| Standard Type | Activity Comment |
|---|---|
| Activity | Not Active |
| Activity | Not Active |
| Activity | Not Active |
| Activity | Not Active |
| Activity | Not Active |
| Activity | Not Active |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units |
|---|---|---|---|---|
| 42 | IC50 | = | 42000 | nM |
| 19 | IC50 | = | 19000 | nM |
| 18 | IC50 | = | 18000 | nM |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000295000 uM | Activity at 0.0000590000 uM | Activity at 0.0001503265 uM | Activity at 0.0002712146 uM | Activity at 0.0005895491 uM | Activity at 0.00117 uM | Activity at 0.00179 uM | Activity at 0.00299 uM | Activity at 0.00672 uM | Activity at 0.014 uM | Activity at 0.026 uM | Activity at 0.040 uM | Activity at 0.074 uM | Activity at 0.167 uM | Activity at 0.363 uM | Activity at 0.628 uM | Activity at 0.975 uM | Activity at 1.849 uM | Activity at 4.119 uM | Activity at 9.037 uM | Activity at 15.83 uM | Activity at 21.08 uM | Activity at 46.23 uM | Activity at 92.54 uM | Activity at 165.6 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4 | -3.0662 | -2.4126 | 1.9741 | -4.0617 | -0.6298 | -3.0662 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7346 | -0.808 | -4.308 | 4 | 0 0 0 0 0 | -0.431 | -4.308 | 0.8987 | -1.5892 | -1.522 | -0.431 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6448 | -12.5127 | 4.5585 | 4 | 0 0 0 0 0 | -9.7509 | 6.5585 | 1.6006 | -0.8104 | 11.697 | -9.7509 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 18.3564 | 99.0378 | 41 | Partial curve; high efficacy | -4.7362 | 2.8473 | 0.9985 | -99.5803 | -0.5425 | -2.1 | 0 0 0 0 0 | -92.8278 | -1.5772 | -1.9365 | 1.8258 | -13.1847 | -92.8278 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 29.0929 | 42.1815 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9879 | -50.8391 | -8.6577 | -3 | 0 0 0 0 0 | -46.8496 | -7.6387 | -8.6142 | -11.6103 | -6.66 | -46.8496 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 18.3564 | 123.8718 | 41 | Partial curve; high efficacy | -4.7362 | 1.6259 | 0.9975 | -121.4578 | 2.414 | -2.1 | 0 0 0 0 0 | -98.8224 | 5.0098 | -1.1767 | -0.5372 | -27.2941 | -98.8224 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 14.581 | 109.9073 | 42 | Partial curve; high efficacy | -4.8362 | 1.8265 | 0.9637 | -106.4086 | 3.4987 | -2.1 | 0 0 0 0 0 | -94.6709 | 12.0352 | -9.7094 | 6.0901 | -28.9742 | -94.6709 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | 0.3 | 0.9096 | -34.0578 | -3.7697 | 4 | 0 0 0 0 0 | -28.0098 | -7.7697 | -15.2699 | -21.1534 | -19.3019 | -28.0098 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 29.0929 | 90.8978 | 10 | Single point of activity | -4.5362 | 4.4495 | 0.9936 | -90.3368 | 0.561 | -3 | 0 0 0 0 0 | -79.9635 | 5.0637 | -2.1732 | -1.6903 | 0.5114 | -79.9635 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | 0.3 | 0.4266 | 15.2787 | -6.7213 | 4 | 0 0 0 0 0 | 10.4803 | -5.7213 | 8.5589 | -5.3046 | 6.719 | 10.4803 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 1.9673 | 0.6089 | -9.5082 | 5.2968 | 4 | 0 0 0 0 0 | -7.9574 | 7.2968 | -1.8903 | 10.3946 | 1.3036 | -7.9574 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 16.3601 | 45.5047 | 10 | Single point of activity | -4.7862 | 4.9549 | 0.9618 | -49.1256 | -3.6209 | -3 | 0 0 0 0 0 | -48.9315 | -7.5358 | -6.333 | 2.7698 | -6.0371 | -48.9315 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | -5.2862 | 0.8 | 0.9747 | -26.7427 | 8.4372 | 4 | 0 0 0 0 0 | -20.7127 | 9.4372 | 2.2965 | 0.248 | -14.6534 | -20.7127 | QC'd by "Chem Div" | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9526 | -10.3928 | 12.1594 | 4 | 0 0 0 0 0 | -10.3008 | 7.6594 | 13.8067 | 14.3816 | -9.7278 | -10.3008 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 2.2526 | 0.9456 | -15.0824 | -3.8247 | 4 | 0 0 0 0 0 | -14.7061 | -2.8247 | -5.6912 | -3.1226 | -9.4063 | -14.7061 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inhibitor | 12.9953 | 78.8447 | 42 | Partial curve; high efficacy | -4.8862 | 1.5579 | 0.9935 | -82.5518 | -3.7072 | -2.1 | 0 0 0 0 0 | -72.8175 | -6.4603 | -0.3489 | -8.7793 | -32.8366 | -72.8175 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inhibitor | 18.3564 | 49.7424 | 10 | Single point of activity | -4.7362 | 2.8473 | 0.9797 | -46.1416 | 3.6008 | -3 | 0 0 0 0 0 | -42.7679 | -0.8992 | 4.983 | 6.9739 | -2.5062 | -42.7679 | QC'd by "Chem Div" | |||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8308 | -9.799 | 10.4725 | 4 | 0 0 0 0 0 | -5.0871 | 8.4725 | 8.2561 | 10.0709 | 16.081 | -5.0871 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 1.8851 | 0.9722 | -5.7685 | 6.2205 | 4 | 0 0 0 0 0 | -5.063 | 6.2205 | -1.5445 | -7.1037 | -5.5678 | -5.063 | QC'd by "Chem Div" | |||||||||||||||||||||||||
| Inactive | 0 | 0.3 | 0.842 | -31.9249 | 3.174 | 4 | 0 0 0 0 0 | -26.7418 | -0.826 | -13.6909 | -13.1344 | -14.0869 | -26.7418 | QC'd by "Chem Div" |
| Standard Type | Standard Relation | Standard Value |
|---|---|---|
| Ratio IC50 | = | 12 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000295000 uM | Activity at 0.0000590000 uM | Activity at 0.0001503265 uM | Activity at 0.0002712146 uM | Activity at 0.0005895491 uM | Activity at 0.00117 uM | Activity at 0.00179 uM | Activity at 0.00299 uM | Activity at 0.00672 uM | Activity at 0.014 uM | Activity at 0.026 uM | Activity at 0.040 uM | Activity at 0.074 uM | Activity at 0.167 uM | Activity at 0.363 uM | Activity at 0.628 uM | Activity at 0.975 uM | Activity at 1.849 uM | Activity at 4.119 uM | Activity at 9.037 uM | Activity at 15.83 uM | Activity at 21.08 uM | Activity at 46.23 uM | Activity at 92.54 uM | Activity at 165.6 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 20.5962 | 118.891 | 41 | Partial curve; high efficacy | -4.6862 | 2.3031 | 0.9994 | -116.1669 | 2.7241 | -2.1 | 0 0 0 0 0 | -99.9451 | 2.7241 | 4.2572 | 0.7717 | -13.7373 | -99.9451 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 0.8 | 0.9749 | -16.1771 | 2.0057 | 4 | 0 0 0 0 0 | -13.1466 | 2.0057 | 1.2486 | -2.8352 | -5.7162 | -13.1466 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6148 | -11.801 | 2.2059 | 4 | 0 0 0 0 0 | -9.7999 | -4.7941 | 3.6452 | 6.7363 | 3.1419 | -9.7999 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | -5.0362 | 2.3332 | 0.9795 | -28.8852 | -5.2723 | 4 | 0 0 0 0 0 | -28.1997 | -7.2723 | -3.3531 | -4.7215 | -17.5124 | -28.1997 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inhibitor | 5.1735 | 94.6885 | 84 | Complete curve; high efficacy | -5.2862 | 2.9023 | 0.9917 | -96.1842 | -1.4957 | -1.1 | 0 0 0 0 0 | -96.0073 | -7.5308 | 4.5779 | -6.8491 | -81.1577 | -96.0073 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inhibitor | 18.3564 | 94.012 | 10 | Single point of activity | -4.7362 | 3.6272 | 0.9999 | -96.5346 | -2.5226 | -3 | 0 0 0 0 0 | -93.107 | -2.9055 | -1.9361 | -2.363 | -9.7613 | -93.107 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8434 | -31.3086 | -2.255 | 4 | 0 0 0 0 0 | -27.0497 | -0.755 | -10.521 | 0.9228 | 0.8125 | -27.0497 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.4495 | 0.7303 | -25.728 | -7.2492 | 4 | 0 0 0 0 0 | -25.3982 | -8.7492 | -13.5128 | 0.9177 | -19.0413 | -25.3982 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inhibitor | 20.5962 | 100.5411 | 41 | Partial curve; high efficacy | -4.6862 | 2.0937 | 0.998 | -104.3872 | -3.8461 | -2.1 | 0 0 0 0 0 | -88.9539 | -4.1551 | -2.0443 | -7.1093 | -18.8654 | -88.9539 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inhibitor | 29.0929 | 91.4133 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9947 | -88.3597 | 3.0536 | -3 | 0 0 0 0 0 | -79.845 | -1.1685 | 2.6559 | 4.5385 | 5.7131 | -79.845 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.786 | -1.8499 | 12.9954 | 4 | 0 0 0 0 1 | 16.1947 | 7.9954 | 18.2295 | 0.5262 | -1.8757 | 16.1947 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9259 | -4.5454 | 4.3839 | 4 | 0 0 0 0 0 | -3.7239 | 5.3839 | 4.747 | 2.666 | 4.8335 | -3.7239 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | -6.2362 | 4.9549 | 0.9762 | -1.4086 | 19.4543 | 4 | 0 0 0 0 0 | 1.2086 | 19.4543 | 17.7088 | -3.3481 | -2.3756 | 1.2086 | QC'd by "Asinex Ltd." | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.4363 | -4.5616 | -11.5616 | 4 | 0 0 0 0 0 | -4.5336 | -11.5616 | -1.6565 | -10.5162 | -2.2482 | -4.5336 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 0.7 | 0.9889 | 6.5184 | -6.9816 | 4 | 0 0 0 0 0 | 2.8921 | -7.4816 | -5.7762 | -3.9537 | -1.5242 | 2.8921 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.5926 | -22.1394 | -0.1559 | 4 | 0 0 0 0 0 | -20.8088 | -4.1559 | -8.304 | 12.2914 | -0.0696 | -20.8088 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inhibitor | 29.0929 | 64.2186 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9684 | -70.1227 | -5.9041 | -3 | 0 0 0 0 0 | -64.396 | -9.2052 | -0.418 | -11.9994 | -2.9068 | -64.396 | QC'd by "Asinex Ltd." | |||||||||||||||||||||
| Inactive | 0 | 1.21 | 0.9644 | -26.9263 | 4.8437 | 4 | 0 0 0 0 0 | -17.9647 | 6.8437 | 4.9663 | 0.5719 | -1.9517 | -17.9647 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9261 | -29.987 | 1.9364 | 4 | 0 0 0 0 0 | -26.9998 | 0.4364 | -0.7582 | -0.4532 | 7.9656 | -26.9998 | QC'd by "Asinex Ltd." | |||||||||||||||||||||||||
| Inactive | 0 | 4.095 | 0.4576 | 1.7803 | 12.607 | 4 | 0 0 0 0 0 | 6.6132 | 11.107 | -4.9986 | 0.186 | 5.2579 | 6.6132 | QC'd by "Asinex Ltd." |
| Standard Type | Standard Relation | Standard Value | Standard Units |
|---|---|---|---|
| Activity | = | 31.32 | % |
| Activity | = | 51.76 | % |
| Absorbance_42C_A | Absorbance_42C_B | Rel_Abs_42C_A | Rel_Abs_42C_B | Avg_Rel_Abs_42C | Absorbance_30C_A | Absorbance_30C_B | Rel_Abs_30C_A | Rel_Abs_30C_B | Avg_Rel_Abs_30C | (Abs_30C)-(Abs_42C) | Activity Score_30C | Activity Outcome_TempDep | Activity Outcome_TempInd | Activity Type |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0.358 | 0.408 | 98.28 | 110.75 | 104.52 | 0.644 | 0.645 | 107.98 | 104.06 | 106.02 | 1.5 | 0 | I | I | |
| 0.35 | 0.386 | 95.78 | 104.11 | 99.95 | 0.647 | 0.643 | 108.52 | 103.71 | 106.12 | 6.17 | 0 | I | I | |
| 0.37 | 0.401 | 102.03 | 108.64 | 105.33 | 0.616 | 0.645 | 102.96 | 104.06 | 103.51 | -1.83 | 0 | I | I | |
| 0.366 | 0.403 | 100.78 | 109.24 | 105.01 | 0.614 | 0.578 | 102.6 | 92.49 | 97.55 | -7.47 | 2 | I | I | |
| 0.367 | 0.387 | 101.09 | 104.41 | 102.75 | 0.579 | 0.623 | 96.32 | 100.26 | 98.29 | -4.46 | 2 | I | I | |
| 0.35 | 0.383 | 95.78 | 103.21 | 99.5 | 0.69 | 0.616 | 116.24 | 99.05 | 107.64 | 8.15 | 0 | I | I | |
| 0.361 | 0.368 | 99.22 | 98.68 | 98.95 | 0.602 | 0.583 | 100.45 | 93.35 | 96.9 | -2.05 | 3 | I | I | |
| 0.339 | 0.395 | 92.35 | 106.83 | 99.59 | 0.578 | 0.648 | 96.14 | 104.58 | 100.36 | 0.77 | 0 | I | I | |
| 0.363 | 0.352 | 99.84 | 93.85 | 96.85 | 0.584 | 0.601 | 97.22 | 96.46 | 96.84 | -0.01 | 3 | I | I | |
