| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00368 uM | Activity at 0.018 uM | Activity at 0.092 uM | Activity at 0.460 uM | Activity at 2.300 uM | Activity at 11.50 uM | Activity at 57.50 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 3.0654 | 0.7737 | -3.7726 | 3 | 4 | 0 0 0 0 0 0 0 | -3.5605 | 3.6834 | 3.2286 | 1.4865 | 1.0454 | 4.9222 | 2.077 | -3.5605 | QC'd by "Asinex Ltd." | |||||
| Inactive | 0 | 4 | -0.126 | 1.507 | 0.2835 | -0.3168 | 2.1178 | -0.1592 | -0.6728 | -0.126 | QC'd by "Asinex Ltd." | ||||||||||
| Inactive | 0 | 4 | -1.5121 | -0.0243 | 1.9464 | -0.4362 | -0.8973 | -1.02 | -0.339 | -1.5121 | QC'd by "Asinex Ltd." | ||||||||||
| Inactive | 0 | 4 | 2.7183 | 1.1392 | 1.3398 | 1.8 | 2.5929 | -1.134 | -0.7499 | 2.7183 | QC'd by "Asinex Ltd." | ||||||||||
| Inactive | 0 | 4 | 0.9371 | 2.526 | 2.3449 | -0.3047 | -0.1441 | 0.8372 | 2.2436 | 0.9371 | QC'd by "Asinex Ltd." | ||||||||||
| Inactive | 0 | 2.3332 | 0.9745 | -15.701 | 4 | 4 | 0 0 0 0 0 0 0 | -14.3341 | 4.1553 | 3.0451 | 3.1088 | 4.6641 | 6.1754 | -0.9058 | -14.3341 | QC'd by "Chem Div" | |||||
| Inactive | 0 | 4 | 0.4095 | 1.1341 | 3.7231 | -0.0694 | -0.5444 | 1.6455 | 2.77 | 0.4095 | QC'd by "Life Chemicals" | ||||||||||
| Inactive | 0 | 2.7202 | 0.9857 | -18.1225 | 0.5 | 4 | 0 0 0 0 0 0 0 | -16.7687 | 0.6851 | 1.4923 | 0.5194 | -0.8877 | 1.2859 | -1.6738 | -16.7687 | QC'd by "Asinex Ltd." | |||||
| Inhibitor | 10.691 | 95.6541 | 42 | Partial curve; partial efficacy | -4.971 | 0.9 | 0.989 | -94.2459 | 1.4082 | -2.2 | 0 0 0 0 0 0 0 | -78.5383 | 0.9479 | 2.3796 | -1.0123 | 0.8335 | -23.0673 | -45.137 | -78.5383 | QC'd by "Key Organics Ltd." | |
| Inactive | 0 | 4.9549 | 0.9597 | -11.6878 | 1 | 4 | 0 0 0 0 0 0 0 | -10.1565 | 1.3104 | 0.9788 | 0.7234 | 1.1431 | -0.9688 | 1.4714 | -10.1565 | ||||||
| Inactive | 0 | 4 | 1.1301 | -0.241 | 3.6135 | 1.2614 | 0.5453 | -0.2781 | 2.1699 | 1.1301 | |||||||||||
| Inactive | 0 | -4.521 | 4.095 | 0.9859 | -24.661 | 1 | 4 | 0 0 0 0 0 0 0 | -23.0508 | 0.8455 | 2.5884 | -0.3597 | -0.5012 | 1.5413 | 0.6088 | -23.0508 | QC'd by "Chem Div" | ||||
| Inactive | 0 | -4.521 | 2.2481 | 0.9782 | -34.1868 | 1 | 4 | 0 0 0 0 0 0 0 | -27.6556 | 4.3021 | -1.0501 | 0.6344 | 0.9925 | 0.5319 | -2.5794 | -27.6556 | |||||
| Inactive | 0 | 4 | 2.5588 | -1.1886 | -1.0122 | -0.2586 | -1.3517 | -0.7605 | -0.7526 | 2.5588 | QC'd by "Life Chemicals" | ||||||||||
| Inactive | 0 | 4.9549 | 0.9696 | -22.0842 | 0.5 | 4 | 0 0 0 0 0 0 0 | -19.6535 | -0.5568 | 1.5194 | -0.558 | -1.0239 | 2.661 | 1.2897 | -19.6535 | QC'd by "Enamine" | |||||
| Inhibitor | 9.5283 | 82.7928 | 42 | Partial curve; high efficacy | -5.021 | 2.4064 | 0.9978 | -81.2684 | 1.5244 | -2.1 | 0 0 0 0 0 0 0 | -81.267 | 2.0656 | 3.4885 | 0.6372 | -0.7879 | -0.3503 | -47.432 | -81.267 | QC'd by "Enamine" | |
| Inhibitor | 16.9441 | 71.2895 | 21 | Partial curve; partial efficacy | -4.771 | 1.6604 | 0.9979 | -71.8245 | -0.535 | -2.2 | 0 0 0 0 0 0 0 | -63.5034 | -0.8169 | -0.6812 | -0.9446 | 1.8465 | -3.593 | -25.227 | -63.5034 | QC'd by "Enamine" | |
| Inactive | 0 | 4.9549 | 0.9894 | -21.6249 | 0.5 | 4 | 0 0 0 0 0 0 0 | -19.2707 | 0.5316 | -1.0992 | 0.0658 | 0.3204 | 0.4367 | 1.2832 | -19.2707 | QC'd by "Enamine" | |||||
| Inactive | 0 | 4 | 0.5235 | 0.753 | 0.1223 | 0.4654 | 2.3429 | 2.584 | -1.0292 | 0.5235 | QC'd by "Enamine" | ||||||||||
| Inactive | 0 | 4 | -1.33 | 0.0278 | 2.4956 | 0.1202 | -0.5738 | 1.1006 | 0.9974 | -1.33 | QC'd by "Enamine" |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00295 uM | Activity at 0.015 uM | Activity at 0.074 uM | Activity at 0.369 uM | Activity at 1.840 uM | Activity at 9.220 uM | Activity at 46.10 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 2.9093 | 50.5354 | 23 | Partial curve; partial efficacy | -5.5362 | 0.7 | 0.9929 | -48.8038 | 1.7316 | -2.2 | 0 0 0 0 0 0 0 | -43.2489 | -1.054 | 2.1193 | -1.6066 | -6.876 | -20.8245 | -31.9978 | -43.2489 | QC'd by "Chemdiv" | |
| Inactive | 0 | 2.4064 | 0.8698 | -23.1458 | -1 | 4 | 0 0 0 0 0 0 0 | -15.1835 | -3.3735 | 0.4876 | -10.232 | -25.1125 | -26.7881 | -25.3609 | -15.1835 | QC'd by "Tocris" | |||||
| Inhibitor | 0.058 | 46.9497 | 27 | Complete curve; partial efficacy | -7.2362 | 3.1925 | 0.9572 | -47.8385 | -0.8888 | -1.2 | 0 0 0 0 0 0 0 | -53.2718 | -2.1843 | -0.0113 | -33.3305 | -42.3062 | -42.1118 | -53.7632 | -53.2718 | QC'd by "BIOMOL" | |
| Inhibitor | 29.0929 | 36.0144 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9313 | -36.0144 | 0 | -3 | 0 0 0 0 0 0 0 | -32.512 | 3.0902 | -5.136 | 0.7043 | -3.9769 | 1.9811 | 3.1203 | -32.512 | QC'd by "CarsonNewman-SPECS" | |
| Inactive | 0 | -5.0362 | 2.4064 | 0.9713 | -28.5145 | 0 | 4 | 0 0 0 0 0 0 0 | -27.9287 | -1.7911 | 2.8223 | 0.4899 | -2.3072 | 1.677 | -14.8299 | -27.9287 | QC'd by "CarsonNewman-SPECS" | ||||
| Inactive | 0 | 3.5117 | 0.8537 | -3.4237 | -18.348 | 4 | 0 0 0 0 0 0 1 | -33.2465 | -21.9567 | -14.6167 | -15.1022 | -1.6634 | -1.6031 | -7.3523 | -33.2465 | QC'd by "CarsonNewman-SPECS" | |||||
| Inactive | 0 | 0.7 | 0.4527 | -4 | -31.8292 | 4 | 0 0 0 0 0 0 1 | -39.4023 | -23.191 | -11.8344 | -14.5214 | 0.9411 | 0.1198 | -15.9636 | -39.4023 | QC'd by "CarsonNewman-SPECS" | |||||
| Inhibitor | 9.2 | 78.218 | 42 | Partial curve; partial efficacy | -5.0362 | 1.2475 | 0.9953 | -75.7625 | 2.4554 | -2.2 | 0 0 0 0 0 0 0 | -66.4584 | -0.0753 | 4.4328 | 0.1139 | 3.4111 | -7.0088 | -36.8887 | -66.4584 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 14.581 | 60.0079 | 21 | Partial curve; partial efficacy | -4.8362 | 2.1211 | 0.9818 | -55.4823 | 4.5256 | -2.2 | 0 0 0 0 0 0 0 | -50.7442 | 0.3388 | 2.6752 | 4.3632 | 5.9636 | 8.7444 | -12.2868 | -50.7442 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 20.5962 | 59.9867 | 10 | Single point of activity | -4.6862 | 3.2975 | 0.9865 | -57.9029 | 2.0838 | -3 | 0 0 0 0 0 0 0 | -53.8622 | 0.477 | 2.9216 | -2.5993 | 4.4615 | 4.2612 | -1.7336 | -53.8622 | QC'd by "CarsonNewman-SPECS" | |
| Inactive | 0 | -5.2862 | 3.2975 | 0.9605 | -28.7625 | -1.5 | 4 | 0 0 0 0 0 0 0 | -28.9687 | -5.9503 | 0.7443 | 2.0073 | -2.3137 | -2.5779 | -24.8499 | -28.9687 | QC'd by "CarsonNewman-SPECS" | ||||
| Activator | 0 | -6.1862 | 0.8 | 0.9543 | -35.1073 | 35.3974 | 5 | 0 0 0 0 0 0 0 | -36.8495 | 29.2448 | 35.394 | 32.8426 | -1.4268 | -9.9598 | -23.8198 | -36.8495 | QC'd by "UNC" | ||||
| Inactive | 0 | -5.2362 | 3.5722 | 0.979 | -29.4797 | -1 | 4 | 0 0 0 0 0 0 0 | -29.5664 | -2.6266 | 1.7791 | -3.5765 | 1.1061 | -1.5199 | -25.1201 | -29.5664 | QC'd by "Asinex Ltd." | ||||
| Inactive | 0 | 1.6266 | 0.8619 | -12.8836 | -1 | 4 | 0 0 0 0 0 0 0 | -11.153 | -1.8492 | 1.729 | -3.2576 | 0.1518 | -1.2665 | -4.5816 | -11.153 | QC'd by "Asinex Ltd." | |||||
| Inhibitor | 8.1995 | 34.8803 | 21 | Partial curve; partial efficacy | -5.0862 | 1 | 0.9733 | -35.3803 | -0.5 | -2.2 | 0 0 0 0 0 0 0 | -30.3169 | -2.0214 | 1.2967 | -2.6476 | 1.0235 | -8.8042 | -18.3495 | -30.3169 | QC'd by "Asinex Ltd." | |
| Inhibitor | 23.1093 | 33.8898 | 10 | Single point of activity | -4.6362 | 3.0654 | 0.9624 | -36.8898 | -3 | -3 | 0 0 0 0 0 0 0 | -33.2415 | -5.3748 | 1.439 | -5.0766 | -2.0615 | -2.8448 | -4.7558 | -33.2415 | QC'd by "Asinex Ltd." | |
| Inhibitor | 16.3601 | 34.1902 | 10 | Partial curve; partial efficacy; poor fit | -4.7862 | 1.8265 | 0.8925 | -37.6902 | -3.5 | -2.4 | 0 0 0 0 0 0 0 | -33.0752 | -0.9038 | 0.3051 | -4.2129 | -11.4639 | -2.381 | -12.2122 | -33.0752 | QC'd by "DPISMR" | |
| Inactive | 0 | 2.3332 | 0.8149 | -7.5604 | 2.5 | 4 | 0 0 0 0 0 0 0 | -7.1337 | 0.6779 | 3.1519 | -0.3867 | 4.5089 | 3.4253 | -0.5641 | -7.1337 | QC'd by "InterBioScreen" | |||||
| Inactive | 0 | 4 | -3.6735 | 0.2076 | -2.2121 | 0.5965 | 0.7393 | -4.0036 | -2.6081 | -3.6735 | QC'd by "DPISMR" | ||||||||||
| Inhibitor | 7.3078 | 34.4943 | 21 | Partial curve; partial efficacy | -5.1362 | 3.5117 | 0.9188 | -36.6032 | -2.1088 | -2.2 | 0 0 0 0 0 0 0 | -36.6696 | -3.6853 | -3.7391 | -9.3642 | 0.3947 | 4.4185 | -25.9259 | -36.6696 | QC'd by "InterBioScreen" |
| Phenotype | Analysis Comment | Activity_Score | Max_Response | Activity at 0.029 uM | Activity at 0.115 uM | Activity at 0.144 uM | Activity at 0.230 uM | Activity at 0.575 uM | Activity at 1.257 uM | Activity at 2.059 uM | Activity at 2.870 uM | Activity at 3.790 uM | Activity at 5.750 uM | Activity at 7.911 uM | Activity at 11.54 uM | Activity at 17.22 uM | Activity at 25.95 uM | Activity at 38.35 uM | Activity at 57.50 uM | Activity at 85.10 uM | Activity at 115.2 uM | Activity at 153.0 uM | Activity at 245.0 uM | Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -0.96 | 3.5361 | -0.96 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9559 | -3.6852 | -0.9559 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9553 | -5.7534 | -0.9553 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9545 | -5.6084 | -0.9545 | QC'd by ChemRoutes | ||||||||||||||||||||
| Inactive | 0 | -0.953 | -2.3216 | -0.953 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9492 | 2.2186 | -0.9492 | QC'd by Edelris | ||||||||||||||||||||
| Inactive | 0 | -0.9486 | -1.2758 | -0.9486 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9467 | 4.4666 | -0.9467 | QC'd by ChemRoutes | ||||||||||||||||||||
| Inactive | 0 | -0.9436 | -8.9932 | -0.9436 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9422 | -1.7826 | -0.9422 | QC'd by Analyticon | ||||||||||||||||||||
| Inactive | 0 | -0.941 | 5.2115 | -0.941 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9398 | 4.3972 | -0.9398 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9362 | 4.3836 | -0.9362 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9299 | 2.8643 | -0.9299 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9293 | 4.8772 | -0.9293 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9286 | -10.0521 | -0.9286 | QC'd by Chemdiv | ||||||||||||||||||||
| Inactive | 0 | -0.9253 | -2.1742 | -0.9253 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -0.9204 | 0.4163 | -0.9204 | QC'd by Edelris | ||||||||||||||||||||
| Inactive | 0 | -0.9193 | -0.0183 | -0.9193 | QC'd by Analyticon | ||||||||||||||||||||
| Inactive | 0 | -0.9182 | -0.8109 | -0.9182 | QC'd by Analyticon |
| Inhibit teichoic acid synthesis (OD600_A) | Inhibit teichoic acid synthesis (OD600_B) | Inhibit teichoic acid synthesis (% Survival_A) | Inhibit teichoic acid synthesis (% Survival_B) | Inhibit teichoic acid synthesis (% Survival_Avg) | Score | Panel ID | Panel Name |
|---|---|---|---|---|---|---|---|
| 0.175 | 0.164 | 55 | 62 | 58 | 42 | 2 | DeltatarO mutant |
| 0.097 | 0.16 | -17 | 31 | 7 | 1 | Wild type | |
| 0.156 | 0.124 | 45 | 33 | 39 | 61 | 2 | DeltatarO mutant |
| 0.281 | 0.309 | 79 | 84 | 81 | 1 | Wild type | |
| 0.175 | 0.134 | 55 | 40 | 47 | 53 | 2 | DeltatarO mutant |
| 0.236 | 0.254 | 56 | 64 | 60 | 1 | Wild type | |
| 0.174 | 0.158 | 54 | 58 | 56 | 44 | 2 | DeltatarO mutant |
| 0.248 | 0.283 | 62 | 75 | 68 | 1 | Wild type | |
| 0.201 | 0.159 | 68 | 58 | 63 | 37 | 2 | DeltatarO mutant |
| 0.281 | 0.312 | 79 | 85 | 82 | 1 | Wild type | |
| 0.225 | 0.199 | 80 | 88 | 84 | 16 | 2 | DeltatarO mutant |
| 0.245 | 0.277 | 60 | 72 | 66 | 1 | Wild type | |
| 0.158 | 0.138 | 46 | 43 | 45 | 55 | 2 | DeltatarO mutant |
| 0.297 | 0.311 | 87 | 84 | 86 | 1 | Wild type | |
| 0.168 | 0.122 | 51 | 31 | 41 | 59 | 2 | DeltatarO mutant |
| 0.255 | 0.269 | 65 | 70 | 68 | 1 | Wild type | |
| 0.169 | 0.148 | 52 | 50 | 51 | 49 | 2 | DeltatarO mutant |
| 0.251 | 0.267 | 63 | 69 | 66 | 1 | Wild type | |
| 0.184 | 0.165 | 59 | 63 | 61 | 39 | 2 | DeltatarO mutant |
| 0.281 | 0.315 | 79 | 86 | 82 | 1 | Wild type |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000386857 uM | Activity at 0.0001060182 uM | Activity at 0.0001896372 uM | Activity at 0.0004510146 uM | Activity at 0.0007501981 uM | Activity at 0.0009728036 uM | Activity at 0.00288 uM | Activity at 0.00508 uM | Activity at 0.00871 uM | Activity at 0.015 uM | Activity at 0.026 uM | Activity at 0.053 uM | Activity at 0.079 uM | Activity at 0.232 uM | Activity at 0.457 uM | Activity at 0.692 uM | Activity at 1.068 uM | Activity at 2.292 uM | Activity at 3.859 uM | Activity at 11.39 uM | Activity at 17.02 uM | Activity at 25.62 uM | Activity at 57.25 uM | Activity at 87.55 uM | Activity at 183.4 uM | Activity at 286.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6.75 | 4.9549 | 0.9727 | 0.0901 | 17.5 | 4 | 0 0 0 1 | 8.9408 | 15.9527 | -1.5916 | 1.4969 | 8.9408 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.3 | 4.095 | 0.9996 | 5.5 | -7.7823 | 4 | 0 0 0 1 | -11.1081 | -7.5736 | -7.7353 | 5.034 | -11.1081 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.15 | 4.9549 | 0.907 | -15.9207 | 9.5 | 4 | 0 0 0 1 | 17.8725 | 5.2874 | 13.9021 | -13.6839 | 17.8725 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 35.4813 | 46.4095 | 0 | Single point of activity | -4.45 | 2.5884 | 1 | 45.9404 | -0.4691 | 3 | 1 0 0 0 | 35.593 | 40.1678 | -0.3909 | 1.933 | 35.593 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 39.8107 | 72.2646 | 0 | Single point of activity | -4.4 | 4.9549 | 0.9515 | 68.1912 | -4.0733 | 3 | 0 0 0 0 | 58.0117 | 5.8738 | -9.2278 | -8.5224 | 58.0117 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 14.1254 | 45.3319 | 0 | Partial curve; partial efficacy; poor fit | -4.85 | 2.4064 | 0.9982 | 40.7728 | -4.5591 | 2.4 | 1 0 0 0 | 40.0933 | -24.9557 | -3.8845 | 11.5254 | 40.0933 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -5.75 | 4.9549 | 0.9291 | -20.6086 | 33.1545 | 4 | 1 0 0 0 | -12.8464 | 45.4569 | 28.2161 | -28.42 | -12.8464 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.35 | 4.9549 | 0.855 | -24.2184 | -0.5 | 4 | 0 0 0 0 | -18.932 | -3.6477 | -2.409 | 4.988 | -18.932 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 3.6272 | 0.8625 | 15 | -8.5523 | 4 | 0 0 0 0 | 14.477 | -2.951 | -13.7936 | -5.9646 | 14.477 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.7 | 4.9549 | 0.6637 | 3 | -16.864 | 4 | 0 0 0 0 | 8.8169 | -15.72 | 6.3794 | -6.3599 | 8.8169 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 2.4064 | 0.9999 | 21.5 | -2.4101 | 4 | 1 0 0 0 | 20.2184 | 33.3778 | -2.4251 | 3.5771 | 20.2184 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.8117 | 2.5 | -8.345 | 4 | 0 0 0 0 | 1.096 | -8.966 | -5.5054 | -11.1209 | 1.096 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 39.8107 | 38.7945 | 0 | Single point of activity | -4.4 | 4.9549 | 0.6241 | 41.7557 | 2.9612 | 3 | 0 0 0 0 | 36.2039 | 21.355 | -6.3904 | -4.5325 | 36.2039 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -6.05 | 4.095 | 0.9994 | -6.0518 | 20 | 4 | 0 0 0 1 | 20.5156 | 19.7377 | 1.4122 | -6.2932 | 20.5156 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.2 | 4.095 | 1 | 10.5 | -10.1683 | 4 | 1 0 0 1 | -15.9884 | 36.1362 | -10.1402 | 8.7939 | -15.9884 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.5 | 1.3905 | 0.9999 | -24.241 | 0.2745 | 4 | 0 0 0 1 | -5.5981 | -4.3546 | -20.7587 | -23.9509 | -5.5981 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.711 | -2.4459 | 21 | 4 | 0 0 0 0 | -3.3453 | 17.3219 | -9.9549 | 5.5495 | -3.3453 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 39.8107 | 47.809 | 0 | Partial curve; partial efficacy; poor fit | -4.4 | 4.9549 | 0.5212 | 50.2399 | 2.4309 | 2.4 | 0 0 0 0 | 43.4722 | 30.2363 | -10.9855 | -11.5143 | 43.4722 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 22.3872 | 75.5081 | 0 | Partial curve; high efficacy; poor fit | -4.65 | 1.9673 | 0.9829 | 96.5324 | 21.0243 | 2.3 | 0 0 0 0 | 86.4985 | 26.0932 | 16.3365 | 36.2613 | 86.4985 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.7429 | -1 | -13.0738 | 4 | 0 0 0 0 | 1.8063 | -11.3115 | 0.8702 | -5.1757 | 1.8063 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00295 uM | Activity at 0.015 uM | Activity at 0.074 uM | Activity at 0.369 uM | Activity at 1.840 uM | Activity at 9.220 uM | Activity at 46.10 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 0.4611 | 127.6706 | 91 | Complete curve; high efficacy | -6.3362 | 0.8 | 0.9629 | -117.9324 | 9.7381 | -1.1 | 0 0 0 0 0 0 0 | -114.9439 | 0.1462 | 6.7829 | -3.0457 | -63.3386 | -73.1871 | -112.7326 | -114.9439 | QC'd by "Chemdiv" | |
| Inhibitor | 0.3663 | 150.15 | 94 | Complete curve; high efficacy | -6.4362 | 1.9673 | 0.9965 | -142.2946 | 7.8554 | -1.1 | 0 0 0 0 0 0 0 | -137.0793 | 12.5 | 0.8151 | 4.1952 | -68.5044 | -137.8226 | -144.6083 | -137.0793 | QC'd by "Tocris" | |
| Inhibitor | 0.0366 | 153.0293 | 100 | Complete curve; high efficacy | -7.4362 | 4.9549 | 0.991 | -146.3466 | 6.6827 | -1.1 | 0 0 0 0 0 0 0 | -151.4976 | -3.7176 | 15.5689 | -146.466 | -145.1462 | -142.0212 | -143.328 | -151.4976 | QC'd by "BIOMOL" | |
