97 |
| Growth Rate | = | 0.5 |
| Growth Rate | = | 0.33 |
| Growth Rate | = | 0.54 |
| Standard Type | Standard Relation | Standard Value |
|---|---|---|
| Growth Rate | = | 0.94 |
| Growth Rate | = | 0.96 |
| Growth Rate | = | 0.56 |
| Growth Rate | = | 0.78 |
| Growth Rate | = | 0.8 |
| Growth Rate | = | 0.92 |
| Growth Rate | = | 0.78 |
| Growth Rate | = | -0.28 |
| Growth Rate | = | -0.1 |
| Growth Rate | = | 0.54 |
| Growth Rate | = | 0.58 |
| Growth Rate | = | 0.72 |
| Growth Rate | = | 0.97 |
| Growth Rate | = | 0.76 |
| Growth Rate | = | 0.97 |
| Growth Rate | = | 0.82 |
| Growth Rate | = | 0.75 |
| Growth Rate | = | 0.87 |
| Growth Rate | = | 0.77 |
| Growth Rate | = | 0.78 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 9.3495 | 37.1145 | 0 | Partial curve; high efficacy; poor fit | -5.0292 | 4.5045 | 0.3394 | 139.866 | 102.7515 | 2.3 | 0 0 0 0 0 0 0 1 0 0 1 | 88.0524 | 128.0096 | 112.7233 | 88.6255 | 79.2461 | 88.4591 | 116.5125 | 107.4342 | 40.612 | 105.1422 | 136.3749 | 88.0524 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 142.8394 | 114.1417 | 111.508 | 167.841 | 110.3078 | 162.3881 | 116.8787 | 143.5866 | 138.3617 | 142.2804 | 96.0848 | 142.8394 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 0.0066 | 105.2593 | 0 | Complete curve; high efficacy; poor fit | -8.1792 | 0.7 | 0.8893 | 112.3492 | 217.6086 | 1.3 | 0 0 1 0 0 0 0 0 0 0 1 | 149.7744 | 206.0416 | 175.7962 | 99.9709 | 145.4635 | 125.3281 | 120.2334 | 135.1946 | 115.4803 | 122.2618 | 90.372 | 149.7744 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 29.4231 | 126.3953 | 81.165 | 86.1405 | 110.3352 | 124.4199 | 134.8609 | 111.8128 | 89.3843 | 231.3882 | 107.4383 | 29.4231 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 0 | 5 | 143.6153 | 87.7329 | 109.6233 | 117.133 | 130.2435 | 108.0073 | 71.945 | 131.4159 | 458.2894 | 127.4181 | 102.4514 | 143.6153 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 20.931 | 115.7607 | 0 | Partial curve; high efficacy; poor fit | -4.6792 | 4.5045 | 0.6728 | 52.682 | 168.4428 | 2.3 | 0 0 0 0 0 0 0 0 1 0 0 | 57.3383 | 156.9875 | 210.0745 | 196.4426 | 169.3007 | 145.4793 | 168.5143 | 122.6219 | 177.1228 | 240.8839 | 147.1926 | 57.3383 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -4.8792 | 3.5117 | 0.7454 | 3.7363 | 121.3761 | 4 | 1 0 0 0 0 0 0 0 0 0 0 | 4.9959 | 69.8483 | 72.4018 | 110.8591 | 122.5541 | 161.1408 | 130.7083 | 144.5237 | 100.537 | 122.3534 | 47.4563 | 4.9959 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 11.7704 | 120.3803 | 0 | Partial curve; high efficacy; poor fit | -4.9292 | 4.9549 | 0.6857 | 256.5786 | 136.1982 | 2.3 | 0 0 0 0 0 0 0 0 0 0 1 | 129.6573 | 124.8033 | 153.6337 | 147.2807 | 166.633 | 130.3024 | 101.8421 | 144.7083 | 155.0295 | 116.7688 | 231.6699 | 129.6573 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 123.0403 | 128.8699 | 210.7699 | 190.2566 | 146.8479 | 215.4495 | 109.2714 | 124.0291 | 164.0907 | 204.8081 | 137.4596 | 123.0403 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 3.7221 | 32.6568 | 0 | Complete curve; high efficacy; poor fit | -5.4292 | 4.9549 | 0.4276 | 89.2254 | 121.8822 | 1.3 | 0 1 0 0 0 0 0 0 0 0 0 | 100.4672 | 87.1822 | 158.1858 | 123.8552 | 104.2031 | 121.5711 | 143.849 | 137.3495 | 134.3819 | 92.8337 | 79.7182 | 100.4672 | QC'd by BIOMOL | |||||||||||||||
| Activator | 1.4818 | 129.4082 | 0 | Complete curve; high efficacy; poor fit | -5.8292 | 0.9 | 0.78 | 36.537 | 165.9452 | 1.3 | 0 0 1 0 0 0 0 0 0 0 0 | 42.5687 | 179.6537 | 123.5264 | 118.8734 | 141.6283 | 179.6193 | 162.4189 | 95.5446 | 129.6678 | 48.1471 | 54.8755 | 42.5687 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0.0662 | 23.8999 | 0 | Complete curve; high efficacy; poor fit | -7.1792 | 4.9549 | 0.3972 | 157.0608 | 133.1609 | 1.3 | 0 0 0 0 1 0 0 0 0 0 0 | 156.4182 | 131.6383 | 146.4008 | 133.9209 | 120.0163 | 196.9193 | 161.7274 | 189.7061 | 147.8016 | 155.1127 | 132.5334 | 156.4182 | QC'd by BIOMOL | |||||||||||||||
| Activator | 1.6626 | 39.682 | 0 | Complete curve; high efficacy; poor fit | -5.7792 | 4.9549 | 0.6393 | 68.8456 | 108.5275 | 1.3 | 0 0 0 0 0 0 0 0 1 0 0 | 58.2968 | 104.9015 | 85.3011 | 114.5667 | 123.321 | 105.3304 | 99.8094 | 125.7757 | 85.4017 | 139.4605 | 80.254 | 58.2968 | QC'd by BIOMOL | |||||||||||||||
| Activator | 7.4266 | 132.8913 | 0 | Complete curve; high efficacy; poor fit | -5.1292 | 1.9673 | 0.5196 | 45.9316 | 178.823 | 1.3 | 0 0 0 0 0 0 1 0 0 0 0 | 46.3684 | 155.3315 | 110.8327 | 150.523 | 132.3744 | 223.2312 | 259.9272 | 370.7888 | 225.3172 | 120.4312 | 80.8278 | 46.3684 | QC'd by BIOMOL | |||||||||||||||
| Activator | 26.3506 | 64.9742 | 0 | Partial curve; high efficacy; poor fit | -4.5792 | 4.5045 | 0.7787 | 65.5932 | 130.5675 | 2.3 | 0 0 0 0 0 0 0 1 0 0 0 | 70.9665 | 137.7579 | 130.009 | 140.9582 | 142.8709 | 108.0684 | 128.1229 | 122.7238 | 83.1025 | 134.1418 | 125.1981 | 70.9665 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0.0662 | 42.9607 | 0 | Complete curve; high efficacy; poor fit | -7.1792 | 4.9549 | 0.3774 | 171.918 | 128.9573 | 1.3 | 0 0 0 0 1 0 0 0 0 0 0 | 186.2327 | 131.3763 | 114.3898 | 169.2145 | 100.0259 | 417.4076 | 185.7832 | 137.3011 | 196.8317 | 196.7498 | 128.9228 | 186.2327 | QC'd by BIOMOL | |||||||||||||||
| Activator | 20.931 | 357.0759 | 0 | Partial curve; high efficacy | -4.6792 | 1.6266 | 0.9443 | 496.1622 | 139.0863 | 2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 450.0879 | 120.9857 | 123.3915 | 150.1624 | 127.9468 | 154.6912 | 129.5912 | 127.2593 | 186.5804 | 191.2598 | 245.2113 | 450.0879 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -5.5292 | 3.1925 | 0.6838 | 22.4254 | 105.7286 | 4 | 0 0 0 0 0 1 0 0 0 0 0 | 26.5078 | 99.369 | 74.6534 | 92.2028 | 101.9959 | 99.5674 | 165.511 | 173.0397 | 87.2348 | 39.9146 | 14.0508 | 26.5078 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 4.6859 | 57.8133 | 0 | Complete curve; high efficacy; poor fit | -5.3292 | 4.9549 | 0.7192 | 154.7956 | 96.9823 | 1.3 | 0 0 0 1 0 0 0 0 0 0 0 | 156.3746 | 97.7645 | 116.0346 | 97.6905 | 140.5417 | 97.0357 | 110.7006 | 102.9928 | 57.4166 | 132.01 | 153.4092 | 156.3746 | QC'd by BIOMOL | |||||||||||||||
| Activator | 23.485 | 41.3394 | 0 | Partial curve; high efficacy; poor fit | -4.6292 | 1 | 0.5264 | 88.6415 | 129.9809 | 2.3 | 0 1 0 0 0 0 0 0 0 0 0 | 97.9229 | 133.6208 | 96.1141 | 131.6403 | 139.2531 | 128.2736 | 113.9247 | 123.5101 | 139.3218 | 112.8157 | 122.8129 | 97.9229 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 0 | 5 | 96.9812 | 124.7788 | 111.8627 | 99.1911 | 109.8132 | 115.8543 | 122.7029 | 124.9787 | 11.9636 | 106.6618 | 115.32 | 96.9812 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 5.8992 | 18.5523 | 0 | Partial curve; high efficacy; poor fit | -5.2292 | 1.5936 | 0.4036 | 98.2719 | 116.8242 | 2.3 | 0 0 0 0 0 0 0 0 0 0 1 | 112.1416 | 116.3242 | 116.0395 | 124.1925 | 105.021 | 117.4347 | 113.456 | 126.6776 | 109.8792 | 109.999 | 101.2806 | 112.1416 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0.0053 | 14 | 0 | Complete curve; high efficacy; poor fit | -8.2792 | 1.01 | 0.4672 | 116.3066 | 102.3066 | 1.3 | 0 0 0 0 0 0 0 0 0 0 0 | 115.6225 | 103.8066 | 106.9288 | 110.734 | 112.8603 | 113.7842 | 118.7801 | 117.453 | 127.3511 | 110.7768 | 108.9356 | 115.6225 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -4.7792 | 2.7202 | 0.9256 | 7.4047 | 112.2611 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 11.7612 | 91.0017 | 111.0572 | 112.5676 | 117.0089 | 126.6768 | 110.9798 | 121.4511 | 106.8272 | 107.2462 | 67.7802 | 11.7612 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 0 | 5 | 113.2428 | 112.6901 | 103.509 | 103.9003 | 102.6066 | 116.1617 | 101.937 | 105.5529 | 69.0952 | 107.2108 | 101.4004 | 113.2428 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -4.7792 | 3.132 | 0.9526 | 8.0992 | 113.0586 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 3.8949 | 109.004 | 119.742 | 107.3798 | 101.7335 | 102.3462 | 118.5813 | 117.9993 | 118.1915 | 117.6295 | 71.8786 | 3.8949 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.8792 | 1.7529 | 0.9755 | -3.302 | 111.2729 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 9.2164 | 111.826 | 113.9215 | 114.6486 | 108.2664 | 119.8515 | 109.8219 | 108.5622 | 95.889 | 98.5807 | 43.5668 | 9.2164 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 16.6261 | 24.8763 | 0 | Partial curve; high efficacy; poor fit | -4.7792 | 1.6924 | 0.3474 | 92.6528 | 117.529 | 2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 95.2635 | 108.3173 | 105.9493 | 113.7331 | 109.0795 | 117.0458 | 137.3809 | 129.6073 | 122.6355 | 108.5839 | 108.1314 | 95.2635 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 112.755 | 117.1575 | 116.8914 | 112.2579 | 112.3712 | 121.4293 | 115.3043 | 115.3089 | 107.1441 | 121.4021 | 110.4386 | 112.755 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -4.7792 | 2.1876 | 0.9885 | 10.0687 | 113.7476 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 17.4423 | 109.6122 | 112.2788 | 114.0082 | 120.8283 | 115.6809 | 111.1114 | 117.7232 | 111.2532 | 104.4167 | 66.1423 | 17.4423 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -5.5292 | 4.5045 | 0.983 | 17.5135 | 117.5997 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 12.8583 | 129.2377 | 109.7349 | 118.9217 | 115.1912 | 116.2997 | 113.6696 | 110.2515 | 109.5472 | 23.6461 | 24.0475 | 12.8583 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 18.6548 | 46.1917 | 0 | Partial curve; high efficacy; poor fit | -4.7292 | 4.5045 | 0.8247 | 65.8443 | 112.0361 | 2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 66.8775 | 99.5341 | 112.8886 | 111.9402 | 121.8966 | 115.7352 | 104.7994 | 116.4969 | 106.3102 | 117.5636 | 97.7297 | 66.8775 | QC'd by BIOMOL | |||||||||||||||
| Activator | 23.485 | 62.9557 | 0 | Partial curve; high efficacy; poor fit | -4.6292 | 4.095 | 0.8722 | 43.341 | 106.2967 | 2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 48.3003 | 107.43 | 119.6331 | 100.9738 | 99.0434 | 113.2845 | 112.3172 | 103.1487 | 97.5313 | 103.1683 | 98.0579 | 48.3003 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -6.1792 | 0.9 | 0.9914 | 13.9467 | 122.2757 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 16.0493 | 121.1837 | 125.2456 | 121.294 | 112.6383 | 110.2161 | 103.736 | 66.186 | 43.9935 | 33.7622 | 19.0904 | 16.0493 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.7292 | 2.7202 | 0.9798 | 10.0162 | 112.8615 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 12.0535 | 113.9203 | 107.621 | 117.2056 | 105.2005 | 113.2177 | 112.1472 | 115.6483 | 117.9416 | 106.7652 | 77.548 | 12.0535 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 10.4904 | 33.9355 | 0 | Complete curve; high efficacy; poor fit | -4.9792 | 4.9549 | 0.8133 | 87.1253 | 121.0609 | 1.3 | 0 0 0 0 0 0 0 0 0 0 0 | 87.3266 | 113.333 | 118.7195 | 122.2141 | 120.0529 | 128.8421 | 109.7936 | 131.8841 | 120.4381 | 122.1734 | 91.044 | 87.3266 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 106.0617 | 105.15 | 95.4872 | 110.3326 | 113.665 | 116.9489 | 116.2338 | 108.1254 | 105.7991 | 103.2361 | 100.4977 | 106.0617 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -5.9792 | 1.1 | 0.9829 | 13.8927 | 96.7448 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 17.662 | 101.5453 | 96.4145 | 90.1277 | 94.5053 | 100.6076 | 78.93 | 71.9789 | 45.249 | 27.2076 | 13.5407 | 17.662 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 0.7427 | 5.4328 | 0 | Complete curve; high efficacy; poor fit | -6.1292 | 4.9549 | 0.4642 | 117.2092 | 111.7764 | 1.3 | 0 0 0 0 0 0 0 0 0 0 1 | 111.9075 | 115.2092 | 111.9615 | 115.9844 | 108.9243 | 109.7763 | 107.7652 | 113.0327 | 118.4395 | 118.7792 | 114.168 | 111.9075 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 109.5103 | 113.4756 | 109.9484 | 115.0474 | 114.0506 | 116.6804 | 107.3915 | 105.6838 | 121.9588 | 114.747 | 114.6431 | 109.5103 | QC'd by BIOMOL |
| pKi_min | pKi_max | pIC50_min | pIC50_max | Type | Action | Reference (PubMed ID) |
|---|---|---|---|---|---|---|
| 7.2 | 7.2 | Inhibitor | Inhibition | 20817473 | ||
| 7.8 | 7.8 | Inhibitor | Inhibition | 17850214 | ||
| 9 | 9 | Inhibitor | Inhibition | 20935223 | ||
| 8.3 | 8.3 | Inhibitor | Inhibition | 14981513 | ||
| 7.2 | 7.2 | Inhibitor | Inhibition | 17125279 | ||
| 7.9 | 7.9 | Inhibitor | Inhibition | 20053775 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001529332 uM | Activity at 0.0003637214 uM | Activity at 0.0006049985 uM | Activity at 0.0007847206 uM | Activity at 0.00233 uM | Activity at 0.00410 uM | Activity at 0.00702 uM | Activity at 0.012 uM | Activity at 0.021 uM | Activity at 0.043 uM | Activity at 0.064 uM | Activity at 0.189 uM | Activity at 0.345 uM | Activity at 0.568 uM | Activity at 0.973 uM | Activity at 1.726 uM | Activity at 4.529 uM | Activity at 9.061 uM | Activity at 15.16 uM | Activity at 20.54 uM | Activity at 45.68 uM | Activity at 92.75 uM | Activity at 177.7 uM | Activity at 231.2 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6.5792 | 4.9549 | 0.3504 | -2.2299 | 14.5851 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -5.3569 | 15.4746 | 25.1469 | 1.3289 | 1.4579 | 30.0921 | 12.8619 | -9.5062 | -12.2483 | -4.4439 | 20.4415 | -5.3569 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.1405 | 59.2922 | 4.5279 | 17.637 | 13.7804 | 10.6882 | -1.5038 | -3.3709 | 4.2039 | 30.3994 | -1.9986 | 0.1405 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | -8.3292 | 4.9549 | 0.7822 | -3.2687 | 22.5 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -5.2219 | 15.9277 | 28.3896 | -3.4459 | 0.9788 | -0.6642 | -4.0601 | -8.1409 | 6.6432 | -8.9739 | -5.0251 | -5.2219 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -7.1792 | 3.0654 | 0.4254 | 9 | 32.1457 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 35.3029 | 5.2775 | 41.4344 | 33.1523 | 50.3036 | 20.2436 | 7.3329 | 9.2103 | 16.6719 | 9.4507 | 14.4231 | 35.3029 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -8.3792 | 4.9549 | 0.3583 | 0.93 | 15.5 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 19.3191 | 11.4101 | 19.1762 | -0.614 | -5.8917 | -0.0058 | 21.4835 | -3.8557 | 1.8137 | -0.8127 | -2.8224 | 19.3191 | QC'd by BIOMOL | |||||||||||||||||||
| Activator | 26.3506 | 106.3181 | 0 | Single point of activity | -4.5792 | 4.9549 | 0.9501 | 95.6321 | -10.6859 | 3 | 0 0 0 0 0 0 0 0 0 0 0 | 89.5669 | -8.1996 | -4.634 | -16.5004 | -16.3027 | -20.3551 | -20.1104 | -2.4639 | -1.956 | -4.3704 | -4.1647 | 89.5669 | QC'd by BIOMOL | ||||||||||||||||