| 0.36 | 0.358 | 98.91 | 95.66 | 97.28 | 0.667 | 0.616 | 112.11 | 99.05 | 105.58 | 8.3 | 0 | I | I | |
| 0.234 | 0.376 | 59.56 | 101.09 | 80.33 | 0.59 | 0.65 | 98.3 | 104.92 | 101.61 | 21.28 | 0 | I | I | |
| 0.364 | 0.214 | 100.16 | 52.2 | 76.18 | 0.609 | 0.564 | 101.7 | 90.07 | 95.89 | 19.71 | 4 | I | I | |
| 0.377 | 0.396 | 104.22 | 107.13 | 105.67 | 0.679 | 0.618 | 114.26 | 99.4 | 106.83 | 1.16 | 0 | I | I | |
| 0.347 | 0.357 | 94.85 | 95.36 | 95.1 | 0.62 | 0.648 | 103.68 | 104.58 | 104.13 | 9.02 | 0 | I | I | |
| 0.359 | 0.381 | 98.59 | 102.6 | 100.6 | 0.589 | 0.61 | 98.12 | 98.01 | 98.07 | -2.53 | 2 | I | I | |
| 0.357 | 0.392 | 97.97 | 105.92 | 101.95 | 0.489 | 0.497 | 80.17 | 78.5 | 79.34 | -22.61 | 21 | I | I | |
| 0.369 | 0.361 | 101.72 | 96.57 | 99.14 | 0.591 | 0.666 | 98.47 | 107.68 | 103.08 | 3.94 | 0 | I | I | |
| 0.496 | 0.531 | 141.37 | 147.88 | 144.63 | 0.615 | 0.661 | 102.78 | 106.82 | 104.8 | -39.83 | 0 | I | I | |
| 0.39 | 0.466 | 108.27 | 128.26 | 118.27 | 0.413 | 0.585 | 66.54 | 93.7 | 80.12 | -38.15 | 20 | I | I | |
| 0.367 | 0.425 | 101.09 | 115.88 | 108.49 | 0.534 | 0.543 | 88.25 | 86.45 | 87.35 | -21.14 | 13 | I | I |
| Species | Strain | IsPseudotypeVirus | AssayMeth | CellType | CellType2 | Target | Mutations | EC50Mod | EC50 | EC50Unit | ECOtherPct | ECOtherPctUnit | ECOtherConc | ECOtherConcUnit | ToxAssayMeth | ToxCellType | CC50Mod | CC50 | CC50Unit | TIMod | TI | RelResFoldChg | Comments | Reference | Citation | Other Information |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| HIV-1 | LAI | RT | HuT TK+ | HuT 78 | Reverse transcriptase | < | 1 | uM | 100 | % | 1 | uM | MTT | > | 10 | uM | > | 10 | HuT TK+=HuT 78 CELLS EXPRESSING HSV-1 THYMIDINE KINASE; MEASUREMENT WAS MADE ON DAY10 POSTINFECTION AT 10 TCID50 | 9281520 | USE OF HERPES SIMPLEX VIRUS THYMIDINE KINASE TO IMPROVE THE ANTIVIRAL ACTIVITY OF ZIDOVUDINE. Virology 1997, 235, 398-405. | |||||
| HIV-1 | MN | RT | HuT TK+ | HuT 78 | Reverse transcriptase | < | 0.3 | uM | 76.74 | % | 0.3 | uM | MTT | > | 10 | uM | > | 33.3 | HuT TK+=HuT 78 CELLS EXPRESSING HSV-1 THYMIDINE KINASE; MEASUREMENT WAS MADE ON DAY14 POSTINFECTION AT 10 TCID50 | 9281520 | USE OF HERPES SIMPLEX VIRUS THYMIDINE KINASE TO IMPROVE THE ANTIVIRAL ACTIVITY OF ZIDOVUDINE. Virology 1997, 235, 398-405. | |||||
| HIV-1 | MN | RT | HuT TK+ | HuT 78 | Reverse transcriptase | < | 0.3 | uM | 69 | % | 0.3 | uM | MTT | > | 10 | uM | > | 33.3 | HuT TK+=HuT 78 CELLS EXPRESSING HSV-1 THYMIDINE KINASE; MEASUREMENT WAS MADE ON DAY14 POSTINFECTION AT 100 TCID50 | 9281520 | USE OF HERPES SIMPLEX VIRUS THYMIDINE KINASE TO IMPROVE THE ANTIVIRAL ACTIVITY OF ZIDOVUDINE. Virology 1997, 235, 398-405. | |||||
| R5; CLINICAL ISOLATE | 1(JSL) | P24 | PBMC | Reverse transcriptase | MDR | 0.07 | uM | 90 | % | 1 | uM | MTT | > | 100 | uM | > | 1428 | HIV-1(JSL) WAS ISOLATED FROM PATIENTS WHO RECEIVED ANTIRETROVIRAL THERAPY FOR A LONG PERIOD AND WHOSE VIRUS ACQUIRED A NUMBER OF MUTATIONS IN THE RT- AND PR-ENCODING GENES; DETAILS OF MUTATIONS NOT GIVEN | 15280474 | SPIRODIKETOPIPERAZINE-BASED CCR5 INHIBITOR WHICH PRESERVES CC-CHEMOKINE/CCR5 INTERACTIONS AND EXERTS POTENT ACTIVITY AGAINST R5 HUMAN IMMUNODEFICIENCY VIRUS TYPE 1 IN VITRO. Journal of Virology 2004, 78(16), 8654-8662. | ECOtherConcMod:> | |||||
| HIV-1 | NL4-3 | LUCIFERASE | 1G5 T | Reverse transcriptase | < | 1 | uM | 99 | % | 1 | uM | TRYPAN BLUE | > | 1 | uM | > | 1 | ASSAY WAS CONDUCTED ON DAY 3 POST-INFECTION | 16725040 | INHIBITION OF HIGHLY PRODUCTIVE HIV-1 INFECTION IN T CELLS, PRIMARY HUMAN MACROPHAGES, MICROGLIA, AND ASTROCYTES BY SARGASSUM FUSIFORME. AIDS Research and Therapy 2006, 3(1), 15 PP. | CCOtherPct:6 | CCOtherPctUnit:% | CCOtherConc:1 | CCOtherConcUnit:uM | |||||
| HIV-1 | NL4-3 | LUCIFERASE | 1G5 T | Reverse transcriptase | < | 1 | uM | 99 | % | 1 | uM | TRYPAN BLUE | > | 1 | uM | > | 1 | ASSAY WAS CONDUCTED ON DAY 5 POST-INFECTION | 16725040 | INHIBITION OF HIGHLY PRODUCTIVE HIV-1 INFECTION IN T CELLS, PRIMARY HUMAN MACROPHAGES, MICROGLIA, AND ASTROCYTES BY SARGASSUM FUSIFORME. AIDS Research and Therapy 2006, 3(1), 15 PP. | CCOtherPct:7 | CCOtherPctUnit:% | CCOtherConc:1 | CCOtherConcUnit:uM | |||||
| HIV-1 | NL4-3 | LUCIFERASE | 1G5 T | Reverse transcriptase | < | 1 | uM | 99 | % | 1 | uM | TRYPAN BLUE | > | 1 | uM | > | 1 | ASSAY WAS CONDUCTED ON DAY 7 POST-INFECTION | 16725040 | INHIBITION OF HIGHLY PRODUCTIVE HIV-1 INFECTION IN T CELLS, PRIMARY HUMAN MACROPHAGES, MICROGLIA, AND ASTROCYTES BY SARGASSUM FUSIFORME. AIDS Research and Therapy 2006, 3(1), 15 PP. | CCOtherPct:3 | CCOtherPctUnit:% | CCOtherConc:1 | CCOtherConcUnit:uM | |||||
| HIV-1 | LAV | RT | U1(THF-.alpha. STIM) | U1 | Tumor necrosis factor alpha | ~ | 30 | ug/mL | 70 | % | 50 | ug/mL | > | 50 | ug/mL | > | 1.66 | CHRONICALLY HIV-1 INFECTED PROMONOCYTE CELL LINE | 8327469 | THALIDOMIDE INHIBITS THE REPLICATION OF HUMAN IMMUNODEFICIENCY VIRUS TYPE 1. Proceedings of the National Academy of Sciences of the United States of America 1993, 90, 5974-5978. | CCOtherPct:0 | CCOtherPctUnit:% | CCOtherConc:50 | CCOtherConcUnit:ug/mL | |||||
| HIV-1 | BaL | P24 (DAY 18) | MACROPHAGES(GM-CSF) | Macrophage | Ribonucleotide reductase | < | 10 | uM | 75 | % | 10 | uM | > | 1000 | uM | > | 10 | MAXIMAL P24 EXPRESSION AT DAY 18 | 7973634 | HYDROXYUREA AS AN INHIBITOR OF HUMAN IMMUNODEFICIENCY VIRUS-TYPE 1 REPLICATION. Science 1994, 266(5186), 801-805. | CCOtherPct:0 | CCOtherPctUnit:% | CCOtherConc:1000 | CCOtherConcUnit:uM | |||||
| HIV-1 | BaL | P24 (DAY 18) | MACROPHAGES(GM-CSF) | Macrophage | Ribonucleotide reductase | < | 10 | uM | 38 | % | 2 | uM | > | 1000 | uM | > | 10 | MAXIMAL P24 EXPRESSION AT DAY 18 | 7973634 | HYDROXYUREA AS AN INHIBITOR OF HUMAN IMMUNODEFICIENCY VIRUS-TYPE 1 REPLICATION. Science 1994, 266(5186), 801-805. | CCOtherPct:0 | CCOtherPctUnit:% | CCOtherConc:1000 | CCOtherConcUnit:uM | |||||
| HIV-1 | BaL | P24 (DAY 18) | MACROPHAGES(GM-CSF) | Macrophage | Ribonucleotide reductase | < | 10 | uM | 99 | % | 50 | uM | > | 1000 | uM | > | 10 | MAXIMAL P24 EXPRESSION AT DAY 18 | 7973634 | HYDROXYUREA AS AN INHIBITOR OF HUMAN IMMUNODEFICIENCY VIRUS-TYPE 1 REPLICATION. Science 1994, 266(5186), 801-805. | ECOtherPctMod:> | CCOtherPct:0 | CCOtherPctUnit:% | CCOtherConc:1000 | CCOtherConcUnit:uM | |||||
| HIV-1 | IIIB | RT | HT4(R116; AZT RESISTANT CELLS) | HT4 | Reverse transcriptase | ~ | 0.01 | uM | 70 | % | 0.01 | uM | ~` | 1 | uM | ~ | 100 | FLOXURIDINE APPEARS TO POTENTIATE AZT ACTIVITY AND ALSO HAVE SOME ANTI-HIV ACTIVITY IN AZT RESISTANT CELL LINES | 8827211 | USE OF FLOXURIDINE TO MODULATE THE ANTIVIRAL ACTIVITY OF ZIDOVUDINE. AIDS Research and Human Retroviruses 1996, 12(11), 965-968. | ECOtherPctMod:~ | CCOtherPct:35 | CCOtherPctUnit:% | CCOtherConc:.1 | CCOtherConcUnit:uM | |||||
| HIV-1 | 1 | .beta.GAL AS A MEASURE OF TAT-MEDIATED TRANSACTIVATION | HeLa H12(HIV-1 LTR-Laz, TAT) | HeLa | Tat:TAR/LTR | < | 0.1 | uM | 52 | % | 0.1 | uM | TRYPAN BLUE | > | 100 | uM | > | 1000 | DRUG AND RECOMBINANT TAT WERE INTRODUCED INTO CELLS THROUGH ELECTROPORATION | 9561563 | CURCUMIN AND CURCUMIN DERIVATIVES INHIBIT TAT-MEDIATED TRANSACTIVATION OF TYPE 1 HUMAN IMMUNODEFICIENCY VIRUS LONG TERMINAL REPEAT. Research in Virology 1998, 149(1), 43-52. | |||||
| HIV-1 | 1 | .beta.GAL AS A MEASURE OF TAT-MEDIATED TRANSACTIVATION | HeLa H12(HIV-1 LTR-Laz, TAT) | HeLa | Tat:TAR/LTR | < | 0.01 | uM | 78 | % | 0.01 | uM | TRYPAN BLUE | > | 100 | uM | > | 10000 | DRUG AND RECOMBINANT TAT WERE INTRODUCED INTO CELLS THROUGH ELECTROPORATION | 9561563 | CURCUMIN AND CURCUMIN DERIVATIVES INHIBIT TAT-MEDIATED TRANSACTIVATION OF TYPE 1 HUMAN IMMUNODEFICIENCY VIRUS LONG TERMINAL REPEAT. Research in Virology 1998, 149(1), 43-52. | |||||
| HIV-1 | IIIB | SYNCYT FORM | MOLT-4/H9(HIV-1(IIIB)) | MOLT-4 | gp120 | < | 1 | uM | 95 | % | 10 | uM | -100 | 10 | uM | > | 10 | CHRONICALLY INFECTED H9 CELLS | 9343823 | TRIAZINE DYES INHIBIT HIV-1 ENTRY BY BINDING TO ENVELOPE GLYCOPROTEINS. Microbiology and Immunology 1997, 41(9), 717-724. | CCOtherPct:30 | CCOtherPctUnit:% | CCOtherConc:10 | CCOtherConcUnit:uM | |||||
| HIV-1 | 1 | .beta.GAL AS A MEASURE OF TAT-MEDIATED TRANSACTIVATION | HeLa H12(HIV-1 LTR-Laz, TAT) | HeLa | Tat:TAR/LTR | < | 0.01 | uM | 75 | % | 0.01 | uM | TRYPAN BLUE | > | 100 | uM | > | 10000 | DRUG AND RECOMBINANT TAT WERE INTRODUCED INTO CELLS THROUGH ELECTROPORATION | 9561563 | CURCUMIN AND CURCUMIN DERIVATIVES INHIBIT TAT-MEDIATED TRANSACTIVATION OF TYPE 1 HUMAN IMMUNODEFICIENCY VIRUS LONG TERMINAL REPEAT. Research in Virology 1998, 149(1), 43-52. | |||||
| HIV-1 | 1 | P24 | MT-4 | Integrase | < | 0.25 | uM | 95 | % | 0.25 | uM | MICROSCOPIC EXAMINATION | > | 20 | uM | > | 80 | IN THE PRESENCE OF 50% NHS | 16554152 | A SERIES OF 5-AMINOSUBSTITUTED 4-FLUOROBENZYL-8-HYDROXY-[1,6]NAPHTHYRIDINE-7-CARBOXAMIDE HIV-1 INTEGRASE INHIBITORS. Bioorganic & Medical Chemistry Letters 2006, 16(11), 2900-2904. | ECOtherPctMod:> | |||||
| HIV-1 | 1 | P24 | MT-4 | Integrase | < | 0.103 | uM | 95 | % | 0.103 | uM | MICROSCOPIC EXAMINATION | > | 20 | uM | > | 194 | IN THE PRESENCE OF 10% FBS | 16554152 | A SERIES OF 5-AMINOSUBSTITUTED 4-FLUOROBENZYL-8-HYDROXY-[1,6]NAPHTHYRIDINE-7-CARBOXAMIDE HIV-1 INTEGRASE INHIBITORS. Bioorganic & Medical Chemistry Letters 2006, 16(11), 2900-2904. | ECOtherPctMod:> | |||||
| HIV-1 | NL4-3 | RT | MT-4 | Reverse transcriptase | < | 1 | uM | 100 | % | 1 | uM | WST-8 | > | 1 | uM | > | 1 | MEASUREMENTS WERE MADE ON DAY 4, 6 AND 8 POST INFECTION | 15371436 | POLYARGININE INHIBITS GP160 PROCESSING BY FURIN AND SUPPRESSES PRODUCTIVE HUMAN IMMUNODEFICIENCY VIRUS TYPE 1 INFECTION. The Journal of Biological Chemistry 2004, 279(47), 49055-49063. | ||||||
| HIV-1 | LAI | RT | HuT 78 | Reverse transcriptase | < | 1 | uM | 57.14 | % | 1 | uM | MTT | > | 10 | uM | > | 10 | MEASUREMENT WAS MADE ON DAY10 POSTINFECTION AT 10 TCID50 | 9281520 | USE OF HERPES SIMPLEX VIRUS THYMIDINE KINASE TO IMPROVE THE ANTIVIRAL ACTIVITY OF ZIDOVUDINE. Virology 1997, 235, 398-405. |
| Standard Type | Standard Relation | Standard Value | Standard Units |
|---|---|---|---|
| %max | = | 20.34 | % |
| %max | = | 16.37 | % |
| %max | = | 22.3 | % |
| Standard Type | Activity Comment |
|---|---|
| Activity | Not Active |
| Activity | Not Active |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units |
|---|---|---|---|---|
| 300 | LC50 | > | 300000 | nM |
| 40.7 | LC50 | = | 40700 | nM |
