| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000386857 uM | Activity at 0.0001060182 uM | Activity at 0.0001896372 uM | Activity at 0.0004510146 uM | Activity at 0.0007501981 uM | Activity at 0.0009728036 uM | Activity at 0.00288 uM | Activity at 0.00508 uM | Activity at 0.00871 uM | Activity at 0.015 uM | Activity at 0.026 uM | Activity at 0.053 uM | Activity at 0.079 uM | Activity at 0.232 uM | Activity at 0.457 uM | Activity at 0.692 uM | Activity at 1.068 uM | Activity at 2.292 uM | Activity at 3.859 uM | Activity at 11.39 uM | Activity at 17.02 uM | Activity at 25.62 uM | Activity at 57.25 uM | Activity at 87.55 uM | Activity at 183.4 uM | Activity at 286.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6.75 | 4.9549 | 0.9727 | 0.0901 | 17.5 | 4 | 0 0 0 1 | 8.9408 | 15.9527 | -1.5916 | 1.4969 | 8.9408 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.3 | 4.095 | 0.9996 | 5.5 | -7.7823 | 4 | 0 0 0 1 | -11.1081 | -7.5736 | -7.7353 | 5.034 | -11.1081 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.15 | 4.9549 | 0.907 | -15.9207 | 9.5 | 4 | 0 0 0 1 | 17.8725 | 5.2874 | 13.9021 | -13.6839 | 17.8725 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 35.4813 | 46.4095 | 0 | Single point of activity | -4.45 | 2.5884 | 1 | 45.9404 | -0.4691 | 3 | 1 0 0 0 | 35.593 | 40.1678 | -0.3909 | 1.933 | 35.593 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 39.8107 | 72.2646 | 0 | Single point of activity | -4.4 | 4.9549 | 0.9515 | 68.1912 | -4.0733 | 3 | 0 0 0 0 | 58.0117 | 5.8738 | -9.2278 | -8.5224 | 58.0117 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 14.1254 | 45.3319 | 0 | Partial curve; partial efficacy; poor fit | -4.85 | 2.4064 | 0.9982 | 40.7728 | -4.5591 | 2.4 | 1 0 0 0 | 40.0933 | -24.9557 | -3.8845 | 11.5254 | 40.0933 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -5.75 | 4.9549 | 0.9291 | -20.6086 | 33.1545 | 4 | 1 0 0 0 | -12.8464 | 45.4569 | 28.2161 | -28.42 | -12.8464 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.35 | 4.9549 | 0.855 | -24.2184 | -0.5 | 4 | 0 0 0 0 | -18.932 | -3.6477 | -2.409 | 4.988 | -18.932 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 3.6272 | 0.8625 | 15 | -8.5523 | 4 | 0 0 0 0 | 14.477 | -2.951 | -13.7936 | -5.9646 | 14.477 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.7 | 4.9549 | 0.6637 | 3 | -16.864 | 4 | 0 0 0 0 | 8.8169 | -15.72 | 6.3794 | -6.3599 | 8.8169 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.75 | 2.4064 | 0.9999 | 21.5 | -2.4101 | 4 | 1 0 0 0 | 20.2184 | 33.3778 | -2.4251 | 3.5771 | 20.2184 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.8117 | 2.5 | -8.345 | 4 | 0 0 0 0 | 1.096 | -8.966 | -5.5054 | -11.1209 | 1.096 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 39.8107 | 38.7945 | 0 | Single point of activity | -4.4 | 4.9549 | 0.6241 | 41.7557 | 2.9612 | 3 | 0 0 0 0 | 36.2039 | 21.355 | -6.3904 | -4.5325 | 36.2039 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -6.05 | 4.095 | 0.9994 | -6.0518 | 20 | 4 | 0 0 0 1 | 20.5156 | 19.7377 | 1.4122 | -6.2932 | 20.5156 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.2 | 4.095 | 1 | 10.5 | -10.1683 | 4 | 1 0 0 1 | -15.9884 | 36.1362 | -10.1402 | 8.7939 | -15.9884 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.5 | 1.3905 | 0.9999 | -24.241 | 0.2745 | 4 | 0 0 0 1 | -5.5981 | -4.3546 | -20.7587 | -23.9509 | -5.5981 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.711 | -2.4459 | 21 | 4 | 0 0 0 0 | -3.3453 | 17.3219 | -9.9549 | 5.5495 | -3.3453 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Activator | 39.8107 | 47.809 | 0 | Partial curve; partial efficacy; poor fit | -4.4 | 4.9549 | 0.5212 | 50.2399 | 2.4309 | 2.4 | 0 0 0 0 | 43.4722 | 30.2363 | -10.9855 | -11.5143 | 43.4722 | QC'd by Sytravon | |||||||||||||||||||||||
| Activator | 22.3872 | 75.5081 | 0 | Partial curve; high efficacy; poor fit | -4.65 | 1.9673 | 0.9829 | 96.5324 | 21.0243 | 2.3 | 0 0 0 0 | 86.4985 | 26.0932 | 16.3365 | 36.2613 | 86.4985 | QC'd by Sytravon | |||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.7429 | -1 | -13.0738 | 4 | 0 0 0 0 | 1.8063 | -11.3115 | 0.8702 | -5.1757 | 1.8063 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0118 | 90.0897 | 87 | Complete curve; high efficacy | -7.9292 | 2.4729 | 0.969 | 42.5966 | 132.6862 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 57.466 | 123.2938 | 140.8388 | 112.241 | 60.9016 | 44.0896 | 39.7677 | 36.4785 | 40.206 | 39.1769 | 41.4618 | 57.466 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.4176 | 75.8509 | 87 | Complete curve; high efficacy | -6.3792 | 1.5386 | 0.9498 | 72.4265 | 148.2774 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 61.5626 | 139.2774 | 158.5971 | 143.0204 | 144.9664 | 147.8567 | 136.0151 | 91.8156 | 92.9505 | 75.6746 | 74.6768 | 61.5626 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.1482 | 94.4192 | 87 | Complete curve; high efficacy | -6.8292 | 1.1 | 0.9517 | 59.4372 | 153.8564 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 55.0456 | 164.8354 | 134.704 | 151.2303 | 143.6834 | 134.7615 | 95.6484 | 70.0621 | 67.3056 | 76.1055 | 55.6924 | 55.0456 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1663 | 94.1023 | 86 | Complete curve; high efficacy | -6.7792 | 2.7202 | 0.9729 | 50.0751 | 