| Inhibitor | 9.2 | 116.6125 | 43 | Partial curve; high efficacy | -5.0362 | 2.0479 | 0.9392 | -113.4307 | 3.1818 | -2.1 | 0 0 0 0 0 0 0 | -108.0292 | -18.1482 | 8.7373 | 4.0609 | 19.2435 | -1.1542 | -57.3798 | -108.0292 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 3.6626 | 131.4389 | 86 | Complete curve; high efficacy | -5.4362 | 2.1211 | 0.9867 | -119.2873 | 12.1517 | -1.1 | 0 0 0 0 0 0 0 | -120.4922 | 0.5952 | 11.3772 | 12.6904 | 22.4685 | -13.75 | -100.3887 | -120.4922 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 7.3078 | 66.4885 | 42 | Partial curve; partial efficacy | -5.1362 | 1.8851 | 0.9654 | -71.6171 | -5.1286 | -2.2 | 0 0 0 0 0 0 0 | -69.8396 | -13.3563 | 1.4462 | -8.6294 | -0.6061 | -9.7551 | -45.1204 | -69.8396 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 1.4581 | 36.4433 | 10 | Partial curve; partial efficacy; poor fit | -5.8362 | 2.3332 | 0.8494 | -37.2485 | -0.8051 | -2.4 | 0 0 0 0 0 1 0 | -36.8737 | -12.8551 | 4.3142 | 6.1775 | -1.8182 | -24.492 | -69.078 | -36.8737 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 1.636 | 140.9209 | 89 | Complete curve; high efficacy | -5.7862 | 4.9549 | 0.9809 | -138.4526 | 2.4683 | -1.1 | 0 0 0 0 0 0 0 | -146.9772 | -8.2707 | 1.4812 | 0.2137 | 17.5758 | -90.5921 | -127.7512 | -146.9772 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 6.5131 | 134.3412 | 44 | Partial curve; high efficacy | -5.1862 | 2.4064 | 0.9726 | -129.0054 | 5.3357 | -2.1 | 0 0 0 0 0 0 0 | -127.2243 | 2.8111 | -2.3821 | -2.0082 | 25.2245 | -3.052 | -88.3686 | -127.2243 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 7.3078 | 154.6947 | 45 | Partial curve; high efficacy | -5.1362 | 3.5117 | 0.9844 | -153.0133 | 1.6814 | -2.1 | 0 0 0 0 0 0 0 | -150.0131 | -3.2949 | -3.6585 | -0.4487 | -1.3685 | 18.125 | -110.1131 | -150.0131 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 4.1095 | 124.389 | 86 | Complete curve; high efficacy | -5.3862 | 4.095 | 0.9751 | -125.8446 | -1.4557 | -1.1 | 0 0 0 0 0 0 0 | -127.1158 | 18.4524 | -8.1079 | -7.1474 | -9.0732 | -6.875 | -120.0256 | -127.1158 | QC'd by "CarsonNewman-SPECS" | |
| Inhibitor | 6.5131 | 97.2138 | 43 | Partial curve; high efficacy | -5.1862 | 2.2481 | 0.957 | -95.6397 | 1.5741 | -2.1 | 0 0 0 0 0 0 0 | -94.8806 | 10.0582 | 9.2705 | -15.736 | 1.8182 | -3.3942 | -64.2383 | -94.8806 | QC'd by "UNC" | |
| Inhibitor | 3.2643 | 104.7612 | 85 | Complete curve; high efficacy | -5.4862 | 4.5045 | 0.9922 | -99.2655 | 5.4957 | -1.1 | 0 0 0 0 0 0 0 | -99.6641 | 7.7381 | -3.8274 | 7.6142 | 10.2499 | -1.25 | -98.3216 | -99.6641 | QC'd by "Asinex Ltd." | |
| Inhibitor | 3.6626 | 105.2276 | 45 | Partial curve; high efficacy | -5.4362 | 1 | 0.9848 | -99.0929 | 6.1347 | -2.1 | 0 0 0 0 0 0 0 | -91.2458 | 5.3919 | 5.481 | -0.8596 | 6.0606 | -33.8641 | -66.6319 | -91.2458 | QC'd by "Asinex Ltd." | |
| Inhibitor | 1.4581 | 102.7699 | 87 | Complete curve; high efficacy | -5.8362 | 1.4641 | 0.9854 | -108.2575 | -5.4875 | -1.1 | 0 0 0 0 0 0 0 | -108.6922 | -13.8402 | 1.0585 | -10.5649 | -11.0264 | -68.8105 | -99.3381 | -108.6922 | QC'd by "Asinex Ltd." | |
| Inhibitor | 6.5131 | 137.6899 | 45 | Partial curve; high efficacy | -5.1862 | 2.1211 | 0.9942 | -136.9696 | 0.7203 | -2.1 | 0 0 0 0 0 0 0 | -135.0785 | -4.7696 | 8.982 | 2.5381 | -2.7566 | -8.125 | -92.7566 | -135.0785 | QC'd by "Asinex Ltd." | |
| Inhibitor | 4.1095 | 100.7428 | 84 | Complete curve; high efficacy | -5.3862 | 2.3531 | 0.9881 | -84.085 | 16.6577 | -1.1 | 0 0 0 0 0 0 0 | -83.0567 | 15.5597 | 18.6749 | 8.012 | 24.4125 | 3.4466 | -71.5615 | -83.0567 | QC'd by "DPISMR" | |
| Inhibitor | 18.3564 | 117.3766 | 41 | Partial curve; partial efficacy | -4.7362 | 1.3437 | 0.9856 | -102.3987 | 14.9779 | -2.2 | 0 0 0 0 0 0 0 | -77.0357 | 16.2558 | 10.5351 | 13.2373 | 22.522 | 6.6129 | -16.8831 | -77.0357 | QC'd by "InterBioScreen" | |
| Inhibitor | 10.3225 | 93.8007 | 42 | Partial curve; high efficacy | -4.9862 | 1.8851 | 0.9812 | -86.9995 | 6.8012 | -2.1 | 0 0 0 0 0 0 0 | -80.3027 | 1.9528 | 0 | 7.3945 | 13.6736 | 5.625 | -34.032 | -80.3027 | QC'd by "DPISMR" | |
| Activator | 0 | -5.5362 | 4.5045 | 0.9716 | -137.4364 | 17.2653 | 5 | 0 0 0 0 0 0 0 | -139.5196 | 1.7857 | 15.6956 | 8.8443 | 42.2207 | -0.1277 | -133.6667 | -139.5196 | QC'd by "InterBioScreen" |
| Phenotype | Potency | Efficacy | Analysis Comment | FF-overN-Activity_Score | FF-overN-Curve_Description | FF-overN-Fit_LogAC50 | FF-overN-Fit_HillSlope | FF-overN-Fit_R2 | FF-overN-Fit_InfiniteActivity | FF-overN-Fit_ZeroActivity | FF-overN-Fit_CurveClass | FF-overN-Excluded_Points | FF-overN-Max_Response | FF-overN-Activity at 0.0000389080 uM | FF-overN-Activity at 0.0001066275 uM | FF-overN-Activity at 0.0001907270 uM | FF-overN-Activity at 0.0004536066 uM | FF-overN-Activity at 0.0007545096 uM | FF-overN-Activity at 0.0009786459 uM | FF-overN-Activity at 0.00290 uM | FF-overN-Activity at 0.00503 uM | FF-overN-Activity at 0.00876 uM | FF-overN-Activity at 0.015 uM | FF-overN-Activity at 0.026 uM | FF-overN-Activity at 0.052 uM | FF-overN-Activity at 0.080 uM | FF-overN-Activity at 0.235 uM | FF-overN-Activity at 0.459 uM | FF-overN-Activity at 0.740 uM | FF-overN-Activity at 1.165 uM | FF-overN-Activity at 2.228 uM | FF-overN-Activity at 5.999 uM | FF-overN-Activity at 11.47 uM | FF-overN-Activity at 19.13 uM | FF-overN-Activity at 25.10 uM | FF-overN-Activity at 57.49 uM | FF-overN-Activity at 115.7 uM | FF-overN-Activity at 221.8 uM | FF-overN-Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | -8.5233 | -2.8988 | -12.5908 | -2.7412 | -8.5233 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.3 | 4.9549 | 0.5242 | -0.0894 | -10.9265 | 4 | 0 0 0 0 | -0.0745 | -3.5393 | -17.8554 | -0.1186 | -0.0745 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.5515 | -1.0417 | -4.8967 | 0.166 | -2.5515 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.25 | 2.6384 | 0.9993 | 6 | -4.4279 | 4 | 0 0 0 0 | 5.847 | -4.5232 | -4.121 | 4.7547 | 5.847 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.2043 | 0.5279 | -0.6989 | -3.0106 | 0.2043 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -20.4584 | -16.0227 | -10.542 | -12.7 | -20.4584 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.3811 | 1.9328 | 2.0137 | 3.5425 | 0.3811 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.6 | 1.8617 | 0.9679 | -30.78 | -11.3123 | 4 | 0 0 0 0 | -27.3167 | -13.1248 | -9.8436 | -15.1075 | -27.3167 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 1.8851 | 0.9245 | -20.4108 | -4.6526 | 4 | 0 0 0 0 | -18.259 | -6.997 | -2.6272 | -8.4549 | -18.259 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 7.0749 | 12.0764 | 9.4363 | 10.9955 | 7.0749 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 2.3332 | 0.9933 | -31.579 | -4.4538 | 4 | 0 0 0 0 | -28.8158 | -5.5887 | -3.2948 | -9.4116 | -28.8158 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.8635 | 4.4516 | 3.8206 | 7.1937 | 2.8635 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.65 | 1.7529 | 0.9999 | 3.5 | -15.007 | 4 | 0 0 0 1 | -13.3605 | -15.0059 | -10.5774 | 2.4893 | -13.3605 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 1.9673 | 0.9934 | -42.2319 | -13.8044 | 4 | 0 0 0 0 | -38.812 | -14.9413 | -12.7536 | -21.2969 | -38.812 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.9 | 3.132 | 0.6223 | -3.5849 | -13.7261 | 4 | 0 0 0 0 | -3.8208 | -9.1712 | -18.1051 | -9.386 | -3.8208 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.45 | 0.4 | 0.8262 | 1.069 | -18.8346 | 4 | 0 0 0 0 | -2.4425 | -15.6955 | -9.0343 | -9.4911 | -2.4425 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.95 | 3.132 | 0.7705 | 1.5 | -12.3707 | 4 | 0 0 0 0 | 1.5975 | -7.9378 | -16.9756 | -5.1738 | 1.5975 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.5045 | 0.3905 | -9.2851 | -1.5746 | 4 | 0 0 0 0 | -7.9625 | -2.9788 | -14.4042 | -5.0533 | -7.9625 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.8608 | -22.7116 | -5.6684 | 4 | 0 0 0 0 | -20.1763 | -4.2865 | -9.9046 | -3.4737 | -20.1763 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.15 | 4.9549 | 0.5637 | 1 | -8.3478 | 4 | 0 0 0 1 | -11.1241 | -3.9652 | -12.7899 | 0.2253 | -11.1241 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000295000 uM | Activity at 0.0000590000 uM | Activity at 0.0001503265 uM | Activity at 0.0002712146 uM | Activity at 0.0005895491 uM | Activity at 0.00117 uM | Activity at 0.00179 uM | Activity at 0.00299 uM | Activity at 0.00672 uM | Activity at 0.014 uM | Activity at 0.026 uM | Activity at 0.040 uM | Activity at 0.074 uM | Activity at 0.167 uM | Activity at 0.363 uM | Activity at 0.628 uM | Activity at 0.975 uM | Activity at 1.849 uM | Activity at 4.119 uM | Activity at 9.037 uM | Activity at 15.83 uM | Activity at 21.08 uM | Activity at 46.23 uM | Activity at 92.54 uM | Activity at 165.6 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4 | -3.0662 | -2.4126 | 1.9741 | -4.0617 | -0.6298 | -3.0662 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7346 | -0.808 | -4.308 | 4 | 0 0 0 0 0 | -0.431 | -4.308 | 0.8987 | -1.5892 | -1.522 | -0.431 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6448 | -12.5127 | 4.5585 | 4 | 0 0 0 0 0 | -9.7509 | 6.5585 | 1.6006 | -0.8104 | 11.697 | -9.7509 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 18.3564 | 99.0378 | 41 | Partial curve; high efficacy | -4.7362 | 2.8473 | 0.9985 | -99.5803 | -0.5425 | -2.1 | 0 0 0 0 0 | -92.8278 | -1.5772 | -1.9365 | 1.8258 | -13.1847 | -92.8278 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 29.0929 | 42.1815 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9879 | -50.8391 | -8.6577 | -3 | 0 0 0 0 0 | -46.8496 | -7.6387 | -8.6142 | -11.6103 | -6.66 | -46.8496 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 18.3564 | 123.8718 | 41 | Partial curve; high efficacy | -4.7362 | 1.6259 | 0.9975 | -121.4578 | 2.414 | -2.1 | 0 0 0 0 0 | -98.8224 | 5.0098 | -1.1767 | -0.5372 | -27.2941 | -98.8224 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 14.581 | 109.9073 | 42 | Partial curve; high efficacy | -4.8362 | 1.8265 | 0.9637 | -106.4086 | 3.4987 | -2.1 | 0 0 0 0 0 | -94.6709 | 12.0352 | -9.7094 | 6.0901 | -28.9742 | -94.6709 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | 0.3 | 0.9096 | -34.0578 | -3.7697 | 4 | 0 0 0 0 0 | -28.0098 | -7.7697 | -15.2699 | -21.1534 | -19.3019 | -28.0098 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 29.0929 | 90.8978 | 10 | Single point of activity | -4.5362 | 4.4495 | 0.9936 | -90.3368 | 0.561 | -3 | 0 0 0 0 0 | -79.9635 | 5.0637 | -2.1732 | -1.6903 | 0.5114 | -79.9635 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | 0.3 | 0.4266 | 15.2787 | -6.7213 | 4 | 0 0 0 0 0 | 10.4803 | -5.7213 | 8.5589 | -5.3046 | 6.719 | 10.4803 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 1.9673 | 0.6089 | -9.5082 | 5.2968 | 4 | 0 0 0 0 0 | -7.9574 | 7.2968 | -1.8903 | 10.3946 | 1.3036 | -7.9574 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 16.3601 | 45.5047 | 10 | Single point of activity | -4.7862 | 4.9549 | 0.9618 | -49.1256 | -3.6209 | -3 | 0 0 0 0 0 | -48.9315 | -7.5358 | -6.333 | 2.7698 | -6.0371 | -48.9315 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | -5.2862 | 0.8 | 0.9747 | -26.7427 | 8.4372 | 4 | 0 0 0 0 0 | -20.7127 | 9.4372 | 2.2965 | 0.248 | -14.6534 | -20.7127 | QC'd by "Chem Div" | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9526 | -10.3928 | 12.1594 | 4 | 0 0 0 0 0 | -10.3008 | 7.6594 | 13.8067 | 14.3816 | -9.7278 | -10.3008 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 2.2526 | 0.9456 | -15.0824 | -3.8247 | 4 | 0 0 0 0 0 | -14.7061 | -2.8247 | -5.6912 | -3.1226 | -9.4063 | -14.7061 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 12.9953 | 78.8447 | 42 | Partial curve; high efficacy | -4.8862 | 1.5579 | 0.9935 | -82.5518 | -3.7072 | -2.1 | 0 0 0 0 0 | -72.8175 | -6.4603 | -0.3489 | -8.7793 | -32.8366 | -72.8175 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 18.3564 | 49.7424 | 10 | Single point of activity | -4.7362 | 2.8473 | 0.9797 | -46.1416 | 3.6008 | -3 | 0 0 0 0 0 | -42.7679 | -0.8992 | 4.983 | 6.9739 | -2.5062 | -42.7679 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8308 | -9.799 | 10.4725 | 4 | 0 0 0 0 0 | -5.0871 | 8.4725 | 8.2561 | 10.0709 | 16.081 | -5.0871 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 1.8851 | 0.9722 | -5.7685 | 6.2205 | 4 | 0 0 0 0 0 | -5.063 | 6.2205 | -1.5445 | -7.1037 | -5.5678 | -5.063 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 0.3 | 0.842 | -31.9249 | 3.174 | 4 | 0 0 0 0 0 | -26.7418 | -0.826 | -13.6909 | -13.1344 | -14.0869 | -26.7418 | QC'd by "Chem Div" |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00111 uM | Activity at 0.00284 uM | Activity at 0.00446 uM | Activity at 0.00891 uM | Activity at 0.015 uM | Activity at 0.029 uM | Activity at 0.036 uM | Activity at 0.073 uM | Activity at 0.113 uM | Activity at 0.149 uM | Activity at 0.293 uM | Activity at 0.487 uM | Activity at 0.726 uM | Activity at 1.458 uM | Activity at 2.011 uM | Activity at 3.331 uM | Activity at 5.199 uM | Activity at 7.343 uM | Activity at 13.78 uM | Activity at 20.90 uM | Activity at 36.53 uM | Activity at 60.71 uM | Activity at 87.88 uM | Activity at 127.3 uM | Activity at 194.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 1.3987 | 0.9996 | -13.0836 | -0.5853 | 4 | 0 0 0 1 | -0.8016 | -2.9877 | -9.467 | -12.5697 | -0.8016 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inhibitor | 12.5893 | 40.5111 | 10 | Single point of activity | -4.9 | 4.5045 | 0.9991 | -45.3562 | -4.8451 | -3 | 0 0 0 0 | -45.0493 | -5.3378 | -3.9936 | -8.2693 | -45.0493 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||
| Inactive | 0 | 4 | 0 | -2.0352 | 0 | 0 | 0 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | 0 | 0 | 0 | -0.9941 | 0 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 1 | 0 | -13.6335 | 4 | 0 0 0 0 | 0 | -12.1946 | 0 | 0 | 0 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 4 | 0 | 0 | 0 | 0 | 0 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | -13.3369 | -12.1444 | -5.0835 | -13.8274 | -13.3369 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | 0 | -4.5112 | -3.9568 | 0 | 0 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | 0 | 0 | 0 | 0 | 0 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 1.8079 | 0.9998 | -19.413 | 1.5 | 4 | 0 0 0 1 | -2.2992 | 0 | -11.3763 | -18.6775 | -2.2992 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7721 | 4 | -15.6398 | 4 | 0 0 0 0 | 0 | -10.469 | -15.9421 | -20.9499 | 0 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9987 | -20.1455 | -0.5 | 4 | 0 0 0 0 | -19.2879 | 0 | -0.8113 | -0.6866 | -19.2879 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9999 | -7.3207 | 0 | 4 | 0 0 0 0 | -6.934 | 0 | 0 | 0 | -6.934 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 4 | -10.1341 | 0 | -23.8022 | -3.1543 | -10.1341 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 1.8265 | 0.9999 | -31.5926 | 1 | 4 | 0 0 0 1 | -8.4479 | 0 | -12.323 | -29.2439 | -8.4479 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 0.7 | 0.9542 | 2 | -18.0981 | 4 | 0 0 0 0 | 0 | -15.9151 | -9.0083 | -6.2439 | 0 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7994 | 0.5884 | -8.2 | 4 | 0 0 0 0 | -1.1763 | -9.1365 | -5.7126 | -9.75 | -1.1763 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 0.6 | 0.9653 | -16.2314 | 0.756 | 4 | 0 0 0 0 | -14.3595 | -3.5367 | -8.6422 | -10.5182 | -14.3595 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||
| Inactive | 0 | 4 | -3.3063 | -1.5829 | -0.4572 | 0 | -3.3063 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7973 | -6.6878 | -1.5 | 4 | 0 0 0 1 | 0 | -2.5435 | 0 | -5.5731 | 0 | QC'd by "Asinex Ltd." |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000295000 uM | Activity at 0.0000590000 uM | Activity at 0.0001503265 uM | Activity at 0.0002712146 uM | Activity at 0.0005895491 uM | Activity at 0.00117 uM | Activity at 0.00179 uM | Activity at 0.00299 uM | Activity at 0.00672 uM | Activity at 0.014 uM | Activity at 0.026 uM | Activity at 0.040 uM | Activity at 0.074 uM | Activity at 0.167 uM | Activity at 0.363 uM | Activity at 0.628 uM | Activity at 0.975 uM | Activity at 1.849 uM | Activity at 4.119 uM | Activity at 9.037 uM | Activity at 15.83 uM | Activity at 21.08 uM | Activity at 46.23 uM | Activity at 92.54 uM | Activity at 165.6 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 20.5962 | 118.891 | 41 | Partial curve; high efficacy | -4.6862 | 2.3031 | 0.9994 | -116.1669 | 2.7241 | -2.1 | 0 0 0 0 0 | -99.9451 | 2.7241 | 4.2572 | 0.7717 | -13.7373 | -99.9451 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 0.8 | 0.9749 | -16.1771 | 2.0057 | 4 | 0 0 0 0 0 | -13.1466 | 2.0057 | 1.2486 | -2.8352 | -5.7162 | -13.1466 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6148 | -11.801 | 2.2059 | 4 | 0 0 0 0 0 | -9.7999 | -4.7941 | 3.6452 | 6.7363 | 3.1419 | -9.7999 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | -5.0362 | 2.3332 | 0.9795 | -28.8852 | -5.2723 | 4 | 0 0 0 0 0 | -28.1997 | -7.2723 | -3.3531 | -4.7215 | -17.5124 | -28.1997 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inhibitor | 5.1735 | 94.6885 | 84 | Complete curve; high efficacy | -5.2862 | 2.9023 | 0.9917 | -96.1842 | -1.4957 | -1.1 | 0 0 0 0 0 | -96.0073 | -7.5308 | 4.5779 | -6.8491 | -81.1577 | -96.0073 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inhibitor | 18.3564 | 94.012 | 10 | Single point of activity | -4.7362 | 3.6272 | 0.9999 | -96.5346 | -2.5226 | -3 | 0 0 0 0 0 | -93.107 | -2.9055 | -1.9361 | -2.363 | -9.7613 | -93.107 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8434 | -31.3086 | -2.255 | 4 | 0 0 0 0 0 | -27.0497 | -0.755 | -10.521 | 0.9228 | 0.8125 | -27.0497 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.4495 | 0.7303 | -25.728 | -7.2492 | 4 | 0 0 0 0 0 | -25.3982 | -8.7492 | -13.5128 | 0.9177 | -19.0413 | -25.3982 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inhibitor | 20.5962 | 100.5411 | 41 | Partial curve; high efficacy | -4.6862 | 2.0937 | 0.998 | -104.3872 | -3.8461 | -2.1 | 0 0 0 0 0 | -88.9539 | -4.1551 | -2.0443 | -7.1093 | -18.8654 | -88.9539 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inhibitor | 29.0929 | 91.4133 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9947 | -88.3597 | 3.0536 | -3 | 0 0 0 0 0 | -79.845 | -1.1685 | 2.6559 | 4.5385 | 5.7131 | -79.845 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.786 | -1.8499 | 12.9954 | 4 | 0 0 0 0 1 | 16.1947 | 7.9954 | 18.2295 | 0.5262 | -1.8757 | 16.1947 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9259 | -4.5454 | 4.3839 | 4 | 0 0 0 0 0 | -3.7239 | 5.3839 | 4.747 | 2.666 | 4.8335 | -3.7239 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | -6.2362 | 4.9549 | 0.9762 | -1.4086 | 19.4543 | 4 | 0 0 0 0 0 | 1.2086 | 19.4543 | 17.7088 | -3.3481 | -2.3756 | 1.2086 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.4363 | -4.5616 | -11.5616 | 4 | 0 0 0 0 0 | -4.5336 | -11.5616 | -1.6565 | -10.5162 | -2.2482 | -4.5336 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 0.7 | 0.9889 | 6.5184 | -6.9816 | 4 | 0 0 0 0 0 | 2.8921 | -7.4816 | -5.7762 | -3.9537 | -1.5242 | 2.8921 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.5926 | -22.1394 | -0.1559 | 4 | 0 0 0 0 0 | -20.8088 | -4.1559 | -8.304 | 12.2914 | -0.0696 | -20.8088 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inhibitor | 29.0929 | 64.2186 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9684 | -70.1227 | -5.9041 | -3 | 0 0 0 0 0 | -64.396 | -9.2052 | -0.418 | -11.9994 | -2.9068 | -64.396 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 1.21 | 0.9644 | -26.9263 | 4.8437 | 4 | 0 0 0 0 0 | -17.9647 | 6.8437 | 4.9663 | 0.5719 | -1.9517 | -17.9647 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9261 | -29.987 | 1.9364 | 4 | 0 0 0 0 0 | -26.9998 | 0.4364 | -0.7582 | -0.4532 | 7.9656 | -26.9998 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.095 | 0.4576 | 1.7803 | 12.607 | 4 | 0 0 0 0 0 | 6.6132 | 11.107 | -4.9986 | 0.186 | 5.2579 | 6.6132 | QC'd by "Asinex Ltd." |