| 300 | LC50 | > | 300000 | nM |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0005900000 uM | Activity at 0.00295 uM | Activity at 0.015 uM | Activity at 0.074 uM | Activity at 0.369 uM | Activity at 1.840 uM | Activity at 9.220 uM | Activity at 46.10 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0 0 0 0 0 0 0 1 | -2.8899 | -6.1899 | -7.5624 | -5.0442 | -5.2691 | -7.4083 | -3.0625 | 0.8337 | -2.8899 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 0 | -11.886 | 0.7799 | 3.3283 | -1.6574 | -0.379 | -0.0407 | -0.1733 | 3.2895 | -11.886 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | -8.0307 | 0.0881 | -3.9451 | -3.8178 | -5.1347 | -11.9909 | -2.936 | -1.1932 | -8.0307 | QC'd by "Tocris" | ||||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 0 | -1.593 | 1.5561 | 0.9032 | 1.2235 | -3.4696 | -0.9657 | -0.0842 | -2.0495 | -1.593 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 0 | -0.0788 | -4.9337 | 0.46 | -2.5807 | 0.7446 | 0.0136 | -2.3008 | -1.5552 | -0.0788 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | 4.2624 | -0.4312 | 1.7854 | -0.0056 | 5.8662 | 1.0675 | -7.8806 | 1.2475 | 4.2624 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | -4.0346 | -8.947 | -0.9086 | -0.5189 | -7.1836 | -5.169 | -5.6634 | -29.5845 | -4.0346 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 0 | 5.7591 | -1.4068 | 2.7508 | -0.1815 | 2.9785 | 3.694 | 3.9998 | -0.3015 | 5.7591 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | -5.3844 | 2.4078 | -5.9512 | -3.7241 | -3.3992 | 2.057 | 0.6331 | 0.8532 | -5.3844 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 0 | -2.2453 | -3.7363 | 0.6942 | 0.601 | -1.9285 | -1.3609 | 4.3516 | 1.1697 | -2.2453 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | 2.3324 | -0.5355 | 0.1243 | 4.3039 | 4.1456 | 6.6613 | 3.3936 | 4.3321 | 2.3324 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | 6.7977 | 6.2063 | -2.5612 | -1.1693 | -0.5128 | 0.1248 | -0.3521 | 0.7397 | 6.7977 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 0 | 2.0217 | -0.1792 | 0.1152 | -0.6021 | -3.3605 | 0.8237 | 4.5925 | -1.2217 | 2.0217 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | 0.4425 | 0.3833 | -4.4422 | -0.573 | -2.932 | 1.0594 | 0.9653 | -13.9348 | 0.4425 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | -3.4074 | -6.9944 | -1.6722 | 0.3863 | -3.9812 | 2.4758 | -6.1635 | -1.5512 | -3.4074 | QC'd by "Tocris" | ||||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | -4.3806 | -4.5738 | -3.6173 | -2.0174 | 0.1354 | -5.2732 | -8.3845 | -9.4028 | -4.3806 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 0 | -2.4802 | -2.104 | 1.6816 | 1.3442 | 3.6776 | 3.5172 | -1.5608 | -3.0137 | -2.4802 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | -0.8776 | 1.878 | -0.0634 | 4.212 | -1.1416 | 4.9935 | -0.0837 | -6.743 | -0.8776 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | 2.0095 | 0.0313 | -0.3445 | -1.2227 | -5.0231 | -0.664 | 1.2992 | -8.0246 | 2.0095 | QC'd by "Tocris" | |||||||||
| Inactive | 4 | 0 0 0 0 0 0 0 1 | -0.554 | -4.5098 | -3.3182 | -1.7265 | -0.7027 | -6.0998 | -4.6423 | -10.6714 | -0.554 | QC'd by "Tocris" |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|---|
| Activity | Dose-dependent effect |
| Standard Type | Activity Comment |
|---|---|
| Activity | Active |
| Activity | Active |
| plate number | well | row | column | SMILES | replicate 1 | replicate2 | mean | norm1 | norm2 | normAvg | Zscore |
|---|---|---|---|---|---|---|---|---|---|---|---|
| 121 | I01 | I | 1 | Clc1ccc(CCNS(=O)(=O)c2ccc3N(CCc3c2)C(=O)C4CC4)cc1 | 483915 | 505740 | 494827 | 1.022045421 | 1.068140586 | 1.045091947 | 1.075244414 |
| 121 | I21 | I | 21 | COC(=O)c1cn(nc1c2ccc(OC)cc2)c3ccccc3 | 482363 | 498643 | 490503 | 1.018767543 | 1.053151473 | 1.035959508 | 0.857475943 |
| 121 | I22 | I | 22 | COC(=O)Cn1nc(c2ccccc2)c3ccccc13 | 468073 | 471875 | 469974 | 0.988586563 | 0.99661652 | 0.992601541 | -0.176420664 |
| 121 | J10 | J | 10 | CCN1C(=O)c2ccccc2S(=O)(=O)c3ccc(cc13)C(=O)N4CCC(C)CC4 | 467159 | 478877 | 473018 | 0.986656163 | 1.011404989 | 0.999030576 | -0.023116496 |
| 121 | K08 | K | 8 | CCOc1ccc(cc1)n2cc([nH]c2=O)c3ccc(OCC)c(Cl)c3 | 405990 | 431925 | 418957 | 0.857465093 | 0.912240721 | 0.884851851 | -2.745776367 |
| 121 | K09 | K | 9 | FC(F)(F)c1cccc(NC(=O)c2nn(c3ccc(Cl)cc3)c(=O)c4ccccc24)c1 | 441602 | 445014 | 443308 | 0.932678884 | 0.939885148 | 0.936282016 | -1.519393382 |
| 121 | K21 | K | 21 | CCOC(=O)c1ccc(NC(=O)c2cn(nc2c3ccc(OC)cc3)c4ccccc4)cc1 | 426067 | 425758 | 425912 | 0.89986842 | 0.899215801 | 0.899541055 | -2.395503538 |
| 121 | L18 | L | 18 | Fc1ccc(CN2C(=O)c3ccccc3S(=O)(=O)c4ccc(cc24)C(=O)N5CCCCCC5)cc1 | 415786 | 419304 | 417545 | 0.878154588 | 0.885584727 | 0.881869658 | -2.81688855 |
| 121 | M18 | M | 18 | Cc1cc(C)c(NC2=NC3CS(=O)(=O)CC3S2)c(C)c1 | 461134 | 462019 | 461576 | 0.973931152 | 0.975800303 | 0.974864671 | -0.599366921 |
| 121 | M20 | M | 20 | CC(CC(=O)NCCc1c[nH]c2ccccc12)CC3=Nc4ccccc4S(=O)(=O)N3 | 450293 | 444180 | 447236 | 0.95103458 | 0.93812371 | 0.944578089 | -1.321568555 |
| 121 | O09 | O | 9 | COc1ccc(NC(=O)c2nn(c3ccc(Cl)cc3)c(=O)c4ccccc24)cc1OC | 391011 | 364059 | 377535 | 0.825828921 | 0.768905353 | 0.797367137 | -4.831901618 |
| 121 | O16 | O | 16 | COc1cccc(CNS(=O)(=O)c2ccc3NC(=O)CCc3c2)c1 | 459548 | 474936 | 467242 | 0.970581464 | 1.003081459 | 0.986831462 | -0.314011659 |
| 121 | O18 | O | 18 | Clc1ccc(cc1NC2=NC3CS(=O)(=O)CC3S2)C(=O)N4CCN(CC4)C5CCCCC5 | 477363 | 480763 | 479063 | 1.008207368 | 1.015388287 | 1.011797828 | 0.281326243 |
| 121 | P02 | P | 2 | COC(CNC(=O)c1ccc2S(=O)c3ccccc3C(=O)N(Cc4ccccc4)c2c1)OC | 459484 | 469120 | 464302 | 0.970446294 | 0.990797863 | 0.980622079 | -0.462078103 |
| 121 | P16 | P | 16 | CCN(CC)C(=O)c1ccc2c(c1)N(Cc3ccccc3F)C(=O)c4ccccc4S2(=O)=O | 452115 | 452028 | 452071 | 0.954882708 | 0.954698961 | 0.954789779 | -1.078064727 |
| 121 | P18 | P | 18 | Fc1ccc(CN2C(=O)c3ccccc3S(=O)(=O)c4ccc(cc24)C(=O)N5CCCC5)cc1 | 460501 | 476164 | 468332 | 0.972594234 | 1.005675038 | 0.98913358 | -0.259116277 |
| 122 | B04 | B | 4 | COc1ccc(CNC(=O)c2cc(=O)[nH]c3ccc(cc23)S(=O)(=O)N4CCCC4)c(OC)c1 | 510152 | 511896 | 511024 | 1.067484688 | 1.07113398 | 1.069309334 | 2.080198605 |
| 122 | B12 | B | 12 | CCOCCCNC(=O)CCN1C(=O)COc2ccccc12 | 533515 | 535724 | 534619 | 1.116371382 | 1.120993679 | 1.118681484 | 3.562017465 |
| 122 | C05 | C | 5 | O=C(CN1C(=O)CSc2ccc(cc12)S(=O)(=O)N3CCOCC3)N4CCCCC4 | 480020 | 491275 | 485647 | 1.004433973 | 1.027984876 | 1.016208378 | 0.486466153 |
| 122 | C22 | C | 22 | CCC1Oc2ccccc2N(CC(=O)NCc3ccccc3Cl)C1=O | 471446 | 472697 | 472071 | 0.986493018 | 0.989110715 | 0.987800821 | -0.366137061 |
| REPRODUCIBILITY_COSINE_TRANSFORM | PCT_ACTIVE_REPLICATES | REPLICATE_A_ACTIVITY_SCORE_12.5uM_(%) | REPLICATE_B_ACTIVITY_SCORE_12.5uM_(%) |
|---|---|---|---|
| 0 | 0 | 0.193 | |
| 0 | 0 | -0.443 | |
| 0 | 0 | 0.02 | |
| 0 | 0 | -10.883 | |
| 0 | 0 | 3.986 | |
| 0 | 0 | 16.236 | |
| 0 | 0 | 38.043 | |
| 0 | 0 | 3.387 | |
| 0 | 0 | 13.272 | |
| 0 | 0 | -0.209 | |
| 0 | 0 | 0.757 | |
| 0 | 0 | 2.786 | |
| 0 | 0 | -12.234 | |
| 0 | 0 | -10.048 | |
| 0 | 0 | 1.844 | |
| 0 | 0 | -2.259 | |
| 0 | 0 | -8.602 | |
| 0 | 0 | 1.219 | |
| 0 | 0 | 6.005 | |
| 0 | 0 | 13.086 |
| Standard Type | Activity Comment |
|---|---|
| Activity | Active |
| Activity | Active |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000000311 uM | Activity at 0.0000000880 uM | Activity at 0.0000001756 uM | Activity at 0.0000004972 uM | Activity at 0.0000014063 uM | Activity at 0.0000028127 uM | Activity at 0.0000079555 uM | Activity at 0.0000225014 uM | Activity at 0.0000450029 uM | Activity at 0.0001299230 uM | Activity at 0.0003002708 uM | Activity at 0.0008965874 uM | Activity at 0.00268 uM | Activity at 0.00700 uM | Activity at 0.016 uM | Activity at 0.032 uM | Activity at 0.076 uM | Activity at 0.219 uM | Activity at 0.631 uM | Activity at 1.728 uM | Activity at 3.886 uM | Activity at 8.589 uM | Activity at 17.80 uM | Activity at 49.20 uM | Activity at 107.3 uM | Activity at 231.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4.9549 | 0.4153 | -14.5146 | 1 | 4 | 0 0 0 0 1 | 4.685 | -8.5335 | 0.7807 | 11.3474 | -12.5122 | 4.685 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Activator | 12.5893 | 29.2705 | 0 | Single point of activity | -4.9 | 4.9549 | 0.9612 | 31 | 1.7295 | 3 | 0 0 0 0 0 | 30.9001 | -1.4754 | 1.0166 | 5.6243 | 6.6083 | 30.9001 | QC'd by "Microsource" | ||||||||||||||||||||||
| Activator | 8.9125 | 65.9699 | 0 | Partial curve; partial efficacy | -5.05 | 0.6 | 0.9478 | 60.7629 | -5.207 | 2.2 | 0 0 0 0 0 | 46.0767 | -2.3225 | 0.7459 | 18.7564 | 22.5194 | 46.0767 | QC'd by "Microsource" | ||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.3508 | -5.4241 | 12 | 4 | 0 0 0 0 0 | 2.824 | 6.9985 | -6.3081 | -17.4367 | -1.0266 | 2.824 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Inactive | 0 | 4.095 | 0.8518 | -20.6942 | -4.8432 | 4 | 1 0 0 0 0 | -16.9639 | -25.916 | -5.286 | -19.6983 | -24.7451 | -16.9639 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8518 | -16.2964 | 1.5 | 4 | 0 0 0 0 1 | 4.1206 | 1.8961 | -0.6171 | -21.497 | -11.4248 | 4.1206 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Activator | 2.2387 | 83.6659 | 0 | Partial curve; partial efficacy; poor fit | -5.65 | 0.5 | 0.8806 | 54.0974 | -29.5685 | 2.4 | 0 0 0 0 0 | 44.3794 | -19.3312 | -4.1329 | 18.8496 | 13.5792 | 44.3794 | QC'd by "Microsource" | ||||||||||||||||||||||
| Inhibitor | 12.5893 | 81.1747 | 42 | Partial curve; high efficacy | -4.9 | 4.095 | 0.9407 | -88.2352 | -7.0605 | -2.1 | 0 0 0 0 0 | -88.059 | -2.1141 | 2.5457 | -21.0606 | -24.383 | -88.059 | QC'd by "Microsource" | ||||||||||||||||||||||
| Inactive | 0 | 0.8 | 0.9754 | 0.5 | 18 | 4 | 0 0 0 0 0 | 0.1686 | 15.5939 | 9.5523 | 5.2389 | 3.3969 | 0.1686 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.516 | 14 | -11.1922 | 4 | 0 0 0 0 0 | 8.9233 | 2.0681 | -9.5798 | -21.4101 | -15.067 | 8.9233 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Inhibitor | 10 | 111.4578 | 10 | Partial curve; high efficacy; poor fit | -5 | 4.095 | 0.8557 | -88.0204 | 23.4373 | -2.3 | 0 0 0 0 0 | -86.963 | 0.1371 | 16.1149 | 55.0816 | -24.8092 | -86.963 | QC'd by "Microsource" | ||||||||||||||||||||||
| Inhibitor | 12.5893 | 111.8609 | 10 | Single point of activity | -4.9 | 1.3987 | 0.9539 | -66.6934 | 45.1675 | -3 | 0 0 0 0 0 | -51.9056 | 34.8895 | 58.2591 | 32.624 | 3.3045 | -51.9056 | QC'd by "Microsource" | ||||||||||||||||||||||
| Inactive | 0 | 4 | 9.4501 | 23.4721 | 50.1914 | -0.8776 | 27.4967 | 9.4501 | QC'd by "Microsource" | |||||||||||||||||||||||||||||||
| Inactive | 0 | 3.6272 | 0.9908 | -9.6077 | 22.5 | 4 | 0 0 0 0 0 | -9.2564 | 21.9907 | 20.6042 | 24.2232 | 8.6092 | -9.2564 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Activator | 0 | Single point of activity | 4.9549 | 0.3547 | 25.2512 | 5 | 3 | 0 0 0 0 1 | 15.4142 | 5.7176 | 6.5342 | 43.2316 | 7.0919 | 15.4142 | QC'd by "Microsource" | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6074 | 7 | 18.5 | 4 | 0 0 0 0 0 | 11.6515 | 12.5897 | 21.5938 | 21.2209 | 4.3118 | 11.6515 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Activator | 2.2387 | 52.7895 | 0 | Partial curve; partial efficacy | -5.65 | 2.2526 | 0.9613 | 44.2358 | -8.5537 | 2.2 | 0 0 0 0 1 | -9.4264 | -2.4981 | -13.182 | 11.9591 | 42.1127 | -9.4264 | QC'd by "Microsource" | ||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.942 | 28 | 1.1909 | 4 | 0 0 0 0 1 | 1.5316 | 4.6729 | 1.2372 | -2.341 | 24.4478 | 1.5316 | QC'd by "Microsource" | ||||||||||||||||||||||||||