144.1775 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 56.0568 | 132.0924 | 142.9387 | 160.1371 | 137.1338 | 142.2899 | 85.8931 | 48.2002 | 45.0417 | 52.6033 | 54.1832 | 56.0568 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.0332 | 121.0752 | 86 | Complete curve; high efficacy | -7.4792 | 1 | 0.9841 | 42.1192 | 163.1944 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 35.7472 | 158.2854 | 158.4708 | 139.505 | 123.3406 | 71.5741 | 65.2589 | 55.0718 | 50.0867 | 42.1782 | 37.1955 | 35.7472 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.7427 | 78.6716 | 85 | Complete curve; high efficacy | -6.1292 | 1.8851 | 0.9834 | 63.6148 | 142.2865 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 58.2475 | 142.1116 | 146.4992 | 135.5304 | 145.8795 | 136.7066 | 141.0466 | 113.8331 | 74.386 | 65.1288 | 71.8868 | 58.2475 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.8333 | 86.2191 | 85 | Complete curve; high efficacy | -6.0792 | 1 | 0.9302 | 67.549 | 153.7681 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 69.8532 | 158.4753 | 142.7847 | 153.7541 | 141.7507 | 166.925 | 141.693 | 105.2958 | 104.6674 | 77.2217 | 76.1652 | 69.8532 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 3.7221 | 64.4935 | 85 | Complete curve; high efficacy | -5.4292 | 4.9549 | 0.792 | 112.0642 | 176.5577 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 89.6942 | 158.9633 | 166.2699 | 180.3984 | 167.1951 | 174.9654 | 191.2964 | 181.3214 | 193.1909 | 122.0222 | 135.5388 | 89.6942 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0526 | 123.2368 | 85 | Complete curve; high efficacy | -7.2792 | 0.6 | 0.9724 | 33.4065 | 156.6433 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 35.7651 | 153.6951 | 126.1364 | 142.4363 | 103.2491 | 92.5951 | 73.1478 | 60.6143 | 43.3887 | 40.0313 | 37.8821 | 35.7651 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0066 | 77.5262 | 84 | Complete curve; high efficacy | -8.1792 | 0.8 | 0.9753 | 21.6969 | 99.2231 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.2627 | 91.552 | 76.4137 | 56.5612 | 42.1934 | 34.0283 | 31.1809 | 27.3506 | 26.0778 | 20.6343 | 20.2144 | 13.2627 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.5258 | 123.4599 | 84 | Complete curve; high efficacy | -6.2792 | 1.3987 | 0.9682 | 42.1223 | 165.5821 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.7016 | 164.86 | 160.7689 | 152.0063 | 170.1205 | 168.2257 | 149.3034 | 88.2138 | 74.0696 | 51.7982 | 49.7901 | 25.7016 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 1.8655 | 82.3759 | 84 | Complete curve; high efficacy | -5.7292 | 2.3332 | 0.9291 | 61.702 | 144.078 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.7606 | 136.01 | 140.2451 | 152.6106 | 148.0124 | 143.6336 | 147.0904 | 134.4052 | 111.2842 | 54.4794 | 84.3712 | 51.7606 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 2.3485 | 101.9247 | 84 | Complete curve; high efficacy | -5.6292 | 0.6 | 0.9558 | 71.9549 | 173.8795 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 91.649 | 176.6761 | 171.0851 | 177.7813 | 159.9071 | 159.3009 | 150.4576 | 153.7054 | 126.8633 | 116.4271 | 84.8154 | 91.649 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0187 | 90.9237 | 84 | Complete curve; high efficacy | -7.7292 | 0.7 | 0.9959 | 26.7347 | 117.6584 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.5723 | 109.5774 | 101.7596 | 83.7496 | 73.3799 | 52.6521 | 41.57 | 35.4354 | 30.2412 | 26.6759 | 25.3877 | 29.5723 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0132 | 127.3735 | 83 | Complete curve; high efficacy | -7.8792 | 0.7 | 0.9722 | 17.3385 | 144.712 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.7384 | 132.8301 | 113.2475 | 89.3417 | 75.7175 | 55.4002 | 27.7414 | 22.1078 | 14.4402 | 14.0116 | 16.7785 | 33.7384 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 3.7221 | 86.0142 | 83 | Complete curve; high efficacy | -5.4292 | 1.21 | 0.9721 | 65.5416 | 151.5558 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 66.7748 | 154.8648 | 146.5307 | 153.6238 | 147.9405 | 153.7843 | 144.2907 | 154.4262 | 119.8728 | 100.2565 | 83.0111 | 66.7748 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.3722 | 105.7898 | 83 | Complete curve; high efficacy | -6.4292 | 2.8473 | 0.984 | 36.148 | 141.9378 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.8052 | 141.9378 | 142.9518 | 145.1156 | 141.0583 | 137.6217 | 130.5085 | 57.9133 | 51.2669 | 41.3882 | 33.0007 | 22.8052 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 1.6626 | 102.3144 | 83 | Complete curve; high efficacy | -5.7792 | 1 | 0.9242 | 40.9668 | 143.2813 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.0105 | 152.3961 | 124.7264 | 140.9824 | 142.6059 | 141.9566 | 147.0368 | 112.3972 | 81.2873 | 85.0891 | 38.4602 | 47.0105 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0118 | 140.013 | 83 | Complete curve; high efficacy | -7.9292 | 2.5884 | 0.9982 | 17.9926 | 158.0057 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.8749 | 156.5885 | 154.4434 | 130.94 | 45.1268 | 15.3104 | 17.3742 | 18.8144 | 19.4156 | 21.1886 | 21.2708 | 14.8749 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4686 | 118.6089 | 83 | Complete curve; high efficacy | -6.3292 | 1.8579 | 0.9872 | 28.1061 | 146.7151 