| Absorbance_42C_A | Absorbance_42C_B | Rel_Abs_42C_A | Rel_Abs_42C_B | Avg_Rel_Abs_42C | Absorbance_30C_A | Absorbance_30C_B | Rel_Abs_30C_A | Rel_Abs_30C_B | Avg_Rel_Abs_30C | (Abs_30C)-(Abs_42C) | Activity Score_30C | Activity Outcome_TempDep | Activity Outcome_TempInd | Activity Type |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0.358 | 0.408 | 98.28 | 110.75 | 104.52 | 0.644 | 0.645 | 107.98 | 104.06 | 106.02 | 1.5 | 0 | I | I | |
| 0.35 | 0.386 | 95.78 | 104.11 | 99.95 | 0.647 | 0.643 | 108.52 | 103.71 | 106.12 | 6.17 | 0 | I | I | |
| 0.37 | 0.401 | 102.03 | 108.64 | 105.33 | 0.616 | 0.645 | 102.96 | 104.06 | 103.51 | -1.83 | 0 | I | I | |
| 0.366 | 0.403 | 100.78 | 109.24 | 105.01 | 0.614 | 0.578 | 102.6 | 92.49 | 97.55 | -7.47 | 2 | I | I | |
| 0.367 | 0.387 | 101.09 | 104.41 | 102.75 | 0.579 | 0.623 | 96.32 | 100.26 | 98.29 | -4.46 | 2 | I | I | |
| 0.35 | 0.383 | 95.78 | 103.21 | 99.5 | 0.69 | 0.616 | 116.24 | 99.05 | 107.64 | 8.15 | 0 | I | I | |
| 0.361 | 0.368 | 99.22 | 98.68 | 98.95 | 0.602 | 0.583 | 100.45 | 93.35 | 96.9 | -2.05 | 3 | I | I | |
| 0.339 | 0.395 | 92.35 | 106.83 | 99.59 | 0.578 | 0.648 | 96.14 | 104.58 | 100.36 | 0.77 | 0 | I | I | |
| 0.363 | 0.352 | 99.84 | 93.85 | 96.85 | 0.584 | 0.601 | 97.22 | 96.46 | 96.84 | -0.01 | 3 | I | I | |
| 0.36 | 0.358 | 98.91 | 95.66 | 97.28 | 0.667 | 0.616 | 112.11 | 99.05 | 105.58 | 8.3 | 0 | I | I | |
| 0.234 | 0.376 | 59.56 | 101.09 | 80.33 | 0.59 | 0.65 | 98.3 | 104.92 | 101.61 | 21.28 | 0 | I | I | |
| 0.364 | 0.214 | 100.16 | 52.2 | 76.18 | 0.609 | 0.564 | 101.7 | 90.07 | 95.89 | 19.71 | 4 | I | I | |
| 0.377 | 0.396 | 104.22 | 107.13 | 105.67 | 0.679 | 0.618 | 114.26 | 99.4 | 106.83 | 1.16 | 0 | I | I | |
| 0.347 | 0.357 | 94.85 | 95.36 | 95.1 | 0.62 | 0.648 | 103.68 | 104.58 | 104.13 | 9.02 | 0 | I | I | |
| 0.359 | 0.381 | 98.59 | 102.6 | 100.6 | 0.589 | 0.61 | 98.12 | 98.01 | 98.07 | -2.53 | 2 | I | I | |
| 0.357 | 0.392 | 97.97 | 105.92 | 101.95 | 0.489 | 0.497 | 80.17 | 78.5 | 79.34 | -22.61 | 21 | I | I | |
| 0.369 | 0.361 | 101.72 | 96.57 | 99.14 | 0.591 | 0.666 | 98.47 | 107.68 | 103.08 | 3.94 | 0 | I | I | |
| 0.496 | 0.531 | 141.37 | 147.88 | 144.63 | 0.615 | 0.661 | 102.78 | 106.82 | 104.8 | -39.83 | 0 | I | I | |
| 0.39 | 0.466 | 108.27 | 128.26 | 118.27 | 0.413 | 0.585 | 66.54 | 93.7 | 80.12 | -38.15 | 20 | I | I | |
| 0.367 | 0.425 | 101.09 | 115.88 | 108.49 | 0.534 | 0.543 | 88.25 | 86.45 | 87.35 | -21.14 | 13 | I | I |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00111 uM | Activity at 0.00284 uM | Activity at 0.00446 uM | Activity at 0.00891 uM | Activity at 0.015 uM | Activity at 0.029 uM | Activity at 0.036 uM | Activity at 0.073 uM | Activity at 0.113 uM | Activity at 0.149 uM | Activity at 0.293 uM | Activity at 0.487 uM | Activity at 0.726 uM | Activity at 1.458 uM | Activity at 2.011 uM | Activity at 3.331 uM | Activity at 5.199 uM | Activity at 7.343 uM | Activity at 13.78 uM | Activity at 20.90 uM | Activity at 36.52 uM | Activity at 60.71 uM | Activity at 87.88 uM | Activity at 127.3 uM | Activity at 194.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 1.4641 | 0.71 | -12.454 | -2 | 4 | 0 0 0 0 | -11.2117 | -5.2093 | 0.6206 | -7.2594 | -11.2117 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 4 | -11.3429 | -16.0267 | -12.2608 | -14.6132 | -11.3429 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||||
| Inactive | 0 | 1.6259 | 0.9272 | -14.3148 | -0.877 | 4 | 0 0 0 0 | -15.2623 | -7.8142 | -13.6096 | -13.0621 | -15.2623 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 4 | -12.3142 | -9.814 | -12.586 | -8.4662 | -12.3142 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | -8.2677 | -9.1999 | -12.2836 | -11.2753 | -8.2677 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4.5045 | 0.9238 | -23.3577 | -9.0057 | 4 | 0 0 0 0 | -23.2147 | -6.6714 | -11.5717 | -9.7492 | -23.2147 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inhibitor | 11.2202 | 18.8957 | 21 | Partial curve; partial efficacy | -4.95 | 3.5117 | 0.9065 | -31.7758 | -12.8801 | -2.2 | 0 0 0 0 | -31.4798 | -16.0985 | -9.0667 | -16.5103 | -31.4798 | QC'd by "Chem Div" | ||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8003 | -13.5254 | -8.8783 | 4 | 0 0 0 0 | -13.3545 | -10.4528 | -7.3986 | -12.9731 | -13.3545 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 2.3332 | 0.9015 | -5.5393 | 8 | 4 | 0 0 0 0 | -5.4494 | 5.4818 | 10.3071 | 0 | -5.4494 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 1.9673 | 0.9741 | -21.6735 | -12.4937 | 4 | 0 0 0 0 | -21.3946 | -13.4008 | -12.078 | -16.6303 | -21.3946 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 4 | -5.6419 | -17.3934 | -2.7552 | -14.5706 | -5.6419 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8944 | -16.0102 | -8.6848 | 4 | 0 0 0 0 | -15.0085 | -7.2373 | -9.9603 | -8.6791 | -15.0085 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 1.5579 | 0.9997 | -19.5854 | -2.0513 | 4 | 0 0 0 1 | -5.8527 | -2.9594 | -9.4187 | -17.9878 | -5.8527 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 0.9 | 0.9974 | 18 | -20.2383 | 4 | 0 0 0 0 | 12.7737 | -17.6986 | -10.2115 | 1.1055 | 12.7737 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 1.8851 | 0.9998 | -14.291 | -6.7783 | 4 | 0 0 0 1 | -6.726 | -6.8986 | -8.4505 | -13.1591 | -6.726 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 0.9 | 0.9901 | -24.8053 | -6.5569 | 4 | 0 0 0 0 | -19.0044 | -6.7141 | -9.2211 | -12.2131 | -19.0044 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inhibitor | 10 | 25.7525 | 21 | Partial curve; partial efficacy | -5 | 4.9549 | 0.9958 | -34.5683 | -8.8157 | -2.2 | 0 0 0 0 | -34.709 | -9.7184 | -7.7631 | -13.3604 | -34.709 | QC'd by "Chem Div" | ||||||||||||||||||||||
| Inactive | 0 | 0.5 | 0.7446 | -13.2445 | -2.1109 | 4 | 0 0 0 0 | -9.3704 | -2.5924 | -6.2168 | -4.8236 | -9.3704 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8017 | -7.4285 | -18.0168 | 4 | 0 0 0 0 | -7.4434 | -13.764 | -5.7738 | -9.5578 | -7.4434 | QC'd by "Chem Div" | ||||||||||||||||||||||||||
| Activator | 31.6228 | 49 | 0 | Partial curve; high efficacy | -4.5 | 0.8 | 0.9998 | 65 | 114 | 2.1 | 0 0 0 1 | 118.3965 | 112.9568 | 110.0983 | 102.4909 | 118.3965 | QC'd by "Chem Div" |
| Avg_deltaGFP_Z-score | Absorbance_T0_A | GFP_T0_A | Absorbance_T0_B | GFP_T0_B | Absorbance_A | GFP_A | Absorbance_B | GFP_B | deltaGFP_A | deltaGFP_B | Avg_deltaGFP | deltaGFP_A_Z-score | deltaGFP_B_Z-score |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| -1.27 | 0.058 | 2540356 | 0.057 | 2547765 | 0.323 | 2653767 | 0.324 | 2670642 | 113411 | 122877 | 118144 | -1.02538 | -1.51489 |
| 0.67 | 0.06 | 2426612 | 0.06 | 2412710 | 0.332 | 2588935 | 0.334 | 2587049 | 162323 | 174339 | 168331 | 0.387734 | 0.95318 |
| -0.33 | 0.059 | 2520773 | 0.059 | 2509075 | 0.354 | 2673282 | 0.353 | 2672667 | 152509 | 163592 | 158050 | -0.303321 | -0.354548 |
| 1 | 0.059 | 2468903 | 0.06 | 2466127 | 0.341 | 2639381 | 0.343 | 2657312 | 170478 | 191185 | 180832 | 0.740141 | 1.26456 |
| 0.74 | 0.106 | 2047221 | 0.107 | 2046542 | 0.568 | 2660762 | 0.571 | 2649109 | 613541 | 602567 | 608054 | 0.543696 | 0.932316 |
| -0.66 | 0.092 | 2123400 | 0.091 | 2148341 | 0.529 | 2717562 | 0.527 | 2686607 | 594162 | 538266 | 566214 | -0.115128 | -1.20669 |
| -2.8 | 0.084 | 2199147 | 0.086 | 2231265 | 0.513 | 2727386 | 0.51 | 2708166 | 528239 | 476901 | 502570 | -2.3563 | -3.24802 |
| -1.96 | 0.11 | 2144558 | 0.109 | 2153923 | 0.5 | 2687675 | 0.492 | 2666280 | 543117 | 512357 | 527737 | -1.8505 | -2.06856 |
| -1.14 | 0.104 | 2099367 | 0.101 | 2142517 | 0.523 | 2681778 | 0.518 | 2664243 | 582411 | 521726 | 552068 | -0.514625 | -1.7569 |
| -1.27 | 0.06 | 2163951 | 0.06 | 2189032 | 0.479 | 2724714 | 0.479 | 2724846 | 560763 | 535814 | 548288 | -1.25059 | -1.28825 |
| 0.44 | 0.112 | 2063589 | 0.11 | 2102127 | 0.548 | 2685220 | 0.536 | 2678343 | 621631 | 576216 | 598924 | 0.818731 | 0.0557383 |
| -2.91 | 0.08 | 2158004 | 0.079 | 2170268 | 0.457 | 2669594 | 0.457 | 2657682 | 511590 | 487414 | 499502 | -2.92231 | -2.8983 |
| -0.49 | 0.095 | 2076005 | 0.096 | 2131985 | 0.526 | 2666805 | 0.524 | 2683829 | 590800 | 551844 | 571322 | -0.229425 | -0.755007 |
| -0.9 | 0.062 | 2090554 | 0.062 | 2141637 | 0.497 | 2673509 | 0.491 | 2677205 | 582955 | 535568 | 559262 | -0.496131 | -1.29644 |
| -0.25 | 0.116 | 2079590 | 0.115 | 2121566 | 0.524 | 2677549 | 0.525 | 2680407 | 597959 | 558841 | 578400 | 0.0139578 | -0.522249 |
| -2.52 | 0.062 | 2255876 | 0.061 | 2287219 | 0.513 | 2783828 | 0.509 | 2781307 | 527952 | 494088 | 511020 | -2.36606 | -2.67629 |
| -0.99 | 0.065 | 2156875 | 0.064 | 2185148 | 0.514 | 2718354 | 0.514 | 2737090 | 561479 | 551942 | 556710 | -1.22625 | -0.751747 |
| 0.2 | 0.076 | 2248749 | 0.074 | 2236287 | 0.498 | 2854236 | 0.494 | 2844008 | 605487 | 607721 | 606604 | 0.425044 | -0.0214336 |
| -0.39 | 0.059 | 2155193 | 0.061 | 2158543 | 0.53 | 2739701 | 0.526 | 2750103 | 584508 | 591560 | 588034 | -0.243403 | -0.538384 |
| 2.08 | 0.08 | 2151673 | 0.079 | 2156007 | 0.528 | 2802359 | 0.525 | 2836180 | 650686 | 680173 | 665430 | 1.86521 | 2.29612 |
| Phenotype | Potency | Efficacy | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.092 uM | Activity at 0.460 uM | Activity at 2.300 uM | Activity at 11.50 uM | Activity at 57.50 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4 | 1.8666 | 1.3623 | 1.2101 | 0.0793 | 0.9406 | 1.8666 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 0.9158 | 0.954 | 1.0334 | 0.1081 | 0.2978 | 0.9158 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 1.1839 | 0.3469 | 0.9282 | -0.1429 | 0.8561 | 1.1839 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 0.5999 | -1.8607 | -3.4054 | -0.9612 | -1.656 | 0.5999 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 0.7172 | 2.0249 | 1.3236 | -0.247 | -0.023 | 0.7172 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | -0.1231 | 2.0517 | 1.9419 | 1.0913 | 2.0523 | -0.1231 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 3.9667 | 4.224 | 4.4129 | 3.4343 | 2.846 | 3.9667 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 1.6712 | 2.5288 | 3.0286 | 1.3084 | 1.9224 | 1.6712 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | -0.2068 | 0.9071 | 1.4484 | 0.5176 | 0.0441 | -0.2068 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | -8.9193 | -6.801 | -5.7497 | -7.5221 | -7.8954 | -8.9193 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | -5.4427 | -5.048 | -3.3808 | -6.4571 | -6.3565 | -5.4427 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4.5045 | 0.9573 | 6 | -1.2364 | 4 | 0 0 0 0 1 | -1.7138 | -0.9469 | -0.4156 | -1.8636 | 4.7904 | -1.7138 | QC'd by Sytravon | ||||
| Inactive | 0 | 4 | 2.9724 | 1.7032 | 1.4813 | 1.3316 | 1.1401 | 2.9724 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 0.4812 | 0.3594 | 0.5958 | -0.4127 | 0.3876 | 0.4812 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | -0.5204 | -0.2624 | -0.7504 | -0.7663 | 0.0982 | -0.5204 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4.9549 | 0.6237 | 0 | -3.2845 | 4 | 0 0 0 0 0 | 1.3559 | -1.7513 | -4.8204 | -0.5682 | -1.1748 | 1.3559 | QC'd by Sytravon | ||||
| Inactive | 0 | 4 | 2.8298 | 0.4882 | 1.6336 | 0.1799 | 2.885 | 2.8298 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 1.6222 | 2.6229 | 1.2995 | 0.9818 | 0.6747 | 1.6222 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 0.9915 | 2.9075 | 1.885 | 0.6136 | 2.029 | 0.9915 | QC'd by Sytravon | |||||||||
| Inactive | 0 | 4 | 3.7346 | 3.189 | 3.5928 | 3.494 | 2.7849 | 3.7346 | QC'd by Sytravon |
| plate number | well | row | column | SMILES | replicate 1 | replicate2 | mean | norm1 | norm2 | normAvg | Zscore |
|---|---|---|---|---|---|---|---|---|---|---|---|
| 121 | I01 | I | 1 | Clc1ccc(CCNS(=O)(=O)c2ccc3N(CCc3c2)C(=O)C4CC4)cc1 | 483915 | 505740 | 494827 | 1.022045421 | 1.068140586 | 1.045091947 | 1.075244414 |
| 121 | I21 | I | 21 | COC(=O)c1cn(nc1c2ccc(OC)cc2)c3ccccc3 | 482363 | 498643 | 490503 | 1.018767543 | 1.053151473 | 1.035959508 | 0.857475943 |
| 121 | I22 | I | 22 | COC(=O)Cn1nc(c2ccccc2)c3ccccc13 | 468073 | 471875 | 469974 | 0.988586563 | 0.99661652 | 0.992601541 | -0.176420664 |
| 121 | J10 | J | 10 | CCN1C(=O)c2ccccc2S(=O)(=O)c3ccc(cc13)C(=O)N4CCC(C)CC4 | 467159 | 478877 | 473018 | 0.986656163 | 1.011404989 | 0.999030576 | -0.023116496 |
| 121 | K08 | K | 8 | CCOc1ccc(cc1)n2cc([nH]c2=O)c3ccc(OCC)c(Cl)c3 | 405990 | 431925 | 418957 | 0.857465093 | 0.912240721 | 0.884851851 | -2.745776367 |
| 121 | K09 | K | 9 | FC(F)(F)c1cccc(NC(=O)c2nn(c3ccc(Cl)cc3)c(=O)c4ccccc24)c1 | 441602 | 445014 | 443308 | 0.932678884 | 0.939885148 | 0.936282016 | -1.519393382 |
| 121 | K21 | K | 21 | CCOC(=O)c1ccc(NC(=O)c2cn(nc2c3ccc(OC)cc3)c4ccccc4)cc1 | 426067 | 425758 | 425912 | 0.89986842 | 0.899215801 | 0.899541055 | -2.395503538 |
| 121 | L18 | L | 18 | Fc1ccc(CN2C(=O)c3ccccc3S(=O)(=O)c4ccc(cc24)C(=O)N5CCCCCC5)cc1 | 415786 | 419304 | 417545 | 0.878154588 | 0.885584727 | 0.881869658 | -2.81688855 |
| 121 | M18 | M | 18 | Cc1cc(C)c(NC2=NC3CS(=O)(=O)CC3S2)c(C)c1 | 461134 | 462019 | 461576 | 0.973931152 | 0.975800303 | 0.974864671 | -0.599366921 |
| 121 | M20 | M | 20 | CC(CC(=O)NCCc1c[nH]c2ccccc12)CC3=Nc4ccccc4S(=O)(=O)N3 | 450293 | 444180 | 447236 | 0.95103458 | 0.93812371 | 0.944578089 | -1.321568555 |
| 121 | O09 | O | 9 | COc1ccc(NC(=O)c2nn(c3ccc(Cl)cc3)c(=O)c4ccccc24)cc1OC | 391011 | 364059 | 377535 | 0.825828921 | 0.768905353 | 0.797367137 | -4.831901618 |
| 121 | O16 | O | 16 | COc1cccc(CNS(=O)(=O)c2ccc3NC(=O)CCc3c2)c1 | 459548 | 474936 | 467242 | 0.970581464 | 1.003081459 | 0.986831462 | -0.314011659 |
| 121 | O18 | O | 18 | Clc1ccc(cc1NC2=NC3CS(=O)(=O)CC3S2)C(=O)N4CCN(CC4)C5CCCCC5 | 477363 | 480763 | 479063 | 1.008207368 | 1.015388287 | 1.011797828 | 0.281326243 |
| 121 | P02 | P | 2 | COC(CNC(=O)c1ccc2S(=O)c3ccccc3C(=O)N(Cc4ccccc4)c2c1)OC | 459484 | 469120 | 464302 | 0.970446294 | 0.990797863 | 0.980622079 | -0.462078103 |
| 121 | P16 | P | 16 | CCN(CC)C(=O)c1ccc2c(c1)N(Cc3ccccc3F)C(=O)c4ccccc4S2(=O)=O | 452115 | 452028 | 452071 | 0.954882708 | 0.954698961 | 0.954789779 | -1.078064727 |
| 121 | P18 | P | 18 | Fc1ccc(CN2C(=O)c3ccccc3S(=O)(=O)c4ccc(cc24)C(=O)N5CCCC5)cc1 | 460501 | 476164 | 468332 | 0.972594234 | 1.005675038 | 0.98913358 | -0.259116277 |
| 122 | B04 | B | 4 | COc1ccc(CNC(=O)c2cc(=O)[nH]c3ccc(cc23)S(=O)(=O)N4CCCC4)c(OC)c1 | 510152 | 511896 | 511024 | 1.067484688 | 1.07113398 | 1.069309334 | 2.080198605 |
| 122 | B12 | B | 12 | CCOCCCNC(=O)CCN1C(=O)COc2ccccc12 | 533515 | 535724 | 534619 | 1.116371382 | 1.120993679 | 1.118681484 | 3.562017465 |
| 122 | C05 | C | 5 | O=C(CN1C(=O)CSc2ccc(cc12)S(=O)(=O)N3CCOCC3)N4CCCCC4 | 480020 | 491275 | 485647 | 1.004433973 | 1.027984876 | 1.016208378 | 0.486466153 |
| 122 | C22 | C | 22 | CCC1Oc2ccccc2N(CC(=O)NCc3ccccc3Cl)C1=O | 471446 | 472697 | 472071 | 0.986493018 | 0.989110715 | 0.987800821 | -0.366137061 |