| Inhibitor | 35.4813 | 55.7622 | 10 | Single point of activity | -4.45 | 4.9549 | 0.7876 | -42.7915 | 12.9707 | -3 | 0 0 0 0 0 | -30.6839 | 14.5151 | 3.8713 | 4.7738 | 29.0235 | -30.6839 | QC'd by "Microsource" | ||||||||||||||||||||||
| Inhibitor | 35.4813 | 49.2317 | 10 | Single point of activity | -4.45 | 4.4495 | 0.7066 | -51.9324 | -2.7008 | -3 | 0 0 0 0 0 | -40.193 | -17.9891 | 11.8148 | -5.5992 | 0.7455 | -40.193 | QC'd by "Microsource" |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000000311 uM | Activity at 0.0000000880 uM | Activity at 0.0000001756 uM | Activity at 0.0000004972 uM | Activity at 0.0000014063 uM | Activity at 0.0000028127 uM | Activity at 0.0000079555 uM | Activity at 0.0000225014 uM | Activity at 0.0000450029 uM | Activity at 0.0001299230 uM | Activity at 0.0003002708 uM | Activity at 0.0008965874 uM | Activity at 0.00268 uM | Activity at 0.00700 uM | Activity at 0.016 uM | Activity at 0.032 uM | Activity at 0.076 uM | Activity at 0.219 uM | Activity at 0.631 uM | Activity at 1.728 uM | Activity at 3.886 uM | Activity at 8.587 uM | Activity at 17.80 uM | Activity at 49.20 uM | Activity at 107.3 uM | Activity at 231.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 25.1189 | 46.3945 | 20 | Partial curve; partial efficacy | -4.6 | 2.2526 | 0.9287 | -51.2557 | -4.8612 | -2.2 | 0 0 0 0 0 | -41.1028 | -5.7868 | -8.9838 | -1.9677 | -26.4188 | -41.1028 | QC'd by "BIOMOL" | ||||||||||||||||||||||
| Inactive | 0 | 3.5117 | 0.9435 | 10 | -4.567 | 4 | 0 0 0 0 1 | -5.6299 | -3.6518 | -3.5753 | -4.2225 | 6.795 | -5.6299 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 3.0654 | 0.9376 | 11 | -2.7695 | 4 | 0 0 0 0 1 | -2.8045 | -1.4193 | -3.1412 | -1.9048 | 7.584 | -2.8045 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7625 | 1 | -16.7 | 4 | 0 0 0 0 | -0.288 | -12.25 | 5.019 | -2.495 | -0.288 | QC'd by "Prestwick Chemical; Inc." | |||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8335 | 4.5 | -7.0946 | 4 | 0 0 0 0 | 3.0138 | -4.2455 | 6.6652 | 3.4342 | 3.0138 | QC'd by "Prestwick Chemical; Inc." | |||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.993 | 0.5 | -16.2895 | 4 | 0 0 0 0 1 | -17.2531 | -11.9079 | 0.4577 | 0.7459 | 0.1472 | -17.2531 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 3.0654 | 0.989 | -13.9862 | -8.1964 | 4 | 0 0 0 0 | -13.7385 | -8.6044 | -8.0804 | -9.4725 | -13.7385 | QC'd by "Prestwick Chemical; Inc." | |||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8435 | -11.2843 | 4 | 4 | 0 0 0 0 0 | -11.9036 | 3.4878 | 5.2393 | 0.5291 | 5.9839 | -11.9036 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 0.8 | 0.7241 | 0.6 | -14.6999 | 4 | 0 0 0 0 1 | -12.1307 | -11.4165 | -6.1179 | -8.0206 | -2.8333 | -12.1307 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8652 | 1 | -19.7041 | 4 | 0 0 0 0 0 | -4.2947 | -18.0867 | -15.9371 | 4.8395 | 2.1157 | -4.2947 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inhibitor | 14.1254 | 42.1465 | 10 | Single point of activity | -4.85 | 4.9549 | 0.8997 | -40.1465 | 2 | -3 | 0 0 0 0 0 | -41.8192 | -2.393 | 5.1804 | -2.5248 | 4.6867 | -41.8192 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6566 | -10.2454 | 0 | 4 | 0 0 0 0 0 | -10.2045 | -4.5492 | -0.0989 | 4.6103 | -5.6017 | -10.2045 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.5279 | 3 | -11.3522 | 4 | 0 0 0 0 | 1.078 | -15.7102 | -2.9932 | -14.9547 | 1.078 | QC'd by "Prestwick Chemical; Inc." | |||||||||||||||||||||||||||
| Inactive | 0 | 1.6924 | 0.9123 | 0.5 | -10.147 | 4 | 0 0 0 0 | 0.4297 | -9.2892 | -3.9336 | -3.1566 | 0.4297 | QC'd by "Prestwick Chemical; Inc." | |||||||||||||||||||||||||||
| Inactive | 0 | 2.4064 | 0.7886 | 8 | -4.3029 | 4 | 0 0 0 0 0 | 5.7256 | -1.9822 | -4.4191 | -3.8175 | 8.0142 | 5.7256 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.997 | 5.5 | -12.076 | 4 | 0 0 0 1 | -6.5693 | -12.5633 | -7.4947 | 4.9219 | -6.5693 | QC'd by "Prestwick Chemical; Inc." | |||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9232 | -18.4489 | -2.2837 | 4 | 0 0 0 0 | -16.2075 | -1.3456 | -4.9534 | -0.2364 | -16.2075 | QC'd by "Prestwick Chemical; Inc." | |||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9481 | 2 | -17.5643 | 4 | 0 0 0 0 1 | -13.5121 | -12.9703 | 3.6247 | 1.4507 | 0.7522 | -13.5121 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.5725 | -10.2193 | 7.5 | 4 | 0 0 0 0 0 | -12.7555 | 5.891 | 7.5423 | -18.5161 | 0.6587 | -12.7555 | QC'd by "Prestwick Chemical; Inc." | ||||||||||||||||||||||||||
| Inhibitor | 31.6228 | 100.7069 | 40 | Partial curve; high efficacy | -4.5 | 3.5722 | 0.9933 | -104.0783 | -3.3715 | -2.1 | 0 0 0 0 0 | -83.3961 | 0.3188 | -7.6251 | -4.9588 | -20.5702 | -83.3961 | QC'd by "BIOMOL" |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0008905393 uM | Activity at 0.00133 uM | Activity at 0.00260 uM | Activity at 0.00420 uM | Activity at 0.00779 uM | Activity at 0.011 uM | Activity at 0.023 uM | Activity at 0.033 uM | Activity at 0.070 uM | Activity at 0.092 uM | Activity at 0.148 uM | Activity at 0.213 uM | Activity at 0.447 uM | Activity at 0.637 uM | Activity at 1.271 uM | Activity at 1.910 uM | Activity at 3.487 uM | Activity at 5.719 uM | Activity at 10.47 uM | Activity at 17.11 uM | Activity at 29.50 uM | Activity at 51.33 uM | Activity at 83.48 uM | Activity at 153.7 uM | Activity at 271.3 uM | Activity at 313.8 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -4.2 | 1 | 0.8542 | 15 | -0.8141 | 4 | 0 0 0 0 0 0 0 0 | 12.4761 | 0.6149 | 0.1958 | -4.8451 | 1.0169 | -0.1665 | 0.9292 | 7.324 | 12.4761 | QC'd by Chem Div | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 5.5368 | -0.1521 | -0.4853 | 0.8123 | 3.04 | 4.3508 | 5.5368 | QC'd by Chem Div | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 8.6042 | 4.8618 | 6.0005 | 4.8572 | 2.4088 | 2.5501 | 1.8735 | 3.3336 | 8.6042 | QC'd by Chem Div | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.8803 | 1.5268 | -0.8493 | -0.8611 | 4.1068 | -1.778 | -0.0897 | -1.4954 | -2.8803 | QC'd by Chem Div | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 6.6979 | 5.8514 | 4.5387 | 3.2655 | 6.7193 | 3.1377 | 3.8268 | 4.8314 | 6.6979 | QC'd by Chem Div | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 11.2642 | 3.9196 | 1.8947 | 4.7539 | 2.7499 | 4.3951 | 11.2642 | QC'd by Chem Div | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3429 | 2.9262 | -0.1885 | 3.2488 | 1.5027 | -2.5002 | 4.3429 | QC'd by Chem Div | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -0.6829 | 3.3556 | 1.3973 | 2.4698 | 3.7138 | 2.6913 | -0.6829 | QC'd by DPISMR | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.1094 | 2.978 | 2.9594 | -0.2137 | 3.9629 | 3.2444 | 7.0105 | 2.2449 | 4.1094 | QC'd by ChemBridge | ||||||||||||||||||||||||||
| Inactive | 0 | -3.9 | 1 | 0.7748 | 30 | 0.6852 | 4 | 0 0 0 0 0 0 0 0 | 23.3109 | 4.9223 | 1.4858 | -0.2624 | 1.7621 | -0.0889 | 1.7568 | 6.6429 | 23.3109 | QC'd by ChemBridge | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 7.2259 | 1.1257 | 2.5045 | 2.118 | 2.136 | 0.3108 | 7.2259 | QC'd by DPISMR | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.7681 | 6.7634 | 2.2278 | 3.3419 | 0.9846 | 1.3115 | 2.7671 | 3.3811 | 2.7681 | QC'd by ChemBridge | ||||||||||||||||||||||||||
| Inactive | 0 | -4.1 | 1 | 0.8429 | 18 | -0.1632 | 4 | 0 0 0 0 0 0 0 0 | 13.8334 | 2.7619 | 1.5007 | -1.4428 | 1.3099 | -2.636 | 1.8618 | 7.5982 | 13.8334 | QC'd by ChemBridge | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 5.8128 | -3.6075 | 1.4591 | 2.0274 | -0.4652 | -4.916 | 5.8128 | QC'd by ChemBridge | ||||||||||||||||||||||||||||
| Inactive | 0 | -3.95 | 1 | 0.7398 | -12.738 | -0.5 | 4 | 0 0 0 0 0 0 | -8.9483 | -1.7034 | -0.1105 | -2.1462 | 1.7984 | -5.297 | -8.9483 | QC'd by ChemBridge | ||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.5811 | -8.353 | -2.4919 | -8.4727 | -4.4155 | -5.0949 | -1.5077 | -0.4001 | -2.5811 | QC'd by ChemBridge | ||||||||||||||||||||||||||
| Inactive | 0 | -4.45 | 1 | 0.7869 | -2 | 9 | 4 | 0 0 0 0 0 0 0 0 | 0.1751 | 11.5214 | 7.293 | 5.7774 | 10.9823 | 7.558 | 6.13 | 1.2752 | 0.1751 | QC'd by ChemBridge | ||||||||||||||||||||||
| Inactive | 0 | -3.95 | 1 | 0.8443 | 24 | -0.6883 | 4 | 0 0 0 0 0 0 0 0 | 17.1313 | -1.3595 | 1.4567 | -3.4902 | 0.3518 | 2.6702 | 1.9371 | 6.158 | 17.1313 | QC'd by ChemBridge | ||||||||||||||||||||||
| Inactive | 0 | -6.65 | 1 | 0.4363 | 3 | -6.188 | 4 | 0 0 0 0 0 0 | 7.2613 | -3.49 | 1.1499 | 3.8934 | 1.143 | -1.0367 | 7.2613 | QC'd by ChemBridge | ||||||||||||||||||||||||
| Inactive | 0 | 0.6 | 0.956 | -7.3878 | 7.5 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -7.4065 | 6.3748 | 5.7815 | 8.5267 | 5.2031 | 4.2367 | 3.0265 | -1.7308 | -2.2978 | -3.391 | -4.7307 | -7.4065 | QC'd by Microsource |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0006653454 uM | Activity at 0.0009950977 uM | Activity at 0.00194 uM | Activity at 0.00314 uM | Activity at 0.00582 uM | Activity at 0.00823 uM | Activity at 0.017 uM | Activity at 0.024 uM | Activity at 0.052 uM | Activity at 0.069 uM | Activity at 0.111 uM | Activity at 0.159 uM | Activity at 0.334 uM | Activity at 0.476 uM | Activity at 0.949 uM | Activity at 1.427 uM | Activity at 2.605 uM | Activity at 4.273 uM | Activity at 7.820 uM | Activity at 12.78 uM | Activity at 22.04 uM | Activity at 38.35 uM | Activity at 62.38 uM | Activity at 114.8 uM | Activity at 202.7 uM | Activity at 234.5 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 3.1414 | 91.5653 | 84 | Complete curve; high efficacy | -5.5029 | 1.1 | 0.996 | -83.5653 | 8 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -83.3985 | 5.8642 | 5.1752 | 6.8922 | 10.9031 | 5.3804 | 2.223 | -20.9811 | -45.6671 | -65.9774 | -77.4953 | -83.3985 | QC'd by SigmaAldrich | ||||||||||||||||
| Inhibitor | 7.5686 | 73.193 | 83 | Complete curve; high efficacy | -5.121 | 1.7885 | 0.9952 | -82.8887 | -9.6957 | -1.1 | 0 0 0 0 0 0 0 0 | -80.375 | -9.2369 | -7.6804 | -7.6509 | -14.8323 | -17.372 | -58.9614 | -82.7971 | -80.375 | QC'd by Chem Div | |||||||||||||||||||
| Inhibitor | 9.5283 | 113.417 | 83 | Complete curve; high efficacy | -5.021 | 2.0479 | 0.9957 | -126.8199 | -13.4029 | -1.1 | 0 0 0 0 0 0 0 0 | -128.8821 | -12.2785 | -9.679 | -19.3504 | -12.0769 | -19.5794 | -82.8273 | -119.9921 | -128.8821 | QC'd by Asinex Ltd. | |||||||||||||||||||