| Inactive | 0 | -9.0292 | 4.9549 | 0.3986 | 4 | -15.1512 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 11.3272 | -9.7093 | 7.8423 | 3.3761 | 3.3993 | 12.5003 | -0.1871 | -0.4744 | -2.7008 | 3.131 | -0.5831 | 11.3272 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -4.4792 | 0.8 | 0.6034 | -34.4978 | -4 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -27.0815 | -0.6401 | -2.5148 | -2.2817 | -11.0081 | 1.0964 | -8.2348 | -11.6629 | -9.9639 | -6.098 | -9.2602 | -27.0815 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -0.5346 | 21.1593 | 8.3572 | 33.0086 | 10.5883 | 22.2102 | 40.9143 | 0.4509 | 15.3039 | 15.2483 | 15.763 | -0.5346 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | -7.3792 | 4.9549 | 0.7214 | 0.1942 | 24.8634 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 4.0666 | 15.5309 | 28.0524 | 23.0389 | 33.3812 | -2.1843 | -9.3457 | 8.1115 | 11.7564 | -7.393 | -1.8671 | 4.0666 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -29.782 | -16.4018 | -13.9219 | -14.5268 | -17.1479 | -18.8724 | 16.6048 | -0.8381 | -12.8788 | -19.3078 | -27.9636 | -29.782 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -9.6121 | -3.3856 | -4.2081 | -0.1463 | -6.8307 | -5.5043 | 3.9502 | -1.1496 | -1.2765 | -3.5332 | -1.7407 | -9.6121 | QC'd by BIOMOL | |||||||||||||||||||||||
| Activator | 0.3317 | 33.6033 | 0 | Complete curve; partial efficacy; poor fit | -6.4792 | 0.7 | 0.7143 | 30.0135 | -3.5898 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 22.2786 | -3.1933 | -2.4551 | -4.0417 | 0.0215 | 12.0732 | 5.3241 | 19.2039 | 7.3986 | 43.3559 | 28.5427 | 22.2786 | QC'd by BIOMOL | ||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -9.5858 | 0.041 | -18.5471 | 2.7931 | -0.1637 | -0.4717 | -3.0273 | -11.8154 | -12.2288 | -9.8437 | -6.1918 | -9.5858 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.5442 | 42.3006 | -2.9992 | 22.39 | 37.6161 | -4.1163 | 32.1707 | 0.342 | -5.1772 | 42.8575 | -0.9173 | 3.5442 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | -6.3792 | 4.9549 | 0.3244 | -0.642 | 10 | 4 | 0 0 0 1 0 0 0 0 0 0 1 | 5.1111 | 9.829 | 12.0079 | 3.1136 | 38.3079 | -0.5321 | 25.7035 | -1.3518 | -3.035 | -0.4212 | 4.2273 | 5.1111 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -6.8792 | 4.9549 | 0.3907 | 0.623 | 8.5 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 7.3318 | 6.6121 | -0.5158 | 8.0808 | 9.1773 | 18.9883 | -0.8974 | 4.1363 | 2.4077 | -2.3975 | -0.5411 | 7.3318 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -7.6292 | 2.2526 | 0.4672 | 6 | -9.6735 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 4.0434 | -5.2371 | -12.2279 | -11.2597 | -1.2292 | 3.2718 | -0.8651 | 26.0229 | -0.0171 | -0.6029 | 8.9518 | 4.0434 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -0.5003 | -6.9544 | 28.7797 | -7.1636 | -6.641 | 1.8449 | -16.4193 | -9.0529 | -12.5437 | -4.3363 | -10.7171 | -0.5003 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 9.9428 | -15.6543 | 18.1375 | -12.36 | -2.5628 | 16.0422 | -19.5863 | -8.3403 | -1.4148 | -7.2678 | 0.1307 | 9.9428 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001529332 uM | Activity at 0.0003637214 uM | Activity at 0.0006049985 uM | Activity at 0.0007847206 uM | Activity at 0.00233 uM | Activity at 0.00410 uM | Activity at 0.00702 uM | Activity at 0.012 uM | Activity at 0.021 uM | Activity at 0.043 uM | Activity at 0.064 uM | Activity at 0.189 uM | Activity at 0.345 uM | Activity at 0.568 uM | Activity at 0.973 uM | Activity at 1.726 uM | Activity at 4.529 uM | Activity at 9.061 uM | Activity at 15.16 uM | Activity at 20.54 uM | Activity at 45.68 uM | Activity at 92.75 uM | Activity at 177.7 uM | Activity at 231.2 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 1.177 | 177.9558 | 93 | Complete curve; high efficacy | -5.9292 | 4.4495 | 0.9941 | -184.5509 | -6.595 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -185.5575 | -4.6679 | -6.0764 | 2.0148 | -8.4168 | -11.0338 | -21.5021 | -2.901 | -155.7275 | -182.4713 | -186.415 | -185.5575 | QC'd by Toronto Research | ||||||||||||||||
| Inhibitor | 1.1471 | 185.2071 | 93 | Complete curve; high efficacy | -5.9404 | 1.21 | 0.97 | -180.9352 | 4.2719 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -177.4789 | -1.8992 | -5.8756 | 3.9529 | 36.1181 | -2.14 | -22.9111 | -15.9848 | -71.7614 | -129.8809 | -162.4978 | -177.4789 | QC'd by Selleck | ||||||||||||||||
| Inhibitor | 1.6626 | 168.1274 | 91 | Complete curve; high efficacy | -5.7792 | 3.132 | 0.9837 | -169.0446 | -0.9171 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -168.1209 | -22.0426 | -2.082 | -5.3204 | 5.5407 | 1.319 | -1.4501 | 14.7212 | -89.7232 | -163.7665 | -168.7071 | -168.1209 | QC'd by Toronto Research | ||||||||||||||||
| Inhibitor | 1.6626 | 180.9167 | 91 | Complete curve; high efficacy | -5.7792 | 3.0654 | 0.9946 | -179.0078 | 1.9089 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | -184.1644 | 24.6062 | -0.2533 | 6.7266 | -4.2589 | 5.2703 | -6.9623 | 3.8251 | -93.9542 | -164.0777 | -181.1503 | -184.1644 | QC'd by Microsource | ||||||||||||||||
| Inhibitor | 2.5119 | 207.74 | 91 | Complete curve; high efficacy | -5.6 | 1.2876 | 1 | -191.8317 | 15.9083 | -1.1 | 0 0 0 0 | -186.9705 | 0.1857 | -67.9483 | -158.9713 | -186.9705 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 2.6351 | 194.9538 | 90 | Complete curve; high efficacy | -5.5792 | 3.132 | 0.9719 | -181.5277 | 13.4261 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -182.0412 | -10.1591 | -4.3271 | 41.7265 | 2.8061 | 30.912 | 14.2918 | 18.2215 | -27.3816 | -157.9177 | -180.8355 | -182.0412 | QC'd by Microsource | ||||||||||||||||
| Inhibitor | 2.6351 | 187.8571 | 90 | Complete curve; high efficacy | -5.5792 | 1.9673 | 0.9892 | -184.816 | 3.0411 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -185.5582 | -11.9648 | 9.2141 | -3.27 | 11.0994 | 17.1828 | -3.5684 | -6.2672 | -52.0668 | -151.5101 | -173.32 | -185.5582 | QC'd by NCGCChem | ||||||||||||||||
| Inhibitor | 1.049 | 135.3045 | 90 | Complete curve; high efficacy | -5.9792 | 1.21 | 0.9819 | -141.7236 | -6.4191 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -147.6287 | -12.4793 | -9.977 | -7.7012 | -7.9502 | -2.9377 | -8.1662 | -64.6761 | -88.8563 | -120.3966 | -133.137 | -147.6287 | QC'd by SantaCruz Bio | ||||||||||||||||
| Inhibitor | 2.8184 | 216.3846 | 90 | Complete curve; high efficacy | -5.55 | 1.6924 | 0.9997 | -186.2959 | 30.0887 | -1.1 | 0 0 0 0 | -182.6431 | 24.865 | -42.6314 | -161.1067 | -182.6431 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 2.3485 | 163.714 | 89 | Complete curve; high efficacy | -5.6292 | 2.2526 | 0.9797 | -163.714 | 0 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -160.5039 | -3.8215 | -6.7268 | -7.2153 | 21.4522 | 3.6974 | -17.7659 | -0.4266 | -46.4433 | -147.1554 | -160.0245 | -160.5039 | QC'd by Chemscene | ||||||||||||||||
| Inhibitor | 2.6351 | 163.4895 | 89 | Complete curve; high efficacy | -5.5792 | 2.9023 | 0.9893 | -160.8371 | 2.6524 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -164.4551 | -6.4389 | 12.3743 | 8.8055 | 8.3741 | 8.3794 | -11.7519 | -4.8192 | -29.5494 | -138.8745 | -157.2471 | -164.4551 | QC'd by NCGCChem | ||||||||||||||||
| Inhibitor | 4.6859 | 191.4425 | 87 | Complete curve; high efficacy | -5.3292 | 3.132 | 0.9826 | -168.3143 | 23.1281 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -166.8767 | 18.2901 | 14.4046 | 9.0452 | 34.109 | 42.8357 | 21.6911 | 10.3813 | 25.2215 | -83.459 | -167.42 | -166.8767 | QC'd by Selleck | ||||||||||||||||
| Inhibitor | 4.6859 | 162.9612 | 87 | Complete curve; high efficacy | -5.3292 | 2.2481 | 0.9856 | -169.2903 | -6.3291 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -177.4531 | -11.7541 | 3.3773 | -4.3533 | -18.2902 | -11.7259 | -2.3524 | -8.7407 | -13.4287 | -99.7645 | -147.5191 | -177.4531 | QC'd by XcessBio | ||||||||||||||||
| Inhibitor | 3.7221 | 126.7841 | 86 | Complete curve; high efficacy | -5.4292 | 1.4641 | 0.957 | -135.7206 | -8.9365 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -142.2647 | -0.6771 | -6.2358 | -11.2121 | -16.6768 | -27.3011 | -0.3514 | -8.3109 | -35.4059 | -95.2772 | -106.0275 | -142.2647 | QC'd by Toronto Research | ||||||||||||||||
| Inhibitor | 9.3495 | 220.0109 | 85 | Complete curve; high efficacy | -5.0292 | 2.3332 | 0.9927 | -186.755 | 33.2559 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -173.5087 | 27.1661 | 26.0463 | 40.0162 | 35.5618 | 41.0454 | 34.7298 | 24.2825 | 29.7949 | -6.87 | -142.7818 | -173.5087 | QC'd by Selleck | ||||||||||||||||
| Inhibitor | 10 | 130.3003 | 84 | Complete curve; high efficacy | -5 | 2.7868 | 0.9985 | -148.0456 | -17.7453 | -1.1 | 0 0 0 0 | -146.7041 | -67.4842 | -127.8599 | -147.7501 | -146.7041 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 10 | 145.2603 | 84 | Complete curve; high efficacy | -5 | 1.7885 | 0.9997 | -161.3387 | -16.0784 | -1.1 | 0 0 0 0 | -152.7828 | -41.646 | -82.1916 | -129.7354 | -152.7828 | QC'd by GVK | |||||||||||||||||||||||
| Inhibitor | 3.1623 | 82.1469 | 84 | Complete curve; high efficacy | -5.5 | 2.1876 | 1 | -81.0655 | 1.0814 | -1.1 | 0 0 0 0 | -79.882 | -22.1789 | -55.8956 | -75.2948 | -79.882 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 10 | 127.8972 | 83 | Complete curve; high efficacy | -5 | 1.6259 | 0.9999 | -122.4842 | 5.4131 | -1.1 | 0 0 0 0 | -119.3803 | -48.5016 | -88.2414 | -110.9773 | -119.3803 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 9.3495 | 66.4535 | 82 | Complete curve; high efficacy | -5.0292 | 2.2526 | 0.9036 | -65.8754 | 0.5781 | -1.1 | 0 0 0 0 0 0 1 0 0 0 0 | -62.9964 | -8.1444 | 9.5224 | 4.2202 | 2.8496 | 11.2227 | -15.5853 | 28.5669 | -1.4504 | -13.5243 | -50.6989 | -62.9964 | QC'd by Toronto Research |
| pKi_min | pKi_max | pKd_min | pKd_max | pIC50_min | pIC50_max | Type | Action | Reference (PubMed ID) |
|---|---|---|---|---|---|---|---|---|
| 7.3 | 7.3 | Inhibitor | Inhibition | 20817473 | ||||
| 8.1 | 8.1 | Inhibitor | Inhibition | 16451062 | ||||
| 7 | 7 | Inhibitor | Inhibition | 12719470 | ||||
| 8.1 | 8.1 | Inhibitor | Inhibition | 22935731 | ||||
| 5.9 | 5.9 | Inhibitor | Inhibition | 18077363 | ||||
| 7.3 | 8.1 | Inhibitor | Inhibition | 22695126 | ||||
| 8.4 | 8.4 | Inhibitor | Inhibition | 20935223 | ||||
| 5.5 | 5.5 | Inhibitor | Inhibition | 19402633 | ||||
| 7.7 | 7.7 | Inhibitor | Inhibition | 14981513 | ||||
| 7.3 | 7.3 | Inhibitor | Inhibition | 19541823 | ||||
| 8.3 | 8.3 | 9 | 9 | Inhibitor | Inhibition | 19320489,22037378 | ||
| 8 | 8 | Inhibitor | Inhibition | 19402633 | ||||
| 5.5 | 5.5 | Inhibitor | Inhibition | 21341675 | ||||
| 8.6 | 8.6 | Inhibitor | Inhibition | 23256033 | ||||
| 9.4 | 9.4 | Inhibitor | Inhibition | 17495131 | ||||
| 7.9 | 7.9 | Inhibitor | Inhibition | 22247788 | ||||
| 7.7 | 7.7 | Inhibitor | Inhibition | 17850214 | ||||
| 6.6 | 6.6 | Inhibitor | Inhibition | 12707311 | ||||
| 7.1 | 7.1 | Inhibitor | Inhibition | 17125279 | ||||
| 7.9 | 7.9 | Inhibitor | Inhibition | 20855207 |
| pKi_min | pKi_max | pKd_min | pKd_max | pIC50_min | pIC50_max | Type | Action | Reference (PubMed ID) |
|---|---|---|---|---|---|---|---|---|
| 6.3 | 6.3 | Inhibitor | Inhibition | 20420387 | ||||
| 7.7 | 7.7 | Inhibitor | Inhibition | 20817473 | ||||
| 8.5 | 8.5 | Inhibitor | Inhibition | 19143567 | ||||
| 9 | 9 | Inhibitor | Inhibition | 16451062 | ||||
| 7 | 7 | Inhibitor | Inhibition | 12719470 | ||||
| 8.3 | 8.3 | Inhibitor | Inhibition | 21903390 | ||||
| 9.2 | 9.2 | 8.4 | 8.4 | Inhibitor | Inhibition | 22037378,14981513 | ||
| 7.3 | 7.3 | Inhibitor | Inhibition | 19541823 | ||||
| 9 | 9 | Inhibitor | Inhibition | 19320489 | ||||
| 8.2 | 8.2 | 8.4 | 9 | Inhibitor | Inhibition | 17360485,22037378,19402633 | ||
| 5 | 5 | Inhibitor | Inhibition | 21341675 | ||||
| 7.4 | 7.4 | Inhibitor | Inhibition | 17157005 | ||||
| 10.2 | 10.2 | Inhibitor | Inhibition | 20053775 | ||||
| 5.9 | 5.9 | Inhibitor | Inhibition | 17495131 | ||||
| 8.5 | 8.5 | Inhibitor | Inhibition | 22247788 | ||||
| 7.9 | 7.9 | Inhibitor | Inhibition | 17125279 | ||||
| 7 | 7 | Inhibitor | Inhibition | 18945615 | ||||
| 8.4 | 8.4 | Inhibitor | Inhibition | 20855207 | ||||
| 7.8 | 7.8 | Inhibitor | Inhibition | 19320489 | ||||
| 6.9 | 6.9 | Inhibitor | Inhibition | 22935731 |
| Standard Type | Standard Relation | Standard Value | Standard Units |
|---|---|---|---|
| Inhibition | = | 0.24 | % |
| Inhibition | = | 4.58 | % |
| Inhibition | = | -0.3 | % |
| Inhibition | = | -0.3 | % |
| Inhibition | = | -0.04 | % |
| Inhibition | = | -0.04 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | 0.03 | % |
| Inhibition | = | 0 | % |
| Inhibition | = | 0.03 | % |
| Inhibition | = | 0 | % |
| Inhibition | = | -0.27 | % |
| Inhibition | = | -0.27 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | 14.41 | % |
| Inhibition | = | 0.39 | % |
| Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|
| Delta TM | = | -0.03532 | C | Thermal Shift Assay |
| Delta TM | = | -0.09791 | C | Thermal Shift Assay |
| Delta TM | = | -0.72 | C | |
| Delta TM | = | 0.39 | C | Thermal Shift Assay |
| Delta TM | = | 0.6544 | C | Thermal Shift Assay |
| Delta TM | = | 0.01068 | C | Thermal Shift Assay |
| Delta TM | = | 0.05 | C | Thermal Shift Assay |
| Delta TM | = | 0.3911 | C | Thermal Shift Assay |
| Delta TM | = | -0.1368 | C | Thermal Shift Assay |
| Delta TM | = | 0.38 | C | |
| Delta TM | = | 0.18 | C | Thermal Shift Assay |
| Delta TM | = | 0.02 | C | Thermal Shift Assay |
| Delta TM | = | 0.24 | C | Thermal Shift Assay |
| Delta TM | = | -0.1886 | C | Thermal Shift Assay |
| Delta TM | = | -0.3286 | C | Thermal Shift Assay |
| Delta TM | = | -0.9406 | C | Thermal Shift Assay |
| Delta TM | = | -0.6238 | C | Thermal Shift Assay |
| Delta TM | = | 0.17 | C | Thermal Shift Assay |
| Delta TM | = | 0.35 | C | Thermal Shift Assay |
| Delta TM | = | 0.08 | C | Thermal Shift Assay |
| CAS | Cell_line | rucaparib_conc | compound_conc | normalized_percent_viability | compound_name | SMILES |
|---|---|---|---|---|---|---|