| Phenotype | Potency | Efficacy | Analysis Comment | FF-overN-Activity_Score | FF-overN-Curve_Description | FF-overN-Fit_LogAC50 | FF-overN-Fit_HillSlope | FF-overN-Fit_R2 | FF-overN-Fit_InfiniteActivity | FF-overN-Fit_ZeroActivity | FF-overN-Fit_CurveClass | FF-overN-Excluded_Points | FF-overN-Max_Response | FF-overN-Activity at 0.0000389080 uM | FF-overN-Activity at 0.0001066275 uM | FF-overN-Activity at 0.0001907270 uM | FF-overN-Activity at 0.0004536066 uM | FF-overN-Activity at 0.0007545096 uM | FF-overN-Activity at 0.0009784578 uM | FF-overN-Activity at 0.00290 uM | FF-overN-Activity at 0.00507 uM | FF-overN-Activity at 0.00876 uM | FF-overN-Activity at 0.016 uM | FF-overN-Activity at 0.026 uM | FF-overN-Activity at 0.052 uM | FF-overN-Activity at 0.080 uM | FF-overN-Activity at 0.235 uM | FF-overN-Activity at 0.459 uM | FF-overN-Activity at 0.739 uM | FF-overN-Activity at 1.169 uM | FF-overN-Activity at 2.226 uM | FF-overN-Activity at 6.007 uM | FF-overN-Activity at 11.47 uM | FF-overN-Activity at 19.12 uM | FF-overN-Activity at 25.20 uM | FF-overN-Activity at 57.49 uM | FF-overN-Activity at 115.7 uM | FF-overN-Activity at 221.8 uM | FF-overN-Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6 | 3.5722 | 0.9998 | 8 | -4.573 | 4 | 0 0 0 1 | 0.0919 | -4.6442 | 3.1713 | 7.9059 | 0.0919 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 3.5722 | 0.955 | 11 | -10.4556 | 4 | 0 0 0 0 | 10.3819 | -7.9209 | -13.2963 | -7.8629 | 10.3819 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 3.9295 | 0.9982 | -20.5535 | -1.4154 | 4 | 0 0 0 0 | -20.4612 | -1.7364 | -0.7629 | -17.0693 | -20.4612 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.5 | 1 | 0.6282 | -19.163 | -1 | 4 | 0 0 0 0 | -14.3025 | 0.9125 | -7.5415 | -3.4541 | -14.3025 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.95 | 2.2526 | 0.9995 | -16.7735 | 3.5 | 4 | 0 0 0 0 | -16.7304 | 3.5028 | -6.5545 | -16.8946 | -16.7304 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5 | 0.6 | 0.9765 | -26.0622 | 0.057 | 4 | 0 0 0 0 | -20.0519 | -0.7858 | -6.9465 | -12.3383 | -20.0519 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.5 | 1.4487 | 0.9277 | -11.1274 | 1 | 4 | 0 0 0 0 | -7.6062 | 2.4742 | -0.4153 | -0.9904 | -7.6062 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.35 | 0.6 | 0.9824 | -10.0654 | 9.5 | 4 | 0 0 0 0 | -7.5545 | 7.8538 | 2.9441 | -1.9949 | -7.5545 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.4936 | 1.9596 | 1.2945 | 6.6505 | 2.4936 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.55 | 2.5334 | 0.6159 | -11.4423 | -23.9956 | 4 | 0 0 0 0 | -13.2853 | -18.831 | -28.7463 | -22.7697 | -13.2853 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.0756 | 0 | 0 | -9.752 | -4.0756 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 1.6436 | 0.9984 | -26.3723 | 6.5 | 4 | 0 0 0 0 | -20.7269 | 6.8952 | 5.4769 | -1.6781 | -20.7269 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.35 | 4.9549 | 0.8085 | -22.1835 | 1.5 | 4 | 0 0 0 0 | -16.8196 | 1.0548 | -3.7533 | 7.1078 | -16.8196 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -9.2421 | -7.2234 | -5.2389 | -3.1916 | -9.2421 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -12.9119 | -16.3463 | -12.7285 | -15.6237 | -12.9119 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.468 | -15.2266 | 3 | 4 | 0 0 0 0 | -8.9707 | 0 | -26.8555 | -10.0921 | -8.9707 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6823 | 3.8566 | 7.6151 | 8.0028 | 2.6823 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.4875 | -11.1688 | 2 | 4 | 0 0 0 1 | -1.2431 | 0 | -17.6407 | -4.4754 | -1.2431 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.55 | 2.3531 | 0.986 | -25.9932 | 3.5 | 4 | 0 0 0 0 | -21.2443 | 5.1247 | 1.651 | 0.2461 | -21.2443 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 4.095 | 0.7467 | -1.9217 | 6 | 4 | 0 0 0 0 | -2.0181 | 2.9034 | 8.923 | -0.4967 | -2.0181 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00460 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.112 uM | Activity at 0.230 uM | Activity at 0.460 uM | Activity at 0.871 uM | Activity at 0.984 uM | Activity at 1.439 uM | Activity at 2.300 uM | Activity at 4.560 uM | Activity at 5.230 uM | Activity at 7.193 uM | Activity at 11.50 uM | Activity at 22.87 uM | Activity at 26.96 uM | Activity at 44.22 uM | Activity at 57.50 uM | Activity at 114.7 uM | Activity at 121.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6.8 | 4.9549 | 0.8159 | 2 | -8.876 | 4 | 0 0 0 0 | -0.3922 | -6.98 | 4.9207 | 1.8774 | -0.3922 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6 | 4.9549 | 0.9989 | 3 | -8.4743 | 4 | 0 0 0 1 | -8.9436 | -8.7286 | -0.7486 | 3.1076 | -8.9436 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -5.45 | 1.7529 | 0.9999 | 31.5 | -1.4018 | 4 | 0 0 0 1 | 0 | -1.1682 | 2.486 | 27.8307 | 0 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6 | 0.6 | 0.9574 | -3.5578 | 18 | 4 | 0 0 0 0 | -2.9648 | 13.9674 | 5.3752 | 2.1822 | -2.9648 | QC'd by CBC | |||||||||||||||||||
| Activator | 0.8913 | 55.3545 | 0 | Complete curve; partial efficacy; poor fit | -6.05 | 4.9549 | 0.9968 | 47.9876 | -7.3669 | 1.4 | 0 0 0 0 | 45.9161 | -7.5163 | 36.2451 | 49.4307 | 45.9161 | QC'd by CBC | ||||||||||||||||
| Inactive | 0 | 4 | -0.4061 | 3.1581 | 7.1489 | 1.8466 | -0.4061 | QC'd by CBC | |||||||||||||||||||||||||
| Inactive | 0 | 4 | 8.0219 | 9.7586 | 2.6391 | 4.515 | 8.0219 | QC'd by CBC | |||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 2.9023 | 0.9336 | 14 | -3.7678 | 4 | 0 0 0 0 | 13.2222 | -6.4732 | -1.1472 | -0.6942 | 13.2222 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6.75 | 4.9549 | 0.6234 | 5.5 | -2.8563 | 4 | 0 0 0 1 | -0.8656 | -1.9636 | 9.114 | 2.2001 | -0.8656 | QC'd by CBC | |||||||||||||||||||
| Activator | 3.1623 | 120.5805 | 0 | Partial curve; high efficacy; poor fit | -5.5 | 2.5884 | 1 | 125.8416 | 5.2611 | 2.3 | 0 0 0 1 | -13.8758 | 5.0261 | 13.541 | 121.9395 | -13.8758 | QC'd by CBC | ||||||||||||||||
| Inactive | 0 | -5.05 | 4.095 | 0.995 | 39.9163 | 10.5 | 4 | 0 0 0 0 | 39.907 | 11.8101 | 9.2103 | 32.1484 | 39.907 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6.75 | 4.9549 | 0.6885 | 5.5 | -14.2723 | 4 | 0 0 0 0 | -1.4364 | -12.3103 | 13.1505 | 4.6329 | -1.4364 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.4877 | 7 | -4.299 | 4 | 0 0 0 0 | 12.0135 | -2.3325 | 8.0236 | 0.5611 | 12.0135 | QC'd by CBC | |||||||||||||||||||
| Activator | 14.1254 | 56.9966 | 0 | Partial curve; partial efficacy; poor fit | -4.85 | 1.5579 | 0.9975 | 55.2294 | -1.7671 | 2.4 | 0 0 0 0 | 49.6994 | -2.5363 | 1.1452 | 21.5084 | 49.6994 | QC'd by CBC | ||||||||||||||||
| Inactive | 0 | -6.7 | 4.9549 | 0.6978 | 8.5 | -0.5 | 4 | 0 0 0 1 | 0.9512 | 0.1013 | 11.4064 | 5.1489 | 0.9512 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.671 | 13 | -7.7542 | 4 | 0 0 0 1 | 0 | -4.3785 | 20.2445 | 6.0485 | 0 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | 4 | -3.0754 | -7.5861 | -4.61 | -0.5732 | -3.0754 | QC'd by CBC | |||||||||||||||||||||||||
| Inactive | 0 | -4.95 | 0.7 | 0.969 | -2 | 20.5 | 4 | 0 0 0 0 | 2.437 | 20.2378 | 15.4328 | 10.7009 | 2.437 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6.8 | 4.5045 | 0.7622 | -2 | -15.313 | 4 | 0 0 0 0 | -4.8971 | -12.7608 | 2.2051 | -3.2116 | -4.8971 | QC'd by CBC | |||||||||||||||||||
| Inactive | 0 | -6.05 | 4.5045 | 0.9997 | 13 | -6.5465 | 4 | 0 0 0 1 | 0 | -6.2888 | 8.2825 | 12.9406 | 0 | QC'd by CBC |
| mP_A | FluorTotal_A | Pchan_A | Schan_A | mP_B | FluorTotal_B | Pchan_B | Schan_B | Z-score_A | Z-score_B | Percent Ctrl_A | Percent Ctrl_B | STD_A | STD_B | Note: Polarization Artifact |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 122.4 | 19579888 | 6065842 | 7448204 | 128.1 | 19637672 | 6057220 | 7523232 | -1.18225 | -0.635232 | 93.2647 | 101.541 | -1.8003 | 0.362745 | |
| 124.6 | 19582526 | 6056571 | 7469384 | 129.8 | 19625175 | 6045019 | 7535137 | -0.634716 | -0.199611 | 97.3807 | 104.669 | -0.700117 | 1.09906 | |
| 124.2 | 19663896 | 6083826 | 7496244 | 126.2 | 19699034 | 6084886 | 7529262 | -0.734268 | -1.1221 | 96.6324 | 98.0451 | -0.90015 | -0.460198 | |
| 123 | 19731798 | 6110340 | 7511118 | 126.7 | 19714113 | 6087353 | 7539407 | -1.03292 | -0.993979 | 94.3873 | 98.965 | -1.50025 | -0.243634 | |
| 128.1 | 19896360 | 6137066 | 7622228 | 130.5 | 19724618 | 6072617 | 7579384 | 0.236366 | -0.0202377 | 103.929 | 105.957 | 1.05018 | 1.40225 | |
| 125.6 | 19867716 | 6140208 | 7587300 | 131.3 | 19673493 | 6053122 | 7567249 | -0.385835 | 0.18476 | 99.2516 | 107.429 | -0.200033 | 1.74875 | |
| 127.7 | 20023968 | 6178251 | 7667466 | 128.8 | 19866494 | 6124246 | 7618002 | 0.136814 | -0.455859 | 103.181 | 102.829 | 0.850142 | 0.665934 | |
| 129.2 | 19617723 | 6045630 | 7526463 | 132.7 | 19789155 | 6081720 | 7625715 | 0.510134 | 0.543507 | 105.987 | 110.005 | 1.60027 | 2.35513 | |
| 130.9 | 19747075 | 6077508 | 7592059 | 133.8 | 19696771 | 6048221 | 7600329 | 0.933231 | 0.82538 | 109.167 | 112.029 | 2.45041 | 2.83157 | |
| 127.4 | 19957146 | 6158996 | 7639154 | 131.1 | 19907155 | 6125922 | 7655311 | 0.0621494 | 0.133511 | 102.619 | 107.061 | 0.700117 | 1.66213 | |
| 128.6 | 19704360 | 6075475 | 7553410 | 127.9 | 19896451 | 6137996 | 7620459 | 0.360806 | -0.686482 | 104.864 | 101.173 | 1.30022 | 0.276119 | |
| 126.5 | 19754661 | 6100993 | 7552675 | 131.2 | 19811438 | 6095996 | 7619446 | -0.161843 | 0.159136 | 100.935 | 107.245 | 0.250042 | 1.70544 | |
| 125.2 | 19898037 | 6151330 | 7595377 | 128.5 | 19820522 | 6111613 | 7597296 | -0.485388 | -0.532733 | 98.5033 | 102.277 | -0.400067 | 0.535996 | |
| 125.2 | 19744447 | 6103923 | 7536601 | 130.1 | 19613194 | 6040039 | 7533116 | -0.485388 | -0.122737 | 98.5033 | 105.221 | -0.400067 | 1.229 | |
| 127.4 | 19962800 | 6160970 | 7640860 | 131.3 | 19894559 | 6121179 | 7652201 | 0.0621494 | 0.18476 | 102.619 | 107.429 | 0.700117 | 1.74875 | |
| 128.8 | 20020402 | 6171580 | 7677242 | 132.5 | 19888130 | 6113399 | 7661332 | 0.410582 | 0.492258 | 105.239 | 109.637 | 1.40023 | 2.26851 | |
| 128.3 | 19971225 | 6158905 | 7653415 | 131.8 | 20071564 | 6173303 | 7724958 | 0.286142 | 0.312884 | 104.303 | 108.349 | 1.15019 | 1.96532 | |
| 128.7 | 19749821 | 6088940 | 7571941 | 129 | 19670633 | 6062787 | 7545059 | 0.385694 | -0.404609 | 105.051 | 103.197 | 1.35023 | 0.752559 | |
| 125.7 | 19727542 | 6096177 | 7535188 | 129 | 19624155 | 6048706 | 7526743 | -0.360947 | -0.404609 | 99.4387 | 103.197 | -0.150025 | 0.752559 | |
| 127.8 | 20049952 | 6185948 | 7678056 | 130.8 | 20021937 | 6162516 | 7696905 | 0.161702 | 0.0566366 | 103.368 | 106.509 | 0.90015 | 1.53219 |
| Phenotype | Potency | Efficacy | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00460 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.092 uM | Activity at 0.115 uM | Activity at 0.230 uM | Activity at 0.460 uM | Activity at 0.911 uM | Activity at 1.057 uM | Activity at 1.771 uM | Activity at 2.301 uM | Activity at 4.634 uM | Activity at 5.773 uM | Activity at 11.50 uM | Activity at 16.40 uM | Activity at 23.82 uM | Activity at 35.99 uM | Activity at 57.50 uM | Activity at 114.4 uM | Activity at 129.1 uM | Activity at 273.4 uM | Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 15.8489 | 72.7667 | 0 | Partial curve; partial efficacy; poor fit | -4.8 | 1 | 0.9956 | 71.5604 | -1.2063 | 2.4 | 0 0 0 0 | 56.9219 | -2.7032 | 5.7184 | 29.0721 | 56.9219 | QC'd by CBC | ||||||||||||||||||
| Inactive | 0 | -5.65 | 2.7202 | 0.876 | -3.076 | -11.1378 | 4 | 0 0 0 0 | -4.8556 | -10.9482 | -10.07 | -0.8967 | -4.8556 | QC'd by CBC | |||||||||||||||||||||
| Activator | 14.1254 | 116.3598 | 0 | Partial curve; high efficacy; poor fit | -4.85 | 2.2526 | 0.9976 | 114.9836 | -1.3761 | 2.3 | 0 0 0 0 | 110.7742 | -4.0165 | 2.5263 | 42.9951 | 110.7742 | QC'd by CBC | ||||||||||||||||||
| Inactive | 0 | -4.35 | 4.9549 | 0.6203 | 9 | -2.1257 | 4 | 0 0 0 0 | 6.649 | -3.8222 | 2.8199 | -4.6881 | 6.649 | QC'd by CBC | |||||||||||||||||||||
| Activator | 22.3872 | 69.8021 | 0 | Partial curve; partial efficacy | -4.65 | 1.7529 | 0.999 | 66.6142 | -3.1879 | 2.2 | 0 0 0 0 | 55.5041 | -3.9302 | -1.5453 | 13.5134 | 55.5041 | QC'd by CBC | ||||||||||||||||||
| Inactive | 0 | 4 | -10.8628 | -6.0946 | -6.3923 | -2.7723 | -10.8628 | QC'd by CBC | |||||||||||||||||||||||||||
| Activator | 3.1623 | 46.5616 | 0 | Complete curve; partial efficacy | -5.5 | 1 | 1 | 40.0835 | -6.4781 | 1.2 | 0 0 0 0 | 37.587 | -4.7841 | 6.0554 | 30.2065 | 37.587 | QC'd by CBC | ||||||||||||||||||
| Inactive | 0 | 4 | -5.1322 | -4.7917 | -1.3649 | -10.6528 | -5.1322 | QC'd by CBC | |||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.4495 | 0.7339 | 13 | 0.9992 | 4 | 0 0 0 0 | 11.2209 | -2.5007 | 5.0259 | 0.3015 | 11.2209 | QC'd by CBC | |||||||||||||||||||||
| Inactive | 0 | 4 | 11.7523 | 6.5427 | 3.7075 | 3.7602 | 11.7523 | QC'd by CBC | |||||||||||||||||||||||||||
| Inactive | 0 | 4 | -13.953 | -10.1902 | -10 | -18.4577 | -13.953 | QC'd by CBC | |||||||||||||||||||||||||||
| Inactive | 0 | 4 | -4.5083 | -2.0629 | 5.4547 | -1.4612 | -4.5083 | QC'd by CBC | |||||||||||||||||||||||||||
| Inactive | 0 | 4 | -7.5306 | -15.4441 | -6.4413 | -15.0974 | -7.5306 | QC'd by CBC | |||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 2.2526 | 0.9477 | -26.3385 | -15.8934 | 4 | 0 0 0 0 | -25.2821 | -17.3753 | -14.9112 | -17.8522 | -25.2821 | QC'd by CBC | |||||||||||||||||||||
| Inactive | 0 | 4 | -12.6647 | -11.4457 | -10.7961 | -20.5075 | -12.6647 | QC'd by CBC | |||||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 4.9549 | 0.594 | -16.1597 | -5.6067 | 4 | 0 0 0 1 | -3.9011 | -10.3012 | -3.0056 | -14.7164 | -3.9011 | QC'd by CBC | |||||||||||||||||||||
| Inactive | 0 | -5.15 | 4.9549 | 0.9234 | -15.5602 | -3.9488 | 4 | 0 0 0 1 | -5.8836 | -5.9172 | -2.4573 | -14.6335 | -5.8836 | QC'd by CBC | |||||||||||||||||||||
| Inactive | 0 | -4.35 | 4.4495 | 0.7251 | -13.3612 | -2 | 4 | 0 0 0 0 | -10.7177 | -1.1966 | -5.5978 | 0.8791 | -10.7177 | QC'd by CBC | |||||||||||||||||||||
| Inactive | 0 | -5.7 | 4.5045 | 0.8075 | 1.0108 | 10.5 | 4 | 0 0 0 0 | 4.4351 | 10.6905 | 9.7726 | -1.6577 | 4.4351 | QC'd by CBC | |||||||||||||||||||||
| Activator | 35.4813 | 30.7807 | 0 | Partial curve; partial efficacy; poor fit | -4.45 | 1.4781 | 0.9703 | 47.2807 | 16.5 | 2.4 | 0 0 0 0 | 37.2969 | 14.4206 | 18.8162 | 21.2663 | 37.2969 | QC'd by CBC |
| Max_response | Activity at 15.40 uM | Activity at 76.90 uM | Compound QC |
|---|---|---|---|
| -4.7811 | -3.1736 | -4.7811 | QC'd by ChemBridge |
| -4.7807 | -1.5118 | -4.7807 | QC'd by Life Chemicals |
| -4.7807 | -3.1454 | -4.7807 | QC'd by InterBioScreen |
| -4.7806 | 3.611 | -4.7806 | QC'd by ChemBridge |
| -4.7805 | -1.6207 | -4.7805 | QC'd by Life Chemicals |
| -4.7804 | -6.8292 | -4.7804 | QC'd by Asinex Ltd. |
| -4.7801 | -0.8209 | -4.7801 | QC'd by Chem Div |
| -4.7798 | -1.211 | -4.7798 | QC'd by Enamine |
| -4.7794 | -4.64 | -4.7794 | QC'd by DPISMR |
| -4.7793 | 3.4727 | -4.7793 | QC'd by Enamine |
| -4.7789 | -4.0331 | -4.7789 | QC'd by Chem Div |
| -4.7787 | 4.2825 | -4.7787 | QC'd by Asinex Ltd. |
| -4.7786 | -5.1813 | -4.7786 | QC'd by Florida Center for Heterocyclic Compounds |
| -4.7778 | -3.0892 | -4.7778 | QC'd by ChemBridge |
| -4.7773 | -1.3982 | -4.7773 | QC'd by Key Organics Ltd. |
| -4.7772 | -4.2776 | -4.7772 | QC'd by Sergey Kozmin - Univ. of Chicago - MLI CMLD |
| -4.777 | -7.6001 | -4.777 | QC'd by Wei Zhang - Fluorous Technologies; Inc. - MLI PSL |
| -4.7768 | -2.3177 | -4.7768 | QC'd by Specs |
| -4.7766 | -3.7761 | -4.7766 | QC'd by InterBioScreen |
| -4.7766 | -0.1513 | -4.7766 | QC'd by InterBioScreen |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00366 uM | Activity at 0.018 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.073 uM | Activity at 0.091 uM | Activity at 0.165 uM | Activity at 0.229 uM | Activity at 0.457 uM | Activity at 0.575 uM | Activity at 0.940 uM | Activity at 1.600 uM | Activity at 2.289 uM | Activity at 3.140 uM | Activity at 4.699 uM | Activity at 9.139 uM | Activity at 11.40 uM | Activity at 21.25 uM | Activity at 28.60 uM | Activity at 57.07 uM | Activity at 80.69 uM | Activity at 114.0 uM | Activity at 162.0 uM | Activity at 229.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 5.7214 | 8.6314 | 10.1509 | 9.4532 | 6.7941 | 5.7214 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | 4.6112 | 4.6112 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||||
| Inactive | 4 | -2.3744 | -2.3744 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | 6.7367 | -4.0062 | 2.2497 | 1.4266 | 2.0011 | 3.3808 | 6.7367 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | -2.7854 | -1.3593 | -1.6912 | -2.0074 | 1.8167 | -0.4278 | -2.7854 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -2.7388 | 2.7691 | 0.219 | 4.542 | 3.4083 | -2.7388 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -0.0117 | 4.0579 | 0.9447 | 1.1341 | -2.3162 | -0.0117 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 3.7695 | 11.7104 | 7.4353 | 4.0568 | 3.1008 | 3.7695 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 5.5498 | 5.9044 | 3.2491 | 5.276 | 6.9333 | 5.5498 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | 12.0843 | 12.9091 | 10.119 | 12.5774 | 12.2515 | 12.0843 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | -0.2629 | 2.9525 | 1.1464 | 1.4514 | 0.2181 | -0.2629 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | 8.3211 | 6.2941 | 7.289 | 4.2801 | 3.1894 | 8.3211 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | -3.1455 | -0.8453 | 2.5993 | -2.2393 | -0.3052 | -3.1455 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 3.7867 | 7.8704 | 5.3135 | 4.3995 | -2.7456 | 3.7867 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 1 | -8.8426 | -4.2899 | -7.4803 | -5.849 | -5.1242 | -0.9961 | -8.8426 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 3.1704 | 3.7523 | 0.2197 | 4.2066 | -1.7683 | 2.1784 | 3.1704 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 11.6449 | 11.6449 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||||||