| Inhibitor | 8.9125 | 97.0941 | 83 | Complete curve; high efficacy | -5.05 | 1.4163 | 0.9972 | -95.9137 | 1.1804 | -1.1 | 0 0 0 0 0 0 | -95.1525 | -2.2262 | 3.0431 | -10.9978 | -55.3438 | -87.9728 | -95.1525 | QC'd by Key Organics Ltd. | |||||||||||||||||||||
| Inhibitor | 7.5686 | 80.842 | 83 | Complete curve; high efficacy | -5.121 | 1.8617 | 0.99 | -94.8681 | -14.0261 | -1.1 | 0 0 0 0 0 0 0 0 | -88.9598 | -9.2218 | -14.3086 | -16.5014 | -16.2031 | -22.3172 | -68.1032 | -98.8209 | -88.9598 | QC'd by Sigma Chemical Company | |||||||||||||||||||
| Inhibitor | 9.5283 | 107.836 | 83 | Complete curve; high efficacy | -5.021 | 0.8 | 0.9912 | -121.2518 | -13.4158 | -1.1 | 0 0 0 0 0 0 0 0 | -109.8296 | -16.8462 | -9.939 | -19.9812 | -16.655 | -43.876 | -69.7913 | -99.6793 | -109.8296 | QC'd by Asinex Ltd. | |||||||||||||||||||
| Inhibitor | 9.5283 | 102.4102 | 83 | Complete curve; high efficacy | -5.021 | 2.2526 | 0.9928 | -112.0345 | -9.6243 | -1.1 | 0 0 0 0 0 0 0 0 | -116.7026 | -13.4215 | -5.2335 | -14.5215 | -9.9722 | -10.6725 | -70.1375 | -106.0787 | -116.7026 | QC'd by InterBioScreen | |||||||||||||||||||
| Inhibitor | 6.7456 | 100.7477 | 83 | Complete curve; high efficacy | -5.171 | 2.0479 | 0.9883 | -102.4434 | -1.6957 | -1.1 | 0 0 0 0 0 0 0 0 | -110.1541 | -0.6199 | -3.1798 | -6.2849 | 2.8918 | -11.5064 | -77.2529 | -92.783 | -110.1541 | QC'd by InterBioScreen | |||||||||||||||||||
| Inhibitor | 8.4921 | 112.572 | 83 | Complete curve; high efficacy | -5.071 | 2.0479 | 0.9978 | -114.9669 | -2.3949 | -1.1 | 0 0 0 0 0 0 0 0 | -112.6964 | -0.4977 | -0.1079 | -6.8481 | -0.5406 | -11.4336 | -76.2713 | -113.3796 | -112.6964 | QC'd by Chem Div | |||||||||||||||||||
| Inhibitor | 9.5283 | 100.6484 | 83 | Complete curve; high efficacy | -5.021 | 1.7885 | 0.9962 | -100.6484 | 0 | -1.1 | 0 0 0 0 0 0 0 0 | -102.9125 | 3.2274 | 0.2085 | -3.8063 | -2.2579 | -5.9804 | -58.4009 | -93.2587 | -102.9125 | QC'd by InterBioScreen | |||||||||||||||||||
| Inhibitor | 7.0327 | 75.8075 | 82 | Complete curve; high efficacy | -5.1529 | 1.21 | 0.9887 | -67.8075 | 8 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -62.7329 | 6.4136 | 9.158 | 7.5581 | 6.5704 | 5.8253 | 3.2639 | 4.0875 | -18.7337 | -46.8788 | -54.1698 | -62.7329 | QC'd by Timtec | ||||||||||||||||
| Inhibitor | 9.5283 | 77.6809 | 82 | Complete curve; high efficacy | -5.021 | 1.2221 | 0.9944 | -83.7222 | -6.0413 | -1.1 | 0 0 0 0 0 0 0 0 | -81.7738 | -4.3587 | -3.5127 | -10.8793 | -7.6754 | -16.5948 | -51.1312 | -73.833 | -81.7738 | QC'd by InterBioScreen | |||||||||||||||||||
| Inhibitor | 10.691 | 75.7058 | 82 | Complete curve; high efficacy | -4.971 | 1.9673 | 0.9723 | -81.5585 | -5.8527 | -1.1 | 0 0 0 0 0 0 0 0 | -71.231 | -3.7858 | -1.8418 | -9.4119 | -9.4119 | -9.0819 | -46.725 | -88.2668 | -71.231 | QC'd by Chem Div | |||||||||||||||||||
| Inhibitor | 6.012 | 99.4255 | 82 | Complete curve; high efficacy | -5.221 | 0.4 | 0.9552 | -66.4076 | 33.018 | -1.1 | 0 0 0 0 0 0 0 0 | -48.5497 | 32.9302 | 23.8568 | 11.216 | 1.8455 | -3.1495 | -12.7102 | -42.9961 | -48.5497 | QC'd by InterBioScreen | |||||||||||||||||||
| Inhibitor | 12.5893 | 84.4035 | 82 | Complete curve; high efficacy | -4.9 | 2.7202 | 0.9858 | -86.2417 | -1.8382 | -1.1 | 0 0 0 0 0 0 | -85.684 | 2.3129 | -10.9395 | 1.6385 | -38.1285 | -86.0696 | -85.684 | QC'd by Nathanael S Gray - Dana Farber Cancer Institute - MLI PSL | |||||||||||||||||||||
| Inhibitor | 12.5893 | 81.6146 | 82 | Complete curve; high efficacy | -4.9 | 2.3332 | 0.999 | -91.3016 | -9.687 | -1.1 | 0 0 0 0 0 0 | -91.1194 | -8.8096 | -11.8548 | -10.1481 | -45.0265 | -88.9937 | -91.1194 | QC'd by InterBioScreen | |||||||||||||||||||||
| Inhibitor | 13.4591 | 86.9588 | 82 | Complete curve; high efficacy | -4.871 | 1.4641 | 0.9849 | -93.9971 | -7.0383 | -1.1 | 0 0 0 0 0 0 0 0 | -84.5472 | -4.3953 | -7.2317 | -9.2129 | -14.3512 | -7.0393 | -45.0179 | -87.0343 | -84.5472 | QC'd by InterBioScreen | |||||||||||||||||||
| Inhibitor | 8.9125 | 91.1397 | 82 | Complete curve; high efficacy | -5.05 | 4.095 | 0.9946 | -89.0564 | 2.0833 | -1.1 | 0 0 0 0 0 0 | -93.3505 | 5.8165 | -1.4499 | 2.1549 | -65.2799 | -85.2894 | -93.3505 | QC'd by Enamine | |||||||||||||||||||||
| Inhibitor | 15.1014 | 90.2598 | 82 | Complete curve; high efficacy | -4.821 | 2.4064 | 0.9711 | -110.2608 | -20.001 | -1.1 | 0 0 0 0 0 0 0 0 | -98.3869 | -17.9349 | -21.0527 | -21.4562 | -23.8802 | -18.187 | -46.7884 | -119.3299 | -98.3869 | QC'd by NCI Chemotherapeutic Agents Repository | |||||||||||||||||||
| Inhibitor | 15.7441 | 90.0908 | 81 | Complete curve; high efficacy | -4.8029 | 1.6604 | 0.9839 | -89.1483 | 0.9425 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -83.9438 | 2.967 | 7.2054 | 2.7371 | -0.6122 | 2.788 | -2.9535 | -4.3083 | -13.5377 | -29.9354 | -76.8118 | -83.9438 | QC'd by SigmaAldrich |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00123 uM | Activity at 0.00610 uM | Activity at 0.00630 uM | Activity at 0.013 uM | Activity at 0.025 uM | Activity at 0.042 uM | Activity at 0.068 uM | Activity at 0.120 uM | Activity at 0.202 uM | Activity at 0.314 uM | Activity at 0.611 uM | Activity at 1.089 uM | Activity at 1.568 uM | Activity at 3.058 uM | Activity at 5.503 uM | Activity at 7.834 uM | Activity at 15.29 uM | Activity at 27.41 uM | Activity at 39.61 uM | Activity at 75.76 uM | Activity at 149.6 uM | Activity at 201.4 uM | Activity at 319.7 uM | Activity at 605.8 uM | Activity at 817.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 112.2018 | 2659.1944 | 100 | Partial curve; high efficacy | -3.95 | 4.5045 | 0.9988 | 2689.24 | 30.0456 | 2.1 | 0 0 0 0 0 0 | 2175.7605 | -2.1864 | 18.441 | 20.7973 | 83.3849 | 426.7958 | 2175.7605 | QC'd by Microsource | ||||||||||||||||||||
| Activator | 0.1778 | 128.3128 | 95 | Complete curve; high efficacy | -6.75 | 4.9549 | 0.9927 | 134.4851 | 6.1723 | 1.1 | 0 0 0 0 0 1 | 14.509 | 5.6033 | 24.7938 | 142.7655 | 131.831 | 127.7753 | 14.509 | QC'd by SigmaAldrich | ||||||||||||||||||||
| Activator | 0.4467 | 126.1077 | 91 | Complete curve; high efficacy | -6.35 | 1.8617 | 0.9998 | 123.6363 | -2.4714 | 1.1 | 0 0 0 0 0 1 | 0.2688 | -2.5844 | 7.8161 | 80.257 | 120.2764 | 123.3895 | 0.2688 | QC'd by SigmaAldrich | ||||||||||||||||||||
| Activator | 1.122 | 117.1254 | 90 | Complete curve; high efficacy | -5.95 | 2.2481 | 0.9788 | 132.4265 | 15.3011 | 1.1 | 0 0 0 0 0 | 143.3187 | 15.8094 | 39.5652 | 122.9227 | 119.7824 | 143.3187 | QC'd by Tocris | |||||||||||||||||||||
| Activator | 112.2018 | 1122.1776 | 71 | Partial curve; high efficacy | -3.95 | 4.5045 | 0.9983 | 1140.5688 | 18.3912 | 2.1 | 0 0 0 0 0 | 922.7903 | 3.2305 | 7.5889 | 41.6506 | 204.8302 | 922.7903 | QC'd by Timtec | |||||||||||||||||||||
| Activator | 100 | 709.5673 | 58 | Partial curve; high efficacy | -4 | 3.99 | 0.9988 | 700.7079 | -8.8594 | 2.1 | 0 0 0 0 0 0 | 592.8155 | -15.9019 | -8.6532 | 4.5286 | -20.153 | 176.4838 | 592.8155 | QC'd by CarsonNewman-SPECS | ||||||||||||||||||||
| Activator | 79.4328 | 826.4076 | 57 | Partial curve; high efficacy | -4.1 | 4.095 | 0.9972 | 826.7667 | 0.3591 | 2.1 | 0 0 0 0 0 0 | 665.6736 | -2.5729 | -3.4508 | -16.7617 | 25.5851 | 154.5978 | 665.6736 | QC'd by Prestwick Chemical; Inc. | ||||||||||||||||||||
| Activator | 100 | 589.9325 | 55 | Partial curve; high efficacy | -4 | 3.2475 | 0.984 | 613.2979 | 23.3654 | 2.1 | 0 0 0 0 0 0 | 498.6162 | -5.747 | 1.059 | 37.6543 | 62.5313 | 194.9599 | 498.6162 | QC'd by CarsonNewman-SPECS | ||||||||||||||||||||
| Activator | 112.2018 | 558.6566 | 55 | Partial curve; high efficacy | -3.95 | 4.5045 | 0.9992 | 557.2619 | -1.3947 | 2.1 | 0 0 0 0 0 | 448.681 | -6.8565 | -3.8767 | 7.0632 | 81.1858 | 448.681 | QC'd by Vitas | |||||||||||||||||||||
| Activator | 100 | 612.4753 | 55 | Partial curve; high efficacy | -4 | 4.5045 | 0.9972 | 611.2868 | -1.1885 | 2.1 | 0 0 0 0 0 0 | 533.4091 | -10.048 | -5.6002 | -8.2068 | 21.4265 | 142.7223 | 533.4091 | QC'd by Pharmacopeia | ||||||||||||||||||||
| Activator | 100 | 511.5518 | 53 | Partial curve; high efficacy | -4 | 4.4495 | 0.9965 | 517.5467 | 5.995 | 2.1 | 0 0 0 0 0 0 | 453.9884 | -10.4867 | 10.4448 | 3.9744 | 21.1983 | 121.4017 | 453.9884 | QC'd by CarsonNewman-SPECS | ||||||||||||||||||||
| Activator | 112.2018 | 440.1981 | 52 | Partial curve; high efficacy | -3.95 | 4.095 | 0.9989 | 439.2753 | -0.9228 | 2.1 | 0 0 0 0 0 | 348.6312 | -5.1918 | -3.3018 | 6.9705 | 74.6909 | 348.6312 | QC'd by Sequoia | |||||||||||||||||||||
| Activator | 100 | 497.635 | 52 | Partial curve; high efficacy | -4 | 3.6772 | 0.9977 | 486.8252 | -10.8098 | 2.1 | 0 0 0 0 0 0 | 401.671 | -14.9427 | -21.3461 | -13.1864 | 2.6858 | 130.5049 | 401.671 | QC'd by Pharmacopeia | ||||||||||||||||||||
| Activator | 100 | 438.5085 | 51 | Partial curve; high efficacy | -4 | 4.9549 | 0.9987 | 437.7956 | -0.7128 | 2.1 | 0 0 0 0 0 0 | 392.29 | -7.2531 | 0.2913 | -4.176 | 9.3666 | 93.145 | 392.29 | QC'd by Pharmacopeia | ||||||||||||||||||||
| Activator | 56.2341 | 819.9718 | 50 | Partial curve; high efficacy | -4.25 | 3.2475 | 0.9993 | 802.9227 | -17.049 | 2.1 | 0 0 0 0 0 | 787.1792 | -7.4836 | -10.9833 | -14.2075 | 580.1833 | 787.1792 | QC'd by NCI | |||||||||||||||||||||
| Activator | 112.2018 | 363.641 | 50 | Partial curve; high efficacy | -3.95 | 4.9549 | 0.9972 | 355.9752 | -7.6658 | 2.1 | 0 0 0 0 0 0 | 293.7089 | -16.7363 | 0.4741 | -6.1211 | -4.3689 | 34.2599 | 293.7089 | QC'd by Pharmacopeia | ||||||||||||||||||||
| Activator | 112.2018 | 363.0297 | 50 | Partial curve; high efficacy | -3.95 | 4.5045 | 0.9992 | 370.4299 | 7.4002 | 2.1 | 0 0 0 0 0 0 | 299.7006 | 3.6943 | 4.7004 | 13.0282 | 5.8575 | 63.7543 | 299.7006 | QC'd by Pharmacopeia | ||||||||||||||||||||
| Activator | 100 | 295.8134 | 48 | Partial curve; high efficacy | -4 | 3.6272 | 0.9992 | 302.0389 | 6.2255 | 2.1 | 0 0 0 0 0 0 | 251.6991 | 2.6798 | 8.4811 | 8.6778 | 9.6504 | 86.3825 | 251.6991 | QC'd by CarsonNewman-SPECS | ||||||||||||||||||||
| Activator | 100 | 233.3469 | 46 | Partial curve; high efficacy | -4 | 4.5045 | 0.9961 | 221.7227 | -11.6242 | 2.1 | 0 0 0 0 0 0 | 192.4676 | -6.6471 | -16.5394 | -18.4762 | -5.6031 | 42.3638 | 192.4676 | QC'd by CarsonNewman-SPECS | ||||||||||||||||||||