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.0205 | 138.0525 | 155.3457 | 144.6536 | 140.3247 | 148.8544 | 132.2913 | 70.3553 | 46.413 | 33.1335 | 22.0753 | 27.0205 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0166 | 75.7054 | 99 | Complete curve; high efficacy | -7.7792 | 1.6259 | 0.8287 | 113.3664 | 189.0718 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 76.415 | 189.0718 | 184.1323 | 176.4162 | 143.7765 | 121.3848 | 112.8196 | 136.1769 | 124.1622 | 121.4205 | 110.849 | 76.415 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.0148 | 78.3238 | 95 | Complete curve; high efficacy | -7.8292 | 1.8851 | 0.8849 | 90.161 | 168.4848 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 67.4943 | 179.706 | 152.1469 | 156.7226 | 115.951 | 90.8871 | 81.2427 | 94.0684 | 108.6438 | 92.5891 | 100.3562 | 67.4943 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0093 | 193.2895 | 93 | Complete curve; high efficacy | -8.0292 | 0.5 | 0.8666 | 72.6851 | 265.9745 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 105.1458 | 244.5929 | 174.7663 | 172.838 | 154.9069 | 132.1222 | 117.3729 | 90.5899 | 87.8655 | 85.6705 | 30.7772 | 105.1458 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0021 | 162.7839 | 89 | Complete curve; high efficacy | -8.6792 | 2.2526 | 0.9095 | 41.4972 | 204.2812 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.0569 | 187.9512 | 112.2831 | 54.6119 | 32.4006 | 43.042 | 48.5635 | 47.4689 | 74.453 | 40.5481 | 25.5935 | 16.0569 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0037 | 168.1839 | 89 | Complete curve; high efficacy | -8.4292 | 1.9887 | 0.954 | 44.8326 | 213.0165 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.7704 | 206.3802 | 163.4097 | 86.4546 | 36.0223 | 49.8397 | 39.3597 | 43.2938 | 52.6884 | 61.3728 | 57.8548 | 16.7704 | QC'd by Waterstone | |||||||||||||||
| Cytotoxic | 0.0469 | 148.8106 | 89 | Complete curve; high efficacy | -7.3292 | 2.4064 | 0.85 | 61.7336 | 210.5442 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.2046 | 222.3206 | 202.2319 | 203.978 | 192.1974 | 118.2623 | 35.924 | 46.0477 | 60.9187 | 116.7207 | 98.8749 | 8.2046 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0026 | 113.2709 | 89 | Complete curve; high efficacy | -8.5792 | 3.132 | 0.8977 | 42.9988 | 156.2697 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.2361 | 152.3367 | 113.4138 | 40.5936 | 38.1277 | 40.3624 | 43.6023 | 34.1379 | 43.8713 | 64.7368 | 64.0648 | 21.2361 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0017 | 114.4953 | 89 | Complete curve; high efficacy | -8.7792 | 4.095 | 0.8416 | 43.8532 | 158.3484 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.1898 | 152.8039 | 67.852 | 54.5193 | 52.3593 | 57.3458 | 49.824 | 62.0593 | 47.5054 | 30.8367 | 28.4655 | 14.1898 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0026 | 72.7342 | 89 | Complete curve; high efficacy | -8.5792 | 2.7202 | 0.9074 | 41.83 | 114.5643 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 49.3766 | 112.1875 | 83.5951 | 46.535 | 30.9547 | 33.4355 | 32.3129 | 43.2452 | 44.0893 | 44.7978 | 56.0035 | 49.3766 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0743 | 128.2241 | 89 | Complete curve; high efficacy | -7.1292 | 0.3 | 0.8073 | 65.0905 | 193.3146 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 71.5247 | 186.4209 | 158.6743 | 129.1227 | 120.8146 | 138.5824 | 133.4969 | 104.1228 | 120.2992 | 101.9603 | 77.7756 | 71.5247 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0662 | 125.7204 | 89 | Complete curve; high efficacy | -7.1792 | 1.8265 | 0.9719 | 67.5385 | 193.259 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 52.5197 | 186.6163 | 181.5655 | 200.1337 | 192.1342 | 128.2412 | 83.3632 | 87.4098 | 64.6315 | 70.6854 | 65.1161 | 52.5197 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.6619 | 78.2859 | 88 | Complete curve; high efficacy | -6.1792 | 1.8851 | 0.9469 | 96.3016 | 174.5875 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 101.3711 | 171.7651 | 176.8613 | 184.4702 | 181.7039 | 154.2237 | 171.0284 | 143.1726 | 100.5791 | 90.9185 | 104.0348 | 101.3711 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0935 | 125.7312 | 88 | Complete curve; high efficacy | -7.0292 | 3.99 | 0.9702 | 62.9518 | 188.683 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 71.3789 | 173.2237 | 176.4213 | 202.4283 | 200.5745 | 169.0569 | 72.0679 | 47.8354 | 55.5118 | 65.1828 | 73.8404 | 71.3789 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0743 | 119.1274 | 88 | Complete curve; high efficacy | -7.1292 | 0.7 | 0.988 | 58.8412 | 177.9686 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 65.4007 | 172.7284 | 171.0856 | 155.1599 | 146.3776 | 116.5859 | 99.7792 | 91.9843 | 65.4198 | 64.0028 | 56.2793 | 65.4007 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.3317 | 103.9102 | 88 | Complete curve; high efficacy | -6.4792 | 0.3 | 0.8436 | 77.4858 | 181.396 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 101.3477 | 161.302 | 177.473 | 153.8803 | 133.2684 | 139.1275 | 144.3925 | 135.8497 | 117.6086 | 91.5334 | 104.8313 | 101.3477 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.1321 | 123.717 | 88 | Complete curve; high efficacy | -6.8792 | 1 | 0.9623 | 67.9127 | 191.6297 