| Inactive | 4 | -0.8722 | 2.8697 | -0.0842 | -0.9793 | 0.7832 | -1.5591 | -0.8722 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -15.5235 | 1.8708 | 3.896 | 0.8458 | 0.9194 | -4.7588 | -15.5235 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 6.8026 | 2.8566 | 1.831 | 0.9212 | -2.584 | 6.8026 | QC'd by "Asinex Ltd." |
| HTRF-Ratio_Avg.NPI | HTRF-Ch1_A | HTRF-Ch2_A | HTRF-Ratio_A | HTRF-Ch1_B | HTRF-Ch2_B | HTRF-Ratio_B | HTRF-Ratio_Avg |
|---|---|---|---|---|---|---|---|
| 2.3 | 17638 | 7444 | 23694 | 17895 | 7063 | 25336 | 24515 |
| 4.8 | 17347 | 7312 | 23724 | 17257 | 7071 | 24405 | 24064.5 |
| 4.2 | 17868 | 7517 | 23770 | 18158 | 7395 | 24554 | 24162 |
| 17.3 | 11844 | 7012 | 16891 | 13204 | 6392 | 20657 | 18774 |
| 6.6 | 12258 | 6577 | 18638 | 14321 | 6502 | 22026 | 20332 |
| 18.1 | 11561 | 6789 | 17029 | 13512 | 6666 | 20270 | 18649.5 |
| -3.9 | 11113 | 5694 | 19517 | 11959 | 4942 | 24199 | 21858 |
| 10.3 | 12215 | 6757 | 18078 | 13988 | 6506 | 21500 | 19789 |
| -20.7 | 10425 | 4592 | 22703 | 11876 | 4585 | 25902 | 24302.5 |
| 14.4 | 12356 | 6766 | 18262 | 13858 | 6888 | 20119 | 19190.5 |
| 5.8 | 12868 | 6545 | 19661 | 14017 | 6600 | 21238 | 20449.5 |
| 15.8 | 12205 | 6703 | 18208 | 13470 | 6818 | 19757 | 18982.5 |
| 3.2 | 11742 | 5785 | 20297 | 12927 | 6054 | 21353 | 20825 |
| 10.3 | 12241 | 6415 | 19082 | 13490 | 6587 | 20480 | 19781 |
| -2.3 | 10948 | 5353 | 20452 | 12530 | 5499 | 22786 | 21619 |
| 9.1 | 12644 | 6696 | 18883 | 13920 | 6620 | 21027 | 19955 |
| 8.7 | 13443 | 7082 | 18982 | 14453 | 6863 | 21059 | 20020.5 |
| -27 | 10044 | 4376 | 22952 | 11409 | 4149 | 27498 | 25225 |
| 10 | 11550 | 6340 | 18218 | 13279 | 6196 | 21432 | 19825 |
| 3.7 | 10765 | 5590 | 19258 | 12467 | 5606 | 22239 | 20748.5 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.347 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.717 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.13 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -4.4 | 4.9549 | 0.7 | -26.5489 | -2.5 | 4 | 0 0 0 0 | -18.7908 | -9.9553 | 1.4556 | 1.5083 | -18.7908 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -6.3 | 4.9549 | 0.8372 | 0.7335 | 13 | 4 | 0 0 0 0 | 3.8783 | 11.0087 | 0 | -1.4721 | 3.8783 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | -7.0767 | 0 | 0 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -6.3 | 4.9549 | 0.4226 | 2.5 | -6.0532 | 4 | 0 0 0 1 | -1.1886 | -4.6277 | 7.6987 | -2.282 | -1.1886 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -4.85 | 4.095 | 0.9177 | -14.9072 | 3 | 4 | 0 0 0 0 | -14.0893 | 5.8884 | 0 | 0 | -14.0893 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -4.45 | 4.9549 | 0.9565 | 7 | -5.2106 | 4 | 0 0 0 0 | 4.4674 | -6.4255 | -3.9724 | -5.7764 | 4.4674 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 5.1862 | -0.5632 | 8.2671 | 9.2494 | 5.1862 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -6.3 | 4.9549 | 0.6755 | -15.5767 | 3.5 | 4 | 0 0 0 1 | 0 | 0 | -21.7306 | -9.3152 | 0 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -4.45 | 4.9549 | 0.6676 | -12.8912 | 3 | 4 | 0 0 0 0 | -9.4927 | 0 | 0 | 9.4652 | -9.4927 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -6.3 | 4.9549 | 0.3745 | -10.5729 | 14 | 4 | 0 0 0 1 | 4.1396 | 10.0525 | -25.8941 | 4.7866 | 4.1396 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 2.6711 | 2.7533 | 3.7028 | 0 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -3.6287 | -7.1208 | -7.4233 | 1.4494 | -3.6287 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5.35 | 4.9549 | 0.7286 | 10.5 | -0.4715 | 4 | 0 0 0 0 | 8.002 | 3.2258 | -4.5596 | 13.1472 | 8.002 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -5.75 | 2.3332 | 0.9993 | -13.3247 | 15.5 | 4 | 0 0 0 1 | 14.8748 | 14.9002 | 0 | -12.7706 | 14.8748 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -5.4 | 4.9549 | 0.7927 | 9 | -1.1062 | 4 | 0 0 0 0 | 5.9401 | 0.6656 | -3.0052 | 11.9289 | 5.9401 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6019 | 0 | 0 | 0 | 2.6019 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.4483 | -2.3916 | -0.3049 | 2.6987 | 3.4483 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | -0.5979 | 3.0488 | 2.099 | 0 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3887 | 9.716 | 11.4329 | 13.4933 | 4.3887 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | -6.893 | 0 | 0 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00174 uM | Activity at 0.00357 uM | Activity at 0.00697 uM | Activity at 0.016 uM | Activity at 0.028 uM | Activity at 0.056 uM | Activity at 0.105 uM | Activity at 0.226 uM | Activity at 0.447 uM | Activity at 0.627 uM | Activity at 0.951 uM | Activity at 1.818 uM | Activity at 2.333 uM | Activity at 4.073 uM | Activity at 6.884 uM | Activity at 11.29 uM | Activity at 15.41 uM | Activity at 25.59 uM | Activity at 50.19 uM | Activity at 58.90 uM | Activity at 114.8 uM | Activity at 162.0 uM | Activity at 229.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 100 | 38.2868 | Single point of activity | -4 | 4.9549 | 0.9173 | 40 | 1.7132 | 3 | 0 0 0 0 0 | 30.0132 | 5.2309 | 2.1349 | 2.7977 | -1.489 | 30.0132 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Activator | 100 | 54.6995 | Single point of activity | -4 | 4.9549 | 0.9067 | 56.2988 | 1.5993 | 3 | 0 0 0 0 0 | 42.8693 | 6.5044 | 4.3471 | -0.522 | -3.4058 | 42.8693 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -17.2476 | 21.6169 | 12.7311 | 22.8702 | 20.8427 | -17.2476 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Activator | 100 | 74.7794 | Single point of activity | -4 | 4.9549 | 0.9041 | 76.0108 | 1.2314 | 3 | 0 0 0 0 0 | 57.8804 | 6.7166 | 3.0104 | 3.7559 | -6.8905 | 57.8804 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Activator | 100 | 53.1278 | Single point of activity | -4 | 4.9549 | 0.9205 | 64.5427 | 11.4149 | 3 | 0 0 0 0 0 | 51.5124 | 12.0687 | 10.6696 | 16.4441 | 7.3638 | 51.5124 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Activator | 89.1251 | 88.3489 | Single point of activity | -4.05 | 4.9549 | 0.8504 | 83.4345 | -4.9144 | 3 | 0 0 0 0 0 | 66.09 | -2.4773 | 2.699 | 3.4126 | -18.2031 | 66.09 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 28.3132 | 7.6044 | 7.1621 | 1.8797 | -18.6884 | 28.3132 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 | -12.1963 | 15.5341 | 6.1257 | -12.1963 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Activator | 70.7946 | 131.9739 | Single point of activity | -4.15 | 4.9549 | 0.9814 | 124.2791 | -7.6948 | 3 | 0 0 0 0 | 113.1868 | -14.9551 | 3.8059 | -12.5697 | 113.1868 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Activator | 50.1187 | 98.8583 | Partial curve; high efficacy; poor fit | -4.3 | 2.8473 | 0.9993 | 127.1199 | 28.2616 | 2.3 | 0 0 0 | 118.3612 | 29.7145 | 27.0534 | 118.3612 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Activator | 89.1251 | 52.8332 | Single point of activity | -4.05 | 4.9549 | 0.8839 | 46.5982 | -6.2351 | 3 | 0 0 0 0 0 | 35.9582 | -5.7785 | 0.0051 | -3.002 | -11.6645 | 35.9582 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Activator | 44.6684 | 58.1237 | Single point of activity | -4.35 | 3.132 | 1 | 63.6237 | 5.5 | 3 | 0 0 0 | 60.693 | 5.2497 | 5.4646 | 60.693 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Activator | 100 | 32 | Partial curve; partial efficacy; poor fit | -4 | 4.9549 | 0.7933 | 42 | 10 | 2.4 | 0 0 0 0 0 | 31.927 | 6.4109 | 17.9669 | 11.7318 | 10.1379 | 31.927 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Activator | 70.7946 | 52.3872 | Partial curve; partial efficacy; poor fit | -4.15 | 3.132 | 0.9366 | 88.8106 | 36.4234 | 2.4 | 0 0 0 | 79.2341 | 43.0009 | 30.195 | 79.2341 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 10.1042 | -2.0932 | -3.6864 | -11.1533 | -2.2306 | 10.1042 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Activator | 35.4813 | 94.2201 | Single point of activity | -4.45 | 1.7137 | 1 | 103.2201 | 9 | 3 | 1 0 0 | 91.9965 | 33.4991 | 9.8887 | 91.9965 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Activator | 89.1251 | 188.8272 | Single point of activity | -4.05 | 4.9549 | 0.9819 | 184.3761 | -4.4511 | 3 | 0 0 0 0 0 | 142.9272 | -4.9415 | 0.8751 | 3.841 | 0.2429 | 142.9272 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 15.1304 | -16.5373 | -21.4322 | -21.4132 | -27.9881 | 15.1304 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Activator | 89.1251 | 54.5907 | Single point of activity | -4.05 | 4.9549 | 0.8982 | 43.8763 | -10.7143 | 3 | 0 0 0 0 0 | 34.3843 | -5.7785 | -4.8931 | -14.2749 | -14.7248 | 34.3843 | QC'd by "Asinex Ltd." | |||||||||||||||||||
| Activator | 56.2341 | 79.3018 | Partial curve; high efficacy; poor fit | -4.25 | 3.132 | 0.9915 | 106.1029 | 26.8011 | 2.3 | 0 0 0 | 98.2435 | 30.6599 | 23.0391 | 98.2435 | QC'd by "Asinex Ltd." |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00366 uM | Activity at 0.018 uM | Activity at 0.091 uM | Activity at 0.457 uM | Activity at 2.290 uM | Activity at 11.40 uM | Activity at 57.10 uM | Activity at 114.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | -18.6944 | -16.4688 | -21.0535 | -18.6569 | -21.2387 | -18.6944 | QC'd by "Chem Div" | |||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -10.5731 | -6.3238 | -5.0728 | -10.0177 | -9.1591 | -10.5731 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -20.9106 | -9.1883 | -14.5238 | -10.32 | -16.7599 | -20.9106 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -14.976 | -6.1336 | -5.9392 | -8.0291 | -13.3224 | -14.976 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -17.0295 | -7.3413 | -7.7338 | -7.023 | -12.9903 | -17.0295 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -7.6456 | 7.5602 | 6.2602 | 5.948 | 3.5763 | -7.6456 | QC'd by "Chem Div" | ||||||||||||
| Inhibitor | 56.2341 | 51.8151 | Partial curve; partial efficacy; poor fit | -4.25 | 2.3332 | 0.9681 | -53.5412 | -1.7261 | -2.4 | 0 0 0 0 0 | -52.4914 | -0.4336 | -0.9826 | -4.7322 | -25.7264 | -52.4914 | QC'd by "Chem Div" | ||||
| Inactive | 4 | 0 0 0 0 0 | -11.9031 | -7.9949 | -12.5613 | -13.3404 | -9.3154 | -11.9031 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -18.4236 | 0.258 | 0.8315 | -1.6401 | -6.8466 | -18.4236 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | -17.2118 | -16.2591 | -19.8884 | -17.4024 | -20.0078 | -17.2118 | QC'd by "Chem Div" | |||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -16.8313 | -10.0087 | -8.8391 | -10.5867 | -9.3418 | -16.8313 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -6.7293 | -13.0106 | -9.8363 | -10.4044 | -13.1352 | -6.7293 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | -0.6109 | -0.508 | 3.969 | 1.3962 | 3.5402 | -0.6109 | QC'd by "Chem Div" | |||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -19.2263 | -10.4317 | -10.645 | -12.9544 | -8.0548 | -19.2263 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -19.5782 | -17.1915 | -17.4143 | -17.6927 | -30.3966 | -19.5782 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -17.5302 | -9.8783 | -9.1532 | -13.5844 | -9.2694 | -17.5302 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | -11.9062 | -9.7368 | -9.5071 | -10.0381 | -13.0691 | -11.9062 | QC'd by "Chem Div" | |||||||||||||
| Inactive | 4 | -19.9153 | -18.2374 | -18.6714 | -22.0089 | -21.7411 | -19.9153 | QC'd by "Chem Div" | |||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 14.5935 | 1.829 | 2.4851 | 2.7485 | -0.7044 | 14.5935 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -10.4477 | -8.2332 | -4.1692 | -6.4251 | -8.3536 | -10.4477 | QC'd by "Chem Div" |
| Max_response | Activity at 15.4 uM | Activity at 76.9 uM | Compound QC |
|---|---|---|---|
| 17.8834 | 21.9423 | 17.8834 | QC'd by Sytravon |
| 17.883 | 6.815 | 17.883 | QC'd by Sytravon |
| 17.8605 | 5.0674 | 17.8605 | QC'd by Sytravon |
| 17.8326 | 17.2685 | 17.8326 | QC'd by Sytravon |
| 17.8049 | 0.1941 | 17.8049 | QC'd by Sytravon |
| 17.7855 | -6.4295 | 17.7855 | QC'd by Sytravon |
| 17.704 | 18.9018 | 17.704 | QC'd by Sytravon |
| 17.6889 | 12.4654 | 17.6889 | QC'd by Sytravon |
| 17.6676 | 22.7303 | 17.6676 | QC'd by Sytravon |
| 17.6537 | 5.1758 | 17.6537 | QC'd by Sytravon |
| 17.6448 | 15.3937 | 17.6448 | QC'd by Sytravon |
| 17.5821 | 11.7354 | 17.5821 | QC'd by Labotest |
| 17.5765 | 11.2006 | 17.5765 | QC'd by Sytravon |
| 17.56 | 6.5656 | 17.56 | QC'd by Sytravon |
| 17.5583 | 3.6123 | 17.5583 | QC'd by Sytravon |
| 17.5273 | 19.7769 | 17.5273 | QC'd by Sytravon |
| 17.523 | 22.7179 | 17.523 | QC'd by Sytravon |
| 17.5209 | -4.2415 | 17.5209 | QC'd by Sytravon |
| 17.5125 | -11.6066 | 17.5125 | QC'd by Sytravon |
| 17.4857 | 46.797 | 17.4857 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 2.300 uM | Activity at 11.50 uM | Activity at 57.50 uM | Activity at 115.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4.0950 | 0.9821 | -0.9159 | 4.5000 | 4.0000 | 0 0 0 0 | -1.1800 | 4.3015 | -0.4289 | -0.3951 | -1.1800 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.0000 | -3.2543 | -3.2390 | -0.8825 | -0.1010 | -3.2543 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.0000 | -0.8119 | -1.2485 | -2.5976 | -0.7522 | -0.8119 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.9549 | 0.9072 | -1.0000 | -11.2111 | 4.0000 | 0 0 0 0 | -2.1046 | -8.5093 | 0.7717 | -1.3735 | -2.1046 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.9549 | 0.6593 | -11.6940 | -2.6417 | 4.0000 | 0 0 0 0 | -8.0783 | -4.8676 | -1.7587 | -0.5347 | -8.0783 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.0000 | -1.6059 | -5.8638 | -3.5706 | -3.2696 | -1.6059 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.0000 | -0.1521 | 2.9140 | 0.6852 | -0.7434 | -0.1521 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 2.3531 | 0.9745 | -6.4082 | -0.3065 | 4.0000 | 0 0 0 0 | -7.0068 | -1.9221 | -5.9860 | -6.1608 | -7.0068 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.0000 | -3.3478 | -0.2303 | -3.0697 | 0.3647 | -3.3478 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.9549 | 0.9030 | -13.8252 | 0 | 4.0000 | 0 0 0 0 | -9.8543 | -0.5080 | -1.0508 | 1.5628 | -9.8543 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.0000 | -0.0032 | -0.0209 | -3.5547 | -0.3910 | -0.0032 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.0000 | -3.7518 | -3.6157 | -0.4669 | -3.9284 | -3.7518 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.0000 | -3.8188 | -4.5612 | -2.1035 | -2.7576 | -3.8188 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.4495 | 0.8890 | -1.8122 | -7.6162 | 4.0000 | 0 0 0 0 | -2.5354 | -5.9302 | -1.6084 | -0.6769 | -2.5354 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.0000 | 0.7484 | 0.6046 | 0.9044 | -0.1519 | 0.7484 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 4.0000 | -1.7691 | -8.1273 | 0.9371 | -8.8067 | -1.7691 | QC'd by Sytravon | ||||||||||
| Inactive | 0 | 2.9023 | 0.9981 | -9.1930 | 0.5000 | 4.0000 | 0 0 0 0 | -8.4942 | 0.6087 | 0.6529 | -5.1788 | -8.4942 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.9549 | 0.8215 | -9.3505 | -1.1245 | 4.0000 | 0 0 0 0 | -6.5421 | -2.9030 | -0.1037 | -1.1081 | -6.5421 | QC'd by Sytravon | |||||
| Inactive | 0 | 2.4064 | 0.9556 | -8.1547 | -1.4259 | 4.0000 | 0 0 0 0 | -6.7956 | -2.2492 | -1.1883 | -3.8915 | -6.7956 | QC'd by Sytravon | |||||
| Inactive | 0 | 4.0000 | 0.3933 | 1.0566 | 0.0830 | 0.7711 | 0.3933 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.369 uM | Activity at 1.840 uM | Activity at 9.220 uM | Activity at 46.10 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4 | 0.4852 | 1.3329 | 4.6087 | 0.4852 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -5.5864 | -3.7441 | -3.9306 | -5.5864 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -3.2988 | -6.1435 | -2.1999 | -3.2988 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -7.3584 | -2.8399 | -7.786 | -7.3584 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -4.3522 | -5.0741 | -4.8829 | -4.3522 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | 2.6765 | -1.8458 | -1.1971 | 2.6765 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4.9549 | 0.8345 | 6.5 | 0.4094 | 4 | 0 0 0 | 4.5972 | 1.38 | -0.9088 | 4.5972 | QC'd by Sytravon | ||||||
| Inactive | 0 | 4.045 | 0.9911 | 2.5 | -5.7263 | 4 | 0 0 0 | 2.489 | -3.1053 | 2.9273 | 2.489 | QC'd by Sytravon | ||||||
| Inactive | 0 | 4 | -1.4069 | -2.8935 | -0.9832 | -1.4069 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -7.3135 | -5.7292 | -8.4836 | -7.3135 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -6.7284 | -6.1728 | -7.0074 | -6.7284 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -0.0063 | 3.252 | 1.0092 | -0.0063 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | -10.583 | -10.2134 | -12.7771 | -10.583 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4 | 2.658 | -0.0253 | 4.1958 | 2.658 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4.9549 | 0.9485 | 1.8623 | -6.9487 | 4 | 0 0 0 | -0.9481 | -6.2213 | -7.874 | -0.9481 | QC'd by Sytravon | ||||||
| Inactive | 0 | 1.9887 | 0.9996 | 4.5 | -11.3652 | 4 | 0 0 0 | 4.2182 | -10.3044 | -1.228 | 4.2182 | QC'd by Sytravon | ||||||
| Inactive | 0 | 1 | 0.9997 | -16.7973 | -6.6112 | 4 | 0 0 0 | -16.081 | -10.0927 | -13.8873 | -16.081 | QC'd by Sytravon | ||||||
| Inactive | 0 | 3.5722 | 0.9976 | -11.2568 | -5.6054 | 4 | 0 0 0 | -11.0474 | -5.9212 | -11.0064 | -11.0474 | QC'd by Sytravon | ||||||