| Activator | 112.2018 | 234.6061 | 46 | Partial curve; high efficacy | -3.95 | 4.9549 | 0.984 | 235.2356 | 0.6295 | 2.1 | 0 0 0 0 0 0 | 197.0148 | 0.9163 | -4.5136 | 1.9482 | 17.442 | 18.7867 | 197.0148 | QC'd by Pharmacopeia |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00123 uM | Activity at 0.00610 uM | Activity at 0.00630 uM | Activity at 0.013 uM | Activity at 0.025 uM | Activity at 0.042 uM | Activity at 0.068 uM | Activity at 0.120 uM | Activity at 0.202 uM | Activity at 0.314 uM | Activity at 0.611 uM | Activity at 1.089 uM | Activity at 1.568 uM | Activity at 3.058 uM | Activity at 5.503 uM | Activity at 7.834 uM | Activity at 15.29 uM | Activity at 27.41 uM | Activity at 39.61 uM | Activity at 75.76 uM | Activity at 149.6 uM | Activity at 201.4 uM | Activity at 319.7 uM | Activity at 605.8 uM | Activity at 817.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4.9549 | 0.7824 | 1.5059 | 12.5 | 4 | 0 0 0 0 0 0 | 2.5014 | 8.6579 | 16.7333 | 7.679 | -0.4118 | 3.2398 | 2.5014 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.5059 | 2 | 22.5 | 4 | 0 0 0 0 0 0 | 6.2536 | 23.1671 | 31.5741 | 20.3971 | 12.3231 | 23.6931 | 6.2536 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 3.0654 | 0.4875 | 6 | 14 | 4 | 0 0 0 0 0 0 | 7.1178 | 13.8537 | 13.0635 | 10.2396 | 19.9104 | 9.8496 | 7.1178 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8513 | -6.1222 | 14.5 | 4 | 0 0 0 0 0 0 | -2.6019 | 18.6181 | 15.6971 | 11.9589 | 10.6497 | 12.3116 | -2.6019 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.444 | 1 | -8.9353 | 4 | 0 0 0 0 0 0 | 4.128 | -6.6128 | 2.8591 | 5.135 | -4.2457 | -1.6866 | 4.128 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 0.9 | 0.6078 | 1.5 | 7 | 4 | 0 0 0 0 0 0 | 3.2802 | 4.9355 | 7.5212 | 2.2467 | 1.4536 | 0.7626 | 3.2802 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4 | 15.8078 | 23.8467 | 15.2102 | 5.4007 | 17.1177 | 11.7038 | 15.8078 | QC'd by Pharmacopeia | |||||||||||||||||||||||||||||
| Inactive | 0 | 4 | -4.3249 | 4.3564 | 0.9262 | -8.2609 | 6.6136 | 3.2318 | -4.3249 | QC'd by Pharmacopeia | |||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.386 | 6.5 | 16 | 4 | 0 0 0 0 0 1 | 18.5613 | 14.4696 | 22.6167 | 10.2425 | 16.2585 | 8.0741 | 18.5613 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7935 | 15 | -5.3851 | 4 | 0 0 0 0 0 0 | 16.1015 | -1.1543 | 20.9641 | 12.4561 | 14.2395 | 11.4227 | 16.1015 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.5045 | 0.9473 | 10.5 | 22 | 4 | 0 0 0 0 0 0 | 8.6846 | 21.3965 | 22.3063 | 12.7817 | 10.4065 | 12.724 | 8.6846 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 0.9 | 0.7228 | 2.6804 | 26 | 4 | 0 0 0 0 0 0 | -2.7663 | 19.5819 | 6.4245 | 5.729 | 8.0359 | 4.8741 | -2.7663 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.4495 | 0.861 | 16.5 | 8.5 | 4 | 0 0 0 0 0 1 | 9.315 | 8.5106 | 10.8538 | 6.2271 | 15.3684 | 16.5398 | 9.315 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.5741 | 10.5 | 0.7083 | 4 | 0 0 0 0 0 0 | 12.2191 | 4.1249 | -2.3265 | 14.4634 | 3.8399 | 10.7866 | 12.2191 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4 | 9.7084 | 13.4221 | 8.3748 | 0.3338 | 10.1018 | 18.0457 | 9.7084 | QC'd by Pharmacopeia | |||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.4502 | -7.4141 | 8.5 | 4 | 0 0 0 0 0 0 | -4.5118 | 9.0559 | 14.9898 | -2.0146 | 10.2874 | 8.4395 | -4.5118 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6758 | 28 | 0.2443 | 4 | 0 0 0 0 0 0 | 23.0495 | 7.0826 | -6.4631 | 4.1349 | 2.386 | -6.0302 | 23.0495 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4.4495 | 0.7608 | -2.5925 | 6.5 | 4 | 0 0 0 0 0 1 | 8.9695 | 3.4459 | 5.6768 | 9.8855 | -0.0456 | -2.1604 | 8.9695 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 2.6384 | 0.665 | 13.5 | 20 | 4 | 0 0 0 0 0 0 | 13.5742 | 16.0359 | 22.5098 | 21.2723 | 19.3862 | 14.3408 | 13.5742 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inactive | 0 | 4 | -3.2632 | -16.2622 | -13.7616 | -11.6684 | -9.5243 | -17.6211 | -3.2632 | QC'd by Prestwick Chemical; Inc. |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0006615435 uM | Activity at 0.0009894114 uM | Activity at 0.00193 uM | Activity at 0.00314 uM | Activity at 0.00579 uM | Activity at 0.00818 uM | Activity at 0.017 uM | Activity at 0.024 uM | Activity at 0.052 uM | Activity at 0.068 uM | Activity at 0.110 uM | Activity at 0.158 uM | Activity at 0.332 uM | Activity at 0.473 uM | Activity at 0.944 uM | Activity at 1.419 uM | Activity at 2.593 uM | Activity at 4.249 uM | Activity at 7.775 uM | Activity at 12.71 uM | Activity at 21.91 uM | Activity at 38.14 uM | Activity at 62.54 uM | Activity at 114.2 uM | Activity at 201.6 uM | Activity at 233.1 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 6.7456 | 1494.3646 | 100 | Complete curve; high efficacy | -5.171 | 2.6384 | 0.965 | -1503.2555 | -8.8908 | -1.1 | 0 0 0 0 0 0 0 0 | -1260.1318 | -11.1547 | -6.7992 | -1.6069 | 13.7817 | -128.8233 | -1191.5094 | -1764.3843 | -1260.1318 | QC'd by Enamine | |||||||||||||||||||
| Inhibitor | 0.0953 | 1682.333 | 92 | Complete curve; high efficacy | -7.021 | 1.4787 | 0.9805 | -97.0681 | 1585.265 | -1.1 | 1 0 0 0 0 0 0 0 | -38.6964 | 3173.9085 | 1467.8379 | 734.0242 | 61.6921 | -105.8029 | -252.9709 | 21.2579 | -38.6964 | QC'd by Richard A Houghten - Torrey Pines Institute for Molecular Studies - MLI PSL | |||||||||||||||||||
| Inhibitor | 0.9528 | 462.0855 | 91 | Complete curve; high efficacy | -6.021 | 4.9549 | 0.8781 | -147.1919 | 314.8936 | -1.1 | 1 0 1 0 0 0 0 0 | -170.5569 | 526.5921 | 229.1516 | 847.3074 | 389.4244 | -222.0195 | -22.4759 | -166.4298 | -170.5569 | QC'd by Chem Div | |||||||||||||||||||
| Inhibitor | 0.0675 | 24.591 | 86 | Complete curve; high efficacy | -7.171 | 3.1925 | 0.4734 | -42.2643 | -66.8553 | -1.1 | 0 0 0 0 0 0 0 1 | -61.4189 | -67.8557 | -65.4209 | -48.882 | -33.4136 | -32.3036 | -35.0315 | -67.9216 | -61.4189 | QC'd by Scott E Schaus - Boston Univ. - MLI CMLD | |||||||||||||||||||
| Inhibitor | 0.019 | 21.6073 | 86 | Complete curve; high efficacy | -7.721 | 3.0654 | 0.8497 | -38.71 | -60.3172 | -1.1 | 0 0 0 0 0 0 | -33.8968 | -60.016 | -50.4881 | -38.7102 | -36.9245 | -45.4763 | -33.8968 | QC'd by Specs | |||||||||||||||||||||
| Inhibitor | 5.548 | 138.1821 | 86 | Complete curve; high efficacy | -5.2559 | 1.3723 | 0.995 | -149.829 | -11.6469 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -146.0322 | -15.3641 | -14.426 | -10.6845 | -2.5307 | -13.6678 | -14.3878 | -34.5896 | -65.4595 | -119.9073 | -140.2727 | -146.0322 | QC'd by Tocris | ||||||||||||||||
| Inhibitor | 1.1995 | 6.0318 | 86 | Complete curve; high efficacy | -5.921 | 4.9549 | 0.4811 | -77.4305 | -71.3987 | -1.1 | 0 0 0 0 0 0 0 1 | -69.1964 | -75.7075 | -69.7865 | -73.9043 | -66.5822 | -78.692 | -74.9799 | -77.8985 | -69.1964 | QC'd by NIH Chemical Genomics Center (NCGC) | |||||||||||||||||||
| Inhibitor | 3.0131 | 74.5196 | 85 | Complete curve; high efficacy | -5.521 | 1.2475 | 0.976 | -90.5995 | -16.08 | -1.1 | 0 0 0 0 0 0 0 0 | -88.471 | -25.2771 | -12.4556 | -14.1585 | -17.913 | -51.4226 | -73.9001 | -93.7883 | -88.471 | QC'd by Key Organics Ltd. | |||||||||||||||||||
| Inhibitor | 1.6944 | 72.7439 | 85 | Complete curve; high efficacy | -5.771 | 1.6266 | 0.9736 | -86.1149 | -13.3709 | -1.1 | 0 0 0 0 0 0 0 0 | -90.2672 | -16.7468 | -16.0693 | -11.6766 | -14.4415 | -64.3096 | -72.7308 | -87.9452 | -90.2672 | QC'd by Asinex Ltd. | |||||||||||||||||||
| Inhibitor | 0.151 | 140.6456 | 85 | Complete curve; high efficacy | -6.821 | 0.9 | 0.9849 | -44.2164 | -184.862 | -1.1 | 0 0 0 0 0 0 | -53.3465 | -180.1774 | -166.0242 | -127.2248 | -89.878 | -43.6723 | -53.3465 | QC'd by Sytravon | |||||||||||||||||||||
| Inhibitor | 2.4782 | 71.9197 | 85 | Complete curve; high efficacy | -5.6059 | 1.21 | 0.9515 | -90.347 | -18.4273 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -92.3794 | -29.4176 | -25.4576 | -10.6267 | -18.3361 | -13.1226 | -18.0422 | -51.5862 | -63.4387 | -81.7748 | -84.6589 | -92.3794 | QC'd by Microsource | ||||||||||||||||
| Inhibitor | 2.6855 | 76.2541 | 85 | Complete curve; high efficacy | -5.571 | 1.5095 | 0.9645 | -93.4891 | -17.235 | -1.1 | 0 0 0 0 0 0 0 0 | -83.3595 | -19.1979 | -15.5958 | -20.1946 | -17.5552 | -53.8059 | -81.8551 | -105.9967 | -83.3595 | QC'd by Specs | |||||||||||||||||||
| Inhibitor | 3.0131 | 93.5998 | 85 | Complete curve; high efficacy | -5.521 | 4.095 | 0.9841 | -106.6274 | -13.0276 | -1.1 | 0 0 0 0 0 0 0 0 | -100.9847 | -15.8586 | -12.6799 | -7.6231 | -13.2588 | -38.4269 | -100.335 | -118.4749 | -100.9847 | QC'd by Chem Div | |||||||||||||||||||
| Inhibitor | 2.2087 | 70.7868 | 85 | Complete curve; high efficacy | -5.6559 | 1.4641 | 0.9882 | -83.9058 | -13.119 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -80.3383 | -14.6034 | -13.7105 | -8.1697 | -17.0327 | -13.9823 | -20.0222 | -32.5347 | -69.34 | -76.772 | -86.3228 | -80.3383 | QC'd by Prestwick Chemical; Inc. | ||||||||||||||||
| Inhibitor | 16.9441 | 355.3528 | 85 | Complete curve; high efficacy | -4.771 | 1.1 | 0.9993 | -356.9435 | -1.5907 | -1.1 | 0 0 0 0 0 0 0 0 | -318.1315 | -3.9948 | -2.9251 | -4.5312 | 0 | -40.0216 | -141.0144 | -284.0357 | -318.1315 | QC'd by Enamine | |||||||||||||||||||
| Inhibitor | 5.3582 | 75.6887 | 84 | Complete curve; high efficacy | -5.271 | 1.1 | 0.986 | -94.241 | -18.5523 | -1.1 | 0 0 0 0 0 0 0 0 | -92.9398 | -25.1237 | -17.5814 | -17.053 | -18.0751 | -44.0369 | -68.5795 | -88.598 | -92.9398 | QC'd by Jeff Aube - Univ. of Kansas - MLI CMLD | |||||||||||||||||||
| Inhibitor | 0.7569 | 135.5837 | 84 | Complete curve; high efficacy | -6.121 | 1.3437 | 0.7835 | -54.4989 | 81.0848 | -1.1 | 1 0 0 0 1 0 0 0 | 0 | 114.0331 | 82.5711 | 72.5433 | 33.2174 | -170.3018 | -49.8526 | -108.2167 | 0 | QC'd by Sergey Kozmin - Univ. of Chicago - MLI CMLD | |||||||||||||||||||
| Inhibitor | 4.7755 | 97.0719 | 84 | Complete curve; high efficacy | -5.321 | 0.8 | 0.9918 | -103.7002 | -6.6283 | -1.1 | 0 0 0 0 0 0 0 0 | -94.1135 | -1.4836 | -13.9984 | -10.0011 | -18.7058 | -41.6061 | -71.5982 | -94.9636 | -94.1135 | QC'd by Key Organics Ltd. | |||||||||||||||||||
| Inhibitor | 3.7933 | 76.1919 | 84 | Complete curve; high efficacy | -5.421 | 1.1 | 0.9724 | -84.3357 | -8.1438 | -1.1 | 0 0 0 0 0 0 0 0 | -80.1829 | 0.3249 | -17.896 | -10.6249 | -19.5352 | -32.7938 | -69.8932 | -81.1131 | -80.1829 | QC'd by ChemBridge | |||||||||||||||||||
| Inhibitor | 3.0131 | 69.4925 | 84 | Complete curve; high efficacy | -5.521 | 1.5579 | 0.9812 | -74.2039 | -4.7114 | -1.1 | 0 0 0 0 0 0 0 0 | -65.987 | -5.0213 | -5.2016 | -3.1865 | -8.3924 | -32.9126 | -65.2042 | -82.0627 | -65.987 | QC'd by Asinex Ltd. |
| HTRF-Ratio_Avg.NPI | HTRF-Ch1_A | HTRF-Ch2_A | HTRF-Ratio_A | HTRF-Ch1_B | HTRF-Ch2_B | HTRF-Ratio_B | HTRF-Ratio_Avg |
|---|---|---|---|---|---|---|---|
| 2.3 | 17638 | 7444 | 23694 | 17895 | 7063 | 25336 | 24515 |
| 4.8 | 17347 | 7312 | 23724 | 17257 | 7071 | 24405 | 24064.5 |
| 4.2 | 17868 | 7517 | 23770 | 18158 | 7395 | 24554 | 24162 |
| 17.3 | 11844 | 7012 | 16891 | 13204 | 6392 | 20657 | 18774 |
| 6.6 | 12258 | 6577 | 18638 | 14321 | 6502 | 22026 | 20332 |
| 18.1 | 11561 | 6789 | 17029 | 13512 | 6666 | 20270 | 18649.5 |
| -3.9 | 11113 | 5694 | 19517 | 11959 | 4942 | 24199 | 21858 |
| 10.3 | 12215 | 6757 | 18078 | 13988 | 6506 | 21500 | 19789 |
| -20.7 | 10425 | 4592 | 22703 | 11876 | 4585 | 25902 | 24302.5 |
| 14.4 | 12356 | 6766 | 18262 | 13858 | 6888 | 20119 | 19190.5 |
| 5.8 | 12868 | 6545 | 19661 | 14017 | 6600 | 21238 | 20449.5 |