| 387867-13-2 | OCI-C5x | 0 | 1.95E-8 | 98.44581603 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 0 | 7.81E-8 | 105.4182649 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 0 | 3.05E-10 | 103.4653304 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 0 | 1.25E-6 | 116.6830792 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-P5x | 0 | 5.0E-6 | 86.18167609 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-P5x | 2.0E-5 | 3.13E-7 | 146.2440526 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-P5x | 2.0E-5 | 7.81E-8 | 115.2946934 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 1.0E-5 | 4.88E-9 | 111.5049869 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 171235-71-5 | OCI-C5x | 0 | 1.22E-9 | 110.3190489 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 2.0E-5 | 3.13E-7 | 91.298805 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 2.0E-5 | 7.81E-8 | 90.00294196 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 5.0E-6 | 88.26242556 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 0 | 3.05E-10 | 119.5103986 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 3.13E-7 | 92.31053176 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 7.81E-8 | 92.60337348 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 1.95E-8 | 99.98664107 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 1.25E-6 | 86.03710969 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 1.0E-5 | 5.0E-6 | 112.1402411 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 1.0E-5 | 1.25E-6 | 134.2448013 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 1.0E-5 | 3.13E-7 | 113.9128147 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| Standard Type | Activity Comment |
|---|---|
| Activity | Non-Toxic |
| Activity | Non-Toxic |
| TotalNuclei_24h_A | %Pos_24h_A | TotalNuclei_24h_B | %Pos_24h_B | TotalNuclei_48h_A | %Pos_48h_A | TotalNuclei_48h_B | %Pos_48h_B | TotalNuclei_Norm_A_24h | %Pos_Norm_A_24h | TotalNuclei_Norm_B_24h | %Pos_Norm_B_24h | TotalNuclei_Norm_A_48h | %Pos_Norm_A_48h | TotalNuclei_Norm_B_48h | %Pos_Norm_B_48h | Avg_TotalNuclei_Norm_24h | Avg_%Pos_Norm_24h | Avg_TotalNuclei_Norm_48h | Avg_%Pos_Norm_48h | Viability 24h | Viability 48h | Hit 24h | Hit 48h | Molar Concentration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1208 | 0.166 | 1233 | 0.324 | 1534 | 0.0652 | 1567 | 0.128 | 107.5241301 | 0.014207932 | 114.2526206 | 0.301056209 | 111.5408212 | -0.200936304 | 115.8595194 | -0.078440722 | 110.8883753 | 0.15763207 | 113.7001703 | -0.139688513 | High | High | Low | Low | 123 uM |
| 1278 | 0.0782 | 1173 | 0.341 | 1644 | 0.304 | 1525 | 0.262 | 113.754833 | -0.105094533 | 108.6928824 | 0.324276435 | 119.5391852 | 0.073652809 | 112.754159 | 0.076453966 | 111.2238577 | 0.109590951 | 116.1466721 | 0.075053388 | High | High | Low | Low | 41 uM |
| 1191 | 0.336 | 1251 | 0.24 | 1484 | 0.135 | 1553 | 0.258 | 106.0109594 | 0.245203592 | 115.9205421 | 0.186320973 | 107.9052012 | -0.120675332 | 114.8243993 | 0.071830244 | 110.9657507 | 0.215762282 | 111.3648002 | -0.024422544 | High | High | Low | Low | 13.7 uM |
| 1235 | 0.081 | 1129 | 0 | 1539 | 0.065 | 1463 | 0.273 | 109.9274012 | -0.101289898 | 104.615741 | -0.141493985 | 111.9043832 | -0.201166278 | 108.1700555 | 0.089169202 | 107.2715711 | -0.121391942 | 110.0372193 | -0.055998538 | High | High | Low | Low | 4.6 uM |
| 1274 | 0.0785 | 1127 | 0.177 | 1643 | 0.365 | 1410 | 0.213 | 113.3987928 | -0.104686893 | 104.4304164 | 0.100269547 | 119.4664728 | 0.143794919 | 104.2513863 | 0.019813371 | 108.9146046 | -0.002208673 | 111.8589295 | 0.081804145 | High | High | Low | Low | 1.5 uM |
| 1212 | 0 | 1184 | 0 | 1575 | 0 | 1383 | 0.0723 | 107.8801702 | -0.211352536 | 109.7121677 | -0.141493985 | 114.5220296 | -0.27590787 | 102.2550832 | -0.142826051 | 108.796169 | -0.176423261 | 108.3885564 | -0.209366961 | High | High | Low | Low | 500 nM |
| 1232 | 0 | 1268 | 0 | 1361 | 0.0735 | 1411 | 0.142 | 109.6603711 | -0.211352536 | 117.4958012 | -0.141493985 | 98.96157604 | -0.191392377 | 104.3253235 | -0.062257695 | 113.5780861 | -0.176423261 | 101.6434498 | -0.126825036 | High | High | Low | Low | 10 mM |
| 1145 | 0.0873 | 1164 | 0.258 | 1473 | 0.0679 | 1479 | 0.203 | 101.9164975 | -0.092729471 | 107.8589216 | 0.210907095 | 107.1053648 | -0.197831653 | 109.3530499 | 0.008254066 | 104.8877095 | 0.059088812 | 108.2292074 | -0.094788793 | High | High | Low | Low | 3.333 mM |
| 1374 | 0.291 | 1147 | 0.0872 | 1603 | 0.374 | 1447 | 0.0691 | 122.2997969 | 0.184057682 | 106.2836625 | -0.022387884 | 116.5579768 | 0.154143755 | 106.987061 | -0.146525029 | 114.2917297 | 0.080834899 | 111.7725189 | 0.003809363 | High | High | Low | Low | 1.111 mM |
| 1208 | 0.166 | 1215 | 0 | 1445 | 0.138 | 1552 | 0.0644 | 107.5241301 | 0.014207932 | 112.5846991 | -0.141493985 | 105.0694176 | -0.11722572 | 114.7504621 | -0.151957902 | 110.0544146 | -0.063643027 | 109.9099399 | -0.134591811 | High | High | Low | Low | 370 uM |
| 1127 | 0.177 | 1208 | 0.248 | 1448 | 0.207 | 1355 | 0.221 | 100.3143167 | 0.02915471 | 111.936063 | 0.197248139 | 105.2875548 | -0.037884645 | 100.1848429 | 0.029060815 | 106.1251899 | 0.113201424 | 102.7361989 | -0.004411915 | High | High | Low | Low | 123 uM |
| 1264 | 0.0791 | 1133 | 0.0883 | 1421 | 0.493 | 1365 | 0.147 | 112.5086924 | -0.103871615 | 104.9863902 | -0.020885398 | 103.32432 | 0.290978363 | 100.9242144 | -0.056478042 | 108.7475413 | -0.062378506 | 102.1242672 | 0.11725016 | High | High | Low | Low | 41 uM |
| 1316 | 0.076 | 1210 | 0 | 1570 | 0.318 | 1472 | 0.204 | 117.1372145 | -0.108083888 | 112.1213876 | -0.141493985 | 114.1584676 | 0.089750998 | 108.8354898 | 0.009409997 | 114.6293011 | -0.124788937 | 111.4969787 | 0.049580497 | High | High | Low | Low | 13.7 uM |
| 1347 | 0.148 | 1270 | 0.0787 | 1558 | 0.257 | 1546 | 0.259 | 119.8965258 | -0.010250432 | 117.6811258 | -0.033997997 | 113.2859188 | 0.019608888 | 114.3068392 | 0.072986175 | 118.7888258 | -0.022124215 | 113.796379 | 0.046297531 | High | High | Low | Low | 4.6 uM |
| 1211 | 0.165 | 1181 | 0.339 | 1480 | 0.27 | 1451 | 0.276 | 107.7911602 | 0.012849134 | 109.4341808 | 0.321544644 | 107.6143516 | 0.034557207 | 107.2828096 | 0.092636994 | 108.6126705 | 0.167196889 | 107.4485806 | 0.0635971 | High | High | Low | Low | 1.5 uM |
| 1192 | 0.0839 | 1269 | 0.0788 | 1480 | 0.27 | 1536 | 0.13 | 106.0999694 | -0.097349384 | 117.5884635 | -0.033861407 | 107.6143516 | 0.034557207 | 113.5674677 | -0.076128861 | 111.8442165 | -0.065605396 | 110.5909096 | -0.020785827 | High | High | Low | Low | 500 nM |
| 1241 | 0 | 1168 | 0.171 | 1489 | 0.269 | 1469 | 0.136 | 110.4614614 | -0.211352536 | 108.2295709 | 0.092074173 | 108.2687632 | 0.033407336 | 108.6136784 | -0.069193278 | 109.3455161 | -0.059639182 | 108.4412208 | -0.017892971 | High | High | Low | Low | 10 mM |
| 1139 | 0.0878 | 1049 | 0 | 1346 | 0.297 | 1327 | 0.226 | 101.3824372 | -0.092050072 | 97.2027567 | -0.141493985 | 97.87089005 | 0.065603714 | 98.11460259 | 0.034840468 | 99.29259695 | -0.116772029 | 97.99274632 | 0.050222091 | High | High | Low | Low | 3.333 mM |
| 1189 | 0.0841 | 1149 | 0.087 | 1470 | 0.34 | 1403 | 0.214 | 105.8329393 | -0.097077625 | 106.4689871 | -0.022661063 | 106.8872276 | 0.115048152 | 103.7338262 | 0.020969302 | 106.1509632 | -0.059869344 | 105.3105269 | 0.068008727 | High | High | Low | Low | 1.111 mM |
| 1239 | 0 | 1133 | 0.265 | 1476 | 0.203 | 1391 | 0.431 | 110.2834414 | -0.211352536 | 104.9863902 | 0.220468365 | 107.323502 | -0.042484127 | 102.8465804 | 0.271806223 | 107.6349158 | 0.004557914 | 105.0850412 | 0.114661048 | High | High | Low | Low | 370 uM |
| Standard Type | Activity Comment |
|---|---|
| Activity | Active |
| Activity | Active |
| Luminescence_A_48H | Luminescence_B_48H | Luminescence_A_72H | Luminescence_B_72H | MELAS Plate 1 Z-score | MELAS Plate 2 Z-score | Rieske Plate 1 Z-score | Rieske Plate 2 Z-score | MELAS Z-score | Rieske Z-score | Positive Type |
|---|---|---|---|---|---|---|---|---|---|---|
| 165158 | 155927 | 170154 | 247648 | -0.91114795 | -0.750334054 | -0.604348285 | 0.41730416 | -0.830741002 | -0.093522062 | |
| 472324 | 375710 | 159329 | 108347 | 0.313893621 | 0.271403418 | -0.708077714 | -1.033704551 | 0.29264852 | -0.870891132 | |
| 501171 | 341374 | 180003 | 171286 | 0.428941427 | 0.111780618 | -0.509971274 | -0.378109564 | 0.270361022 | -0.444040419 | |
| 169870 | 144188 | 272757 | 235867 | -0.892355519 | -0.804906865 | 0.378834218 | 0.294589079 | -0.848631192 | 0.336711648 | |
| 98016 | 62719 | 154247 | 123580 | -1.17892414 | -1.183643756 | -0.756775447 | -0.87503221 | -1.181283948 | -0.815903829 | |
| 308171 | 142888 | 171447 | 189029 | -0.340782511 | -0.810950366 | -0.591958248 | -0.193292171 | -0.575866439 | -0.39262521 | |
| 452693 | 140371 | 108829 | 81089 | 0.235601131 | -0.822651513 | -1.191988676 | -1.317633564 | -0.293525191 | -1.25481112 | |
| 510478 | 389336 | 244397 | 68444 | 0.466059669 | 0.334748603 | 0.107077488 | -1.449348377 | 0.400404136 | -0.671135444 | |
| 497826 | 445194 | 163998 | 139340 | 0.415600875 | 0.594423881 | -0.663337511 | -0.71087045 | 0.505012378 | -0.687103981 | |
| 469027 | 415864 | 153242 | 186799 | 0.300744503 | 0.458073208 | -0.766405754 | -0.216520644 | 0.379408855 | -0.491463199 | |
| 512832 | 270806 | 216462 | 282011 | 0.475447908 | -0.216279195 | -0.160606724 | 0.775241378 | 0.129584356 | 0.307317327 | |
| 475733 | 225262 | 573472 | 467191 | 0.327489419 | -0.428006269 | 3.260404217 | 2.704142054 | -0.050258425 | 2.982273136 | Rieske |
| 508714 | 382882 | 212542 | 309826 | 0.459024472 | 0.304744946 | -0.198169714 | 1.064972301 | 0.381884709 | 0.433401293 | |
| 410000 | 370715 | 313485 | 300966 | 0.065332612 | 0.248182429 | 0.769106014 | 0.972683393 | 0.156757521 | 0.870894703 | |
| 267003 | 116383 | 227782 | 90794 | -0.504969015 | -0.934168047 | -0.05213401 | -1.216542835 | -0.719568531 | -0.634338423 | |
| 385587 | 111421 | 112292 | 108485 | -0.032031483 | -0.957235625 | -1.158804841 | -1.032267094 | -0.494633554 | -1.095535968 | |
| 205007 | 459679 | 137445 | 123652 | -0.752221892 | 0.661762425 | -0.917778853 | -0.874282233 | -0.045229733 | -0.896030543 | |
| 272034 | 316037 | 136675 | 182553 | -0.484904345 | -0.006007211 | -0.925157297 | -0.260748488 | -0.245455778 | -0.592952893 | |
| 339662 | 259651 | 116664 | 155263 | -0.215189887 | -0.26813708 | -1.116910609 | -0.545010825 | -0.241663483 | -0.830960717 | |
| 329885 | 204630 | 182799 | 151543 | -0.254182586 | -0.523921274 | -0.483178897 | -0.583759667 | -0.38905193 | -0.533469282 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000259387 uM | Activity at 0.0000710850 uM | Activity at 0.0001271514 uM | Activity at 0.0003024044 uM | Activity at 0.0005030064 uM | Activity at 0.0006524306 uM | Activity at 0.00193 uM | Activity at 0.00341 uM | Activity at 0.00584 uM | Activity at 0.010 uM | Activity at 0.018 uM | Activity at 0.052 uM | Activity at 0.078 uM | Activity at 0.156 uM | Activity at 0.276 uM | Activity at 0.478 uM | Activity at 0.883 uM | Activity at 1.507 uM | Activity at 3.884 uM | Activity at 7.354 uM | Activity at 12.96 uM | Activity at 21.63 uM | Activity at 38.41 uM | Activity at 76.33 uM | Activity at 137.0 uM | Activity at 204.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 1 | 104.9664 | 88 | Complete curve; high efficacy | -6 | 3.5117 | 0.6658 | -104.9664 | 0 | -1.1 | 0 0 0 | -97.13 | -85.6484 | -112.8671 | -97.13 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 0.3162 | 59.3278 | 88 | Complete curve; high efficacy | -6.5 | 0.8 | 1 | -84.7193 | -25.3915 | -1.1 | 0 0 0 | -83.9327 | -75.7429 | -81.922 | -83.9327 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inhibitor | 3.1623 | 20.4987 | 85 | Complete curve; high efficacy | -5.5 | 4.9549 | 0.4756 | -107.8212 | -87.3224 | -1.1 | 0 0 0 | -101.1849 | -96.9354 | -114.4343 | -101.1849 | QC'd by SIGMA | ||||||||||||||||||||||||
| Inhibitor | 0.7492 | 66.1511 | 66 | Complete curve; partial efficacy | -6.1254 | 1 | 0.8229 | -74.6135 | -8.4624 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | -67.099 | -7.8787 | -22.7216 | -1.4525 | -29.6562 | -23.5194 | -8.332 | -25.0891 | -62.4832 | -68.6466 | -63.9027 | -67.099 | QC'd by Microsource | ||||||||||||||||
| Inhibitor | 1 | 21.6845 | 66 | Complete curve; partial efficacy | -6 | 4.9549 | 0.9699 | -77.7873 | -56.1028 | -1.2 | 0 0 0 | -76.43 | -65.0857 | -78.9894 | -76.43 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inhibitor | 1.122 | 59.6758 | 65 | Complete curve; partial efficacy | -5.95 | 1.21 | 0.9999 | -66.8495 | -7.1736 | -1.2 | 0 0 0 | -66.096 | -42.6313 | -61.4055 | -66.096 | QC'd by Vitas | ||||||||||||||||||||||||
| Inhibitor | 1.9953 | 34.0263 | 64 | Complete curve; partial efficacy | -5.7 | 4.9549 | 0.9891 | -73.9118 | -39.8855 | -1.2 | 0 0 0 | -72.1972 | -47.1162 | -75.3813 | -72.1972 | QC'd by SigmaAldrich | ||||||||||||||||||||||||
| Inhibitor | 12.5893 | 37.2665 | 62 | Complete curve; partial efficacy | -4.9 | 1 | 1 | -78.1117 | -40.8452 | -1.2 | 0 0 0 | -68.8431 | -44.9463 | -54.9089 | -68.8431 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 14.1254 | 32.4297 | 62 | Complete curve; partial efficacy | -4.85 | 1.2216 | 0.9999 | -88.7022 | -56.2725 | -1.2 | 0 0 0 | -81.3177 | -58.1227 | -66.7029 | -81.3177 | QC'd by Enzo | ||||||||||||||||||||||||
| Inhibitor | 10 | 29.8983 | 62 | Complete curve; partial efficacy | -5 | 3.2975 | 0.9999 | -76.1051 | -46.2067 | -1.2 | 0 0 0 | -75.9694 | -46.234 | -54.866 | -75.9694 | QC'd by Microsource | ||||||||||||||||||||||||
| Inhibitor | 11.2202 | 26.8497 | 61 | Complete curve; partial efficacy | -4.95 | 4.095 | 0.9996 | -65.1082 | -38.2585 | -1.2 | 0 0 0 | -65.0072 | -38.2023 | -43.2866 | -65.0072 | QC'd by SigmaAldrich | ||||||||||||||||||||||||
| Inhibitor | 25.1189 | 45.7844 | 61 | Complete curve; partial efficacy | -4.6 | 1.5386 | 1 | -101.459 | -55.6745 | -1.2 | 0 0 0 | -85.8367 | -56.2934 | -62.0903 | -85.8367 | QC'd by SigmaAldrich | ||||||||||||||||||||||||
| Inhibitor | 31.6228 | 32.298 | 60 | Complete curve; partial efficacy | -4.5 | 2.1876 | 0.9999 | -141.8428 | -109.5448 | -1.2 | 0 0 0 | -129.0357 | -109.6207 | -111.066 | -129.0357 | QC'd by Microsource | ||||||||||||||||||||||||
| Inhibitor | 31.6228 | 35.9772 | 60 | Complete curve; partial efficacy | -4.5 | 1.1 | 0.9999 | -99.0432 | -63.0659 | -1.2 | 0 0 0 | -82.9526 | -64.2216 | -69.1965 | -82.9526 | QC'd by Microsource | ||||||||||||||||||||||||