| Inactive | 0 | 4 | -10.6125 | -6.6641 | -8.211 | -10.6125 | QC'd by Sytravon | |||||||||||
| Inactive | 0 | 4.9549 | 0.9992 | 0 | -13.5428 | 4 | 0 0 0 | 0.1922 | -13.369 | -8.2047 | 0.1922 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003270000 uM | Activity at 0.0007732774 uM | Activity at 0.00163 uM | Activity at 0.00369 uM | Activity at 0.00818 uM | Activity at 0.020 uM | Activity at 0.030 uM | Activity at 0.047 uM | Activity at 0.101 uM | Activity at 0.151 uM | Activity at 0.243 uM | Activity at 0.477 uM | Activity at 0.759 uM | Activity at 1.287 uM | Activity at 2.393 uM | Activity at 3.818 uM | Activity at 6.336 uM | Activity at 11.99 uM | Activity at 19.37 uM | Activity at 31.37 uM | Activity at 60.11 uM | Activity at 107.2 uM | Activity at 158.4 uM | Activity at 229.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0 0 0 0 0 | 1.4694 | -3.5669 | -6.235 | 2.8586 | 1.8042 | 1.4694 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -4.2631 | 8.2218 | 8.0811 | 10.2927 | -3.9947 | -4.2631 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 6.0369 | 0.3398 | -2.1048 | -8.1695 | -3.6822 | 6.0369 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | -2.0565 | 1.7294 | -3.5894 | -1.2575 | -0.5402 | -2.0565 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 2.3149 | 1.0048 | 4.6369 | -1.9963 | -3.3543 | 2.3149 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 7.2748 | 7.1515 | 6.1372 | 1.5197 | 5.2332 | 7.2748 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 1.006 | -3.3873 | -7.786 | -9.3037 | -9.1761 | 1.006 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -0.0368 | -9.4458 | -10.5155 | -9.0065 | -12.9141 | -0.0368 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 2.6 | -7.8084 | -12.3007 | -2.0954 | -6.6887 | 2.6 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -11.4867 | -18.9051 | -17.4955 | -19.0735 | -9.6682 | -11.4867 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -7.5605 | -17.2173 | -11.0038 | -16.5656 | -22.4025 | -7.5605 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | -7.5451 | -1.1939 | -1.3084 | -5.8268 | -5.3206 | -7.5451 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -5.5852 | -4.3753 | -1.0046 | -3.1641 | -10.1524 | -5.5852 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 1.1172 | -6.0391 | 7.0118 | 9.0446 | 1.6533 | 1.1172 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 2.3359 | 1.2518 | 1.6626 | -0.9325 | -0.9194 | 2.3359 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 | -19.5354 | 0.3984 | -4.1147 | 2.1883 | -19.5354 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | -5.6552 | -4.6769 | -1.9378 | -0.5867 | -3.224 | -5.6552 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | -11.3738 | -10.4148 | -13.8912 | -10.4252 | -7.8961 | -11.3738 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | -6.1571 | -8.7102 | -2.9113 | -5.2229 | -3.4369 | -6.1571 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -7.3803 | -8.8177 | -11.1654 | -6.5301 | -15.9483 | -7.3803 | QC'd by "Chem Div" |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.369 uM | Activity at 1.840 uM | Activity at 9.220 uM | Activity at 46.10 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4 | -18.6503 | -13.1477 | -13.8495 | -10.193 | -18.6503 | QC'd by ChemBridge | ||||||||||
| Inactive | 0 | 4 | 5.9768 | 15.7971 | 9.5291 | 12.297 | 5.9768 | QC'd by ChemBridge | ||||||||||
| Inactive | 0 | 4 | -2.2605 | -6.3776 | -7.2549 | -8.6562 | -2.2605 | QC'd by ChemBridge | ||||||||||
| Inactive | 0 | -5.65 | 3.5117 | 0.929 | -4.668 | 6.5 | 4 | 0 0 0 0 | -2.7451 | 6.5923 | 2.4824 | -6.39 | -2.7451 | QC'd by ChemBridge | ||||
| Inactive | 0 | -4.85 | 4.5045 | 0.9998 | 0 | -21.4296 | 4 | 1 0 0 0 | 0 | -31.445 | -21.608 | -18.8541 | 0 | QC'd by DPISMR | ||||
| Inactive | 0 | -5.55 | 1.6259 | 0.9999 | -23.1676 | -0.9051 | 4 | 0 0 0 0 | -23.0563 | -1.5876 | -8.4216 | -20.3934 | -23.0563 | QC'd by ChemBridge | ||||
| Inactive | 0 | -5.05 | 3.9295 | 0.3826 | 0 | 12 | 4 | 0 0 0 1 | 17.9335 | 7.3443 | 17.1373 | 5.6102 | 17.9335 | QC'd by ChemBridge | ||||
| Inactive | 0 | -4.85 | 4.095 | 0.7187 | 8.5 | -3.0615 | 4 | 0 0 0 0 | 8.3654 | 1.0162 | -7.5512 | -1.3764 | 8.3654 | QC'd by ChemBridge | ||||
| Inactive | 0 | -5.85 | 1.8265 | 0.9939 | 17 | 2 | 4 | 0 0 0 0 | 16.3557 | 3.3181 | 10.8807 | 16.9605 | 16.3557 | QC'd by ChemBridge | ||||
| Inactive | 0 | 4 | 11.7124 | 6.83 | 11.386 | 12.225 | 11.7124 | QC'd by ChemBridge | ||||||||||
| Inactive | 0 | 4 | 0.7238 | 1.3368 | 3.1439 | 4.0622 | 0.7238 | QC'd by Life Chemicals | ||||||||||
| Inactive | 0 | -5.6 | 0.91 | 0.9987 | 2 | -14.0301 | 4 | 0 0 0 0 | 1.157 | -11.6917 | -6.9414 | -1.9594 | 1.157 | QC'd by Life Chemicals | ||||
| Inactive | 0 | 4 | -14.5304 | -9.6974 | -9.9315 | -8.9501 | -14.5304 | QC'd by Life Chemicals | ||||||||||
| Inactive | 0 | 4 | 3.8506 | 4.8909 | 1.3196 | 0.6926 | 3.8506 | QC'd by Life Chemicals | ||||||||||
| Inactive | 0 | 4 | 3.6273 | 9.2484 | 6.2107 | 7.5599 | 3.6273 | QC'd by Life Chemicals | ||||||||||
| Inactive | 0 | 4 | 5.4983 | 3.0112 | 2.1987 | 0.2649 | 5.4983 | QC'd by Life Chemicals | ||||||||||
| Inactive | 0 | 4 | 0.3801 | -0.8056 | -3.8566 | -3.9684 | 0.3801 | QC'd by Life Chemicals | ||||||||||
| Inactive | 0 | -4.5 | 2.3332 | 0.986 | -34.8622 | -18.1712 | 4 | 0 0 0 0 | -29.8852 | -18.8677 | -17.226 | -19.1089 | -29.8852 | QC'd by Life Chemicals | ||||
| Inactive | 0 | 4 | 2.9246 | 8.951 | 4.9149 | 3.3892 | 2.9246 | QC'd by Life Chemicals | ||||||||||
| Inactive | 0 | -4.95 | 4.095 | 0.9687 | 8 | -9.7934 | 4 | 0 0 0 0 | 7.6704 | -11.4945 | -7.996 | -3.6612 | 7.6704 | QC'd by ChemBridge |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00366 uM | Activity at 0.018 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.073 uM | Activity at 0.091 uM | Activity at 0.165 uM | Activity at 0.229 uM | Activity at 0.457 uM | Activity at 0.575 uM | Activity at 0.940 uM | Activity at 1.600 uM | Activity at 2.289 uM | Activity at 3.140 uM | Activity at 4.699 uM | Activity at 9.139 uM | Activity at 11.40 uM | Activity at 21.25 uM | Activity at 28.60 uM | Activity at 57.06 uM | Activity at 80.69 uM | Activity at 114.0 uM | Activity at 162.0 uM | Activity at 229.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0 0 0 0 0 0 | -8.5357 | 4.3179 | -3.0782 | 18.2044 | 1.4021 | -0.6071 | -8.5357 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inhibitor | 14.1254 | 94.1071 | Partial curve; partial efficacy | -4.85 | 1 | 0.9973 | -87.1071 | 7 | -2.2 | 0 0 0 0 0 | -69.1326 | 7.6715 | 3.9436 | -8.8651 | -33.8049 | -69.1326 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 20.2144 | 23.266 | 6.552 | 3.9866 | 5.6847 | 20.2144 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 | -2.4345 | 28.62 | 17.5955 | 28.0695 | -2.4345 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 1 | -7.2095 | -7.735 | -9.4851 | -7.9812 | 1.2883 | -3.8441 | -7.2095 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | 1.1024 | 3.0058 | 5.1191 | 8.5622 | 10.0935 | 2.832 | 1.1024 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -16.9168 | 16.7339 | 20.4666 | 17.0396 | 14.9834 | 3.2447 | -16.9168 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 16.95 | 3.6518 | 10.7006 | 12.1609 | 17.9239 | 16.95 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 7.8358 | 7.2347 | 7.1972 | -0.9941 | 5.7376 | 5.3715 | 7.8358 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -0.7814 | 9.8991 | 9.354 | 16.6393 | 7.5499 | -0.7814 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 20.4767 | 21.535 | 14.9912 | 12.9439 | 22.6391 | 20.4767 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -11.3724 | 5.1415 | -7.4919 | -12.7916 | -0.0848 | -11.3724 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -4.7334 | 4.0637 | 16.9474 | 20.3686 | 12.9839 | 14.7116 | -4.7334 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 5.3035 | 13.9672 | -6.2006 | 8.737 | 7.4415 | 9.3053 | 5.3035 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||||||
| Inactive | 4 | 13.7341 | 15.3823 | 8.8162 | 12.8936 | 14.0766 | 13.7341 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inhibitor | 25.1189 | 70.1972 | Single point of activity | -4.6 | 1.6436 | 0.9919 | -61.6972 | 8.5 | -3 | 0 0 0 0 0 | -47.4341 | 10.3286 | 9.7459 | 3.6414 | -5.394 | -47.4341 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 3.4844 | 2.4373 | 2.7844 | 2.0269 | 2.7823 | 3.4844 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 1 | 1.6267 | 6.0455 | 2.2559 | 3.9025 | 7.0096 | -5.3015 | 1.6267 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -35.8234 | 9.2678 | 8.5627 | 21.1144 | 2.8518 | -2.6144 | -35.8234 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||||
| Inactive | 4 | 1 0 0 0 0 0 | -8.4219 | 32.4292 | 6.1639 | 8.8591 | 10.3237 | 11.673 | -8.4219 | QC'd by "Asinex Ltd." |
| Fluorescence Polarization | Total Intensity | Z-score_FP | Z-score_Total Intensity | % Elongation_FP | % Elongation_Total Intensity | Fluorogenic |
|---|---|---|---|---|---|---|
| 256.7 | 36080052 | -0.1 | 0.3 | 102 | 113 | |
| 255.7 | 36170657 | -0.3 | 0.3 | 101 | 113 | |
| 256.9 | 35420114 | -0.1 | -0.3 | 102 | 107 | |
| 255.2 | 35741699 | -0.4 | 0 | 100 | 110 | |
| 257.5 | 35227125 | 0 | -0.5 | 103 | 105 | |
| 256.6 | 35252352 | -0.2 | -0.5 | 102 | 105 | |
| 259 | 35849065 | 0.3 | 0.1 | 105 | 111 | |
| 261 | 35903311 | 0.7 | 0.1 | 107 | 111 | |
| 259.7 | 35971169 | 0.5 | 0.2 | 106 | 112 | |
| 260.5 | 36236704 | 0.6 | 0.4 | 107 | 114 | |
| 257.4 | 36144089 | 0 | 0.3 | 103 | 113 | |
| 260.7 | 36158205 | 0.6 | 0.3 | 107 | 113 | |
| 260.4 | 36254981 | 0.6 | 0.4 | 107 | 114 | |
| 261.8 | 36799901 | 0.9 | 0.9 | 108 | 119 | |
| 257.7 | 36498125 | 0.1 | 0.6 | 103 | 116 | |
| 255.9 | 35232080 | -0.3 | -0.5 | 101 | 105 | |
| 256.8 | 35726936 | -0.1 | 0 | 102 | 110 | |
| 257.9 | 36378227 | 0.1 | 0.5 | 104 | 115 | |
| 258.7 | 36309511 | 0.3 | 0.5 | 105 | 115 | |
| 256.8 | 36098037 | -0.1 | 0.3 | 102 | 113 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00460 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.092 uM | Activity at 0.114 uM | Activity at 0.230 uM | Activity at 0.460 uM | Activity at 0.911 uM | Activity at 1.047 uM | Activity at 1.771 uM | Activity at 2.301 uM | Activity at 4.634 uM | Activity at 5.773 uM | Activity at 11.50 uM | Activity at 16.40 uM | Activity at 23.82 uM | Activity at 35.99 uM | Activity at 57.50 uM | Activity at 114.4 uM | Activity at 129.1 uM | Activity at 273.4 uM | Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6 | 2.9023 | 0.9997 | -6.2199 | -22.9484 | 4 | 0 0 0 1 | -15.1871 | -22.8737 | -13.0463 | -6.4332 | -15.1871 | QC'd by Sytravon | ||||||||||||||||||||||
| Inactive | 0 | -6.65 | 0.9 | 0.7402 | -5.4008 | -33.9189 | 4 | 0 0 0 0 | -2.834 | -24.9324 | -8.4029 | -13.6302 | -2.834 | QC'd by Sytravon | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.1352 | -33.2372 | -9.3478 | -12.8263 | -4.1352 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 39.8107 | 1177.6381 | 10 | Single point of activity | -4.4 | 4.4495 | 0.9999 | 1187.4957 | 9.8576 | 3 | 0 0 0 | 994.5525 | 13.6863 | 8.7931 | 994.5525 | QC'd by Sytravon | ||||||||||||||||||||
| Activator | 25.1189 | 856.7947 | 44 | Partial curve; high efficacy | -4.6 | 2.1876 | 1 | 854.9919 | -1.8029 | 2.1 | 0 0 0 | 734.5291 | -1.5024 | 129.7347 | 734.5291 | QC'd by Sytravon | ||||||||||||||||||||
| Activator | 39.8107 | 909.8761 | 10 | Single point of activity | -4.4 | 4.4495 | 1 | 913.6805 | 3.8043 | 3 | 0 0 0 | 765.2265 | 4.3594 | 6.0555 | 765.2265 | QC'd by Sytravon | ||||||||||||||||||||
| Activator | 39.8107 | 1167.7523 | 10 | Single point of activity | -4.4 | 4.4495 | 1 | 1156.7417 | -11.0106 | 3 | 0 0 0 | 968.7954 | -8.2968 | -9.1755 | 968.7954 | QC'd by Sytravon | ||||||||||||||||||||
| Inactive | 0 | -4.8 | 1.2221 | 0.9997 | -16.0914 | -2.4665 | 4 | 0 0 0 | -13.8261 | -2.8887 | -7.9138 | -13.8261 | QC'd by Sytravon | |||||||||||||||||||||||
| Inhibitor | 0.3162 | 28.8427 | 0 | Complete curve; partial efficacy | -6.5 | 1.21 | 1 | -35.2116 | -6.369 | -1.2 | 0 0 0 1 | -16.8972 | -12.8075 | -30.2353 | -34.8348 | -16.8972 | QC'd by Sytravon | |||||||||||||||||||
| Inactive | 0 | -5.05 | 4.095 | 0.9993 | -20.1137 | 2 | 4 | 0 0 0 | -20.5114 | 2.0778 | -14.2469 | -20.5114 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -5.3 | 2.1876 | 1 | -12.8329 | 17 | 4 | 0 0 0 | -12.7775 | 15.8521 | -8.7115 | -12.7775 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -5.05 | 4.095 | 0.9981 | -17.0037 | 2 | 4 | 0 0 0 | -17.5031 | 2.1077 | -11.7225 | -17.5031 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -4.9 | 2.1876 | 0.9999 | -26.0949 | -0.7708 | 4 | 0 0 0 | -25.0791 | -1.059 | -12.1795 | -25.0791 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.388 | 2.5 | -5.8163 | 4 | 0 0 0 | 1.5002 | -0.5325 | -11.5136 | 1.5002 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.6931 | -2.6669 | -8.9116 | -4.6931 | QC'd by Sytravon | |||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.5954 | -3.9778 | -8.3431 | -8.3846 | -2.5954 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.4 | 3.0654 | 0.8654 | 10.5 | -7.3981 | 4 | 0 0 0 0 | 6.4631 | -6.9984 | 9.8147 | 14.878 | 6.4631 | QC'd by Sytravon | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -13.1925 | -10.9583 | -7.0337 | -9.977 | -13.1925 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.7 | 4.9549 | 0.9864 | -3.5338 | -20.2426 | 4 | 0 0 0 1 | -12.6231 | -19.3688 | -2.5282 | -4.667 | -12.6231 | QC'd by Sytravon | ||||||||||||||||||||||
| Inactive | 0 | -6.75 | 4.9549 | 0.9868 | 9.5 | -8.6084 | 4 | 0 0 0 1 | 0.0118 | -6.757 | 10.658 | 8.4888 | 0.0118 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.018 uM | Activity at 0.037 uM | Activity at 0.074 uM | Activity at 0.164 uM | Activity at 0.369 uM | Activity at 0.461 uM | Activity at 0.737 uM | Activity at 0.922 uM | Activity at 1.840 uM | Activity at 2.300 uM | Activity at 3.690 uM | Activity at 4.610 uM | Activity at 9.233 uM | Activity at 20.57 uM | Activity at 46.10 uM | Activity at 92.20 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0 0 0 0 0 | 0.2596 | 10.769 | 4.1255 | -1.6909 | -0.7487 | 0.2596 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -0.8876 | -5.2018 | -3.6707 | 0.3303 | 2.9155 | -0.8876 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -4.2306 | -10.0984 | -0.7957 | -0.9322 | 2.0609 | -4.2306 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 5.8218 | -1.6618 | -3.0553 | 9.7773 | -4.173 | 5.8218 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 4 | -3.2651 | 11.605 | -17.8848 | 5.9785 | 14.3087 | -3.2651 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -7.241 | 3.2008 | 3.9728 | -4.5121 | 3.9811 | -7.241 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -9.807 | 8.9869 | 0.3484 | 0.3728 | 7.0197 | -9.807 | QC'd by "Chem Div" | ||||||||||||||||||||
| Cytotoxic | 17.7828 | 35.5846 | Partial curve; partial efficacy | -4.75 | 2.3031 | 0.9974 | -42.6167 | -7.0321 | -2.2 | 0 0 0 0 0 | -39.1036 | -6.2767 | -6.4175 | -8.2439 | -13.6777 | -39.1036 | QC'd by "Chem Div" | ||||||||||||
| Cytotoxic | 3.5481 | 40.0619 | Single point of activity | -5.45 | 4.9549 | 0.8999 | -40.3659 | -0.3039 | -3 | 0 0 0 0 1 | 2.6367 | -8.333 | 7.8061 | -1.7484 | -40.2332 | 2.6367 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 0.5424 | 1.6591 | 9.6647 | 14.2749 | 15.5896 | 0.5424 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 5.9628 | -8.298 | -2.3104 | 6.1361 | -3.4428 | 5.9628 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -1.0151 | -4.6247 | -5.8885 | -4.492 | -0.7127 | -1.0151 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | -0.9022 | -1.2889 | 13.9053 | -1.079 | 4.3101 | -0.9022 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -23.5202 | -1.5751 | 7.1469 | -12.6721 | 9.6037 | -23.5202 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -0.075 | -0.6173 | -0.8732 | 5.135 | 2.1913 | -0.075 | QC'd by "Chem Div" | ||||||||||||||||||||
| Cytotoxic | 35.4813 | 33.3813 | Single point of activity | -4.45 | 4.9549 | 0.4913 | -37.3813 | -4 | -3 | 0 0 0 0 0 | -30.3178 | -0.6381 | -23.6633 | -3.8386 | 6.0591 | -30.3178 | QC'd by "Chem Div" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -17.414 | 0.1464 | -4.8771 | -5.0687 | -7.6162 | -17.414 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | -4.6673 | -7.1501 | -3.3264 | -4.1232 | -3.249 | -4.6673 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -17.3878 | 6.5726 | 2.9374 | -7.8375 | -3.1433 | -17.3878 | QC'd by "Chem Div" | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -10.2269 | -7.0609 | -5.5812 | -5.8217 | 2.0518 | -10.2269 | QC'd by "Chem Div" |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00366 uM | Activity at 0.018 uM | Activity at 0.091 uM | Activity at 0.229 uM | Activity at 0.457 uM | Activity at 0.575 uM | Activity at 0.943 uM | Activity at 1.600 uM | Activity at 2.289 uM | Activity at 3.140 uM | Activity at 4.718 uM | Activity at 9.139 uM | Activity at 11.40 uM | Activity at 21.05 uM | Activity at 28.60 uM | Activity at 57.06 uM | Activity at 80.69 uM | Activity at 114.0 uM | Activity at 162.0 uM | Activity at 229.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0 0 0 0 0 | -0.226 | 6.4746 | 0.9204 | -0.5372 | 0.8592 | -0.226 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 12.8562 | -1.8356 | -5.6647 | -0.017 | -0.5558 | 12.8562 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 12.5006 | -1.9757 | -2.1008 | -2.1909 | -3.9301 | 12.5006 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 2.0579 | -4.4772 | -3.3361 | -4.7626 | -5.2019 | 2.0579 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 4.1372 | -0.9471 | -3.1539 | -7.212 | -6.4925 | 4.1372 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | -2.6054 | -9.932 | -7.5404 | -0.2177 | -8.4216 | -2.6054 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -3.0398 | -2.9765 | -4.4925 | -0.7002 | 2.9936 | -3.0398 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -3.074 | 3.888 | 1.2985 | 0.6146 | -0.3069 | -3.074 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -9.7692 | -4.4338 | -3.3244 | -6.5932 | -4.4097 | -9.7692 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | 6.2922 | -3.5076 | -1.5083 | 2.7239 | 7.2009 | 5.3756 | 6.2922 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||