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 45.8939 | 178.5371 | 199.9241 | 184.0193 | 181.5655 | 149.5884 | 112.029 | 94.7629 | 81.7313 | 73.6169 | 83.2052 | 45.8939 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0066 | 144.591 | 88 | Complete curve; high efficacy | -8.1792 | 2.7202 | 0.9318 | 43.5813 | 188.1723 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.9675 | 169.8483 | 200.8523 | 105.2569 | 49.6054 | 42.5185 | 45.3031 | 52.1456 | 50.6329 | 56.7946 | 49.5143 | 7.9675 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.935 | 111.4763 | 87 | Complete curve; high efficacy | -6.0292 | 1.4641 | 0.9072 | 88.9886 | 200.4649 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 65.9282 | 174.089 | 200.6763 | 211.7975 | 212.4609 | 203.6327 | 185.8171 | 171.8065 | 108.7421 | 105.1811 | 115.1818 | 65.9282 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0118 | 148.7473 | 87 | Complete curve; high efficacy | -7.9292 | 1.8851 | 0.9147 | 41.9403 | 190.6876 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.0822 | 198.2962 | 171.9006 | 154.0321 | 74.6922 | 45.6818 | 59.0941 | 62.6281 | 63.4243 | 50.9038 | 13.2956 | 8.0822 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.6626 | 84.6257 | 87 | Complete curve; high efficacy | -5.7792 | 2.7202 | 0.9593 | 106.2986 | 190.9242 | -1.1 | 0 1 0 0 0 0 0 0 0 0 0 | 104.8088 | 197.9176 | 147.6744 | 188.5439 | 182.4788 | 196.4457 | 175.6724 | 199.742 | 148.305 | 107.0547 | 110.4851 | 104.8088 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0418 | 88.8779 | 85 | Complete curve; high efficacy | -7.3792 | 1.21 | 0.839 | 31.4966 | 120.3746 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.7124 | 132.8926 | 100.4487 | 96.9022 | 107.9527 | 67.4229 | 23.2321 | 38.2547 | 30.0741 | 55.7633 | 43.3453 | 7.7124 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0148 | 116.4503 | 85 | Complete curve; high efficacy | -7.8292 | 0.4 | 0.8832 | 27.623 | 144.0733 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 23.9089 | 133.1493 | 84.9856 | 90.6764 | 88.2038 | 80.5475 | 48.9343 | 46.7949 | 39.8461 | 48.3702 | 38.3265 | 23.9089 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.003 | 63.5074 | 84 | Complete curve; high efficacy | -8.5292 | 1.2475 | 0.8462 | 22.0615 | 85.5689 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.6855 | 78.4448 | 56.9012 | 38.378 | 27.1259 | 24.862 | 30.8508 | 33.1754 | 27.3561 | 22.2582 | 11.8504 | 4.6855 | QC'd by AG Scientific | |||||||||||||||
| Cytotoxic | 0.0662 | 81.5347 | 84 | Complete curve; high efficacy | -7.1792 | 0.5 | 0.9352 | 26.2812 | 107.8158 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 41.7013 | 104.64 | 91.6911 | 85.7103 | 74.9925 | 66.2502 | 63.8289 | 47.1436 | 40.116 | 32.6453 | 16.3981 | 41.7013 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0053 | 88.8579 | 83 | Complete curve; high efficacy | -8.2792 | 0.7 | 0.9187 | 15.3166 | 104.1745 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.2739 | 95.77 | 55.0437 | 66.1767 | 37.4873 | 30.627 | 23.9238 | 16.0289 | 19.5529 | 17.4589 | 9.8155 | 17.2739 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.2093 | 87.7813 | 83 | Complete curve; high efficacy | -6.6792 | 3.0654 | 0.986 | 28.7833 | 116.5646 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.0348 | 105.4018 | 124.2663 | 111.216 | 120.9286 | 117.8293 | 82.7937 | 30.9384 | 30.8224 | 27.5221 | 30.012 | 28.0348 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.0166 | 84.332 | 83 | Complete curve; high efficacy | -7.7792 | 2.7202 | 0.9842 | 17.1644 | 101.4964 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.8094 | 92.1572 | 111.7148 | 93.8225 | 44.8797 | 23.291 | 16.7021 | 14.9312 | 16.052 | 18.3141 | 17.4498 | 16.8094 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0372 | 78.6204 | 83 | Complete curve; high efficacy | -7.4292 | 2.5884 | 0.9846 | 18.7979 | 97.4182 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.8885 | 92.4206 | 95.8169 | 102.9354 | 82.0365 | 34.5038 | 24.1642 | 19.1575 | 13.7712 | 16.3222 | 26.4683 | 12.8885 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.049 | 96.4977 | 83 | Complete curve; high efficacy | -5.9792 | 0.5 | 0.9575 | 36.2422 | 132.7399 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.2766 | 130.3979 | 127.8742 | 134.2077 | 109.0067 | 109.1952 | 107.7131 | 99.926 | 78.5711 | 59.9369 | 52.6284 | 54.2766 | QC'd by LINCS | |||||||||||||||
| Cytotoxic | 0.0469 | 113.59 | 83 | Complete curve; high efficacy | -7.3292 | 1.9282 | 0.9776 | 20.8655 | 134.4556 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.4008 | 136.3735 | 118.7418 | 147.5619 | 108.8524 | 67.2042 | 21.0092 | 24.2011 | 24.5388 | 19.6988 | 20.3003 | 21.4008 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0059 | 134.114 | 83 | Complete curve; high efficacy | -8.2292 | 0.9 | 0.9582 | 14.3732 | 148.4872 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.7187 | 135.69 | 94.2555 | 92.2912 | 35.674 | 27.573 | 26.6103 | 23.4479 | 18.963 | 13.1392 | 11.2803 | 7.7187 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0166 | 82.999 | 83 | Complete curve; high efficacy | -7.7792 | 4.4495 | 0.9148 | 18.7882 | 101.7872 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 1.3065 | 89.3692 | 109.2888 | 105.2809 | 39.2597 | 12.5607 | 