| Inhibitor | 35.4813 | 37.6242 | 60 | Complete curve; partial efficacy | -4.45 | 4.9549 | 0.9762 | -81.2779 | -43.6537 | -1.2 | 0 0 0 | -66.0936 | -45.7944 | -41.8015 | -66.0936 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 35.4813 | 50.1885 | 60 | Complete curve; partial efficacy | -4.45 | 4.4495 | 0.9982 | -87.6877 | -37.4992 | -1.2 | 0 0 0 | -66.8089 | -38.2236 | -36.8414 | -66.8089 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inhibitor | 35.4813 | 47.3405 | 60 | Complete curve; partial efficacy | -4.45 | 4.9549 | 0.9906 | -107.1544 | -59.8139 | -1.2 | 0 0 0 | -87.9757 | -61.3159 | -58.1701 | -87.9757 | QC'd by Prestwick Chemical; Inc. | ||||||||||||||||||||||||
| Inhibitor | 5.9508 | 124.6251 | 45 | Partial curve; high efficacy | -5.2254 | 2.7202 | 0.864 | -126.7319 | -2.1068 | -2.1 | 0 0 0 0 0 0 0 0 0 0 1 | 0 | 0 | 0 | -13.748 | -1.3723 | -25.9483 | -11.2825 | 26.6518 | 8.4521 | -36.83 | -113.8031 | 0 | QC'd by ChemAxon | ||||||||||||||||
| Inhibitor | 11.8734 | 89.5441 | 42 | Partial curve; partial efficacy | -4.9254 | 1.2475 | 0.9863 | -91.1278 | -1.5837 | -2.2 | 0 0 0 0 0 1 0 0 0 0 0 | -74.7046 | 0 | 0 | 0 | -4.6868 | -8.0974 | -38.1516 | 1.1319 | -8.2196 | -21.8072 | -47.3218 | -74.7046 | QC'd by Cayman | ||||||||||||||||
| Inhibitor | 25.1189 | 267.3838 | 41 | Partial curve; partial efficacy | -4.6 | 4.9549 | 0.8835 | -100.7065 | 166.6773 | -2.2 | 0 0 0 | -71.9482 | 116.4983 | 215.4265 | -71.9482 | QC'd by Tocris |
| Phenotype | Analysis Comment | Activity_Score | Max_Response | Activity at 0.029 uM | Activity at 0.115 uM | Activity at 0.144 uM | Activity at 0.230 uM | Activity at 0.575 uM | Activity at 1.257 uM | Activity at 2.059 uM | Activity at 2.870 uM | Activity at 3.790 uM | Activity at 5.750 uM | Activity at 7.911 uM | Activity at 11.54 uM | Activity at 17.22 uM | Activity at 25.95 uM | Activity at 38.35 uM | Activity at 57.50 uM | Activity at 85.10 uM | Activity at 115.2 uM | Activity at 153.0 uM | Activity at 245.0 uM | Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -0.96 | 3.5361 | -0.96 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9559 | -3.6852 | -0.9559 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9553 | -5.7534 | -0.9553 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9545 | -5.6084 | -0.9545 | QC'd by ChemRoutes | ||||||||||||||||||||
| Inactive | 0 | -0.953 | -2.3216 | -0.953 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9492 | 2.2186 | -0.9492 | QC'd by Edelris | ||||||||||||||||||||
| Inactive | 0 | -0.9486 | -1.2758 | -0.9486 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9467 | 4.4666 | -0.9467 | QC'd by ChemRoutes | ||||||||||||||||||||
| Inactive | 0 | -0.9436 | -8.9932 | -0.9436 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9422 | -1.7826 | -0.9422 | QC'd by Analyticon | ||||||||||||||||||||
| Inactive | 0 | -0.941 | 5.2115 | -0.941 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9398 | 4.3972 | -0.9398 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9362 | 4.3836 | -0.9362 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9299 | 2.8643 | -0.9299 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9293 | 4.8772 | -0.9293 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9286 | -10.0521 | -0.9286 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9253 | -2.1742 | -0.9253 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9204 | 0.4163 | -0.9204 | QC'd by Edelris | ||||||||||||||||||||
| Inactive | 0 | -0.9193 | -0.0183 | -0.9193 | QC'd by Analyticon | ||||||||||||||||||||
| Inactive | 0 | -0.9182 | -0.8109 | -0.9182 | QC'd by Analyticon |
| Phenotype | Potency | Efficacy | Analysis Comment | FF-overN-Activity_Score | FF-overN-Curve_Description | FF-overN-Fit_LogAC50 | FF-overN-Fit_HillSlope | FF-overN-Fit_R2 | FF-overN-Fit_InfiniteActivity | FF-overN-Fit_ZeroActivity | FF-overN-Fit_CurveClass | FF-overN-Excluded_Points | FF-overN-Max_Response | FF-overN-Activity at 0.0000389080 uM | FF-overN-Activity at 0.0001066275 uM | FF-overN-Activity at 0.0001907270 uM | FF-overN-Activity at 0.0004536066 uM | FF-overN-Activity at 0.0007545096 uM | FF-overN-Activity at 0.0009786459 uM | FF-overN-Activity at 0.00290 uM | FF-overN-Activity at 0.00503 uM | FF-overN-Activity at 0.00876 uM | FF-overN-Activity at 0.015 uM | FF-overN-Activity at 0.026 uM | FF-overN-Activity at 0.052 uM | FF-overN-Activity at 0.080 uM | FF-overN-Activity at 0.235 uM | FF-overN-Activity at 0.459 uM | FF-overN-Activity at 0.740 uM | FF-overN-Activity at 1.165 uM | FF-overN-Activity at 2.228 uM | FF-overN-Activity at 5.999 uM | FF-overN-Activity at 11.47 uM | FF-overN-Activity at 19.13 uM | FF-overN-Activity at 25.10 uM | FF-overN-Activity at 57.49 uM | FF-overN-Activity at 115.7 uM | FF-overN-Activity at 221.8 uM | FF-overN-Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | -8.5233 | -2.8988 | -12.5908 | -2.7412 | -8.5233 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.3 | 4.9549 | 0.5242 | -0.0894 | -10.9265 | 4 | 0 0 0 0 | -0.0745 | -3.5393 | -17.8554 | -0.1186 | -0.0745 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.5515 | -1.0417 | -4.8967 | 0.166 | -2.5515 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.25 | 2.6384 | 0.9993 | 6 | -4.4279 | 4 | 0 0 0 0 | 5.847 | -4.5232 | -4.121 | 4.7547 | 5.847 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.2043 | 0.5279 | -0.6989 | -3.0106 | 0.2043 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -20.4584 | -16.0227 | -10.542 | -12.7 | -20.4584 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.3811 | 1.9328 | 2.0137 | 3.5425 | 0.3811 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.6 | 1.8617 | 0.9679 | -30.78 | -11.3123 | 4 | 0 0 0 0 | -27.3167 | -13.1248 | -9.8436 | -15.1075 | -27.3167 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 1.8851 | 0.9245 | -20.4108 | -4.6526 | 4 | 0 0 0 0 | -18.259 | -6.997 | -2.6272 | -8.4549 | -18.259 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 7.0749 | 12.0764 | 9.4363 | 10.9955 | 7.0749 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 2.3332 | 0.9933 | -31.579 | -4.4538 | 4 | 0 0 0 0 | -28.8158 | -5.5887 | -3.2948 | -9.4116 | -28.8158 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.8635 | 4.4516 | 3.8206 | 7.1937 | 2.8635 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.65 | 1.7529 | 0.9999 | 3.5 | -15.007 | 4 | 0 0 0 1 | -13.3605 | -15.0059 | -10.5774 | 2.4893 | -13.3605 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 1.9673 | 0.9934 | -42.2319 | -13.8044 | 4 | 0 0 0 0 | -38.812 | -14.9413 | -12.7536 | -21.2969 | -38.812 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.9 | 3.132 | 0.6223 | -3.5849 | -13.7261 | 4 | 0 0 0 0 | -3.8208 | -9.1712 | -18.1051 | -9.386 | -3.8208 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.45 | 0.4 | 0.8262 | 1.069 | -18.8346 | 4 | 0 0 0 0 | -2.4425 | -15.6955 | -9.0343 | -9.4911 | -2.4425 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.95 | 3.132 | 0.7705 | 1.5 | -12.3707 | 4 | 0 0 0 0 | 1.5975 | -7.9378 | -16.9756 | -5.1738 | 1.5975 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.5045 | 0.3905 | -9.2851 | -1.5746 | 4 | 0 0 0 0 | -7.9625 | -2.9788 | -14.4042 | -5.0533 | -7.9625 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.8608 | -22.7116 | -5.6684 | 4 | 0 0 0 0 | -20.1763 | -4.2865 | -9.9046 | -3.4737 | -20.1763 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.15 | 4.9549 | 0.5637 | 1 | -8.3478 | 4 | 0 0 0 1 | -11.1241 | -3.9652 | -12.7899 | 0.2253 | -11.1241 | QC'd by Sytravon |
| Phenotype-Replicate_1 | Potency-Replicate_1 | Efficacy-Replicate_1 | Analysis Comment-Replicate_1 | Activity_Score-Replicate_1 | Curve_Description-Replicate_1 | Fit_LogAC50-Replicate_1 | Fit_HillSlope-Replicate_1 | Fit_R2-Replicate_1 | Fit_InfiniteActivity-Replicate_1 | Fit_ZeroActivity-Replicate_1 | Fit_CurveClass-Replicate_1 | Excluded_Points-Replicate_1 | Max_Response-Replicate_1 | Activity at 0.0000073560 uM-Replicate_1 | Activity at 0.0000367800 uM-Replicate_1 | Activity at 0.0000735600 uM-Replicate_1 | Activity at 0.0001677464 uM-Replicate_1 | Activity at 0.0003678000 uM-Replicate_1 | Activity at 0.0007362988 uM-Replicate_1 | Activity at 0.00153 uM-Replicate_1 | Activity at 0.00368 uM-Replicate_1 | Activity at 0.00723 uM-Replicate_1 | Activity at 0.00914 uM-Replicate_1 | Activity at 0.018 uM-Replicate_1 | Activity at 0.039 uM-Replicate_1 | Activity at 0.092 uM-Replicate_1 | Activity at 0.191 uM-Replicate_1 | Activity at 0.460 uM-Replicate_1 | Activity at 0.910 uM-Replicate_1 | Activity at 1.182 uM-Replicate_1 | Activity at 2.302 uM-Replicate_1 | Activity at 4.834 uM-Replicate_1 | Activity at 11.49 uM-Replicate_1 | Activity at 23.94 uM-Replicate_1 | Activity at 57.45 uM-Replicate_1 | Activity at 115.4 uM-Replicate_1 | Activity at 193.5 uM-Replicate_1 | Activity at 288.3 uM-Replicate_1 | Compound QC-Replicate_1 | Phenotype-Replicate_2 | Potency-Replicate_2 | Efficacy-Replicate_2 | Analysis Comment-Replicate_2 | Activity_Score-Replicate_2 | Curve_Description-Replicate_2 | Fit_LogAC50-Replicate_2 | Fit_HillSlope-Replicate_2 | Fit_R2-Replicate_2 | Fit_InfiniteActivity-Replicate_2 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -8.3213 | 4.9549 | 0.6423 | 4 | -4.8346 | 4 | 0 0 0 0 0 0 1 | -4.4443 | -2.7788 | 7.3689 | 5.3693 | 2.3397 | 3.3383 | 1.6715 | -4.4443 | QC'd by Sytravon | 0 | |||||||||||||||||||||||||||||||
| Inhibitor | 2.3919 | 69.7049 | 84 | Complete curve; high efficacy | -5.6213 | 0.9 | 0.993 | -69.4929 | 0.212 | -1.1 | 0 0 0 0 0 0 0 | -66.6604 | -0.2513 | 1.2197 | -5.3806 | -9.9311 | -37.162 | -53.3921 | -66.6604 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 9.5221 | 76.4074 | 42 | Partial curve; high efficacy | -5.0213 | 1.111 | 0.9951 | -75.9094 | 0.498 | -2.1 | 0 0 0 0 0 0 0 | -66.5912 | 3.4283 | -1.6815 | -1.5622 | -0.1199 | -13.7121 | -41.7015 | -66.5912 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inactive | 0 | -4.5213 | 1.7529 | 0.9212 | -24.9877 | 5.5 | 4 | 0 0 0 0 0 0 0 | -17.4897 | 7.3623 | 2.4616 | 9.8416 | 3.3605 | 3.9651 | 0.8896 | -17.4897 | QC'd by Sytravon | 0 | |||||||||||||||||||||||||||||||
| Inhibitor | 1.5092 | 115.264 | 87 | Complete curve; high efficacy | -5.8213 | 1.4641 | 0.9934 | -109.8568 | 5.4073 | -1.1 | 0 0 0 0 0 0 0 | -110.2979 | -0.8149 | 9.8634 | 3.518 | -7.3368 | -73.6123 | -100.848 | -110.2979 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 1.6933 | 117.9781 | 87 | Complete curve; high efficacy | -5.7713 | 4.5045 | 0.9912 | -112.73 | 5.2481 | -1.1 | 0 0 0 0 0 0 0 | -115.2658 | 15.9372 | 2.4103 | -1.2409 | 2.2518 | -88.9575 | -109.7932 | -115.2658 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 4.7724 | 81.2956 | 43 | Partial curve; high efficacy | -5.3213 | 1 | 0.9946 | -78.6057 | 2.6899 | -2.1 | 0 0 0 0 0 0 0 | -71.671 | -0.6447 | 6.4302 | 0.1885 | -3.4582 | -24.3313 | -55.7062 | -71.671 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 7.5637 | 94.3951 | 83 | Complete curve; high efficacy | -5.1213 | 4.9549 | 0.9967 | -94.6258 | -0.2307 | -1.1 | 0 0 0 0 0 0 0 | -93.8748 | 3.4317 | -2.5012 | -1.7201 | -2.4455 | 2.6182 | -85.3984 | -93.8748 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 2.6837 | 65.0297 | 84 | Complete curve; high efficacy | -5.5713 | 4.095 | 0.989 | -65.3833 | -0.3537 | -1.1 | 0 0 0 0 0 0 0 | -70.4739 | -2.312 | -0.8042 | -1.2281 | 3.0628 | -22.6396 | -60.696 | -70.4739 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 7.5637 | 57.2061 | 42 | Partial curve; partial efficacy | -5.1213 | 1.6259 | 0.9942 | -54.1319 | 3.0742 | -2.2 | 0 0 0 0 0 0 0 | -52.3087 | 6.207 | 2.8252 | 1.4762 | 0.0987 | -3.9796 | -35.0702 | -52.3087 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 1.1988 | 74.6197 | 85 | Complete curve; high efficacy | -5.9213 | 1.1341 | 0.9933 | -70.9204 | 3.6993 | -1.1 | 0 0 0 0 0 0 0 | -71.4906 | 4.2219 | -0.1886 | 4.5237 | -17.1469 | -46.9199 | -63.4145 | -71.4906 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 2.1317 | 118.4516 | 86 | Complete curve; high efficacy | -5.6713 | 2.7202 | 0.993 | -110.0886 | 8.3631 | -1.1 | 0 0 0 0 0 0 0 | -116.1272 | 7.5782 | 5.1028 | 5.8814 | 12.5352 | -56.6231 | -102.2879 | -116.1272 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 2.1317 | 122.7031 | 87 | Complete curve; high efficacy | -5.6713 | 2.4064 | 0.9787 | -115.7272 | 6.9759 | -1.1 | 0 0 0 0 0 0 0 | -122.0751 | 3.8589 | 17.443 | -6.0833 | 11.7009 | -62.2871 | -106.7609 | -122.0751 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 6.7412 | 121.0829 | 84 | Complete curve; high efficacy | -5.1713 | 4.095 | 0.9954 | -126.4671 | -5.3842 | -1.1 | 0 0 0 0 0 0 0 | -126.975 | -0.8069 | -3.4445 | -2.4548 | -11.8834 | -10.2564 | -113.7668 | -126.975 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 4.7724 | 86.827 | 44 | Partial curve; high efficacy | -5.3213 | 1 | 0.9941 | -85.383 | 1.444 | -2.1 | 0 0 0 0 0 0 0 | -78.6992 | -2.4316 | 1.8612 | -0.004 | -1.8987 | -28.5107 | -58.6303 | -78.6992 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 7.5637 | 125.154 | 84 | Complete curve; high efficacy | -5.1213 | 3.9295 | 0.9979 | -122.5872 | 2.5668 | -1.1 | 0 0 0 0 0 0 0 | -123.0795 | 3.0986 | 3.1267 | 1.8871 | -2.1093 | 5.2605 | -101.0355 | -123.0795 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 0.6741 | 119.9199 | 89 | Complete curve; high efficacy | -6.1713 | 1.3723 | 0.9986 | -109.7454 | 10.1745 | -1.1 | 0 0 0 0 0 0 0 | -110.854 | 8.8459 | 7.7415 | 6.7576 | -35.5397 | -88.9969 | -106.7803 | -110.854 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 6.7412 | 115.9813 | 84 | Complete curve; high efficacy | -5.1713 | 2.3031 | 0.9963 | -113.5967 | 2.3846 | -1.1 | 0 0 0 0 0 0 0 | -113.37 | -1.2322 | -1.5984 | 5.8599 | 5.7708 | -6.0722 | -86.9448 | -113.37 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 1.5092 | 114.0509 | 88 | Complete curve; high efficacy | -5.8213 | 1.9673 | 0.9946 | -113.9158 | 0.1351 | -1.1 | 0 0 0 0 0 0 0 | -113.0117 | -0.8223 | -4.0553 | -2.3728 | -1.6822 | -81.3904 | -111.2484 | -113.0117 | QC'd by Sytravon | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 8.4866 | 60.7927 | 42 | Partial curve; partial efficacy | -5.0713 | 2.4064 | 0.9868 | -57.9639 | 2.8287 | -2.2 | 0 0 0 0 0 0 0 | -56.5473 | 6.8781 | 4.8766 | 1.3348 | -2.2008 | 1.3516 | -39.1581 | -56.5473 | QC'd by Sytravon | 0 |