| Inactive | 4 | -0.2544 | -0.2233 | -1.1943 | -3.5748 | -3.6048 | -2.2861 | -0.2544 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -1.5988 | 14.2358 | 2.588 | 5.3038 | 2.9078 | -1.5988 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | -3.7605 | -2.861 | 1.5078 | 2.0007 | 0.948 | -2.2965 | -3.7605 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 5.982 | 5.5678 | 4.2928 | 9.2904 | 6.0688 | 4.4563 | 5.982 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | 6.8353 | 2.5813 | -3.1437 | -3.6312 | 2.5513 | 11.3967 | 6.8353 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -2.3409 | 7.0392 | -3.5682 | -1.7692 | 5.9909 | -2.9248 | -2.3409 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 0.4459 | -0.2996 | -0.8455 | -0.1901 | 8.987 | 0.4459 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 1.1584 | 5.9201 | 4.3416 | -2.2202 | -2.3243 | 6.6441 | 1.1584 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 4 | 6.7843 | 4.8805 | 4.8824 | 3.991 | 4.4147 | 6.7843 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -15.7664 | 1.54 | 2.1877 | 3.2591 | 9.3946 | -15.7664 | QC'd by "Asinex Ltd." |
| Phenotype | Potency | Efficacy | Analysis Comment | activity-Activity_Score | activity-Curve_Description | activity-Fit_LogAC50 | activity-Fit_HillSlope | activity-Fit_R2 | activity-Fit_InfiniteActivity | activity-Fit_ZeroActivity | activity-Fit_CurveClass | activity-Excluded_Points | activity-Max_Response | activity-Activity at 0.011 uM | activity-Activity at 0.113 uM | activity-Activity at 1.140 uM | activity-Activity at 11.50 uM | activity-Activity at 57.50 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 4.4668 | 119.0007 | 85 | Complete curve; high efficacy | -5.35 | 4.9549 | 0.9999 | -112.4307 | 6.5699 | -1.1 | 0 0 0 0 0 | -112.2063 | 6.5106 | 5.855 | 7.2471 | -111.6796 | -112.2063 | QC'd by Sytravon | |
| Cytotoxic | 2.8184 | 101.3931 | 85 | Complete curve; high efficacy | -5.55 | 4.095 | 0.9998 | -98.8105 | 2.5825 | -1.1 | 0 0 0 0 0 | -99.8086 | 3.4929 | 1.8135 | 0.1929 | -97.9785 | -99.8086 | QC'd by Sytravon | |
| Cytotoxic | 3.1623 | 101.9634 | 85 | Complete curve; high efficacy | -5.5 | 4.095 | 0.9999 | -100.4276 | 1.5359 | -1.1 | 0 0 0 0 0 | -100.2271 | 2.163 | 0.9555 | 0.0213 | -99.9453 | -100.2271 | QC'd by Sytravon | |
| Cytotoxic | 2.8184 | 107.8517 | 85 | Complete curve; high efficacy | -5.55 | 4.095 | 1 | -103.5138 | 4.3379 | -1.1 | 0 0 0 0 0 | -103.9295 | 4.5177 | 3.7953 | 1.9466 | -103.1019 | -103.9295 | QC'd by Sytravon | |
| Cytotoxic | 4.4668 | 118.2014 | 85 | Complete curve; high efficacy | -5.35 | 4.4495 | 0.9999 | -114.0392 | 4.1622 | -1.1 | 0 0 0 0 0 | -113.8116 | 4.1094 | 3.325 | 5.1082 | -112.6974 | -113.8116 | QC'd by Sytravon | |
| Cytotoxic | 6.3096 | 105.3976 | 84 | Complete curve; high efficacy | -5.2 | 4.9549 | 0.9959 | -103.7304 | 1.6672 | -1.1 | 0 0 0 0 0 | -103.5234 | -2.2724 | 0.4384 | 7.6226 | -99.3352 | -103.5234 | QC'd by Sytravon | |
| Cytotoxic | 6.3096 | 101.4794 | 84 | Complete curve; high efficacy | -5.2 | 3.5117 | 0.9998 | -101.9915 | -0.5121 | -1.1 | 0 0 0 0 0 | -102.4011 | -1.5373 | 0.0096 | -0.3452 | -90.968 | -102.4011 | QC'd by Sytravon | |
| Cytotoxic | 7.9433 | 102.5896 | 83 | Complete curve; high efficacy | -5.1 | 4.5045 | 1 | -101.0527 | 1.5368 | -1.1 | 0 0 0 0 0 | -100.851 | 0.9006 | 1.6037 | 1.4302 | -84.9187 | -100.851 | QC'd by Sytravon | |
| Cytotoxic | 3.1623 | 70.2971 | 63 | Complete curve; partial efficacy | -5.5 | 4.9549 | 0.9828 | -69.7049 | 0.5922 | -1.2 | 0 0 0 0 0 | -63.4321 | 3.387 | -3.4687 | 1.565 | -75.6911 | -63.4321 | QC'd by Sytravon | |
| Cytotoxic | 14.1254 | 95.8066 | 42 | Partial curve; high efficacy | -4.85 | 2.0479 | 0.9978 | -95.2224 | 0.5841 | -2.1 | 0 0 0 0 0 | -90.688 | -0.6207 | 3.4708 | -1.7573 | -36.6682 | -90.688 | QC'd by Sytravon | |
| Cytotoxic | 11.2202 | 112.9139 | 42 | Partial curve; high efficacy | -4.95 | 1.7137 | 0.9958 | -104.6169 | 8.297 | -2.1 | 0 0 0 0 0 | -97.9559 | 12.6712 | 3.8381 | 6.1282 | -49.5999 | -97.9559 | QC'd by Sytravon | |
| Cytotoxic | 10 | 69.0448 | 42 | Partial curve; partial efficacy | -5 | 3.99 | 0.9749 | -62.5448 | 6.5 | -2.2 | 0 0 0 0 0 | -62.32 | 9.111 | -1.6802 | 12.1821 | -37.3237 | -62.32 | QC'd by Sytravon | |
| Cytotoxic | 11.2202 | 80.1564 | 42 | Partial curve; partial efficacy | -4.95 | 1.2475 | 0.999 | -73.1564 | 7 | -2.2 | 0 0 0 0 0 | -63.8803 | 6.0928 | 8.3822 | 2.1812 | -33.2986 | -63.8803 | QC'd by Sytravon | |
| Cytotoxic | 12.5893 | 125.2045 | 42 | Partial curve; high efficacy | -4.9 | 1.3437 | 0.9989 | -120.6636 | 4.5408 | -2.1 | 0 0 0 0 0 | -106.9713 | 3.8351 | 6.5495 | -1.8934 | -52.8187 | -106.9713 | QC'd by Sytravon | |
| Cytotoxic | 12.5893 | 111.8018 | 42 | Partial curve; high efficacy | -4.9 | 2.1876 | 0.9982 | -109.0374 | 2.7644 | -2.1 | 0 0 0 0 0 | -105.0457 | 0.5476 | 2.766 | 5.5294 | -48.2674 | -105.0457 | QC'd by Sytravon | |
| Cytotoxic | 12.5893 | 115.1281 | 42 | Partial curve; high efficacy | -4.9 | 2.4064 | 0.9871 | -114.5218 | 0.6063 | -2.1 | 0 0 0 0 0 | -111.6197 | -2.5136 | -5.0094 | 9.6428 | -50.5839 | -111.6197 | QC'd by Sytravon | |
| Cytotoxic | 10 | 66.7357 | 42 | Partial curve; partial efficacy | -5 | 1.5936 | 0.9998 | -66.0378 | 0.6978 | -2.2 | 0 0 0 0 0 | -62.3139 | 0.708 | 0.4832 | -1.6017 | -35.5891 | -62.3139 | QC'd by Sytravon | |
| Cytotoxic | 12.5893 | 84.3893 | 42 | Partial curve; high efficacy | -4.9 | 2.4064 | 0.9981 | -82.2582 | 2.1311 | -2.1 | 0 0 0 0 0 | -80.3317 | -0.5547 | 3.3569 | 3.0162 | -35.6994 | -80.3317 | QC'd by Sytravon | |
| Cytotoxic | 25.1189 | 104.7569 | 41 | Partial curve; partial efficacy | -4.6 | 1.3437 | 0.9947 | -102.6041 | 2.1527 | -2.2 | 0 0 0 0 0 | -77.7304 | 0.629 | 5.7425 | -1.9802 | -23.6366 | -77.7304 | QC'd by Sytravon | |
| Cytotoxic | 19.9526 | 122.6101 | 41 | Partial curve; high efficacy | -4.7 | 2.1211 | 0.9971 | -120.3218 | 2.2883 | -2.1 | 0 0 0 0 0 | -108.398 | 6.0184 | -1.2888 | 2.1585 | -26.8214 | -108.398 | QC'd by Sytravon |
| Max_Response | Activity at 2.29 uM | Activity at 11.40 uM | Activity at 57.10 uM | Activity at 114.0 uM | Activity at 229.0 uM | Compound QC |
|---|---|---|---|---|---|---|
| -13.2744 | -14.0597 | -11.6112 | -13.2744 | QC'd by CBC | ||
| -13.2736 | -2.2436 | -1.4106 | -3.5076 | -4.2706 | -13.2736 | QC'd by ChemBridge |
| -13.2725 | -6.3492 | -3.253 | -0.0584 | -6.7999 | -13.2725 | QC'd by Enamine |
| -13.2721 | -2.684 | -6.1454 | -14.2744 | -13.2721 | -0.8973 | QC'd by InterBioScreen |
| -13.2688 | 1.9838 | 0.4889 | -13.2688 | QC'd by CBC | ||
| -13.2682 | -4.4846 | 2.9589 | -5.115 | -5.7595 | -13.2682 | QC'd by Sytravon |
| -13.2658 | -0.93 | -4.4888 | -3.7077 | -0.7595 | -13.2658 | QC'd by Scripps Research Institute Molecular Screening Center-Florida |
| -13.2621 | -10.0397 | -8.5786 | -8.5671 | -13.2621 | -10.4851 | QC'd by InterBioScreen |
| -13.2619 | -4.902 | -18.7355 | -13.2619 | QC'd by CBC | ||
| -13.2616 | -5.6993 | -9.4488 | -8.2485 | -1.1117 | -13.2616 | QC'd by Asinex Ltd. |
| -13.2589 | -2.6923 | -5.6679 | -1.3754 | -4.9233 | -13.2589 | QC'd by ChemBridge |
| -13.2586 | -7.6996 | -6.7417 | -9.0608 | -13.2586 | 13.0861 | QC'd by Chem Div |
| -13.258 | 4.5885 | -10.8854 | -13.258 | QC'd by CBC | ||
| -13.2566 | -1.7741 | -2.7236 | -3.5771 | -3.8709 | -13.2566 | QC'd by Chem Div |
| -13.255 | -2.106 | 1.9951 | -5.3796 | -7.5294 | -13.255 | QC'd by Sytravon |
| -13.2542 | -3.8713 | -0.3776 | -5.8085 | -5.7762 | -13.2542 | QC'd by Sytravon |
| -13.2537 | -9.0401 | -8.2673 | -9.7055 | -13.2537 | QC'd by ChemBridge | |
| -13.2524 | -8.3625 | -5.9151 | -4.3599 | -2.4204 | -13.2524 | QC'd by Life Chemicals |
| -13.2524 | -11.5667 | -8.9808 | -13.1831 | -13.2524 | -13.0056 | QC'd by Enamine |
| -13.2524 | 12.6035 | 6.6367 | -13.2524 | QC'd by CBC |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00457 uM | Activity at 0.023 uM | Activity at 0.029 uM | Activity at 0.047 uM | Activity at 0.084 uM | Activity at 0.127 uM | Activity at 0.212 uM | Activity at 0.303 uM | Activity at 0.463 uM | Activity at 0.774 uM | Activity at 1.183 uM | Activity at 2.152 uM | Activity at 2.856 uM | Activity at 4.631 uM | Activity at 6.701 uM | Activity at 11.26 uM | Activity at 16.91 uM | Activity at 27.01 uM | Activity at 39.83 uM | Activity at 57.93 uM | Activity at 97.38 uM | Activity at 146.4 uM | Activity at 210.0 uM | Activity at 304.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4 | -6.0625 | -2.3623 | -0.2802 | -5.2775 | -6.0625 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||||||||
| Inhibitor | 35.4813 | 40.7736 | 10 | Single point of activity | -4.45 | 2.4064 | 0.933 | -44.7736 | -4 | -3 | 0 0 0 0 | -35.0558 | 0 | -9.6533 | -5.4245 | -35.0558 | QC'd by Evotec (US) Inc. | |||||||||||||||||||||
| Inactive | 0 | -5.85 | 3.9295 | 0.9968 | -13.4932 | 3 | 4 | 0 0 0 0 | -13.1541 | 2.8182 | -11.1738 | -14.161 | -13.1541 | QC'd by UrkORgSynthesis Ltd | ||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 4.9549 | 0.8892 | 13.5 | -3.5623 | 4 | 0 0 0 1 | -8.0174 | -0.4429 | -6.3019 | 11.0739 | -8.0174 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||
| Inactive | 0 | 4 | -15.8272 | -9.3466 | -13.7699 | -18.4456 | -15.8272 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.7 | 2.4064 | 0.8108 | -13.0434 | 0.4341 | 4 | 0 0 0 0 | -9.5936 | -0.0549 | -7.5602 | -16.7029 | -9.5936 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||
| Inactive | 0 | 4 | -11.635 | -18.2363 | -13.8009 | -16.9167 | -11.635 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | -12.2857 | -9.6332 | -6.6135 | -15.2325 | -12.2857 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||||||||
| Activator | 14.1254 | 48.5674 | 0 | Single point of activity | -4.85 | 1.2221 | 0.9975 | 36.9973 | -11.5701 | 3 | 0 0 0 0 | 30.2349 | -11.1897 | -5.7724 | 8.6511 | 30.2349 | QC'd by Evotec (US) Inc. | |||||||||||||||||||||
| Inactive | 0 | -6.2 | 4.9549 | 0.6966 | 2 | -9.5969 | 4 | 0 0 0 1 | -6.1109 | -7.5807 | 5.9101 | -1.5457 | -6.1109 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||
| Inactive | 0 | -5.85 | 3.132 | 0.9409 | -21.457 | 7.5 | 4 | 0 0 0 0 | -17.551 | 6.6865 | -16.2327 | -25.7975 | -17.551 | QC'd by ChemBridge | ||||||||||||||||||||||||
| Inactive | 0 | 4 | -8.9062 | -10.0321 | -8.4923 | -13.3892 | -8.9062 | QC'd by Enamine | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.6263 | 7.8678 | 51.4183 | 4 | 0 0 0 0 | 13.9623 | 31.0426 | 59.7813 | 63.0809 | 13.9623 | QC'd by Asinex Ltd. | ||||||||||||||||||||||||
| Inhibitor | 19.9526 | 38.6125 | 10 | Single point of activity | -4.7 | 2.3332 | 0.9982 | -39.7401 | -1.1275 | -3 | 0 0 0 0 | -36.5455 | -1.9894 | -0.5229 | -9.5594 | -36.5455 | QC'd by Evotec (US) Inc. | |||||||||||||||||||||
| Inactive | 0 | -6.2 | 4.9549 | 0.9465 | -11.4918 | 22 | 4 | 0 0 0 0 | -6.9123 | 16.7569 | -14.5765 | -13.2401 | -6.9123 | QC'd by ChemBridge | ||||||||||||||||||||||||
| Inactive | 0 | 4 | -15.3605 | -14.6287 | -17.6489 | -22.4317 | -15.3605 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.5 | 4.5045 | 0.9992 | -8.294 | -20.1637 | 4 | 0 0 0 1 | -21.4275 | -20.1364 | -17.9575 | -8.5783 | -21.4275 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||
| Inactive | 0 | 4 | -15.0697 | -19.7843 | -18.2327 | -16.8712 | -15.0697 | QC'd by Evotec (US) Inc. | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.5 | 3.99 | 0.9996 | -14.5384 | 2 | 4 | 0 0 0 1 | -1.5533 | 1.9923 | -1.6259 | -14.1987 | -1.5533 | QC'd by Asinex Ltd. | ||||||||||||||||||||||||
| Inactive | 0 | -4.85 | 3.9295 | 0.9256 | 2.5 | -10.3046 | 4 | 0 0 0 0 | 2.6164 | -8.1304 | -12.3372 | -6.3737 | 2.6164 | QC'd by Evotec (US) Inc. |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000420468 uM | Activity at 0.0001060182 uM | Activity at 0.0001893301 uM | Activity at 0.0004489405 uM | Activity at 0.0009664426 uM | Activity at 0.00171 uM | Activity at 0.00292 uM | Activity at 0.00536 uM | Activity at 0.00931 uM | Activity at 0.020 uM | Activity at 0.041 uM | Activity at 0.085 uM | Activity at 0.146 uM | Activity at 0.251 uM | Activity at 0.501 uM | Activity at 1.073 uM | Activity at 2.225 uM | Activity at 4.221 uM | Activity at 6.452 uM | Activity at 12.64 uM | Activity at 29.84 uM | Activity at 57.50 uM | Activity at 114.0 uM | Activity at 227.6 uM | Activity at 379.2 uM | Activity at 573.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | -8.3336 | -1.4117 | -0.6141 | -1.8079 | 0.0446 | -8.3336 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5.75 | 4.9549 | 0.364 | -29.4824 | 3.3805 | 4 | 0 0 0 0 1 | -1.3954 | 3.2535 | 0.7839 | -59.1373 | 6.0E-4 | -1.3954 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -6.75 | 3.132 | 0.7843 | 0.8702 | 12.5 | 4 | 0 0 0 0 0 | 4.4963 | 10.2975 | -0.4426 | -1.3582 | 0.1626 | 4.4963 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.0548 | -1.7066 | -2.8833 | -2.005 | 0.3693 | 2.0548 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -5.6422 | 0.4339 | -3.0268 | -4.4255 | -2.8516 | -5.6422 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.2315 | -0.9193 | -0.9625 | 13.7196 | -1.9704 | 0.2315 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5.05 | 4.9549 | 0.5023 | -0.0525 | 7.5 | 4 | 0 0 0 0 1 | 5.313 | 2.7111 | 12.7202 | 1.5451 | -0.0438 | 5.313 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3883 | -3.3207 | -0.3808 | -0.1461 | -2.971 | 4.3883 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 5.7635 | -0.6995 | -1.7294 | 6.1024 | 1.8317 | 5.7635 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4.3 | 1.0693 | 0.8616 | -4.2573 | 9.5 | 4 | 0 0 0 0 0 | -1.8811 | 11.1484 | 8.5502 | 5.9885 | 4.608 | -1.8811 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -1.7273 | -3.4115 | -0.1881 | -2.6331 | -1.6916 | -1.7273 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3895 | -3.0627 | -1.1001 | 4.7802 | 0.8642 | 4.3895 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5 | 4.9549 | 0.6649 | 10.5 | 0.7021 | 4 | 0 0 0 0 0 | 13.7837 | 4.4863 | -3.5816 | 7.2204 | 7.3678 | 13.7837 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 6.0179 | 3.343 | 6.8931 | 2.2936 | 4.5224 | 6.0179 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 11.3207 | 3.0878 | 5.164 | 2.5572 | 5.3615 | 11.3207 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 8.7383 | 3.2664 | 2.7307 | 3.2405 | 1.8463 | 8.7383 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4.05 | 2.7202 | 0.9497 | -18.9142 | -2.2922 | 4 | 0 0 0 0 0 | -14.0952 | -1.0768 | -4.0059 | -2.4795 | -5.6228 | -14.0952 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -7.7765 | -2.2569 | -3.9959 | -1.3451 | 0.1566 | -7.7765 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4 | 4.9549 | 0.7054 | -25.0658 | -0.5 | 4 | 0 0 0 0 0 | -17.5549 | -2.6051 | -3.8192 | -2.6993 | 6.0774 | -17.5549 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -5.8 | 4.9549 | 0.4109 | -5.3905 | 4 | 4 | 0 0 0 0 0 | -2.4904 | 3.804 | 2.4492 | -14.0754 | 0.8551 | -2.4904 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000077118 uM | Activity at 0.0000393017 uM | Activity at 0.0000781896 uM | Activity at 0.0001700349 uM | Activity at 0.0003854776 uM | Activity at 0.0008323078 uM | Activity at 0.00150 uM | Activity at 0.00316 uM | Activity at 0.00511 uM | Activity at 0.00966 uM | Activity at 0.023 uM | Activity at 0.050 uM | Activity at 0.101 uM | Activity at 0.217 uM | Activity at 0.414 uM | Activity at 0.673 uM | Activity at 1.904 uM | Activity at 2.793 uM | Activity at 6.307 uM | Activity at 13.45 uM | Activity at 20.56 uM | Activity at 53.33 uM | Activity at 79.85 uM | Activity at 162.3 uM | Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 39.8107 | 53.3202 | 10 | Single point of activity | -4.4 | 2.5884 | 0.9867 | -48.8202 | 4.5 | -3 | 0 0 0 0 0 0 0 | -40.6835 | 8.1603 | 4.0867 | 3.4276 | 5.1196 | 1.6393 | -0.0748 | -40.6835 | QC'd by Tocris | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.015 | -0.2175 | -0.5756 | -1.1195 | 1.4974 | -1.0976 | -0.6212 | 0.015 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.5185 | 6.0779 | 0.5508 | 3.8916 | 2.5984 | 1.1722 | 2.0663 | 0.5185 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.0257 | -0.374 | -1.4506 | -1.3016 | -1.0656 | -0.9235 | 0.4464 | -2.0257 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | -4.3 | 4.5045 | 0.984 | -19.1975 | 0 | 4 | 0 0 0 0 0 0 0 | -16.8312 | -0.2154 | -1.2558 | 0.9738 | 1.1829 | -0.1066 | -0.0366 | -16.8312 | QC'd by Tocris | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.1296 | 2.9655 | 0.6465 | -1.9858 | 1.5085 | -0.0887 | 2.9709 | 2.1296 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 1.8579 | 0.925 | -12.343 | 4 | 4 | 0 0 0 0 0 0 0 | -8.6191 | 5.7795 | 1.9376 | 3.8199 | 5.4558 | 2.7838 | 1.8259 | -8.6191 | QC'd by Tocris | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.0918 | -0.9895 | -2.4108 | -0.8469 | -0.967 | -2.0746 | -1.3704 | -2.0918 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.0255 | -0.6283 | 0.0156 | 0.1788 | -0.8044 | -1.3186 | -0.7153 | 0.0255 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.1146 | -2.8935 | -5.1856 | -5.7517 | -1.454 | -4.3451 | -6.1783 | 0.1146 | QC'd by MedChem Express | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.8877 | -1.3858 | -16.61 | 6.9762 | 7.2289 | -13.8826 | 5.8145 | 3.8877 | QC'd by APExBIO | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -3.262 | -4.1811 | 1.5622 | -0.0496 | -1.6578 | -0.2741 | -0.8617 | -3.262 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | -5.35 | 4.095 | 0.9664 | -6.7999 | 4 | 4 | 0 0 0 0 0 0 1 | 5.437 | 4.9443 | 4.75 | 3.166 | 3.0591 | 2 | -6.4999 | 5.437 | QC'd by Axon Medchem | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -6.3793 | -1.7899 | -0.6034 | -0.4471 | -1.1982 | -1.1612 | 1.5608 | -6.3793 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 0.8 | 0.9159 | 18 | -3.0106 | 4 | 0 0 0 0 0 0 0 | 13.5846 | -2.6459 | -2.5886 | -1.4907 | -4.5922 | 4.0245 | 5.3793 | 13.5846 | QC'd by MedChem Express | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -0.1718 | -2.7451 | -1.5974 | -2.775 | -1.4013 | -1.0798 | -0.4332 | -0.1718 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | -4.25 | 4.9549 | 0.9713 | -25.1804 | -1.7527 | 4 | 0 0 0 0 0 0 0 | -20.9837 | -0.8831 | -2.3367 | -0.2106 | -1.3606 | -4.0325 | -0.9729 | -20.9837 | QC'd by Axon Medchem | ||||||||||||||||||||||