| 15.8 | 12205 | 6703 | 18208 | 13470 | 6818 | 19757 | 18982.5 |
| 3.2 | 11742 | 5785 | 20297 | 12927 | 6054 | 21353 | 20825 |
| 10.3 | 12241 | 6415 | 19082 | 13490 | 6587 | 20480 | 19781 |
| -2.3 | 10948 | 5353 | 20452 | 12530 | 5499 | 22786 | 21619 |
| 9.1 | 12644 | 6696 | 18883 | 13920 | 6620 | 21027 | 19955 |
| 8.7 | 13443 | 7082 | 18982 | 14453 | 6863 | 21059 | 20020.5 |
| -27 | 10044 | 4376 | 22952 | 11409 | 4149 | 27498 | 25225 |
| 10 | 11550 | 6340 | 18218 | 13279 | 6196 | 21432 | 19825 |
| 3.7 | 10765 | 5590 | 19258 | 12467 | 5606 | 22239 | 20748.5 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0008905393 uM | Activity at 0.00133 uM | Activity at 0.00260 uM | Activity at 0.00423 uM | Activity at 0.00779 uM | Activity at 0.011 uM | Activity at 0.023 uM | Activity at 0.033 uM | Activity at 0.070 uM | Activity at 0.092 uM | Activity at 0.148 uM | Activity at 0.213 uM | Activity at 0.447 uM | Activity at 0.637 uM | Activity at 1.271 uM | Activity at 1.910 uM | Activity at 3.487 uM | Activity at 5.719 uM | Activity at 10.47 uM | Activity at 17.11 uM | Activity at 29.50 uM | Activity at 51.33 uM | Activity at 83.79 uM | Activity at 153.7 uM | Activity at 271.3 uM | Activity at 313.8 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 112.2018 | 7915.679 | 100 | Partial curve; partial efficacy | -3.95 | 4.9549 | 0.974 | 7782.4016 | -133.2774 | 2.2 | 0 0 0 0 0 0 0 0 | 6550.8431 | 5.0383 | 1.4327 | -1.8529 | -0.749 | -1.2828 | -0.8048 | -0.2208 | 6550.8431 | QC'd by Asinex Ltd. | |||||||||||||||||||
| Activator | 112.2018 | 19185.7415 | 100 | Partial curve; partial efficacy | -3.95 | 4.9549 | 0.9741 | 18856.4676 | -329.2738 | 2.2 | 0 0 0 0 0 0 0 0 | 15872.4475 | -8.7565 | -6.4408 | 0.7001 | -5.8905 | -4.8567 | -9.6925 | -5.1865 | 15872.4475 | QC'd by UrkORgSynthesis Ltd | |||||||||||||||||||
| Activator | 112.2018 | 2376.3081 | 100 | Partial curve; partial efficacy | -3.95 | 4.5045 | 0.9633 | 2450.5257 | 74.2175 | 2.2 | 0 0 0 0 0 0 0 0 | 1992.2973 | -3.5317 | -4.7193 | 54.5184 | 28.6317 | 18.0366 | 392.2696 | 419.7454 | 1992.2973 | QC'd by ChemBridge | |||||||||||||||||||
| Activator | 100 | 5725.9134 | 100 | Partial curve; partial efficacy | -4 | 4.045 | 0.9954 | 5798.942 | 73.0286 | 2.2 | 0 0 0 0 0 0 0 0 | 4931.0731 | 0.8803 | 0.5649 | -0.7911 | 3.8185 | 42.4751 | 348.6751 | 1565.7548 | 4931.0731 | QC'd by NCI Chemotherapeutic Agents Repository | |||||||||||||||||||
| Activator | 15.8489 | 881.2232 | 93 | Complete curve; high efficacy | -4.8 | 2.2526 | 0.9634 | 878.8998 | -2.3234 | 1.1 | 0 0 0 0 0 0 0 0 | 728.8831 | -4.2226 | -4.7068 | -6.1137 | -1.0929 | 20.5614 | 426.6125 | 996.485 | 728.8831 | QC'd by Asinex Ltd. | |||||||||||||||||||
| Activator | 100 | 1997.1382 | 90 | Partial curve; high efficacy | -4 | 4.045 | 0.9983 | 2014.3209 | 17.1826 | 2.1 | 0 0 0 0 0 0 0 0 | 1721.6418 | 3.4525 | 3.378 | 3.9823 | 9.3476 | 32.2065 | 71.663 | 507.9293 | 1721.6418 | QC'd by Asinex Ltd. | |||||||||||||||||||
| Activator | 7.9433 | 108.3653 | 83 | Complete curve; high efficacy | -5.1 | 1.21 | 0.9975 | 113.1273 | 4.762 | 1.1 | 0 0 0 0 0 0 0 0 | 108.9859 | 5.3988 | 3.1641 | 3.6828 | 13.9146 | 28.6189 | 79.4348 | 108.9185 | 108.9859 | QC'd by Sigma Chemical Company | |||||||||||||||||||
| Activator | 25.1189 | 97.5277 | 81 | Complete curve; high efficacy | -4.6 | 1.9673 | 0.9962 | 100.5707 | 3.043 | 1.1 | 0 0 0 0 0 0 0 0 | 95.2374 | 6.1891 | 3.7946 | 0.6673 | 2.3461 | 4.2715 | 27.8734 | 94.9565 | 95.2374 | QC'd by InterBioScreen | |||||||||||||||||||
| Activator | 25.0638 | 66.3237 | 80 | Complete curve; high efficacy | -4.601 | 1.9673 | 0.9714 | 68.9031 | 2.5794 | 1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 62.2861 | 3.0694 | -0.8446 | 0.6548 | 0.8398 | 3.196 | 1.329 | 8.8431 | 9.8094 | 19.5142 | 63.2257 | 62.2861 | QC'd by Labotest | ||||||||||||||||
| Activator | 31.6228 | 320.5034 | 80 | Complete curve; high efficacy | -4.5 | 3.1925 | 0.9981 | 307.6914 | -12.812 | 1.1 | 0 0 0 0 0 0 0 0 | 307.0772 | -15.3847 | -10.2656 | -16.2349 | -18.8242 | 1.5755 | 14.2479 | 288.2493 | 307.0772 | QC'd by Asinex Ltd. | |||||||||||||||||||
| Activator | 100 | 1250.3151 | 72 | Partial curve; high efficacy | -4 | 3.2975 | 0.9891 | 1276.0835 | 25.7685 | 2.1 | 0 0 0 0 0 0 0 0 | 1037.4663 | 6.7624 | 6.9493 | 6.7276 | 9.5847 | 24.545 | 121.6531 | 390.6169 | 1037.4663 | QC'd by Enamine | |||||||||||||||||||
| Activator | 112.2018 | 1092.6255 | 71 | Partial curve; high efficacy | -3.95 | 4.9549 | 0.9966 | 1125.0573 | 32.4318 | 2.1 | 0 0 0 0 0 0 0 0 | 942.2591 | 60.5087 | 46.3912 | 41.2663 | 36.1932 | 23.2191 | 15.6355 | 148.326 | 942.2591 | QC'd by Chem Div | |||||||||||||||||||
| Activator | 112.2018 | 1105.2997 | 70 | Partial curve; high efficacy | -3.95 | 4.5045 | 0.9998 | 1105.0358 | -0.2639 | 2.1 | 0 0 0 0 0 0 0 0 | 894.0419 | 1.4284 | -3.389 | -3.9616 | -0.1864 | 0.7724 | 6.7469 | 165.5024 | 894.0419 | QC'd by Chem Div | |||||||||||||||||||
| Activator | 100 | 1065.593 | 68 | Partial curve; high efficacy | -4 | 2.9523 | 0.9515 | 1111.0006 | 45.4076 | 2.1 | 0 0 0 0 0 0 0 0 | 881.7465 | -2.6974 | -2.1437 | 0.9503 | 6.9385 | 71.8385 | 203.0705 | 370.0237 | 881.7465 | QC'd by ChemBridge | |||||||||||||||||||
| Activator | 100 | 908.1597 | 63 | Partial curve; high efficacy | -4 | 2.3031 | 0.984 | 930.2328 | 22.0731 | 2.1 | 0 0 0 0 0 0 0 0 | 707.9397 | -2.3217 | -0.4363 | -1.256 | 2.3502 | 33.6888 | 101.7463 | 350.2479 | 707.9397 | QC'd by InterBioScreen | |||||||||||||||||||
| Activator | 112.2018 | 806.0599 | 62 | Partial curve; high efficacy | -3.95 | 4.9549 | 0.9966 | 816.2016 | 10.1417 | 2.1 | 0 0 0 0 0 0 0 0 | 676.784 | 1.2715 | 3.3965 | 0.6738 | 5.3915 | 7.0921 | 42.5928 | 122.1389 | 676.784 | QC'd by NCI Chemotherapeutic Agents Repository | |||||||||||||||||||
| Activator | 112.2018 | 783.7924 | 62 | Partial curve; high efficacy | -3.95 | 4.9549 | 0.9997 | 789.9311 | 6.1387 | 2.1 | 0 0 0 0 0 0 0 0 | 655.0009 | 7.2057 | 7.6589 | 2.2588 | -0.3456 | 4.7899 | 11.3778 | 112.2218 | 655.0009 | QC'd by Maybridge | |||||||||||||||||||
| Activator | 100 | 816.1621 | 61 | Partial curve; high efficacy | -4 | 3.2475 | 0.987 | 832.4554 | 16.2933 | 2.1 | 0 0 0 0 0 0 0 0 | 673.5076 | -6.2485 | 1.8467 | 0.2586 | 3.8523 | 14.6827 | 81.096 | 254.4096 | 673.5076 | QC'd by TimTec | |||||||||||||||||||
| Activator | 100 | 704.5917 | 58 | Partial curve; high efficacy | -4 | 3.2475 | 0.9989 | 709.3423 | 4.7506 | 2.1 | 0 0 0 0 0 0 0 0 | 571.1291 | 0.7768 | -0.8073 | -0.5195 | 2.8471 | 7.8694 | 21.5244 | 216.3485 | 571.1291 | QC'd by Chem Div | |||||||||||||||||||
| Activator | 100 | 588.6904 | 55 | Partial curve; high efficacy | -4 | 4.9549 | 0.9978 | 589.4841 | 0.7937 | 2.1 | 0 0 0 0 0 0 0 0 | 528.2116 | -8.0271 | -8.2801 | -5.8459 | -1.2817 | 0.2612 | 18.8362 | 129.6249 | 528.2116 | QC'd by Specs |
| Standard Type | PubChem Standard Value | IC50 | Target Accession(s) | Ligand | Target |
|---|---|---|---|---|---|
| IC50 | 1.6 | 1600 | P11309 | BDBM7459 | Serine/threonine-protein kinase pim-1 |
| IC50 | 1.1 | 1100 | P11309 | BDBM7460 | Serine/threonine-protein kinase pim-1 |
| IC50 | 15 | 15000 | P11309 | BDBM7461 | Serine/threonine-protein kinase pim-1 |
| IC50 | 1.3 | 1300 | P11309 | BDBM7462 | Serine/threonine-protein kinase pim-1 |
| IC50 | 0.78 | 780 | P11309 | BDBM15236 | Serine/threonine-protein kinase pim-1 |
| IC50 | 0.34 | 340 | P11309 | BDBM23408 | Serine/threonine-protein kinase pim-1 |
| IC50 | 0.43 | 430 | P11309 | BDBM26655 | Serine/threonine-protein kinase pim-1 |
| IC50 | 0.65 | 650 | P11309 | BDBM26656 | Serine/threonine-protein kinase pim-1 |
| IC50 | 0.98 | 980 | P11309 | BDBM26657 | Serine/threonine-protein kinase pim-1 |
| IC50 | 2.7 | 2700 | P11309 | BDBM26658 | Serine/threonine-protein kinase pim-1 |
| IC50 | 4.52 | 4520 | P11309 | BDBM26659 | Serine/threonine-protein kinase pim-1 |
| IC50 | 4.6 | 4600 | P11309 | BDBM26660 | Serine/threonine-protein kinase pim-1 |
| IC50 | 7.8 | 7800 | P11309 | BDBM26661 | Serine/threonine-protein kinase pim-1 |
| IC50 | 8.3 | 8300 | P11309 | BDBM26662 | Serine/threonine-protein kinase pim-1 |
| IC50 | 12.5 | 12500 | P11309 | BDBM26663 | Serine/threonine-protein kinase pim-1 |
| IC50 | 22 | 22000 | P11309 | BDBM26665 | Serine/threonine-protein kinase pim-1 |
| IC50 | 60.2 | 60200 | P11309 | BDBM26666 | Serine/threonine-protein kinase pim-1 |
| IC50 | 107 | 107000 | P11309 | BDBM26667 | Serine/threonine-protein kinase pim-1 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00123 uM | Activity at 0.00246 uM | Activity at 0.00610 uM | Activity at 0.00630 uM | Activity at 0.011 uM | Activity at 0.025 uM | Activity at 0.045 uM | Activity at 0.067 uM | Activity at 0.120 uM | Activity at 0.202 uM | Activity at 0.314 uM | Activity at 0.611 uM | Activity at 1.089 uM | Activity at 1.568 uM | Activity at 3.058 uM | Activity at 5.503 uM | Activity at 7.834 uM | Activity at 15.29 uM | Activity at 27.41 uM | Activity at 39.61 uM | Activity at 75.76 uM | Activity at 149.6 uM | Activity at 201.4 uM | Activity at 319.7 uM | Activity at 605.8 uM | Activity at 817.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 4.9549 | 0.8563 | -9.9979 | -3.182 | 4 | 0 0 0 0 0 0 | -8.823 | -2.9167 | -5.5515 | -1.8183 | -11.2482 | -10.2408 | -8.823 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 1.5386 | 0.564 | 4 | -4.8546 | 4 | 0 0 0 0 0 1 | -7.5471 | -0.6835 | -9.0455 | -3.7039 | -1.1903 | 3.153 | -7.5471 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.431 | -21.0949 | 2.1993 | 4 | 0 0 0 0 0 0 | -29.6624 | -1.0839 | -27.7771 | -29.2982 | -9.5254 | -9.846 | -29.6624 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.3341 | -1.3603 | -6.9124 | 4 | 0 0 0 0 0 1 | -15.5699 | -9.927 | -2.5767 | -5.8552 | -8.5221 | -2.3836 | -15.5699 | QC'd by Microsource | |||||||||||||||||||||||||
| Inhibitor | 0.8913 | 14.1351 | 0 | Complete curve; partial efficacy; poor fit | -6.05 | 2.1211 | 0.6534 | -22.6728 | -8.5377 | -1.4 | 0 0 0 0 0 0 | -21.1521 | -8.7814 | -12.9514 | -21.2535 | -30.9774 | -17.0722 | -21.1521 | QC'd by Microsource | |||||||||||||||||||||
| Inactive | 0 | 3.132 | 0.4725 | 0.5 | -4.2284 | 4 | 0 0 0 0 0 0 | -0.2612 | -1.9763 | -2.0592 | -8.107 | -2.1288 | 0.8201 | -0.2612 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.4917 | -10.967 | -2.3149 | 4 | 0 0 0 0 0 0 | -10.1405 | -1.5124 | -2.5506 | -5.4129 | -17.8892 | -4.0897 | -10.1405 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 3.99 | 0.5924 | -19.9348 | 0 | 4 | 0 0 0 0 0 0 | -28.6957 | -6.2302 | 5.7918 | -15.0449 | -23.6413 | -7.309 | -28.6957 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.4102 | -6.1308 | 5 | 4 | 0 0 0 0 0 0 | -4.355 | 0.8289 | 8.6021 | -2.8349 | -16.359 | 2.161 | -4.355 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.369 | -1.5 | -14.3369 | 4 | 0 0 0 0 0 1 | -9.3021 | -12.7808 | 2.0015 | -0.2528 | -12.5875 | 4.4401 | -9.3021 | QC'd by Microsource | |||||||||||||||||||||||||