| Phenotype-Replicate_1 | Potency-Replicate_1 | Efficacy-Replicate_1 | Analysis Comment-Replicate_1 | Activity_Score-Replicate_1 | Curve_Description-Replicate_1 | Fit_LogAC50-Replicate_1 | Fit_HillSlope-Replicate_1 | Fit_R2-Replicate_1 | Fit_InfiniteActivity-Replicate_1 | Fit_ZeroActivity-Replicate_1 | Fit_CurveClass-Replicate_1 | Excluded_Points-Replicate_1 | Max_Response-Replicate_1 | Activity at 0.0000073560 uM-Replicate_1 | Activity at 0.0000367800 uM-Replicate_1 | Activity at 0.0000735600 uM-Replicate_1 | Activity at 0.0001677464 uM-Replicate_1 | Activity at 0.0003678000 uM-Replicate_1 | Activity at 0.0007362988 uM-Replicate_1 | Activity at 0.00153 uM-Replicate_1 | Activity at 0.00368 uM-Replicate_1 | Activity at 0.00723 uM-Replicate_1 | Activity at 0.00914 uM-Replicate_1 | Activity at 0.018 uM-Replicate_1 | Activity at 0.039 uM-Replicate_1 | Activity at 0.092 uM-Replicate_1 | Activity at 0.191 uM-Replicate_1 | Activity at 0.460 uM-Replicate_1 | Activity at 0.910 uM-Replicate_1 | Activity at 1.182 uM-Replicate_1 | Activity at 2.302 uM-Replicate_1 | Activity at 4.834 uM-Replicate_1 | Activity at 11.49 uM-Replicate_1 | Activity at 23.94 uM-Replicate_1 | Activity at 57.45 uM-Replicate_1 | Activity at 115.4 uM-Replicate_1 | Activity at 193.5 uM-Replicate_1 | Activity at 288.3 uM-Replicate_1 | Compound QC-Replicate_1 | Phenotype-Replicate_2 | Potency-Replicate_2 | Efficacy-Replicate_2 | Analysis Comment-Replicate_2 | Activity_Score-Replicate_2 | Curve_Description-Replicate_2 | Fit_LogAC50-Replicate_2 | Fit_HillSlope-Replicate_2 | Fit_R2-Replicate_2 | Fit_InfiniteActivity-Replicate_2 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -7.26 | 0.7 | 0.9831 | 22 | 0 | 4 | 0 0 0 0 0 0 0 0 | 18.7243 | 0.7509 | 0.7403 | 0.1615 | 0.2208 | 2.5712 | 9.0624 | 12.4905 | 18.7243 | QC'd by Labotest | 0 | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.0813 | 2.9095 | 4.1819 | 3.0683 | 1.5475 | 1.9993 | -1.4829 | 3.8282 | 3.0813 | QC'd by Labotest | 0 | ||||||||||||||||||||||||||||||||||
| Inhibitor | 10.964 | 62.6971 | 10 | Partial curve; high efficacy; poor fit | -4.96 | 4.9549 | 0.998 | -66.9977 | -4.3007 | -2.3 | 1 0 0 0 0 0 0 0 | -65.7875 | -42.8846 | -3.6636 | -4.8429 | -3.3836 | -3.8623 | -4.4736 | -41.4229 | -65.7875 | QC'd by Microsource | 0 | |||||||||||||||||||||||||||
| Inhibitor | 38.9018 | 33.8501 | 10 | Partial curve; partial efficacy; poor fit | -4.41 | 4.9549 | 0.924 | -33.3501 | 0.5 | -2.4 | 0 0 0 0 0 0 0 0 | -29.0418 | -1.5551 | 0.5206 | 0.875 | -1.2476 | -0.5605 | -1.8092 | 7.4199 | -29.0418 | QC'd by SIGMA | 0 | |||||||||||||||||||||||||||
| Inhibitor | 1.7377 | 81.2298 | 85 | Complete curve; high efficacy | -5.76 | 1.9673 | 0.9976 | -79.9564 | 1.2734 | -1.1 | 0 0 0 0 0 0 0 0 | -78.332 | 4.4795 | 0.7606 | 0.0181 | -0.701 | -3.7995 | -49.0322 | -80.0522 | -78.332 | QC'd by Tocris | 0 | |||||||||||||||||||||||||||
| Inhibitor | 34.6713 | 37.2317 | 10 | Partial curve; partial efficacy; poor fit | -4.46 | 2.3531 | 0.9195 | -37.2317 | 0 | -2.4 | 0 0 0 0 0 0 0 0 | -28.5264 | 3.9692 | 5.0423 | -3.0201 | -3.1048 | -1.1738 | -0.8348 | -2.4447 | -28.5264 | QC'd by Microsource | 0 | |||||||||||||||||||||||||||
| Inhibitor | 15.4871 | 71.273 | 41 | Partial curve; high efficacy | -4.81 | 1.4487 | 0.9928 | -70.4113 | 0.8617 | -2.1 | 0 0 0 0 0 0 0 0 | -61.7643 | 0.2853 | 1.9381 | -1.2811 | -0.3436 | 4.6186 | -4.2001 | -27.4432 | -61.7643 | QC'd by GVK | 0 | |||||||||||||||||||||||||||
| Inhibitor | 0.2188 | 91.9728 | 90 | Complete curve; high efficacy | -6.66 | 0.8 | 0.9894 | -90.0102 | 1.9626 | -1.1 | 0 0 0 0 0 0 0 0 | -83.8769 | 2.7707 | 0.8657 | -14.6874 | -27.4321 | -55.0254 | -79.0233 | -92.6031 | -83.8769 | QC'd by Prestwick Chemical; Inc. | 0 | |||||||||||||||||||||||||||
| Inhibitor | 34.6713 | 45.8288 | 10 | Single point of activity | -4.46 | 2.3531 | 0.9938 | -45.8288 | 0 | -3 | 0 0 0 0 0 0 0 0 | -35.0976 | -0.4182 | -0.112 | -0.9148 | 2.1786 | -0.5211 | -0.77 | -3.3082 | -35.0976 | QC'd by Vitas | 0 | |||||||||||||||||||||||||||
| Inhibitor | 13.8029 | 116.5981 | 42 | Partial curve; high efficacy | -4.86 | 0.7 | 0.9704 | -115.474 | 1.1242 | -2.1 | 0 0 0 0 0 0 0 0 | -87.4803 | -1.207 | 1.2781 | -1.1552 | -1.0641 | -0.761 | -34.877 | -47.6739 | -87.4803 | QC'd by Vitas | 0 | |||||||||||||||||||||||||||
| Inhibitor | 19.4971 | 71.1695 | 41 | Partial curve; high efficacy | -4.71 | 2.3332 | 0.9649 | -71.6292 | -0.4597 | -2.1 | 0 0 0 0 0 0 0 0 | -66.007 | -7.507 | 3.5896 | -6.5823 | 3.2102 | 2.0494 | 2.4442 | -17.4355 | -66.007 | QC'd by Enzo | 0 | |||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -0.3397 | 0.6834 | 1.1935 | -3.1601 | -7.1353 | -6.692 | -3.5353 | -4.6055 | -0.3397 | QC'd by Microsource | 0 | ||||||||||||||||||||||||||||||||||
| Inhibitor | 38.9018 | 99.7077 | 10 | Single point of activity | -4.41 | 2.9023 | 0.9979 | -103.2475 | -3.5398 | -3 | 0 0 0 0 0 0 0 0 | -78.9754 | -2.6538 | -1.9475 | -2.4198 | -3.036 | -5.7354 | -4.4174 | -6.1242 | -78.9754 | QC'd by Labotest | 0 | |||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.5579 | 4.2966 | 3.8697 | 0.914 | 1.5784 | 2.7763 | 2.2827 | -0.2746 | 0.5579 | QC'd by Microsource | 0 | ||||||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.2893 | 4.5048 | 5.9389 | 2.7905 | 6.1256 | 1.1364 | 5.7573 | 5.7586 | -2.2893 | QC'd by Tocris | 0 | ||||||||||||||||||||||||||||||||||
| Inhibitor | 12.3018 | 42.2827 | 21 | Partial curve; partial efficacy | -4.91 | 2.3332 | 0.9667 | -45.1528 | -2.8702 | -2.2 | 0 0 0 0 0 0 0 0 | -43.5551 | -8.1379 | -5.4062 | -0.9215 | 0.1464 | -0.2747 | -3.1761 | -22.7908 | -43.5551 | QC'd by Labotest | 0 | |||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.7074 | -0.3729 | 0.324 | 2.0766 | 2.6464 | 1.1615 | -0.7088 | 4.4781 | 2.7074 | QC'd by Prestwick | 0 | ||||||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -1.9964 | 3.7048 | 1.6527 | 3.6208 | 3.1922 | 5.0362 | 4.9342 | -1.7586 | -1.9964 | QC'd by Microsource | 0 | ||||||||||||||||||||||||||||||||||
| Inactive | 0 | -6.36 | 0.8 | 0.8961 | 5 | -7.0477 | 4 | 0 0 0 0 0 0 0 0 | 4.9227 | -4.8515 | -7.6164 | -8.7898 | -3.2699 | 0.2917 | 0.3418 | 5.5058 | 4.9227 | QC'd by Vitas | Inactive | 0 | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 3.4671 | 109.1625 | 45 | Partial curve; high efficacy | -5.46 | 0.9 | 0.9982 | -103.5313 | 5.6312 | -2.1 | 0 0 0 0 0 0 0 0 | -96.3979 | 5.9869 | 3.177 | 3.4783 | 4.7559 | -9.3266 | -39.4946 | -74.1667 | -96.3979 | QC'd by Enzo | 0 |
| Phenotype-Replicate_1 | Potency-Replicate_1 | Efficacy-Replicate_1 | Analysis Comment-Replicate_1 | Activity_Score-Replicate_1 | Curve_Description-Replicate_1 | Fit_LogAC50-Replicate_1 | Fit_HillSlope-Replicate_1 | Fit_R2-Replicate_1 | Fit_InfiniteActivity-Replicate_1 | Fit_ZeroActivity-Replicate_1 | Fit_CurveClass-Replicate_1 | Excluded_Points-Replicate_1 | Max_Response-Replicate_1 | Activity at 0.0000073560 uM-Replicate_1 | Activity at 0.0000367800 uM-Replicate_1 | Activity at 0.0000735600 uM-Replicate_1 | Activity at 0.0001677464 uM-Replicate_1 | Activity at 0.0003678000 uM-Replicate_1 | Activity at 0.0007362988 uM-Replicate_1 | Activity at 0.00153 uM-Replicate_1 | Activity at 0.00368 uM-Replicate_1 | Activity at 0.00723 uM-Replicate_1 | Activity at 0.00914 uM-Replicate_1 | Activity at 0.018 uM-Replicate_1 | Activity at 0.039 uM-Replicate_1 | Activity at 0.092 uM-Replicate_1 | Activity at 0.191 uM-Replicate_1 | Activity at 0.460 uM-Replicate_1 | Activity at 0.910 uM-Replicate_1 | Activity at 1.182 uM-Replicate_1 | Activity at 2.302 uM-Replicate_1 | Activity at 4.834 uM-Replicate_1 | Activity at 11.49 uM-Replicate_1 | Activity at 23.94 uM-Replicate_1 | Activity at 57.45 uM-Replicate_1 | Activity at 115.4 uM-Replicate_1 | Activity at 193.5 uM-Replicate_1 | Activity at 288.3 uM-Replicate_1 | Compound QC-Replicate_1 | Phenotype-Replicate_2 | Potency-Replicate_2 | Efficacy-Replicate_2 | Analysis Comment-Replicate_2 | Activity_Score-Replicate_2 | Curve_Description-Replicate_2 | Fit_LogAC50-Replicate_2 | Fit_HillSlope-Replicate_2 | Fit_R2-Replicate_2 | Fit_InfiniteActivity-Replicate_2 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 21.3174 | 85.5207 | 41 | Partial curve; high efficacy | -4.6713 | 3.1925 | 0.957 | -74.5207 | 11 | -2.1 | 0 0 0 0 0 0 0 | -71.2673 | 6.6581 | 8.6616 | 5.0342 | 9.0296 | 24.6831 | 0.5948 | -71.2673 | QC'd by Microsource | 0 | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.3186 | 7.062 | 5.197 | 5.6925 | 7.2359 | 1.267 | 0.5201 | 0.3186 | QC'd by Microsource | 0 | |||||||||||||||||||||||||||||||||||
| Inhibitor | 7.5637 | 93.5447 | 43 | Partial curve; high efficacy | -5.1213 | 1.9282 | 0.9984 | -89.2795 | 4.2653 | -2.1 | 0 0 0 0 0 0 0 | -87.5289 | 7.1656 | 5.0788 | 2.7979 | 2.1575 | -3.7741 | -60.4613 | -87.5289 | QC'd by Tocris | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 26.837 | 48.6356 | 10 | Single point of activity | -4.5713 | 2.2481 | 0.9788 | -42.8484 | 5.7872 | -3 | 0 0 0 0 0 0 0 | -35.4677 | 5.9629 | 5.4796 | 2.7092 | 10.2755 | 4.6543 | -0.1967 | -35.4677 | QC'd by NCI | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 8.4866 | 130.7668 | 43 | Partial curve; high efficacy | -5.0713 | 1 | 0.9992 | -119.8967 | 10.8701 | -2.1 | 0 0 0 0 0 0 0 | -102.4758 | 11.9466 | 11.2427 | 7.1554 | 5.0781 | -16.0537 | -65.0649 | -102.4758 | QC'd by BIOMOL | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 5.3547 | 99.1896 | 44 | Partial curve; high efficacy | -5.2713 | 0.9 | 0.9888 | -96.5712 | 2.6185 | -2.1 | 0 0 0 0 0 0 0 | -87.001 | -0.2592 | -1.637 | 6.8143 | -4.5159 | -32.2161 | -61.4841 | -87.001 | QC'd by BIOMOL | 0 | ||||||||||||||||||||||||||||
| Inactive | 0 | -4.6713 | 2.3332 | 0.6923 | -15.1448 | -0.5 | 4 | 0 0 0 0 0 0 0 | -13.8707 | -3.7401 | -1.2778 | 5.1005 | -4.6904 | 1.916 | -3.5213 | -13.8707 | QC'd by InterBioScreen | 0 | |||||||||||||||||||||||||||||||
| Inhibitor | 25.4012 | 56.2022 | 40 | Partial curve; partial efficacy | -4.5951 | 4.5045 | 0.9727 | -57.7888 | -1.5865 | -2.2 | 0 0 0 0 0 0 0 0 | -57.6748 | -1.4876 | -4.4957 | -6.2296 | 2.8676 | 3.1906 | -3.7494 | -18.0858 | -57.6748 | QC'd by LightBiologicals | Inhibitor | 40.2582 | 41.121 | 10 | Single point of activity | -4.3951 | 2.9523 | 0.943 | -42.7254 | |||||||||||||||||||
| Inhibitor | 7.5637 | 97.4712 | 43 | Partial curve; high efficacy | -5.1213 | 1.9282 | 0.9955 | -91.4517 | 6.0195 | -2.1 | 0 0 0 0 0 0 0 | -89.1342 | 6.428 | 11.1902 | 4.9868 | 1.8065 | -2.3315 | -62.2028 | -89.1342 | QC'd by Tocris | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 21.3174 | 76.6638 | 41 | Partial curve; partial efficacy | -4.6713 | 1.2475 | 0.9713 | -70.1638 | 6.5 | -2.2 | 0 0 0 0 0 0 0 | -53.0597 | 11.8628 | 10.1962 | -0.3079 | 4.293 | 1.9517 | -17.9254 | -53.0597 | QC'd by SigmaAldrich | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 26.837 | 101.6656 | 40 | Partial curve; high efficacy | -4.5713 | 1.5936 | 0.9916 | -96.2704 | 5.3952 | -2.1 | 0 0 0 0 0 0 0 | -73.3109 | 5.6238 | 8.7858 | 6.2448 | 2.4666 | -0.9326 | -13.5438 | -73.3109 | QC'd by Tocris | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 3.7908 | 87.1465 | 44 | Partial curve; high efficacy | -5.4213 | 0.8 | 0.9942 | -85.1952 | 1.9512 | -2.1 | 0 0 0 0 0 0 0 | -78.8845 | 1.4625 | -1.8716 | 1.6032 | -10.9203 | -35.4628 | -58.552 | -78.8845 | QC'd by Tocris | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 37.9083 | 129.9148 | 10 | Single point of activity | -4.4213 | 4.9549 | 0.9896 | -129.2975 | 0.6173 | -3 | 0 0 0 0 0 0 0 | -114.6255 | -1.4437 | -2.5082 | -0.9019 | 8.8381 | -4.5458 | 3.1106 | -114.6255 | QC'd by SigmaAldrich | 0 | ||||||||||||||||||||||||||||
| Inhibitor | 26.837 | 109.0621 | 40 | Partial curve; high efficacy | -4.5713 | 1.3437 | 0.9459 | -109.3538 | -0.2917 | -2.1 | 0 0 0 0 0 0 0 | -82.8438 | 2.5325 | 5.0732 | 0.7828 | 0.5149 | -19.3744 | -20.4297 | -82.8438 | QC'd by Bosche | 0 | ||||||||||||||||||||||||||||
| Inactive | 0 | -4.41 | 2.9023 | 0.8395 | -17.3952 | -0.5 | 4 | 0 0 0 0 0 0 0 0 | -13.246 | -3.8469 | 1.9539 | -0.2562 | -2.6537 | 1.477 | 0.7446 | -0.9487 | -13.246 | QC'd by ACC | 0 | ||||||||||||||||||||||||||||||
| Inactive | 0 | -8.36 | 3.132 | 0.3628 | 3 | -4.5164 | 4 | 0 0 0 0 0 0 0 0 | 2.109 | -4.1803 | -1.8377 | 5.2557 | -1.0504 | 8.3001 | -3.1085 | 6.745 | 2.109 | QC'd by Pharmaron | 0 | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.5041 | -8.5785 | 2.7045 | 0.1138 | -10.5842 | 0.9358 | 2.0884 | 0.5041 | QC'd by Toronto Research | 0 | |||||||||||||||||||||||||||||||||||
| Inhibitor | 44.4932 | 35.2765 | 10 | Single point of activity | -4.3517 | 3.6772 | 0.8478 | -34.7273 | 0.5492 | -3 | 0 0 0 0 0 0 0 0 | -32.3137 | -1.4989 | -3.7044 | -1.139 | -0.4924 | 12.1946 | -1.1884 | -3.139 | -32.3137 | QC'd by RTI | 0 | |||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 6.6308 | 7.6331 | 6.024 | 7.3986 | 0.2263 | 3.1874 | 3.4285 | 6.6308 | QC'd by Tocris | 0 | |||||||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 5.3261 | 12.5764 | 10.1122 | 11.5363 | 11.262 | 7.195 | 3.9591 | 5.3261 | QC'd by NCGCChem | 0 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00457 uM | Activity at 0.00705 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.070 uM | Activity at 0.104 uM | Activity at 0.147 uM | Activity at 0.228 uM | Activity at 0.454 uM | Activity at 0.702 uM | Activity at 0.990 uM | Activity at 1.179 uM | Activity at 2.205 uM | Activity at 3.547 uM | Activity at 5.245 uM | Activity at 6.528 uM | Activity at 11.35 uM | Activity at 18.98 uM | Activity at 27.12 uM | Activity at 37.89 uM | Activity at 57.10 uM | Activity at 85.70 uM | Activity at 114.4 uM | Activity at 171.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 2.5119 | 89.963 | 85 | Complete curve; high efficacy | -5.6 | 2.4064 | 0.9988 | -81.963 | 8 | -1.1 | 0 0 0 0 | -81.0256 | 4.3424 | -26.1944 | -82.8623 | -81.0256 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 3.1623 | 94.5377 | 85 | Complete curve; high efficacy | -5.5 | 4.5045 | 0.9999 | -94.3225 | 0.2153 | -1.1 | 0 0 0 0 | -94.7013 | -0.2373 | -13.1526 | -93.6408 | -94.7013 | QC'd by SIGMA | |||||||||||||||||||||
| Cytotoxic | 2.8184 | 94.817 | 85 | Complete curve; high efficacy | -5.55 | 2.0479 | 0.9999 | -95.8221 | -1.005 | -1.1 | 0 0 0 0 | -95.0616 | -6.2542 | -35.3146 | -94.5292 | -95.0616 | QC'd by APExBIO | |||||||||||||||||||||
| Cytotoxic | 2.8184 | 90.5207 | 85 | Complete curve; high efficacy | -5.55 | 3.0654 | 0.9989 | -88.5207 | 2 | -1.1 | 0 0 0 0 | -86.8835 | 0 | -24.056 | -89.9601 | -86.8835 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 5.6234 | 96.9742 | 84 | Complete curve; high efficacy | -5.25 | 4.095 | 1 | -95.4742 | 1.5 | -1.1 | 0 0 0 0 | -95.8576 | 1.6559 | 0 | -94.7507 | -95.8576 | QC'd by SynKinase | |||||||||||||||||||||