8.631 | 17.2452 | 27.9372 | 41.2907 | 25.0218 | 1.3065 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0026 | 124.1313 | 82 | Complete curve; high efficacy | -8.5792 | 1.4781 | 0.9864 | 11.3246 | 135.4559 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.9487 | 124.2782 | 72.555 | 39.0972 | 13.7633 | 18.1604 | 10.3035 | 10.5661 | 10.7649 | 8.9075 | 6.6182 | 14.9487 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0209 | 112.543 | 82 | Complete curve; high efficacy | -7.6792 | 1.9673 | 0.9326 | 14.5764 | 127.1195 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 0.7959 | 123.8363 | 116.6866 | 132.1224 | 62.1868 | 31.224 | 17.3277 | 13.6245 | 6.9603 | 45.141 | 5.1024 | 0.7959 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.1049 | 80.7622 | 82 | Complete curve; high efficacy | -6.9792 | 3.99 | 0.9314 | 16.2149 | 96.9771 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.1195 | 101.3823 | 75.2262 | 112.2489 | 99.8696 | 87.6321 | 24.0005 | 28.4571 | 25.408 | 16.8793 | 8.9066 | 2.1195 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.2348 | 92.6555 | 82 | Complete curve; high efficacy | -6.6292 | 0.9 | 0.9866 | 16.7612 | 109.4167 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.3983 | 112.3077 | 99.4639 | 110.1605 | 99.6185 | 92.2501 | 63.4128 | 43.1169 | 34.9892 | 25.2037 | 20.2211 | 13.3983 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.0264 | 105.2236 | 82 | Complete curve; high efficacy | -7.5792 | 2.7868 | 0.9881 | 10.1409 | 115.3645 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.3828 | 108.8197 | 112.7123 | 124.3794 | 75.0669 | 19.9744 | 11.7475 | 17.4558 | 8.7452 | 8.5941 | 7.961 | 5.3828 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.935 | 88.2613 | 82 | Complete curve; high efficacy | -6.0292 | 1.7885 | 0.8556 | 20.4336 | 108.6949 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.8527 | 85.5635 | 121.1104 | 117.0961 | 94.6507 | 99.9913 | 137.0322 | 69.8118 | 48.8332 | 29.7948 | 29.9699 | 4.8527 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0059 | 119.8687 | 82 | Complete curve; high efficacy | -8.2292 | 0.9 | 0.989 | 10.4647 | 130.3334 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 9.7544 | 119.7206 | 88.0559 | 68.5619 | 35.4928 | 30.3765 | 16.1901 | 10.809 | 12.1062 | 11.2172 | 8.007 | 9.7544 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.4176 | 152.6521 | 82 | Complete curve; high efficacy | -6.3792 | 0.4 | 0.9686 | -18.9995 | 133.6526 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.9146 | 127.427 | 102.6532 | 123.6296 | 93.0935 | 83.8593 | 62.241 | 55.7714 | 44.3209 | 18.4384 | 6.137 | 2.9146 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0118 | 64.88 | 87 | Complete curve; high efficacy | -7.9292 | 3.99 | 0.9065 | 42.9911 | 107.8711 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 75.9379 | 117.1662 | 98.059 | 101.6667 | 44.5432 | 37.9315 | 51.796 | 45.545 | 45.898 | 55.6965 | 24.215 | 75.9379 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 86 | Complete curve; high efficacy | -9 | 0 | 0.87 | 27.003 | 27.003 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.714 | 116.1096 | 51.7823 | 38.4774 | 38.149 | 32.5763 | 27.003 | 21.7125 | 13.6562 | 8.2494 | 4.8318 | 11.714 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0148 | 87.33 | 85 | Complete curve; high efficacy | -7.8292 | 2.7202 | 0.8394 | 28.2225 | 115.5525 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.7164 | 112.6565 | 118.5558 | 105.2086 | 50.4614 | 32.8964 | 56.1238 | 44.2032 | 45.6856 | 13.0527 | 3.9671 | 2.7164 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0743 | 81.0479 | 85 | Complete curve; high efficacy | -7.1292 | 2.4064 | 0.9877 | 36.057 | 117.1048 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.612 | 118.1815 | 112.941 | 121.7674 | 108.9169 | 87.1333 | 42.591 | 31.0005 | 32.051 | 39.1543 | 43.5926 | 36.612 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0132 | 95.1834 | 85 | Complete curve; high efficacy | -7.8792 | 2.5884 | 0.9789 | 30.3117 | 125.4951 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.3434 | 119.5176 | 131.0238 | 109.7688 | 49.1996 | 41.2323 | 39.0944 | 29.1842 | 32.4499 | 24.9502 | 25.8886 | 22.3434 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0372 | 96.9526 | 84 | Complete curve; high efficacy | -7.4292 | 3.6772 | 0.9439 | 26.3959 | 123.3485 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 20.4921 | 101.7407 | 120.2132 | 147.5217 | 112.7694 | 37.9374 | 39.3171 | 24.3812 | 25.0767 | 27.6942 | 20.4173 | 20.4921 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1147 | 102.0262 | 84 | Complete curve; high efficacy | -6.9404 | 0.4 | 0.9457 | 28.8277 | 130.8539 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 108.0014 | 122.9006 | 125.5314 | 115.9246 | 89.8709 | 95.6128 | 75.4206 | 75.6584 | 66.6692 | 45.0649 | 45.6837 | 108.0014 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0093 | 90.1584 | 84 | Complete curve; high efficacy | -8.0292 | 1.7137 | 0.9625 | 24.1405 | 114.2989 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 20.1633 | 106.7519 | 116.4044 | 75.807 | 42.4604 | 31.6448 | 37.5173 | 19.1166 | 17.3457 | 30.1096 | 18.8668 | 20.1633 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.4686 | 69.6091 | 84 | Complete curve; high efficacy | -6.3292 | 1.6924 | 0.8276 | 47.7156 | 117.3247 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 95.3248 | 99.0689 | 105.4815 | 112.5472 | 134.071 | 139.2948 | 95.8636 | 78.075 | 56.205 | 61.3157 | 34.976 | 95.3248 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.2957 | 85.2258 | 83 | Complete curve; high efficacy | -6.5292 | 4.9549 | 0.9055 | 30.0023 | 115.2281 | -1.1 | 0 0 0 0 0 0 0 0 0 1 0 | 45.1208 | 102.1961 | 108.7224 | 107.4279 | 107.404 | 145.4631 | 114.1746 | 21.3489 | 22.648 | 33.1896 | 77.556 | 45.1208 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.0118 | 107.3878 | 83 | Complete curve; high efficacy | -7.9292 | 4.4495 | 0.9946 | 18.1514 | 125.5392 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 103.6539 | 130.2388 | 120.1313 | 117.1341 | 24.7883 | 21.8042 | 12.7468 | 20.2894 | 19.912 | 21.3667 | 15.3748 | 103.6539 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 78.3333 | 83 | Complete curve; high efficacy | -7.4792 | 4.4495 | 0.9575 | 20.8089 | 99.1422 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 105.6776 | 94.562 | 86.401 | 118.7673 | 88.3883 | 24.5215 | 23.7163 | 18.8594 | 23.3229 | 22.5677 | 16.9857 | 105.6776 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 0.0118 | 86.291 | 83 | Complete curve; high efficacy | -7.9292 | 0.91 | 0.9712 | 20.4028 | 106.6938 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.9907 | 98.3598 | 100.6509 | 70.7724 | 45.8849 | 40.9594 | 33.2184 | 25.0445 | 19.1657 | 23.312 | 17.8226 | 13.9907 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2348 | 84.5422 | 83 | Complete curve; high efficacy | -6.6292 | 1.1 | 0.9547 | 25.2427 | 109.7849 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 114.3833 | 102.02 | 113.1558 | 103.8422 | 121.0743 | 81.3283 | 72.6842 | 51.9205 | 31.8121 | 26.3723 | 28.0582 | 114.3833 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.0148 | 86.12 | 83 | Complete curve; high efficacy | -7.8292 | 2.1876 | 0.9725 | 16.3085 | 102.4286 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.9507 | 102.9261 | 98.7333 | 90.7778 | 42.922 | 22.2997 | 23.2007 | 30.2306 | 11.6539 | 10.6579 | 13.0824 | 7.9507 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1482 | 77.0938 | 83 | Complete curve; high efficacy | -6.8292 | 4.9549 | 0.9553 | 22.4128 | 99.5066 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 9.87 | 102.0967 | 92.5449 | 98.6527 | 90.3526 | 113.4727 | 42.0252 | 28.6434 | 31.54 | 24.9793 | 14.7719 | 9.87 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 0.4176 | 91.3736 | 83 | Complete curve; high efficacy | -6.3792 | 1.6924 | 0.9858 | 29.7282 | 121.1017 | -1.1 | 0 0 1 0 0 0 0 0 0 0 0 | 21.3801 | 116.2452 | 129.3034 | 186.5441 | 118.5918 | 113.5565 | 105.0881 | 62.7854 | 35.7629 | 34.745 | 35.3537 | 21.3801 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.049 | 87.3616 | 83 | Complete curve; high efficacy | -5.9792 | 1 | 0.8772 | 36.1973 | 123.5589 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.1491 | 117.4289 | 109.6638 | 131.7472 | 129.0154 | 136.5777 | 93.9336 | 88.9455 | 83.6425 | 43.4572 | 25.123 | 54.1491 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.1482 | 113.9905 | 83 | Complete curve; high efficacy | -6.8292 | 1.2876 | 0.8888 | 23.8075 | 137.7981 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.0453 | 114.2505 | 119.5624 | 176.2421 | 137.6679 | 106.6825 | 59.0284 | 55.2507 | 38.1823 | 24.8371 | 27.4067 | 8.0453 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 1.177 | 85.4963 | 83 | Complete curve; high efficacy | -5.9292 | 3.6272 | 0.9149 | 39.2135 | 124.7097 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.6517 | 113.2381 | 135.3021 | 111.0564 | 135.5045 | 142.3677 | 111.5001 | 118.8115 | 56.8306 | 33.2042 | 57.6372 | 27.6517 | QC'd by Microsource |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0148 | 138.4172 | 92 | Complete curve; high efficacy | -7.8292 | 0.8 | 0.9854 | 73.4473 | 211.8645 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 76.0615 | 206.4576 | 176.3477 | 160.675 | 143.036 | 102.2156 | 87.4586 | 76.3866 | 75.9423 | 81.5132 | 71.2845 | 76.0615 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1865 | 129.7094 | 92 | Complete curve; high efficacy | -6.7292 | 2.4729 | 0.9102 | 104.5908 | 234.3002 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 97.9499 | 212.7695 | 199.584 | 247.0735 | 277.3731 | 227.6905 | 162.5507 | 123.8591 | 102.5004 | 104.1059 | 104.3989 | 97.9499 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.5258 | 72.9609 | 91 | Complete curve; high efficacy | -6.2792 | 2.7202 | 0.9263 | 121.6641 | 194.625 | -1.1 | 0 0 0 0 0 0 0 0 0 0 1 | 182.846 | 196.2276 | 201.2704 | 206.5478 | 177.6678 | 187.1047 | 193.8819 | 153.4274 | 124.7553 | 110.5225 | 133.7805 | 182.846 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.0469 | 134.7266 | 91 | Complete curve; high efficacy | -7.3292 | 2.3332 | 0.9427 | 79.2711 | 213.9977 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 74.524 | 225.8348 | 183.7696 | 233.1661 | 192.207 | 130.2439 | 74.8439 | 101.4578 | 75.213 | 88.158 | 64.0647 | 74.524 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 91 | Complete curve; high efficacy | -9 | 0 | 0.9736 | 48.7803 | 48.7803 