| Inhibitor | 0.7079 | 23.6221 | 0 | Complete curve; partial efficacy; poor fit | -6.15 | 3.0654 | 0.6513 | -24.5288 | -0.9067 | -1.4 | 0 0 0 0 0 1 | -13.9864 | -1.5889 | -9.6741 | -27.4469 | -33.3677 | -12.1786 | -13.9864 | QC'd by Microsource | |||||||||||||||||||||
| Inactive | 0 | 4 | -22.4775 | -11.6889 | -11.6628 | -13.5576 | -20.9035 | -8.6191 | -22.4775 | QC'd by Microsource | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0.8 | 0.7088 | -25.4933 | -11.6918 | 4 | 0 0 0 0 0 0 | -24.5778 | -16.5266 | -8.0765 | -17.2318 | -20.0221 | -22.1348 | -24.5778 | QC'd by Microsource | |||||||||||||||||||||||||
| Inhibitor | 0.1778 | 19.9985 | 0 | Complete curve; partial efficacy; poor fit | -6.75 | 4.9549 | 0.6578 | -21.9347 | -1.9361 | -1.4 | 0 0 0 0 0 0 | -23.6561 | -4.5301 | -30.7789 | -20.7284 | -19.2667 | -15.4849 | -23.6561 | QC'd by Microsource | |||||||||||||||||||||
| Inactive | 0 | 1 | 0.9184 | -24.9585 | -2.7331 | 4 | 0 0 0 0 0 1 | -15.8401 | -9.7776 | -20.4013 | -20.4952 | -26.2154 | -25.1202 | -15.8401 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4 | -16.8662 | -15.0798 | -16.9114 | -17.163 | -13.1564 | -16.5558 | -16.8662 | QC'd by Microsource | ||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | 7.7575 | 3.3126 | 6.1383 | 6.2047 | -2.0209 | 6.2212 | 7.7575 | QC'd by Microsource | ||||||||||||||||||||||||||||||
| Inactive | 0 | 4 | 3.7597 | 9.7909 | 7.0224 | 3.0975 | -6.8965 | 12.3146 | 3.7597 | QC'd by Microsource | ||||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6335 | -4.9129 | 6 | 4 | 0 0 0 0 0 0 | -8.8467 | 6.1191 | 5.3496 | 5.0731 | -9.0941 | 2.984 | -8.8467 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7097 | -7.2734 | 0 | 4 | 0 0 0 0 0 0 | -5.915 | 1.1538 | -1.0587 | 0.2688 | -11.4778 | -4.1213 | -5.915 | QC'd by Microsource |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0009200000 uM | Activity at 0.00184 uM | Activity at 0.00456 uM | Activity at 0.00471 uM | Activity at 0.00850 uM | Activity at 0.018 uM | Activity at 0.034 uM | Activity at 0.050 uM | Activity at 0.090 uM | Activity at 0.151 uM | Activity at 0.235 uM | Activity at 0.457 uM | Activity at 0.814 uM | Activity at 1.171 uM | Activity at 2.284 uM | Activity at 4.113 uM | Activity at 5.853 uM | Activity at 11.42 uM | Activity at 20.49 uM | Activity at 29.59 uM | Activity at 56.64 uM | Activity at 111.7 uM | Activity at 150.6 uM | Activity at 238.8 uM | Activity at 452.6 uM | Activity at 611.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 3.6272 | 0.8626 | -16.9749 | 3 | 4 | 0 0 0 0 0 0 | -11.3522 | 4.4122 | -0.1869 | 3.8551 | -9.0486 | -22.4791 | -11.3522 | QC'd by SigmaAldrich | |||||||||||||||||||||||||
| Inactive | 0 | 1.21 | 0.9115 | 1 | 26.5 | 4 | 0 0 0 0 0 0 | 3.0879 | 22.5222 | 31.9661 | 22.8496 | 17.2717 | 6.5589 | 3.0879 | QC'd by NCI | |||||||||||||||||||||||||
| Inactive | 0 | 0.3 | 0.7243 | -12.8995 | 38 | 4 | 0 0 0 0 0 0 | -10.7496 | 28.5168 | 21.9546 | 5.2096 | 6.0738 | 11.3009 | -10.7496 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.8029 | -15.6993 | -1.5 | 4 | 0 0 0 0 0 0 | -11.416 | -1.5504 | -1.249 | -4.6581 | -0.4266 | 0.4639 | -11.416 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6678 | -24.4602 | 3.4359 | 4 | 0 0 0 0 0 1 | -5.4651 | 2.872 | 2.434 | -38.4104 | -25.2406 | -9.2436 | -5.4651 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 2.4064 | 0.4215 | 1 | 17 | 4 | 0 0 0 0 0 0 | 5.8729 | 19.3202 | 14.8828 | 8.6332 | 24.907 | 11.2979 | 5.8729 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 0.6 | 0.7078 | -8.3138 | 14.5 | 4 | 0 0 0 0 0 0 | -10.7777 | 11.8187 | 1.9932 | 1.9062 | -11.5115 | -0.0866 | -10.7777 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 3.99 | 0.916 | 12.5 | 29 | 4 | 0 0 0 0 0 0 | 11.3216 | 25.3511 | 10.2782 | 12.6928 | 12.0425 | 15.0596 | 11.3216 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.7598 | -8.0307 | 2 | 4 | 0 0 0 0 0 0 | -6.9632 | -1.9133 | 5.8317 | -9.609 | -8.7246 | -6.018 | -6.9632 | QC'd by SigmaAldrich | |||||||||||||||||||||||||
| Inactive | 0 | 0.7 | 0.6402 | -18.8089 | -2.3735 | 4 | 0 0 0 0 0 0 | -14.8407 | -3.9662 | -6.7181 | -0.3112 | -9.968 | -9.2615 | -14.8407 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.9739 | -11.7501 | 2 | 4 | 0 0 0 0 0 0 | -11.6929 | 3.078 | 0.2437 | 2.2683 | -12.7084 | -10.568 | -11.6929 | QC'd by Microsource | |||||||||||||||||||||||||
| Inactive | 0 | 0.5 | 0.7605 | -11.0605 | 6 | 4 | 0 0 0 0 0 0 | -14.6337 | 3.6876 | -3.5123 | -6.8473 | -7.5675 | -5.2666 | -14.6337 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 4 | -7.53 | 4.7778 | -6.7829 | -15.1322 | -23.649 | 9.0847 | -7.53 | QC'd by Prestwick Chemical; Inc. | ||||||||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.6409 | -3.2949 | 14 | 4 | 0 0 0 0 0 1 | 12.9818 | 17.651 | 4.102 | 20.6219 | 2.497 | -3.5791 | 12.9818 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 1.8265 | 0.7407 | -32.7287 | -10.9373 | 4 | 0 0 0 0 0 0 | -28.3802 | -13.7631 | -19.1044 | -5.7811 | -12.8137 | -32.2739 | -28.3802 | QC'd by Tocris | |||||||||||||||||||||||||
| Activator | 39.8107 | 46.538 | 0 | Single point of activity | -4.4 | 4.4495 | 0.7454 | 56.6458 | 10.1078 | 3 | 0 0 0 0 0 1 | 17.1415 | 13.5032 | 25.5832 | 14.464 | 6.9538 | 49.1102 | 17.1415 | QC'd by SigmaAldrich | |||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.5359 | -17.7206 | 3.5 | 4 | 0 0 0 0 0 0 | -16.8505 | -6.866 | 13.1002 | -5.4009 | 12.3928 | -11.0619 | -16.8505 | QC'd by SigmaAldrich | |||||||||||||||||||||||||
| Inactive | 0 | 4.9549 | 0.657 | 1.1082 | 10.5 | 4 | 0 0 0 0 0 1 | 10.7172 | 11.3518 | 5.1253 | 15.2488 | -0.3265 | 2.2476 | 10.7172 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||||||||||||
| Inactive | 0 | 0.7 | 0.842 | -14.4407 | 10.5 | 4 | 0 0 0 0 0 0 | -8.7006 | 13.0238 | 6.2792 | 7.2892 | 3.5691 | 0.9878 | -8.7006 | QC'd by BIOMOL | |||||||||||||||||||||||||
| Inactive | 0 | 1.01 | 0.8718 | 2.4065 | -26.9475 | 4 | 0 0 0 0 0 1 | -20.1909 | -25.9748 | -30.373 | -20.9376 | -21.2882 | -7.9946 | -20.1909 | QC'd by Prestwick Chemical; Inc. |
| Phenotype | Potency | Efficacy | Analysis Comment | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003270000 uM | Activity at 0.0007732774 uM | Activity at 0.00163 uM | Activity at 0.00369 uM | Activity at 0.00818 uM | Activity at 0.020 uM | Activity at 0.030 uM | Activity at 0.047 uM | Activity at 0.101 uM | Activity at 0.151 uM | Activity at 0.243 uM | Activity at 0.477 uM | Activity at 0.759 uM | Activity at 1.287 uM | Activity at 2.393 uM | Activity at 3.818 uM | Activity at 6.336 uM | Activity at 11.99 uM | Activity at 19.37 uM | Activity at 31.37 uM | Activity at 60.11 uM | Activity at 107.2 uM | Activity at 158.4 uM | Activity at 229.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 4 | 0 0 0 0 0 | 1.4694 | -3.5669 | -6.235 | 2.8586 | 1.8042 | 1.4694 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -4.2631 | 8.2218 | 8.0811 | 10.2927 | -3.9947 | -4.2631 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 6.0369 | 0.3398 | -2.1048 | -8.1695 | -3.6822 | 6.0369 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | -2.0565 | 1.7294 | -3.5894 | -1.2575 | -0.5402 | -2.0565 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | 2.3149 | 1.0048 | 4.6369 | -1.9963 | -3.3543 | 2.3149 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 7.2748 | 7.1515 | 6.1372 | 1.5197 | 5.2332 | 7.2748 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 1.006 | -3.3873 | -7.786 | -9.3037 | -9.1761 | 1.006 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -0.0368 | -9.4458 | -10.5155 | -9.0065 | -12.9141 | -0.0368 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 2.6 | -7.8084 | -12.3007 | -2.0954 | -6.6887 | 2.6 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -11.4867 | -18.9051 | -17.4955 | -19.0735 | -9.6682 | -11.4867 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | -7.5605 | -17.2173 | -11.0038 | -16.5656 | -22.4025 | -7.5605 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | -7.5451 | -1.1939 | -1.3084 | -5.8268 | -5.3206 | -7.5451 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -5.5852 | -4.3753 | -1.0046 | -3.1641 | -10.1524 | -5.5852 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 0 | 1.1172 | -6.0391 | 7.0118 | 9.0446 | 1.6533 | 1.1172 | QC'd by "Chem Div" | ||||||||||||||||||||||||||||
| Inactive | 4 | 2.3359 | 1.2518 | 1.6626 | -0.9325 | -0.9194 | 2.3359 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 | -19.5354 | 0.3984 | -4.1147 | 2.1883 | -19.5354 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | -5.6552 | -4.6769 | -1.9378 | -0.5867 | -3.224 | -5.6552 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | -11.3738 | -10.4148 | -13.8912 | -10.4252 | -7.8961 | -11.3738 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | -6.1571 | -8.7102 | -2.9113 | -5.2229 | -3.4369 | -6.1571 | QC'd by "Chem Div" | |||||||||||||||||||||||||||||
| Inactive | 4 | 0 0 0 0 1 | -7.3803 | -8.8177 | -11.1654 | -6.5301 | -15.9483 | -7.3803 | QC'd by "Chem Div" |
| Activation at 11.2 uM |
|---|
| 25.9791 |
| 24.6001 |
| 23.5536 |
| 22.7312 |
| 22.7177 |
| 22.1764 |
| 22.1331 |
| 21.3196 |
| 20.9399 |
| 20.5357 |
| 19.9724 |
| 19.7958 |
| 19.6966 |
| 19.0437 |
| 18.6511 |
| 18.5926 |
| 18.5486 |
| 18.5244 |
| 18.4073 |
| 18.3393 |
| Fluorescence Polarization | Total Intensity | Z-score_FP | Z-score_Total Intensity | % Elongation_FP | % Elongation_Total Intensity | Fluorogenic |
|---|---|---|---|---|---|---|
| 256.7 | 36080052 | -0.1 | 0.3 | 102 | 113 | |
| 255.7 | 36170657 | -0.3 | 0.3 | 101 | 113 | |
| 256.9 | 35420114 | -0.1 | -0.3 | 102 | 107 | |
| 255.2 | 35741699 | -0.4 | 0 | 100 | 110 | |
| 257.5 | 35227125 | 0 | -0.5 | 103 | 105 | |
| 256.6 | 35252352 | -0.2 | -0.5 | 102 | 105 | |
| 259 | 35849065 | 0.3 | 0.1 | 105 | 111 | |
| 261 | 35903311 | 0.7 | 0.1 | 107 | 111 | |
| 259.7 | 35971169 | 0.5 | 0.2 | 106 | 112 | |
| 260.5 | 36236704 | 0.6 | 0.4 | 107 | 114 | |
| 257.4 | 36144089 | 0 | 0.3 | 103 | 113 | |
| 260.7 | 36158205 | 0.6 | 0.3 | 107 | 113 | |
| 260.4 | 36254981 | 0.6 | 0.4 | 107 | 114 | |
| 261.8 | 36799901 | 0.9 | 0.9 | 108 | 119 | |
| 257.7 | 36498125 | 0.1 | 0.6 | 103 | 116 | |
| 255.9 | 35232080 | -0.3 | -0.5 | 101 | 105 | |
| 256.8 | 35726936 | -0.1 | 0 | 102 | 110 | |
| 257.9 | 36378227 | 0.1 | 0.5 | 104 | 115 | |
| 258.7 | 36309511 | 0.3 | 0.5 | 105 | 115 | |
| 256.8 | 36098037 | -0.1 | 0.3 | 102 | 113 |
| Inhibition at 26.1 uM |
|---|
| 1.22 |
| 1.22 |
| 1.22 |
| 1.22 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| 1.21 |
| Inhibition at 2.6 uM |
|---|
| 127.19 |
| 125.38 |
| 123.56 |
| 122.83 |
| 122.83 |
| 121.76 |
| 121.66 |
| 121.6 |
| 121.5 |
| 121.39 |
| 121.22 |
| 119.02 |
| 116.83 |
| 116.33 |
| 115.89 |
| 115.77 |
| 115.42 |
| 114.27 |
| 114.13 |
| 114.01 |