| Inactive | 0 | -4.45 | 1.6436 | 0.4672 | 7.5 | -7.6743 | 4 | 0 0 0 0 0 0 0 | 4.0193 | -6.5695 | -2.9715 | -6.8641 | -16.8119 | -3.3436 | -5.0174 | 4.0193 | QC'd by Axon Medchem | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -8.0397 | -4.2819 | -2.9052 | -2.785 | -0.4268 | 1.6569 | -0.2368 | -8.0397 | QC'd by Tocris | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.358 | 2.4598 | 1.0512 | 3.3772 | 0.9166 | 0.3232 | 0.1661 | 3.358 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0007360000 uM | Activity at 0.00368 uM | Activity at 0.018 uM | Activity at 0.092 uM | Activity at 0.460 uM | Activity at 2.300 uM | Activity at 11.50 uM | Activity at 57.50 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0.644 | 1.422 | 0.841 | 6.7312 | 0.9199 | 0.7976 | 0.644 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | 2.3435 | 2.1521 | 2.9689 | 2.7416 | 2.8472 | 0.4111 | 2.3435 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | 0.0015 | 0.3102 | -2.0273 | 1.3352 | 0.1332 | -0.3094 | 0.0015 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -0.1716 | 1.865 | 2.0294 | 6.4476 | 2.3796 | 1.0274 | -0.1716 | QC'd by "DPISMR" | |||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | 1.007 | -2.7011 | -0.1708 | 6.4991 | 2.0041 | 2.0967 | 1.007 | QC'd by "DPISMR" | |||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -1.1179 | 0.2049 | 6.1966 | -2.3909 | -2.1607 | 3.3301 | -1.1179 | QC'd by "DPISMR" | |||||||||||
| Inactive | 4 | 1.0949 | 2.8758 | 2.7284 | 1.683 | 2.3968 | 1.1492 | 1.0949 | QC'd by "Enamine" | ||||||||||||
| Inactive | 4 | 11.7061 | 14.5237 | 13.6692 | 3.9103 | 14.4002 | 15.0123 | 11.7061 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | -0.8885 | 1.6365 | 3.5919 | 1.1642 | 3.1773 | 0.4167 | -0.8885 | QC'd by "Enamine" | ||||||||||||
| Inactive | 4 | 1.4599 | -0.538 | 2.5346 | 2.3752 | 3.3567 | 0.7721 | 1.4599 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | -0.0427 | 1.2187 | 1.9255 | 1.5493 | 2.9677 | 0.0419 | -0.0427 | QC'd by "DPISMR" | ||||||||||||
| Inhibitor | 37.933 | 35.7734 | Partial curve; partial efficacy; poor fit | -4.421 | 4.9549 | 0.9772 | -33.7734 | 2 | -2.4 | 0 0 0 0 0 0 | -29.8112 | 0.9245 | 5.218 | -0.1723 | 1.0843 | 3.5778 | -29.8112 | QC'd by "DPISMR" | |||
| Inactive | 4 | 0 0 0 0 0 0 | -8.1569 | 1.3366 | 0.0372 | 1.4317 | 2.1732 | -0.2051 | -8.1569 | QC'd by "DPISMR" | |||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -2.0656 | 0.9492 | 2.3965 | 1.2731 | 1.4874 | 4.6957 | -2.0656 | QC'd by "DPISMR" | |||||||||||
| Inactive | 4 | 0.7593 | 1.3159 | 1.7201 | 1.7134 | 1.9314 | 3.1668 | 0.7593 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | 0.76 | 2.9569 | 4.6913 | 4.9933 | 3.6857 | 2.5801 | 0.76 | QC'd by "DPISMR" | ||||||||||||
| Inhibitor | 26.8545 | 26.7655 | Partial curve; partial efficacy; poor fit | -4.571 | 4.5045 | 0.9889 | -26.7655 | 0 | -2.4 | 0 0 0 0 0 0 | -26.0546 | -0.3971 | 1.531 | 0.1508 | -1.9239 | -0.6216 | -26.0546 | QC'd by "Enamine" | |||
| Inactive | 4 | 1.7276 | 0.5936 | 2.4796 | 2.8662 | 2.8768 | 1.6972 | 1.7276 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | -0.1439 | -1.2403 | 0.0246 | -0.2502 | 1.0119 | -0.5561 | -0.1439 | QC'd by "DPISMR" | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 0 | -3.3497 | 0.6868 | 2.3313 | -0.2471 | 1.6909 | -0.0071 | -3.3497 | QC'd by "DPISMR" |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | fluc-Phenotype | fluc-Potency | fluc-Efficacy | fluc-Analysis Comment | fluc-Curve_Description | fluc-Fit_LogAC50 | fluc-Fit_HillSlope | fluc-Fit_R2 | fluc-Fit_InfiniteActivity | fluc-Fit_ZeroActivity | fluc-Fit_CurveClass | fluc-Excluded_Points | fluc-Max_Response | fluc-Activity at 0.011 uM | fluc-Activity at 0.113 uM | fluc-Activity at 1.140 uM | fluc-Activity at 11.50 uM | fluc-Activity at 57.50 uM | nluc-Phenotype | nluc-Potency | nluc-Efficacy | nluc-Analysis Comment | nluc-Curve_Description | nluc-Fit_LogAC50 | nluc-Fit_HillSlope | nluc-Fit_R2 | nluc-Fit_InfiniteActivity | nluc-Fit_ZeroActivity | nluc-Fit_CurveClass | nluc-Excluded_Points | nluc-Max_Response | nluc-Activity at 0.011 uM | nluc-Activity at 0.113 uM | nluc-Activity at 1.140 uM | nluc-Activity at 11.50 uM | nluc-Activity at 57.50 uM |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 21.17 | -48.88035 | 10 | Inhibitor | 22.3872 | 58.0467 | Single point of activity | -4.65 | 2.7202 | 0.9717 | -54.4127 | 3.634 | -3 | 0 0 0 0 0 | -49.9338 | 6.8137 | -2.638 | 7.3863 | -4.5761 | -49.9338 | Inhibitor | 19.9526 | 48.9036 | Partial curve; partial efficacy; poor fit | -4.7 | 1.6266 | 0.8503 | -54.5226 | -5.6191 | -2.4 | 0 0 0 0 0 | -47.8269 | -0.7604 | -18.9614 | -4.7345 | -18.9411 | -47.8269 | |||
| Inactive | 1.06 | -61.19665 | 10 | Inhibitor | 1.4125 | 88.4127 | Complete curve; high efficacy | -5.85 | 1 | 0.9962 | -86.2454 | 2.1673 | -1.1 | 0 0 0 0 0 | -82.6714 | 3.9823 | -7.369 | -36.1058 | -78.9285 | -82.6714 | Inhibitor | 0.7079 | 14.0204 | Complete curve; partial efficacy; poor fit | -6.15 | 4.5045 | 0.6924 | -37.5163 | -23.4959 | -1.4 | 0 0 0 0 0 | -39.7219 | -30.1126 | -17.0799 | -35.8626 | -35.1344 | -39.7219 | |||
| Inactive | 25.119 | -55.01235 | 10 | Inhibitor | 25.1189 | 66.1523 | Single point of activity | -4.6 | 1.5936 | 0.9924 | -59.1523 | 7 | -3 | 0 0 0 0 0 | -45.0932 | 5.9868 | 10.3106 | 4.641 | -7.6301 | -45.0932 | Inhibitor | 25.1189 | 81.876 | Partial curve; partial efficacy | -4.6 | 1.4163 | 0.9815 | -84.2096 | -2.3337 | -2.2 | 0 0 0 0 0 | -64.9315 | -5.8528 | 3.4051 | -6.2854 | -22.1854 | -64.9315 | |||
| Inactive | 31.623 | -90.5373 | 10 | Inhibitor | 31.6228 | 133.602 | Single point of activity | -4.5 | 2.0437 | 0.9723 | -127.4045 | 6.1975 | -3 | 1 0 0 0 0 | -96.9593 | 70.8872 | 15.7218 | -4.747 | -7.6655 | -96.9593 | Inhibitor | 31.6228 | 116.0466 | Single point of activity | -4.5 | 2.0937 | 0.9678 | -110.0228 | 6.0238 | -3 | 1 0 0 0 0 | -84.1153 | 78.2061 | 15.4092 | -4.0402 | -6.4051 | -84.1153 | |||
| Inactive | 26.651 | -30.9556 | 10 | Inhibitor | 28.1838 | 42.9785 | Single point of activity | -4.55 | 1.6436 | 0.939 | -41.4785 | 1.5 | -3 | 0 0 0 0 0 | -31.2321 | 6.8681 | -0.8812 | -2.7641 | -6.0977 | -31.2321 | Inhibitor | 25.1189 | 40.3149 | Partial curve; partial efficacy | -4.6 | 1.2475 | 0.9782 | -40.8149 | -0.5 | -2.2 | 0 0 0 0 0 | -30.6791 | 1.88 | -0.7127 | -4.1595 | -10.5284 | -30.6791 | |||
| Inactive | 9.456 | -28.97985 | 10 | Inhibitor | 10 | 32.2918 | Partial curve; partial efficacy; poor fit | -5 | 4.9549 | 0.9895 | -27.7918 | 4.5 | -2.4 | 0 0 0 0 0 | -27.3265 | 2.1576 | 5.9688 | 5.7411 | -17.7386 | -27.3265 | Inhibitor | 8.9125 | 22.7179 | Complete curve; partial efficacy; poor fit | -5.05 | 4.5045 | 0.9654 | -30.7598 | -8.0419 | -1.4 | 0 0 0 0 0 | -30.6332 | -11.2679 | -7.3322 | -5.4516 | -25.3127 | -30.6332 | |||
| Inactive | 33.997 | -106.46675 | 10 | Inhibitor | 28.1838 | 123.4679 | Single point of activity | -4.55 | 2.7868 | 0.9978 | -121.8158 | 1.6522 | -3 | 0 0 0 0 0 | -106.856 | -2.3504 | 2.7994 | 3.288 | -7.476 | -106.856 | Inhibitor | 39.8107 | 129.942 | Single point of activity | -4.4 | 4.9549 | 0.9948 | -124.1106 | 5.8313 | -3 | 0 0 0 0 0 | -106.0775 | 0.6088 | 5.5016 | 5.4483 | 10.5489 | -106.0775 | |||
| Inactive | 31.623 | -99.14035 | 10 | Inhibitor | 31.6228 | 111.2998 | Single point of activity | -4.5 | 2.3031 | 0.9986 | -109.357 | 1.9428 | -3 | 0 0 0 0 0 | -86.7913 | 2.2166 | 3.7805 | -0.134 | -8.8661 | -86.7913 | Inhibitor | 31.6228 | 129.2894 | Single point of activity | -4.5 | 3.5722 | 0.9948 | -125.0911 | 4.1983 | -3 | 0 0 0 0 0 | -111.4894 | 8.4632 | -1.5296 | 6.3846 | 1.1397 | -111.4894 | |||
| Inactive | 25.515 | -79.00125 | 10 | Inhibitor | 11.2202 | 140.7263 | Partial curve; high efficacy | -4.95 | 0.7 | 0.9983 | -142.9098 | -2.1835 | -2.1 | 0 0 0 0 0 | -108.7593 | -5.0538 | -4.4278 | -26.943 | -72.8633 | -108.7593 | Inhibitor | 39.8107 | 52.2962 | Single point of activity | -4.4 | 4.4495 | 0.8184 | -57.5919 | -5.2957 | -3 | 0 0 0 0 0 | -49.2432 | -16.8558 | -14.1666 | -8.9013 | -0.3376 | -49.2432 | |||
| Inactive | 35.717 | -71.4622 | 10 | Inhibitor | 31.6228 | 148.9114 | Partial curve; high efficacy | -4.5 | 2.5334 | 0.9964 | -137.6077 | 11.3037 | -2.1 | 0 0 0 0 0 | -110.7953 | 14.8014 | 12.0471 | 5.8851 | 0.827 | -110.7953 | Inhibitor | 39.8107 | 54.324 | Single point of activity | -4.4 | 4.9549 | 0.9648 | -39.6087 | 14.7153 | -3 | 0 0 0 0 0 | -32.1291 | 18.9475 | 14.3951 | 8.584 | 17.5801 | -32.1291 | |||
| Inactive | 33.552 | -136.92395 | 10 | Inhibitor | 31.6228 | 169.4614 | Single point of activity | -4.5 | 2.9523 | 0.9984 | -166.5059 | 2.9555 | -3 | 0 0 0 0 0 | -141.5867 | 2.6826 | 6.1861 | -0.9364 | -5.5897 | -141.5867 | Inhibitor | 35.4813 | 177.0866 | Single point of activity | -4.45 | 2.5884 | 0.996 | -171.4105 | 5.6761 | -3 | 0 0 0 0 0 | -132.2612 | 9.6404 | 7.6498 | -0.597 | -3.3611 | -132.2612 | |||
| Inactive | 21.679 | -10.228 | 10 | Inhibitor | 39.8107 | 37.0982 | Partial curve; partial efficacy; poor fit | -4.4 | 4.9549 | 0.9802 | -29.0982 | 8 | -2.4 | 0 0 0 0 0 | -23.8319 | 6.3566 | 7.4672 | 6.3848 | 11.1761 | -23.8319 | Activator | 3.5481 | 61.4894 | Single point of activity | -5.45 | 3.2475 | 0.9999 | 67.9894 | 6.5 | 3 | 0 0 0 0 1 | 3.3759 | 6.0913 | 6.8001 | 7.9088 | 66.6549 | 3.3759 | |||
| Inactive | 35.717 | -65.55935 | 10 | Inhibitor | 31.6228 | 91.3675 | Single point of activity | -4.5 | 2.3031 | 0.9998 | -88.058 | 3.3095 | -3 | 1 0 0 0 0 | -69.7409 | -36.6586 | 4.0684 | 2.7745 | -4.8658 | -69.7409 | Inhibitor | 39.8107 | 73.2968 | Single point of activity | -4.4 | 4.9549 | 0.987 | -71.6534 | 1.6434 | -3 | 1 0 0 0 0 | -61.3778 | -28.2855 | 1.699 | -2.9383 | 5.754 | -61.3778 | |||
| Inactive | 37.646 | -178.08295 | 10 | Inhibitor | 35.4813 | 204.2262 | Single point of activity | -4.45 | 3.9295 | 0.9986 | -199.6873 | 4.539 | -3 | 0 0 0 0 0 | -173.3396 | 0.2289 | 8.2189 | 6.3616 | 2.2048 | -173.3396 | Inhibitor | 39.8107 | 216.7006 | Single point of activity | -4.4 | 4.9549 | 0.9949 | -212.8098 | 3.8908 | -3 | 0 0 0 0 0 | -182.8263 | -4.1754 | 1.8489 | 6.2245 | 11.7119 | -182.8263 | |||
| Inactive | 31.833 | -132.7995 | 10 | Inhibitor | 28.1838 | 177.1402 | Partial curve; high efficacy | -4.55 | 2.2481 | 0.9994 | -163.0596 | 14.0806 | -2.1 | 0 0 0 0 0 | -133.2186 | 13.7914 | 11.363 | 14.9985 | -5.8977 | -133.2186 | Inhibitor | 35.4813 | 160.7082 | Single point of activity | -4.45 | 3.5722 | 0.9968 | -156.4736 | 4.2346 | -3 | 1 0 0 0 0 | -132.3804 | 27.1686 | -0.5532 | 8.7715 | 0.9846 | -132.3804 | |||
| Inactive | 24.068 | -97.2818 | 10 | Inhibitor | 19.9526 | 106.3249 | Partial curve; high efficacy | -4.7 | 2.0479 | 0.9995 | -106.9593 | -0.6344 | -2.1 | 0 0 0 0 0 | -95.8417 | -1.735 | -0.4127 | 0.5025 | -27.1155 | -95.8417 | Inhibitor | 28.1838 | 131.3148 | Partial curve; high efficacy | -4.55 | 2.2481 | 0.9998 | -120.8356 | 10.4791 | -2.1 | 0 0 0 0 0 | -98.7219 | 11.5848 | 10.6387 | 9.6738 | -5.1973 | -98.7219 | |||
| Inactive | 33.552 | -57.68655 | 10 | Inhibitor | 31.6228 | 94.3569 | Single point of activity | -4.5 | 2.5884 | 0.9899 | -74.9376 | 19.4193 | -3 | 0 0 0 0 0 | -58.4651 | 24.3301 | 14.6281 | 18.6815 | 13.2425 | -58.4651 | Inhibitor | 35.4813 | 88.8694 | Single point of activity | -4.45 | 3.6272 | 0.9981 | -70.1845 | 18.6848 | -3 | 0 0 0 0 0 | -56.908 | 20.991 | 18.347 | 16.9335 | 17.1087 | -56.908 | |||
| Inactive | 39.811 | -43.0853 | 10 | Inhibitor | 39.8107 | 58.3239 | Single point of activity | -4.4 | 4.4495 | 0.995 | -58.8699 | -0.546 | -3 | 0 0 0 0 0 | -49.4749 | -2.9343 | 0.9852 | 0.505 | -0.104 | -49.4749 | Inhibitor | 39.8107 | 42.6743 | Single point of activity | -4.4 | 4.9549 | 0.9169 | -42.5348 | 0.1395 | -3 | 0 0 0 0 0 | -36.6957 | -7.0353 | 6.9097 | -0.3328 | 0.9745 | -36.6957 | |||
| Inactive | 14.987 | -35.5635 | 10 | Inhibitor | 14.1254 | 57.7501 | Single point of activity | -4.85 | 2.4064 | 0.927 | -41.11 | 16.6401 | -3 | 0 0 0 0 0 | -39.9417 | 23.2588 | 5.4135 | 20.722 | -3.8378 | -39.9417 | Inhibitor | 15.8489 | 44.7755 | Single point of activity | -4.8 | 2.3332 | 0.9662 | -32.5693 | 12.2063 | -3 | 0 0 0 0 0 | -31.1853 | 17.346 | 7.4315 | 12.9691 | -2.6927 | -31.1853 | |||
| Inactive | 23.753 | -117.8715 | 10 | Inhibitor | 25.1189 | 171.2193 | Partial curve; high efficacy | -4.6 | 1.5936 | 0.9978 | -156.5335 | 14.6858 | -2.1 | 0 0 0 0 0 | -120.782 | 19.0828 | 11.6091 | 12.4763 | -22.8454 | -120.782 | Inhibitor | 22.3872 | 147.7288 | Partial curve; high efficacy | -4.65 | 2.2481 | 0.9824 | -130.2723 | 17.4565 | -2.1 | 0 0 0 0 0 | -114.961 | 24.6911 | 5.0626 | 22.7253 | -8.6651 | -114.961 |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.018 uM | Activity at 0.037 uM | Activity at 0.074 uM | Activity at 0.164 uM | Activity at 0.369 uM | Activity at 0.461 uM | Activity at 0.737 uM | Activity at 0.922 uM | Activity at 1.840 uM | Activity at 2.300 uM | Activity at 3.690 uM | Activity at 4.610 uM | Activity at 9.231 uM | Activity at 20.57 uM | Activity at 46.10 uM | Activity at 92.20 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0 0 0 0 0 | 27.0569 | 9.9398 | 10.1515 | 0.1671 | 5.5721 | 27.0569 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -4.9362 | -9.414 | 12.0824 | -11.0493 | -7.696 | -4.9362 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 5.9595 | 4.342 | -1.5624 | -2.6449 | -8.9538 | 5.9595 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -19.7473 | -1.448 | 7.5701 | -38.1554 | -17.3097 | -19.7473 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -1.2351 | -5.5487 | -5.0573 | -16.6211 | 2.7653 | -1.2351 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 7.1959 | -7.7682 | 4.4899 | 3.3992 | 13.3707 | 7.1959 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 8.9833 | 15.335 | 4.2535 | 4.1946 | -14.3236 | 8.9833 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 7.9022 | -10.5174 | 13.4936 | -10.4686 | 7.2323 | 7.9022 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -11.8347 | 12.2839 | -2.7256 | -19.2666 | -5.8034 | -11.8347 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inhibitor | 35.4813 | 106.2444 | Single point of activity | -4.45 | 4.4495 | 0.9934 | -109.7251 | -3.4808 | -3 | 0 0 0 0 0 | -84.6645 | -7.4849 | -2.0755 | -4.8114 | 0.1432 | -84.6645 | QC'd by "Asinex Ltd." | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -3.6 | -2.0717 | 4.9414 | 15.4055 | -0.2463 | -3.6 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 0.7641 | 0 | 28.3456 | 12.1698 | 0.9078 | 0.7641 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -3.7338 | -9.9559 | 0.3986 | 8.9255 | 12.5033 | -3.7338 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -1.7797 | 3.883 | 1.182 | -4.185 | 1.7497 | -1.7797 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inhibitor | 15.8489 | 38.9608 | Single point of activity | -4.8 | 3.6772 | 0.9889 | -35.4608 | 3.5 | -3 | 0 0 0 0 0 | -32.884 | 2.0677 | 5.819 | 2.7318 | -1.3119 | -32.884 | QC'd by "Asinex Ltd." | ||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -3.797 | 8.4821 | -2.1836 | 12.76 | 5.4907 | -3.797 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -18.7499 | 1.0272 | 3.815 | 20.5199 | 1.7606 | -18.7499 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 0.464 | 0 | 9.4101 | -6.5206 | 0.9067 | 0.464 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 0.2371 | 9.7122 | -4.6112 | -6.6419 | -3.2889 | 0.2371 | QC'd by "Asinex Ltd." | ||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 3.6799 | 4.8924 | 1.7621 | -1.6686 | -4.4945 | 3.6799 | QC'd by "Asinex Ltd." |