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.83 | 166.158 | 106.5335 | 67.3448 | 35.2031 | 47.2803 | 44.6563 | 48.7803 | 46.7036 | 51.7045 | 56.8882 | 47.83 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 90 | Complete curve; high efficacy | -9 | 0 | 0.8207 | 46.4226 | 46.4226 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.4032 | 205.1041 | 113.3989 | 45.0423 | 60.9659 | 55.9706 | 82.4919 | 46.4226 | 18.2592 | 10.6648 | 8.4697 | 5.4032 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 1.4818 | 67.8056 | 89 | Complete curve; high efficacy | -5.8292 | 4.9549 | 0.7621 | 141.433 | 209.2386 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 116.0869 | 187.3686 | 222.298 | 199.2101 | 217.5801 | 185.2508 | 221.0682 | 234.3031 | 161.6854 | 158.4572 | 150.9575 | 116.0869 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 89 | Complete curve; high efficacy | -9 | 0 | 0.9591 | 38.8706 | 38.8706 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 39.1109 | 165.4745 | 147.9893 | 92.1226 | 38.8706 | 47.6528 | 15.9643 | 14.5577 | 9.1645 | 7.8078 | 7.0708 | 39.1109 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 89 | Complete curve; high efficacy | -9 | 0 | 0.9388 | 41.1421 | 41.1421 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 3.8961 | 184.0933 | 141.733 | 91.783 | 118.6691 | 84.4271 | 41.1421 | 40.4161 | 26.2497 | 18.5223 | 5.7273 | 3.8961 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 89 | Complete curve; high efficacy | -9 | 0 | 0.9888 | 40.8379 | 40.8379 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 26.1407 | 121.6554 | 195.8384 | 155.5113 | 88.1063 | 68.0947 | 37.7656 | 40.8379 | 40.0991 | 27.9716 | 31.773 | 26.1407 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0382 | 92.5734 | 88 | Complete curve; high efficacy | -7.418 | 0.4 | 0.8897 | 52.7945 | 145.3679 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.9291 | 116.2057 | 136.3435 | 103.0924 | 91.9654 | 79.4739 | 82.0269 | 83.1013 | 67.373 | 61.555 | 57.4999 | 51.9291 | QC'd by ChemPacific | |||||||||||||||
| Cytotoxic | 0.0743 | 134.5354 | 88 | Complete curve; high efficacy | -7.1292 | 1.21 | 0.9307 | 57.9113 | 192.4467 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 49.7147 | 175.8519 | 207.2976 | 185.8686 | 162.8742 | 143.0486 | 63.0491 | 99.1074 | 67.3805 | 57.9379 | 49.2515 | 49.7147 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 88 | Complete curve; high efficacy | -9 | 0 | 0.8758 | 33.7212 | 33.7212 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.1324 | 152.4612 | 97.5893 | 68.7499 | 32.2642 | 58.8159 | 47.2578 | 33.7212 | 8.8049 | 4.8186 | 3.5433 | 4.1324 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 3.7221 | 85.2239 | 87 | Complete curve; high efficacy | -5.4292 | 4.9549 | 0.891 | 150.0271 | 235.251 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 154.7033 | 204.9209 | 231.691 | 212.9559 | 243.8102 | 227.9286 | 234.025 | 230.2626 | 264.0915 | 159.589 | 149.6383 | 154.7033 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 1.3207 | 106.1003 | 87 | Complete curve; high efficacy | -5.8792 | 1.8265 | 0.9417 | 105.4088 | 211.509 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 114.0374 | 223.8378 | 192.8578 | 196.2457 | 228.3532 | 212.5214 | 209.5506 | 192.8647 | 146.6919 | 120.1282 | 91.3668 | 114.0374 | QC'd by XcessBio | |||||||||||||||
| Cytotoxic | 0.1482 | 151.4987 | 87 | Complete curve; high efficacy | -6.8292 | 0.7 | 0.98 | 56.0265 | 207.5252 | -1.1 | 0 1 0 0 0 0 0 0 0 0 0 | 51.814 | 202.2596 | 122.7624 | 197.3713 | 167.7834 | 153.3308 | 139.0984 | 85.596 | 79.1403 | 68.5178 | 69.5035 | 51.814 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0935 | 70.6056 | 87 | Complete curve; high efficacy | -7.0292 | 4.5045 | 0.9613 | 52.9846 | 123.5901 | -1.1 | 0 1 0 0 0 0 0 0 0 0 0 | 41.374 | 115.1832 | 175.7294 | 133.236 | 122.1014 | 112.515 | 54.2553 | 57.0952 | 63.7337 | 53.567 | 50.7817 | 41.374 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 87 | Complete curve; high efficacy | -9 | 0 | 0.9576 | 30.2511 | 30.2511 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.7137 | 142.2621 | 159.7504 | 41.7891 | 40.524 | 22.5735 | 21.9929 | 37.0563 | 30.2511 | 15.9156 | 14.2865 | 7.7137 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.001 | 0 | 87 | Complete curve; high efficacy | -9 | 0 | 0.9353 | 30.6525 | 30.6525 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 10.0983 | 153.4905 | 88.4577 | 56.6365 | 28.9731 | 43.3437 | 33.8307 | 30.6525 | 18.3845 | 11.7562 | 11.5903 | 10.0983 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2635 | 171.4641 | 86 | Complete curve; high efficacy | -6.5792 | 4.9549 | 0.903 | 55.2524 | 226.7165 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 87.6192 | 224.0953 | 196.7275 | 198.1303 | 295.2794 | 221.4309 | 194.6875 | 46.5565 | 51.5148 | 33.1518 | 58.5883 | 87.6192 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0093 | 104.6527 | 88 | Complete curve; high efficacy | -8.0292 | 1.9673 | 0.9946 | 43.2871 | 147.9397 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 46.9856 | 151.2515 | 136.3124 | 112.1568 | 60.3474 | 41.2891 | 43.6006 | 45.5367 | 40.8584 | 41.4875 | 44.248 | 46.9856 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0526 | 90.7291 | 87 | Complete