| Cytotoxic | 3.9811 | 96.1006 | 84 | Complete curve; high efficacy | -5.4 | 4.5045 | 1 | -95.1006 | 1 | -1.1 | 0 0 0 0 | -94.9108 | 0.5692 | -4.2795 | -94.8159 | -94.9108 | QC'd by Tocris | |||||||||||||||||||||
| Cytotoxic | 2.5119 | 77.6563 | 84 | Complete curve; high efficacy | -5.6 | 2.0479 | 0.9997 | -80.7421 | -3.0858 | -1.1 | 0 0 0 0 | -80.0369 | -5.0715 | -39.0219 | -77.613 | -80.0369 | QC'd by Microsource | |||||||||||||||||||||
| Cytotoxic | 7.9433 | 99.4986 | 83 | Complete curve; high efficacy | -5.1 | 4.9549 | 0.9997 | -96.9986 | 2.5 | -1.1 | 0 0 0 0 | -96.805 | 1.2306 | 3.5418 | -95.9316 | -96.805 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 97.8358 | 83 | Complete curve; high efficacy | -5.15 | 4.9549 | 0.9993 | -95.8358 | 2 | -1.1 | 0 0 0 0 | -95.6445 | 0 | 3.4249 | -95.1788 | -95.6445 | QC'd by Tocris | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 97.3751 | 83 | Complete curve; high efficacy | -5.15 | 4.095 | 1 | -97.3751 | 0 | -1.1 | 0 0 0 0 | -97.1807 | 0 | -0.6843 | -95.5282 | -97.1807 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 102.4399 | 83 | Complete curve; high efficacy | -5.15 | 1.6924 | 0.9998 | -100.4399 | 2 | -1.1 | 0 0 0 0 | -96.7629 | 0 | -9.8984 | -85.0051 | -96.7629 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 96.3568 | 83 | Complete curve; high efficacy | -5.15 | 4.9549 | 1 | -96.3568 | 0 | -1.1 | 0 0 0 0 | -96.1644 | 0 | 0 | -95.5939 | -96.1644 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 93.6127 | 83 | Complete curve; high efficacy | -5.15 | 4.9549 | 1 | -93.6127 | 0 | -1.1 | 0 0 0 0 | -93.4258 | 0 | 0 | -92.8807 | -93.4258 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 8.9125 | 97.1357 | 83 | Complete curve; high efficacy | -5.05 | 4.9549 | 1 | -97.1357 | 0 | -1.1 | 0 0 0 0 | -96.9418 | 0 | 0 | -94.9322 | -96.9418 | QC'd by APExBIO | |||||||||||||||||||||
| Cytotoxic | 8.9125 | 105.034 | 83 | Complete curve; high efficacy | -5.05 | 1.6436 | 0.9999 | -100.034 | 5 | -1.1 | 0 0 0 0 | -94.7292 | 3.0536 | -3.9173 | -76.9038 | -94.7292 | QC'd by Glixx | |||||||||||||||||||||
| Cytotoxic | 10 | 91.3037 | 82 | Complete curve; high efficacy | -5 | 2.1876 | 1 | -85.8037 | 5.5 | -1.1 | 0 0 0 0 | -84.1212 | 4.8646 | 2.5388 | -67.7158 | -84.1212 | QC'd by SIGMA | |||||||||||||||||||||
| Cytotoxic | 10 | 98.1252 | 82 | Complete curve; high efficacy | -5 | 2.8473 | 0.9999 | -97.6252 | 0.5 | -1.1 | 0 0 0 0 | -96.8504 | 0 | 0 | -83.9555 | -96.8504 | QC'd by Cayman | |||||||||||||||||||||
| Cytotoxic | 11.2202 | 93.8772 | 82 | Complete curve; high efficacy | -4.95 | 2.4064 | 0.9998 | -92.8772 | 1 | -1.1 | 0 0 0 0 | -91.0561 | 0 | 0 | -72.1776 | -91.0561 | QC'd by Selleck | |||||||||||||||||||||
| Cytotoxic | 0.8913 | 60.2348 | 67 | Complete curve; partial efficacy | -6.05 | 3.5117 | 0.9985 | -93.1767 | -32.9418 | -1.2 | 0 0 0 0 | -93.5509 | -51.1212 | -90.8041 | -91.9137 | -93.5509 | QC'd by Selleck | |||||||||||||||||||||
| Cytotoxic | 0.7943 | 56.6802 | 67 | Complete curve; partial efficacy | -6.1 | 3.9295 | 0.9999 | -91.2497 | -34.5695 | -1.2 | 0 0 0 0 | -91.0675 | -40.2642 | -90.3425 | -90.8279 | -91.0675 | QC'd by MedChem Express |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00457 uM | Activity at 0.00705 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.070 uM | Activity at 0.104 uM | Activity at 0.147 uM | Activity at 0.228 uM | Activity at 0.454 uM | Activity at 0.702 uM | Activity at 0.990 uM | Activity at 1.179 uM | Activity at 2.205 uM | Activity at 3.547 uM | Activity at 5.245 uM | Activity at 6.528 uM | Activity at 11.35 uM | Activity at 18.98 uM | Activity at 27.12 uM | Activity at 37.89 uM | Activity at 57.10 uM | Activity at 85.70 uM | Activity at 114.4 uM | Activity at 171.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 0.7079 | 34.8288 | 10 | Complete curve; partial efficacy; poor fit | -6.15 | 4.9549 | 0.7525 | -34.8113 | 0.0174 | -1.4 | 0 0 0 0 | -43.6793 | -3.7355 | -37.8905 | -22.6342 | -43.6793 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 35.4813 | 36.7648 | 10 | Single point of activity | -4.45 | 2.4064 | 0.8748 | -40.7648 | -4 | -3 | 0 0 0 0 | -31.8873 | -11.4596 | 0 | -6.0521 | -31.8873 | QC'd by Pharmaron | |||||||||||||||||||||
| Inhibitor | 39.8107 | 40.3927 | 10 | Single point of activity | -4.4 | 4.4495 | 0.7948 | -48.5731 | -8.1804 | -3 | 0 0 0 0 | -41.7275 | -5.1127 | -20.8986 | -3.4837 | -41.7275 | QC'd by FLUKA | |||||||||||||||||||||
| Inhibitor | 39.8107 | 36.3021 | 10 | Single point of activity | -4.4 | 4.4495 | 0.9302 | -39.3021 | -3 | -3 | 0 0 0 0 | -33.1684 | -8.7659 | 0 | -0.1246 | -33.1684 | QC'd by Prestwick | |||||||||||||||||||||
| Inhibitor | 10 | 91.8254 | 10 | Partial curve; high efficacy; poor fit | -5 | 3.9295 | 1 | -91.3254 | 0.5 | -2.3 | 1 0 0 0 | -91.1431 | -30.038 | 0 | -57.0259 | -91.1431 | QC'd by APExBIO | |||||||||||||||||||||
| Inhibitor | 39.8107 | 88.8726 | 10 | Single point of activity | -4.4 | 4.9549 | 0.9981 | -87.8726 | 1 | -3 | 0 0 0 0 | -75.3105 | 0 | 0 | 3.3645 | -75.3105 | QC'd by Microsource | |||||||||||||||||||||
| Inhibitor | 39.8107 | 39.074 | 10 | Single point of activity | -4.4 | 4.9549 | 0.9982 | -38.574 | 0.5 | -3 | 0 0 0 0 | -32.9783 | 0 | 0 | 1.4313 | -32.9783 | QC'd by Carbosynth | |||||||||||||||||||||
| Inhibitor | 17.7828 | 45.6593 | 10 | Partial curve; partial efficacy; poor fit | -4.75 | 1.9673 | 0.9887 | -54.3257 | -8.6664 | -2.4 | 0 0 0 0 | -50.2467 | -11.0836 | -6.8054 | -21.6158 | -50.2467 | QC'd by TargetMol | |||||||||||||||||||||
| Inhibitor | 39.8107 | 74.9786 | 10 | Single point of activity | -4.4 | 4.4495 | 0.9815 | -77.9786 | -3 | -3 | 0 0 0 0 | -65.3989 | -8.9317 | 0 | 0 | -65.3989 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 39.8107 | 35.788 | 10 | Single point of activity | -4.4 | 4.4495 | 0.945 | -39.8408 | -4.0529 | -3 | 0 0 0 0 | -34.034 | -8.1712 | -5.8755 | -0.0441 | -34.034 | QC'd by Adooq | |||||||||||||||||||||
| Inhibitor | 19.9526 | 98.5475 | 10 | Partial curve; high efficacy; poor fit | -4.7 | 1.9673 | 0.9936 | -101.5475 | -3 | -2.3 | 0 0 0 0 | -90.5058 | -6.6702 | 0 | -28.4282 | -90.5058 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 39.8107 | 94.2096 | 10 | Partial curve; high efficacy; poor fit | -4.4 | 4.4495 | 0.9731 | -106.3898 | -12.1802 | -2.3 | 0 0 0 0 | -90.4675 | -6.8168 | -21.693 | -10.2877 | -90.4675 | QC'd by Axon Medchem | |||||||||||||||||||||
| Inhibitor | 39.8107 | 68.3394 | 10 | Single point of activity | -4.4 | 4.9549 | 0.8933 | -61.3394 | 7 | -3 | 0 0 0 0 | -51.5329 | 0 | 0 | 21.3412 | -51.5329 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 11.2202 | 45.0575 | 10 | Partial curve; partial efficacy; poor fit | -4.95 | 1.8579 | 0.9996 | -42.5575 | 2.5 | -2.4 | 1 0 0 0 | -40.794 | -21.6798 | 0 | -20.0057 | -40.794 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 22.3872 | 113.3323 | 10 | Partial curve; high efficacy; poor fit | -4.65 | 1.6924 | 1 | -111.3323 | 2 | -2.3 | 1 0 0 0 | -91.8583 | -33.8793 | 0 | -25.3979 | -91.8583 | QC'd by Microsource | |||||||||||||||||||||
| Inhibitor | 7.0795 | 44.42 | 10 | Single point of activity | -5.15 | 4.9549 | 0.6152 | -48.42 | -4 | -3 | 0 0 0 0 | -44.8333 | -14.7954 | -20.376 | 0 | -44.8333 | QC'd by SIGMA | |||||||||||||||||||||
| Inhibitor | 39.8107 | 32.9185 | 10 | Single point of activity | -4.4 | 4.9549 | 0.6127 | -36.9185 | -4 | -3 | 0 0 0 0 | -32.0154 | 2.7163 | -20.0828 | 0 | -32.0154 | QC'd by Selleck | |||||||||||||||||||||
| Inhibitor | 39.8107 | 51.1844 | 10 | Single point of activity | -4.4 | 4.4495 | 1 | -51.1844 | 0 | -3 | 0 0 0 0 | -42.6537 | 0 | 0 | 0 | -42.6537 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 10 | 58.1799 | 10 | Partial curve; partial efficacy; poor fit | -5 | 3.5117 | 0.9887 | -59.1799 | -1 | -2.4 | 0 0 0 0 | -59.8069 | -4.8747 | 2.0564 | -35.7833 | -59.8069 | QC'd by DC Chemicals | |||||||||||||||||||||
| Inhibitor | 39.8107 | 40.2901 | 10 | Single point of activity | -4.4 | 4.4495 | 0.7334 | -45.6865 | -5.3964 | -3 | 0 0 0 0 | -38.9054 | -16.4277 | -13.0282 | -1.1636 | -38.9054 | QC'd by Adooq |
| Phenotype | Potency | Efficacy | Analysis Comment | FF-overN-Activity_Score | FF-overN-Curve_Description | FF-overN-Fit_LogAC50 | FF-overN-Fit_HillSlope | FF-overN-Fit_R2 | FF-overN-Fit_InfiniteActivity | FF-overN-Fit_ZeroActivity | FF-overN-Fit_CurveClass | FF-overN-Excluded_Points | FF-overN-Max_Response | FF-overN-Activity at 0.0000389080 uM | FF-overN-Activity at 0.0001066275 uM | FF-overN-Activity at 0.0001907270 uM | FF-overN-Activity at 0.0004536066 uM | FF-overN-Activity at 0.0007545096 uM | FF-overN-Activity at 0.0009784578 uM | FF-overN-Activity at 0.00290 uM | FF-overN-Activity at 0.00507 uM | FF-overN-Activity at 0.00876 uM | FF-overN-Activity at 0.016 uM | FF-overN-Activity at 0.026 uM | FF-overN-Activity at 0.052 uM | FF-overN-Activity at 0.080 uM | FF-overN-Activity at 0.235 uM | FF-overN-Activity at 0.459 uM | FF-overN-Activity at 0.739 uM | FF-overN-Activity at 1.169 uM | FF-overN-Activity at 2.226 uM | FF-overN-Activity at 6.007 uM | FF-overN-Activity at 11.47 uM | FF-overN-Activity at 19.12 uM | FF-overN-Activity at 25.20 uM | FF-overN-Activity at 57.49 uM | FF-overN-Activity at 115.7 uM | FF-overN-Activity at 221.8 uM | FF-overN-Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6 | 3.5722 | 0.9998 | 8 | -4.573 | 4 | 0 0 0 1 | 0.0919 | -4.6442 | 3.1713 | 7.9059 | 0.0919 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 3.5722 | 0.955 | 11 | -10.4556 | 4 | 0 0 0 0 | 10.3819 | -7.9209 | -13.2963 | -7.8629 | 10.3819 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 3.9295 | 0.9982 | -20.5535 | -1.4154 | 4 | 0 0 0 0 | -20.4612 | -1.7364 | -0.7629 | -17.0693 | -20.4612 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.5 | 1 | 0.6282 | -19.163 | -1 | 4 | 0 0 0 0 | -14.3025 | 0.9125 | -7.5415 | -3.4541 | -14.3025 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.95 | 2.2526 | 0.9995 | -16.7735 | 3.5 | 4 | 0 0 0 0 | -16.7304 | 3.5028 | -6.5545 | -16.8946 | -16.7304 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5 | 0.6 | 0.9765 | -26.0622 | 0.057 | 4 | 0 0 0 0 | -20.0519 | -0.7858 | -6.9465 | -12.3383 | -20.0519 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.5 | 1.4487 | 0.9277 | -11.1274 | 1 | 4 | 0 0 0 0 | -7.6062 | 2.4742 | -0.4153 | -0.9904 | -7.6062 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.35 | 0.6 | 0.9824 | -10.0654 | 9.5 | 4 | 0 0 0 0 | -7.5545 | 7.8538 | 2.9441 | -1.9949 | -7.5545 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.4936 | 1.9596 | 1.2945 | 6.6505 | 2.4936 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.55 | 2.5334 | 0.6159 | -11.4423 | -23.9956 | 4 | 0 0 0 0 | -13.2853 | -18.831 | -28.7463 | -22.7697 | -13.2853 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.0756 | 0 | 0 | -9.752 | -4.0756 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 1.6436 | 0.9984 | -26.3723 | 6.5 | 4 | 0 0 0 0 | -20.7269 | 6.8952 | 5.4769 | -1.6781 | -20.7269 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.35 | 4.9549 | 0.8085 | -22.1835 | 1.5 | 4 | 0 0 0 0 | -16.8196 | 1.0548 | -3.7533 | 7.1078 | -16.8196 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -9.2421 | -7.2234 | -5.2389 | -3.1916 | -9.2421 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -12.9119 | -16.3463 | -12.7285 | -15.6237 | -12.9119 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.468 | -15.2266 | 3 | 4 | 0 0 0 0 | -8.9707 | 0 | -26.8555 | -10.0921 | -8.9707 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6823 | 3.8566 | 7.6151 | 8.0028 | 2.6823 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.4875 | -11.1688 | 2 | 4 | 0 0 0 1 | -1.2431 | 0 | -17.6407 | -4.4754 | -1.2431 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.55 | 2.3531 | 0.986 | -25.9932 | 3.5 | 4 | 0 0 0 0 | -21.2443 | 5.1247 | 1.651 | 0.2461 | -21.2443 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 4.095 | 0.7467 | -1.9217 | 6 | 4 | 0 0 0 0 | -2.0181 | 2.9034 | 8.923 | -0.4967 | -2.0181 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000386857 uM | Activity at 0.0001060182 uM | Activity at 0.0002019424 uM | Activity at 0.0004510146 uM | Activity at 0.0009668607 uM | Activity at 0.00168 uM | Activity at 0.00290 uM | Activity at 0.00509 uM | Activity at 0.00877 uM | Activity at 0.025 uM | Activity at 0.041 uM | Activity at 0.083 uM | Activity at 0.136 uM | Activity at 0.247 uM | Activity at 0.490 uM | Activity at 1.070 uM | Activity at 2.238 uM | Activity at 4.221 uM | Activity at 6.448 uM | Activity at 12.37 uM | Activity at 30.23 uM | Activity at 57.68 uM | Activity at 114.0 uM | Activity at 227.8 uM | Activity at 383.5 uM | Activity at 573.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 3.7924 | 3.15 | 0.963 | 2.3829 | 3.4088 | 3.7221 | 3.7924 | QC'd by MedChem Express | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.2789 | 3.5102 | 1.528 | 1.9238 | 4.6346 | 6.4182 | 1.2789 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.0037 | -4.4248 | -0.615 | -1.2841 | -0.0588 | -4.0514 | 0.0037 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -3.0131 | -5.3427 | -2.388 | -5.1553 | -1.5524 | -1.7506 | -3.0131 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.373 | 0.8235 | 0.0316 | 2.107 | 1.7002 | -1.9138 | 3.373 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.2123 | -4.9482 | 0.0182 | 2.4902 | -0.0466 | 3.4729 | 2.2123 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -6.8722 | -2.3397 | -1.6401 | -4.488 | -0.7912 | -2.054 | -6.8722 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6887 | 2.9795 | 4.8757 | 2.0264 | 2.2902 | 4.458 | 2.6887 | QC'd by MedChem Express | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -3.8031 | -1.1794 | -1.5257 | -1.5947 | 1.0625 | -2.7807 | -3.8031 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -10.2079 | -6.2462 | -2.2383 | -3.1976 | -2.6796 | -7.2482 | -10.2079 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.2044 | 1.1558 | 1.2797 | 1.8267 | -0.4088 | 0.0627 | 3.2044 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -8.9309 | -1.3351 | -3.9232 | -1.9433 | -5.1495 | -5.1305 | -8.9309 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.583 | -2.8916 | -5.1264 | -4.8462 | -1.1066 | 0.1205 | -2.583 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.7511 | 0.2404 | -3.0231 | -3.8049 | -6.4833 | 1.0107 | -2.7511 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.502 | 1.0269 | 0.0012 | 1.2652 | 0.3956 | 0.7999 | -4.502 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.2916 | 1.5967 | 1.7255 | 4.1293 | 0.6629 | 1.259 | 2.2916 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.0438 | -1.4768 | -0.4907 | 0.2776 | 2.287 | -0.8523 | 3.0438 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.3119 | -0.9159 | -1.5721 | -0.7878 | 0.5085 | -2.4781 | -4.3119 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.058 | 5.2803 | 5.2865 | 7.8954 | 10.1632 | 4.5574 | 1.058 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.9292 | -2.6967 | -2.5902 | -0.5082 | 2.8487 | 4.351 | 2.9292 | QC'd by Analyticon |
| Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|
| Delta TM | = | 5.443 | C | Thermal Shift Assay |
| Delta TM | = | -0.3085 | C | Thermal Shift Assay |
| Delta TM | = | -0.7 | C | |
| Delta TM | = | -0.03 | C | Thermal Shift Assay |
| Delta TM | = | 11.17 | C | Thermal Shift Assay |
| Delta TM | = | -1.553 | C | Thermal Shift Assay |
| Delta TM | = | -0.29 | C | Thermal Shift Assay |
| Delta TM | = | -0.3615 | C | Thermal Shift Assay |
| Delta TM | = | 0.0664 | C | Thermal Shift Assay |
| Delta TM | = | -0.66 | C | |
| Delta TM | = | -0.06 | C | Thermal Shift Assay |
| Delta TM | = | -0.21 | C | Thermal Shift Assay |
| Delta TM | = | -0.26 | C | Thermal Shift Assay |
| Delta TM | = | -1.145 | C | Thermal Shift Assay |
| Delta TM | = | -0.6697 | C | Thermal Shift Assay |
| Delta TM | = | 0 | C | Thermal Shift Assay |
| Delta TM | = | -0.4876 | C | Thermal Shift Assay |
| Delta TM | = | 2.74 | C | Thermal Shift Assay |
| Delta TM | = | 0.22 | C | Thermal Shift Assay |
| Delta TM | = | -0.06 | C | Thermal Shift Assay |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000062633 uM | Activity at 0.0000234000 uM | Activity at 0.0000299492 uM | Activity at 0.0000680174 uM | Activity at 0.0001469594 uM | Activity at 0.0003236290 uM | Activity at 0.0006759500 uM | Activity at 0.00129 uM | Activity at 0.00271 uM | Activity at 0.00485 uM | Activity at 0.00758 uM | Activity at 0.016 uM | Activity at 0.038 uM | Activity at 0.071 uM | Activity at 0.177 uM | Activity at 0.355 uM | Activity at 0.588 uM | Activity at 1.399 uM | Activity at 1.898 uM | Activity at 4.965 uM | Activity at 9.229 uM | Activity at 17.27 uM | Activity at 44.90 uM | Activity at 91.89 uM | Activity at 155.1 uM | Activity at 231.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 9.3597 | 0 | 0 | 0 | 0 | 0 | 2.2289 | 0 | 9.3597 | QC'd by Microsource | ||||||||||||||||||||||||||
| Inactive | 0 | -4.475 | 4.9549 | 0.8748 | -21.4867 | 4 | 4 | 0 0 0 0 0 0 0 0 | -17.0722 | 6.1042 | 2.8293 | 0 | 7.4025 | 0 | 6.1286 | 5.2151 | -17.0722 | QC'd by Vitas | ||||||||||||||||||||||
| Inactive | 0 | -8.275 | 1.1705 | 0.6611 | 2 | -6.667 | 4 | 0 0 0 0 0 0 0 0 | -1.0776 | -6.3892 | -2.9698 | -1.7372 | 5.874 | 0.3532 | 2.419 | 2.3477 | -1.0776 | QC'd by Labotest | ||||||||||||||||||||||
| Inactive | 0 | -4.425 | 4.9549 | 0.4933 | -23.5282 | -3 | 4 | 0 0 0 0 0 0 0 0 | -17.9402 | 0.3948 | -8.1012 | -10.4184 | -5.5544 | 1.8102 | -4.7765 | 5.7051 | -17.9402 | QC'd by Vitas | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 7.8331 | 0 | 0 | 9.3496 | 0 | 8.3936 | 8.8574 | 0 | QC'd by Sequoia | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 2.1346 | 2.0873 | 2.8787 | 2.1981 | 0 | 1.0717 | 0 | 0 | QC'd by SIGMA | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 6.7477 | 0 | 7.719 | 6.3706 | 0 | 0 | 0 | 0 | QC'd by Prestwick | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.3259 | 8.1273 | 0 | 0 | 7.3085 | 6.1485 | 9.7634 | 0 | 1.3259 | QC'd by Enzo | ||||||||||||||||||||||||||
| Inactive | 0 | -6.775 | 4.9549 | 0.7871 | -25.4234 | -14.7892 | 4 | 1 0 0 0 0 0 0 1 | -14.8266 | -40.4001 | -18.8558 | -14.3881 | -11.9076 | -28.2695 | -23.675 | -23.6904 | -14.8266 | QC'd by Microsource | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | 0 | 3.2238 | 5.3823 | 0 | 7.5034 | 0 | 0 | QC'd by Microsource | ||||||||||||||||||||||||||
| Inactive | 0 | -4.475 | 4.9549 | 0.4377 | -10.0741 | 2 | 4 | 0 0 0 0 0 0 0 0 | -7.9784 | 0 | 0 | 6.8904 | -2.1283 | 0 | 0.7614 | 9.8865 | -7.9784 | QC'd by Labotest | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.1184 | 4.7394 | 4.4107 | -0.6138 | 5.1674 | 0 | 2.3218 | -1.3941 | -2.1184 | QC'd by Microsource | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0.2342 | 2.9725 | 5.1318 | 0 | 2.0235 | 0 | 0.0589 | 0 | QC'd by Enzo | ||||||||||||||||||||||||||
| Inactive | 0 | -8.725 | 0.6 | 0.7945 | 4.5 | -11.9886 | 4 | 0 0 0 0 0 0 0 1 | -9.0185 | -8.3238 | -0.4567 | 0.9031 | 0.0721 | 3.3394 | 7.7262 | 3.0826 | -9.0185 | QC'd by Vitas | ||||||||||||||||||||||
| Inactive | 0 | -9.125 | 4.9549 | 0.5569 | 5 | -5.3552 | 4 | 0 0 0 0 0 0 0 1 | -2.6103 | -2.796 | 6.9995 | 3.4228 | 1.6101 | 8.0983 | 7.0134 | 2.0138 | -2.6103 | QC'd by Specs | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.9896 | 0 | 0 | 9.6344 | 0 | 0 | 4.2786 | 0 | 0.9896 | QC'd by GVK | ||||||||||||||||||||||||||
| Inactive | 0 | -5.525 | 4.095 | 0.6337 | -3.6963 | 3 | 4 | 0 0 0 0 0 0 0 0 | -3.4671 | 3.2926 | 6.7211 | 0 | 4.9171 | 0 | 2.2046 | -3.4969 | -3.4671 | QC'd by Prestwick | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.1269 | 3.0732 | 0 | 6.5383 | 2.8274 | 0 | -3.4128 | 8.3114 | 3.1269 | QC'd by Labotest | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | 2.578 | 6.6592 | 0 | 0 | 0 | 3.3663 | 0 | QC'd by Prestwick | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6761 | 0 | 0 | 8.9375 | 0 | 0 | 0.408 | 0 | 2.6761 | QC'd by Prestwick Chemical; Inc. |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000062633 uM | Activity at 0.0000234000 uM | Activity at 0.0000299492 uM | Activity at 0.0000680174 uM | Activity at 0.0001469594 uM | Activity at 0.0003236290 uM | Activity at 0.0006759500 uM | Activity at 0.00129 uM | Activity at 0.00271 uM | Activity at 0.00485 uM | Activity at 0.00758 uM | Activity at 0.016 uM | Activity at 0.038 uM | Activity at 0.071 uM | Activity at 0.177 uM | Activity at 0.355 uM | Activity at 0.588 uM | Activity at 1.399 uM | Activity at 1.898 uM | Activity at 4.965 uM | Activity at 9.229 uM | Activity at 17.27 uM | Activity at 44.90 uM | Activity at 91.89 uM | Activity at 155.1 uM | Activity at 231.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 0.0015 | 95.0131 | 100 | Complete curve; high efficacy | -8.8295 | 4.9549 | 0.995 | -92.9859 | 2.0272 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.2587 | -1.6791 | -84.9271 | -90.9202 | -90.8631 | -90.7375 | -92.2911 | -92.6732 | -94.1019 | -94.0673 | -96.0913 | -96.2587 | QC'd by SIGMA | ||||||||||||||||
| Inhibitor | 0.0017 | 96.0144 | 100 | Complete curve; high efficacy | -8.7683 | 3.2475 | 0.9987 | -95.3786 | 0.6358 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.9294 | 1.7123 | -0.1391 | -34.4453 | -93.3159 | -93.9442 | -94.1795 | -94.3745 | -94.7424 | -94.9325 | -95.6129 | -96.9294 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0017 | 101.1335 | 100 | Complete curve; high efficacy | -8.7683 | 4.5045 | 0.9988 | -96.4557 | 4.6778 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -98.6254 | 2.9383 | 5.3252 | -23.8352 | -93.6078 | -94.3407 | -94.7755 | -96.5382 | -96.9802 | -98.093 | -97.488 | -98.6254 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0014 | 95.7664 | 100 | Complete curve; high efficacy | -8.8683 | 3.0654 | 0.9932 | -91.7312 | 4.0352 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -94.3736 | 0 | 6.5073 | -50.3576 | -85.2142 | -89.4583 | -90.3553 | -90.6328 | -93.2878 | -91.6178 | -92.6738 | -94.3736 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0027 | 92.0567 | 99 | Complete curve; high efficacy | -8.575 | 3.99 | 0.9971 | -93.082 | -1.0254 | -1.1 | 0 0 0 0 0 0 0 0 | -97.5703 | -1.153 | -56.5542 | -91.9507 | -92.331 | -93.0234 | -92.9105 | -92.2466 | -97.5703 | QC'd by Alfa Aesar | |||||||||||||||||||
| Inhibitor | 0.0027 | 86.1528 | 99 | Complete curve; high efficacy | -8.575 | 4.9549 | 0.9984 | -92.0573 | -5.9045 | -1.1 | 0 0 0 0 0 0 0 0 | -92.9872 | -5.0961 | -62.3948 | -91.5014 | -91.2009 | -92.0539 | -90.8793 | -91.9519 | -92.9872 | QC'd by Microsource | |||||||||||||||||||
| Inhibitor | 0.0021 | 98.4878 | 99 | Complete curve; high efficacy | -8.675 | 4.5045 | 0.9983 | -91.9795 | 6.5083 | -1.1 | 0 0 0 0 0 0 0 0 | -94.0485 | 5.8681 | -73.3835 | -89.9758 | -90.798 | -91.9458 | -91.2065 | -93.7497 | -94.0485 | QC'd by Bosche | |||||||||||||||||||
| Inhibitor | 7.0E-4 | 82.7334 | 99 | Complete curve; high efficacy | -9.175 | 0.6 | 0.8847 | -82.6567 | 0.0767 | -1.1 | 0 0 0 0 0 0 0 0 | -94.3569 | -37.5208 | -62.7186 | -72.7916 | -74.3825 | -79.8918 | -76.6331 | -78.5528 | -94.3569 | QC'd by Selleck | |||||||||||||||||||
| Inhibitor | 0.0037 | 95.0819 | 99 | Complete curve; high efficacy | -8.4362 | 1.2221 | 0.9994 | -94.5205 | 0.5614 | -1.1 | 0 0 0 0 0 0 0 | -93.7704 | -1.1631 | 0.6157 | -11.9264 | -47.6173 | -82.383 | -92.7843 | -93.7704 | QC'd by Adooq | ||||||||||||||||||||
| Inhibitor | 0.0033 | 94.0479 | 99 | Complete curve; high efficacy | -8.4795 | 3.5117 | 0.9958 | -93.9623 | 0.0856 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -97.8774 | 1.2665 | -23.1756 | -88.8678 | -90.2585 | -91.8229 | -92.3997 | -94.1271 | -95.2991 | -93.6757 | -95.8566 | -97.8774 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0047 | 102.0075 | 98 | Complete curve; high efficacy | -8.3295 | 2.2481 | 0.997 | -94.1763 | 7.8312 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -98.7173 | 5.6987 | -9.7434 | -65.3554 | -90.638 | -91.2058 | -92.371 | -92.7427 | -94.2549 | -94.3053 | -96.979 | -98.7173 | QC'd by GVK | ||||||||||||||||
| Inhibitor | 0.0047 | 100.429 | 98 | Complete curve; high efficacy | -8.325 | 3.6772 | 0.9994 | -93.2276 | 7.2013 | -1.1 | 0 0 0 0 0 0 0 0 | -94.7435 | 8.1328 | -8.6557 | -90.5176 | -92.1158 | -93.5383 | -93.4255 | -92.4974 | -94.7435 | QC'd by Prestwick | |||||||||||||||||||
| Inhibitor | 0.0038 | 96.7634 | 98 | Complete curve; high efficacy | -8.425 | 3.99 | 0.9994 | -92.0205 | 4.743 | -1.1 | 0 0 0 0 0 0 0 0 | -93.5167 | 4.0536 | -21.1619 | -91.8053 | -91.1174 | -91.9789 | -90.7784 | -91.2901 | -93.5167 | QC'd by Selleck | |||||||||||||||||||
| Inhibitor | 0.0045 | 90.5397 | 98 | Complete curve; high efficacy | -8.3466 | 4.5045 | 0.9995 | -92.4565 | -1.9167 | -1.1 | 0 0 0 0 0 0 0 | -93.156 | -4.128 | -89.5728 | -91.2217 | -93.3904 | -92.524 | -93.0057 | -93.156 | QC'd by Selleck | ||||||||||||||||||||
| Inhibitor | 0.0052 | 98.2987 | 98 | Complete curve; high efficacy | -8.288 | 4.9549 | 0.9993 | -92.6581 | 5.6406 | -1.1 | 0 0 0 0 0 0 0 | -93.5941 | 0 | -91.9394 | -91.381 | -91.3804 | -93.5391 | -93.3571 | -93.5941 | QC'd by ChemieTek | ||||||||||||||||||||
| Inhibitor | 0.0052 | 98.8546 | 98 | Complete curve; high efficacy | -8.288 | 0.6 | 0.9861 | -94.1197 | 4.7349 | -1.1 | 0 0 0 0 0 0 0 | -93.9318 | -33.6729 | -64.3585 | -76.1096 | -84.2151 | -92.4038 | -93.1111 | -93.9318 | QC'd by MedChem Express | ||||||||||||||||||||
| Inhibitor | 0.004 | 86.0426 | 98 | Complete curve; high efficacy | -8.3992 | 4.5045 | 0.9996 | -92.288 | -6.2454 | -1.1 | 0 0 0 0 0 0 0 | -91.795 | -7.0299 | -86.4668 | -91.4418 | -93.2202 | -92.6549 | -92.4417 | -91.795 | QC'd by Selleck | ||||||||||||||||||||
| Inhibitor | 0.0046 | 98.0203 | 98 | Complete curve; high efficacy | -8.338 | 3.5117 | 0.9996 | -93.1684 | 4.8519 | -1.1 | 0 0 0 0 0 0 0 | -93.7644 | -11.8828 | -91.4502 | -92.2553 | -94.1095 | -92.9439 | -93.2642 | -93.7644 | QC'd by SIGMA | ||||||||||||||||||||
| Inhibitor | 0.0042 | 104.4497 | 98 | Complete curve; high efficacy | -8.3795 | 4.9549 | 0.9968 | -93.9204 | 10.5293 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.6259 | 8.6675 | 7.5142 | -90.2575 | -91.0844 | -91.1114 | -92.6871 | -93.2743 | -95.4523 | -94.079 | -95.5345 | -96.6259 | QC'd by BioAustralis | ||||||||||||||||
| Inhibitor | 0.0042 | 94.9421 | 98 | Complete curve; high efficacy | -8.3795 | 2.8473 | 0.9968 | -94.7591 | 0.183 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.9399 | 0.6808 | -16.1375 | -78.234 | -91.1234 | -91.9081 | -92.3507 | -95.4781 | -97.4887 | -95.7111 | -95.4747 | -96.9399 | QC'd by ActiveBioChem |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000420468 uM | Activity at 0.0001060182 uM | Activity at 0.0001893301 uM | Activity at 0.0004489405 uM | Activity at 0.0009664426 uM | Activity at 0.00171 uM | Activity at 0.00292 uM | Activity at 0.00536 uM | Activity at 0.00931 uM | Activity at 0.020 uM | Activity at 0.041 uM | Activity at 0.085 uM | Activity at 0.146 uM | Activity at 0.251 uM | Activity at 0.501 uM | Activity at 1.073 uM | Activity at 2.225 uM | Activity at 4.221 uM | Activity at 6.452 uM | Activity at 12.64 uM | Activity at 29.84 uM | Activity at 57.50 uM | Activity at 114.0 uM | Activity at 227.6 uM | Activity at 379.2 uM | Activity at 573.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | -8.3336 | -1.4117 | -0.6141 | -1.8079 | 0.0446 | -8.3336 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5.75 | 4.9549 | 0.364 | -29.4824 | 3.3805 | 4 | 0 0 0 0 1 | -1.3954 | 3.2535 | 0.7839 | -59.1373 | 6.0E-4 | -1.3954 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -6.75 | 3.132 | 0.7843 | 0.8702 | 12.5 | 4 | 0 0 0 0 0 | 4.4963 | 10.2975 | -0.4426 | -1.3582 | 0.1626 | 4.4963 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.0548 | -1.7066 | -2.8833 | -2.005 | 0.3693 | 2.0548 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -5.6422 | 0.4339 | -3.0268 | -4.4255 | -2.8516 | -5.6422 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.2315 | -0.9193 | -0.9625 | 13.7196 | -1.9704 | 0.2315 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5.05 | 4.9549 | 0.5023 | -0.0525 | 7.5 | 4 | 0 0 0 0 1 | 5.313 | 2.7111 | 12.7202 | 1.5451 | -0.0438 | 5.313 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3883 | -3.3207 | -0.3808 | -0.1461 | -2.971 | 4.3883 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 5.7635 | -0.6995 | -1.7294 | 6.1024 | 1.8317 | 5.7635 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4.3 | 1.0693 | 0.8616 | -4.2573 | 9.5 | 4 | 0 0 0 0 0 | -1.8811 | 11.1484 | 8.5502 | 5.9885 | 4.608 | -1.8811 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -1.7273 | -3.4115 | -0.1881 | -2.6331 | -1.6916 | -1.7273 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3895 | -3.0627 | -1.1001 | 4.7802 | 0.8642 | 4.3895 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5 | 4.9549 | 0.6649 | 10.5 | 0.7021 | 4 | 0 0 0 0 0 | 13.7837 | 4.4863 | -3.5816 | 7.2204 | 7.3678 | 13.7837 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 6.0179 | 3.343 | 6.8931 | 2.2936 | 4.5224 | 6.0179 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 11.3207 | 3.0878 | 5.164 | 2.5572 | 5.3615 | 11.3207 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 8.7383 | 3.2664 | 2.7307 | 3.2405 | 1.8463 | 8.7383 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4.05 | 2.7202 | 0.9497 | -18.9142 | -2.2922 | 4 | 0 0 0 0 0 | -14.0952 | -1.0768 | -4.0059 | -2.4795 | -5.6228 | -14.0952 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -7.7765 | -2.2569 | -3.9959 | -1.3451 | 0.1566 | -7.7765 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4 | 4.9549 | 0.7054 | -25.0658 | -0.5 | 4 | 0 0 0 0 0 | -17.5549 | -2.6051 | -3.8192 | -2.6993 | 6.0774 | -17.5549 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -5.8 | 4.9549 | 0.4109 | -5.3905 | 4 | 4 | 0 0 0 0 0 | -2.4904 | 3.804 | 2.4492 | -14.0754 | 0.8551 | -2.4904 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003926931 uM | Activity at 0.0007804147 uM | Activity at 0.00118 uM | Activity at 0.00232 uM | Activity at 0.00353 uM | Activity at 0.00468 uM | Activity at 0.00703 uM | Activity at 0.014 uM | Activity at 0.021 uM | Activity at 0.041 uM | Activity at 0.063 uM | Activity at 0.122 uM | Activity at 0.190 uM | Activity at 0.286 uM | Activity at 0.563 uM | Activity at 0.859 uM | Activity at 1.138 uM | Activity at 1.709 uM | Activity at 3.373 uM | Activity at 5.124 uM | Activity at 9.921 uM | Activity at 15.37 uM | Activity at 29.76 uM | Activity at 46.08 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 14.818 | 50.7231 | 41 | Partial curve; partial efficacy | -4.8292 | 0.9 | 0.8807 | 54.2209 | 104.944 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 66.2656 | 101.903 | 115.439 | 103.799 | 102.567 | 102.876 | 104.948 | 97.8775 | 93.2447 | 97.159 | 78.0412 | 66.2656 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 1.049 | 79.5313 | 81 | Complete curve; high efficacy | -5.9792 | 1.8851 | 0.9646 | 10.5281 | 90.0594 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -3.7821 | 92.9084 | 86.5524 | 88.9758 | 94.7082 | 82.8235 | 87.7033 | 74.8976 | 28.5615 | 19.9506 | 21.5684 | -3.7821 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 16.6261 | 118.628 | 40 | Partial curve; high efficacy | -4.7792 | 1 | 0.9709 | -16.0121 | 102.616 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.7778 | 104.124 | 95.7465 | 109.29 | 105.625 | 98.8238 | 98.1055 | 101.703 | 89.9585 | 69.8008 | 53.5069 | 8.7778 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 18.6548 | 77.5002 | 20 | Partial curve; partial efficacy | -4.7292 | 2.3332 | 0.9434 | 18.2554 | 95.7555 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 19.8347 | 98.8022 | 92.8907 | 105.302 | 94.7617 | 86.4328 | 101.168 | 96.5676 | 90.4798 | 91.2243 | 70.3799 | 19.8347 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 4.6859 | 68.1888 | 21 | Complete curve; partial efficacy | -5.3292 | 3.0654 | 0.9327 | 29.2373 | 97.4261 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 33.394 | 93.72 | 98.6553 | 91.3219 | 100.534 | 101.289 | 113.289 | 83.2851 | 94.1473 | 57.7627 | 27.4112 | 33.394 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 1.3207 | 98.8766 | 80 | Complete curve; high efficacy | -5.8792 | 0.7 | 0.97 | 6.1967 | 105.073 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.7624 | 107.441 | 91.8586 | 106.704 | 98.4748 | 102.706 | 86.2461 | 62.8478 | 52.8198 | 31.9999 | 28.8143 | 8.7624 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.7292 | 0.9 | 0.6041 | 78.2653 | 102.744 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 82.345 | 102.744 | 105.642 | 94.2843 | 101.161 | 107.516 | 108.028 | 103.339 | 94.1169 | 95.3866 | 97.5226 | 82.345 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 1.3207 | 110.775 | 80 | Complete curve; high efficacy | -5.8792 | 0.8 | 0.9696 | -3.6427 | 107.132 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -3.4271 | 104.368 | 107.148 | 100.937 | 105.181 | 104.184 | 92.5459 | 64.8811 | 33.7264 | 39.5354 | 11.2501 | -3.4271 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 18.6548 | 105.111 | 20 | Partial curve; partial efficacy | -4.7292 | 0.9 | 0.9255 | -5.8485 | 99.2621 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 21.7215 | 107.878 | 91.2729 | 89.9385 | 104.02 | 105.705 | 88.3306 | 100.518 | 80.9433 | 76.5259 | 53.1208 | 21.7215 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 8.3328 | 86.2777 | 20 | Partial curve; partial efficacy | -5.0792 | 1.1 | 0.9442 | 7.2248 | 93.5025 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 17.7991 | 91.4686 | 94.9323 | 90.045 | 102.304 | 79.2054 | 102.459 | 88.2356 | 81.1333 | 58.7329 | 39.0636 | 17.7991 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 20.931 | 52.2091 | 20 | Partial curve; partial efficacy | -4.6792 | 1.8265 | 0.9328 | 52.9832 | 105.192 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 59.944 | 109.664 | 107.488 | 105.075 | 99.4401 | 103.379 | 104.521 | 109.426 | 104.787 | 95.3915 | 89.497 | 59.944 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 6.619 | 108.406 | 40 | Partial curve; high efficacy | -5.1792 | 0.8 | 0.9452 | -14.1974 | 94.2085 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | -0.5296 | 97.0972 | 92.5882 | 98.3581 | 80.5704 | 97.5771 | 87.5474 | 81.5007 | 72.1201 | 33.6196 | 35.4888 | -0.5296 | QC'd by Tocris | |||||||||||||||
| Activator | 0 | 5 | 98.367 | 100.411 | 125.501 | 101.237 | 104.372 | 114.69 | 111.449 | 113.578 | 109.066 | 104.641 | 105.572 | 98.367 | QC'd by Microsource | ||||||||||||||||||||||||
| Inactive | 0 | -4.8292 | 4.9549 | 0.5127 | 87.2712 | 99.6046 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 87.4934 | 96.1046 | 106.281 | 97.5888 | 91.2571 | 100.115 | 100.653 | 99.8934 | 101.313 | 103.822 | 92.9555 | 87.4934 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 18.6548 | 123.677 | 40 | Partial curve; high efficacy | -4.7292 | 0.9 | 0.959 | -23.8326 | 99.8445 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.9869 | 103.298 | 104.486 | 100.971 | 106.52 | 95.1676 | 95.2122 | 85.2723 | 83.2248 | 70.7812 | 53.474 | 6.9869 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.7292 | 3.0654 | 0.4521 | 75.5242 | 101.45 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 76.9764 | 94.831 | 94.8766 | 98.8404 | 87.2962 | 104.404 | 109.036 | 119.352 | 100.091 | 102.064 | 92.4269 | 76.9764 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 0.0021 | 38.4642 | 10 | Complete curve; partial efficacy; poor fit | -8.6792 | 3.5117 | 0.735 | 38.6755 | 77.1397 | -1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 50.4013 | 75.9997 | 53.8566 | 29.664 | 27.3995 | 31.871 | 38.878 | 41.9871 | 44.1 | 44.0222 | 42.1015 | 50.4013 | QC'd by BIOMOL | |||||||||||||||
| Inhibitor | 0.0053 | 59.1285 | 28 | Complete curve; partial efficacy | -8.2792 | 4.9549 | 0.958 | 43.5239 | 102.652 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 35.927 | 100.849 | 102.892 | 55.3229 | 38.8921 | 45.1454 | 52.901 | 48.6458 | 46.1041 | 42.1005 | 38.1565 | 35.927 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Inhibitor | 5.8992 | 73.8782 | 21 | Complete curve; partial efficacy | -5.2292 | 1.7137 | 0.9798 | 31.677 | 105.555 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 31.9936 | 110.951 | 110.702 | 101.775 | 102.835 | 105.882 | 102.962 | 99.3522 | 102.587 | 70.3484 | 46.6733 | 31.9936 | QC'd by Bosche | |||||||||||||||
| Inhibitor | 0.0332 | 70.0249 | 23 | Complete curve; partial efficacy | -7.4792 | 1.5579 | 0.9305 | 21.9114 | 91.9363 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 23.5109 | 91.7062 | 100.195 | 73.5537 | 72.6164 | 43.5294 | 21.1546 | 12.4956 | 13.1856 | 33.0778 | 31.9538 | 23.5109 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003926931 uM | Activity at 0.0007804147 uM | Activity at 0.00118 uM | Activity at 0.00232 uM | Activity at 0.00353 uM | Activity at 0.00468 uM | Activity at 0.00703 uM | Activity at 0.014 uM | Activity at 0.021 uM | Activity at 0.041 uM | Activity at 0.063 uM | Activity at 0.122 uM | Activity at 0.190 uM | Activity at 0.286 uM | Activity at 0.563 uM | Activity at 0.859 uM | Activity at 1.138 uM | Activity at 1.709 uM | Activity at 3.373 uM | Activity at 5.124 uM | Activity at 9.921 uM | Activity at 15.37 uM | Activity at 29.76 uM | Activity at 46.08 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 18.6548 | 34.4951 | 41 | Partial curve; partial efficacy | -4.7292 | 1.9673 | 0.9274 | 69.9387 | 104.434 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 73.1879 | 99.4338 | 106.452 | 103.657 | 105.931 | 103.698 | 108.954 | 106.235 | 100.971 | 99.7778 | 91.1091 | 73.1879 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 16.6261 | 125.293 | 40 | Partial curve; high efficacy | -4.7792 | 1.2475 | 0.9775 | -21.6097 | 103.683 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.3192 | 94.3532 | 105.391 | 101.484 | 107.355 | 105.386 | 112.085 | 102.539 | 90.757 | 78.832 | 46.9198 | 2.3192 | QC'd by Tocris | |||||||||||||||
| Activator | 0 | 5 | 94.6877 | 113.378 | 111.094 | 106.78 | 107.557 | 101.675 | 111.61 | 115.235 | 115.47 | 105.821 | 109.28 | 94.6877 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 23.485 | 37.4969 | 10 | Partial curve; partial efficacy; poor fit | -4.6292 | 1.1 | 0.8115 | 70.3954 | 107.892 | -2.4 | 0 0 0 0 0 0 0 0 0 0 0 | 80.5616 | 111.392 | 111.445 | 104.219 | 112.837 | 110.525 | 103.092 | 99.7926 | 104.941 | 104.267 | 95.8227 | 80.5616 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 13.2066 | 95.7205 | 40 | Partial curve; high efficacy | -4.8792 | 3.5722 | 0.9844 | 7.9202 | 103.641 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.0981 | 97.0208 | 96.7895 | 108.124 | 102.494 | 102.89 | 103.643 | 109.944 | 106.335 | 102.151 | 44.0773 | 8.0981 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 26.3506 | 103.679 | 10 | Single point of activity | -4.5792 | 4.9549 | 0.9811 | -1.9189 | 101.76 | -3 | 1 0 0 0 0 0 0 0 0 0 0 | 4.1751 | 6.3703 | 106.992 | 101.879 | 102.818 | 101.685 | 104.296 | 90.7108 | 103.48 | 100.054 | 95.1253 | 4.1751 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.9792 | 2.5334 | 0.4958 | 110.22 | 114.493 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 109.698 | 111.493 | 112.367 | 116.81 | 116.933 | 113.677 | 115.762 | 113.214 | 111.782 | 107.932 | 112.778 | 109.698 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 3.3173 | 108.071 | 80 | Complete curve; high efficacy | -5.4792 | 2.3332 | 0.9926 | -0.8665 | 107.204 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 1.3296 | 111.132 | 104.656 | 111.282 | 106.67 | 101.163 | 113.541 | 101.431 | 90.0709 | 24.6353 | 2.9091 | 1.3296 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.3792 | 4.9549 | 0.7206 | 87.3453 | 100.288 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 83.0857 | 101.788 | 101.025 | 100.843 | 95.8929 | 94.1551 | 103.88 | 99.413 | 103.84 | 90.9856 | 91.1194 | 83.0857 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 23.485 | 100.465 | 10 | Partial curve; high efficacy; poor fit | -4.6292 | 1.1 | 0.7538 | -10.4084 | 90.0565 | -2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 7.3914 | 96.3907 | 105.734 | 98.6036 | 97.6483 | 86.4323 | 77.1538 | 69.1243 | 70.1964 | 77.2926 | 70.7056 | 7.3914 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.8792 | 4.9549 | 0.4699 | 101.013 | 104.795 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 98.393 | 102.795 | 102.149 | 104.823 | 104.737 | 106.085 | 107.019 | 107.482 | 101.585 | 101.681 | 103.631 | 98.393 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 26.3506 | 112.031 | 40 | Partial curve; high efficacy | -4.5792 | 4.095 | 0.9893 | -5.653 | 106.378 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.4431 | 107.464 | 106.828 | 108.132 | 113.126 | 107.569 | 104.82 | 100.516 | 106.781 | 102.764 | 96.2927 | 4.4431 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -8.4792 | 4.9549 | 0.3254 | 105.011 | 110.672 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 105.918 | 110.172 | 110.982 | 100.455 | 107.597 | 103.885 | 101.019 | 104.824 | 112.319 | 103.719 | 105.539 | 105.918 | QC'd by Microsource | ||||||||||||||||||
| Inactive | 0 | -4.8792 | 0.6 | 0.838 | 93.109 | 109.84 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 97.0641 | 111.84 | 111.287 | 109.037 | 106.641 | 106.427 | 109.712 | 106.233 | 107.465 | 104.09 | 101.747 | 97.0641 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 16.6261 | 114.19 | 40 | Partial curve; high efficacy | -4.7792 | 1.1 | 0.9677 | -11.2483 | 102.941 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.3054 | 105.036 | 96.3351 | 99.5416 | 106.156 | 103.629 | 108.253 | 100.381 | 89.2188 | 74.0557 | 58.245 | 12.3054 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -8.5292 | 4.9549 | 0.3217 | 104.845 | 96.3452 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 102.941 | 96.8452 | 98.109 | 108.225 | 103.862 | 112.562 | 98.7803 | 104.204 | 109.683 | 107.415 | 97.5367 | 102.941 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 0.0042 | 75.0844 | 85 | Complete curve; high efficacy | -8.3792 | 3.6272 | 0.9242 | 26.0286 | 101.113 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 24.6026 | 101.663 | 92.4858 | 36.7868 | 6.1651 | 18.2995 | 35.773 | 32.3087 | 31.585 | 25.0624 | 32.2037 | 24.6026 | QC'd by BIOMOL | |||||||||||||||
| Inhibitor | 0.0037 | 103.451 | 81 | Complete curve; high efficacy | -8.4292 | 4.9549 | 0.9974 | 7.605 | 111.056 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.9147 | 111.584 | 101.473 | 8.46 | 12.4871 | 8.8218 | 7.9055 | 7.9452 | 5.9143 | 6.6889 | 7.5394 | 7.9147 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Activator | 0 | 5 | 96.6652 | 110.077 | 104.404 | 104.234 | 109.705 | 109.251 | 101.473 | 107.396 | 98.5584 | 108.18 | 107.907 | 96.6652 | QC'd by Bosche | ||||||||||||||||||||||||
| Inhibitor | 0.1663 | 107.524 | 80 | Complete curve; high efficacy | -6.7792 | 1.8617 | 0.9953 | 0.1865 | 107.71 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 0.6792 | 106.064 | 110.132 | 106.658 | 108.734 | 86.9112 | 53.8328 | 4.7276 | 2.3546 | 1.3344 | 0.3978 | 0.6792 | QC'd by Tocris |