curve; high efficacy | -7.2792 | 1.2475 | 0.969 | 49.3002 | 140.0293 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.2116 | 136.8931 | 136.6639 | 140.7519 | 111.5654 | 96.3382 | 58.163 | 55.064 | 58.6659 | 57.3681 | 48.8529 | 36.2116 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1865 | 111.0998 | 86 | Complete curve; high efficacy | -6.7292 | 1.5579 | 0.9597 | 58.0636 | 169.1634 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 30.8392 | 165.6134 | 164.7399 | 166.9572 | 172.8379 | 153.7472 | 111.4217 | 72.2937 | 71.4323 | 70.5615 | 64.8202 | 30.8392 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.1049 | 99.2537 | 86 | Complete curve; high efficacy | -6.9792 | 3.132 | 0.8788 | 51.4415 | 150.6952 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.3763 | 133.6762 | 159.094 | 152.6324 | 154.4225 | 134.3854 | 64.9851 | 70.6294 | 68.5418 | 58.5559 | 55.5813 | 4.3763 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.3317 | 94.9929 | 84 | Complete curve; high efficacy | -6.4792 | 0.3 | 0.9521 | 37.641 | 132.6338 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 50.4436 | 114.4568 | 123.9845 | 113.8331 | 96.152 | 92.1624 | 89.6664 | 81.8815 | 79.9224 | 68.1558 | 59.6137 | 50.4436 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.7427 | 84.9044 | 84 | Complete curve; high efficacy | -6.1292 | 2.2526 | 0.933 | 45.6644 | 130.5688 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.4643 | 134.3384 | 115.1991 | 125.3701 | 119.0101 | 144.1666 | 143.8172 | 97.9891 | 50.7825 | 53.0518 | 54.3899 | 36.4643 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.8333 | 75.354 | 84 | Complete curve; high efficacy | -6.0792 | 3.99 | 0.9614 | 46.5835 | 121.9376 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.0973 | 124.2208 | 119.0164 | 110.2614 | 120.2463 | 126.3612 | 130.9298 | 108.8859 | 50.9325 | 50.2586 | 56.0536 | 33.0973 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.3722 | 88.0762 | 84 | Complete curve; high efficacy | -6.4292 | 4.4495 | 0.9703 | 37.6549 | 125.7311 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 44.0074 | 106.5992 | 127.2247 | 130.6238 | 138.3415 | 127.8948 | 120.6987 | 48.2184 | 35.9135 | 36.3641 | 34.926 | 44.0074 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0093 | 130.6425 | 84 | Complete curve; high efficacy | -8.0292 | 0.9 | 0.9867 | 24.621 | 155.2635 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 18.1076 | 143.3641 | 125.7098 | 98.5685 | 66.0334 | 36.9882 | 37.4695 | 36.8721 | 31.0273 | 25.0064 | 19.2735 | 18.1076 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.4686 | 84.3499 | 83 | Complete curve; high efficacy | -6.3292 | 3.0654 | 0.8927 | 37.763 | 122.1129 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.9174 | 100.9718 | 133.1095 | 113.0152 | 128.6977 | 133.2765 | 119.5843 | 64.2784 | 53.3781 | 48.5286 | 44.75 | 8.9174 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.3317 | 88.6774 | 83 | Complete curve; high efficacy | -6.4792 | 1.6259 | 0.9909 | 34.1483 | 122.8257 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 32.8455 | 112.8257 | 122.9968 | 126.477 | 124.3559 | 121.5352 | 96.4604 | 60.3971 | 43.4033 | 34.0922 | 32.8733 | 32.8455 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.2957 | 104.4395 | 83 | Complete curve; high efficacy | -6.5292 | 0.6 | 0.9636 | 33.4657 | 137.9052 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 30.41 | 139.5422 | 127.9789 | 115.7906 | 133.779 | 110.193 | 87.9596 | 73.5955 | 58.1049 | 55.3613 | 47.9141 | 30.41 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 2.3485 | 86.6758 | 83 | Complete curve; high efficacy | -5.6292 | 4.095 | 0.9684 | 53.6121 | 140.2879 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.2528 | 135.5146 | 146.9511 | 127.3268 | 148.5202 | 130.0159 | 143.2286 | 148.4195 | 122.3701 | 57.6127 | 55.7427 | 51.2528 | QC'd by LINCS | |||||||||||||||
| Cytotoxic | 0.5899 | 78.4815 | 83 | Complete curve; high efficacy | -6.2292 | 1 | 0.962 | 39.6422 | 118.1236 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.8849 | 113.0988 | 105.5924 | 123.1519 | 126.3882 | 114.8478 | 93.4484 | 78.3964 | 61.996 | 52.621 | 41.6161 | 36.8849 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 1.6626 | 85.9672 | 83 | Complete curve; high efficacy | -5.7792 | 2.4729 | 0.9295 | 40.7279 | 126.6952 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.4756 | 118.8121 | 112.7597 | 122.0662 | 124.4452 | 131.3159 | 149.7541 | 122.8382 | 80.2944 | 49.8125 | 50.9941 | 28.4756 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0743 | 90.7413 | 83 | Complete curve; high efficacy | -7.1292 | 1.9673 | 0.9464 | 25.6492 | 116.3905 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.9198 | 106.5785 | 111.2723 | 128.5693 | 109.6739 | 79.4144 | 37.1158 | 33.6722 | 41.618 | 29.6887 | 19.1474 | 5.9198 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4176 | 196.8504 | 83 | Complete curve; high efficacy | -6.3792 | 0.3 | 0.9606 | -31.7676 | 165.0828 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.8348 | 135.921 | 148.6439 | 123.1507 | 111.4731 | 78.5446 | 71.3085 | 64.7602 | 62.72 | 28.6854 | 14.0462 | 2.8348 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.5258 | 95.9955 | 83 | Complete curve; high efficacy | -6.2792 | 0.4 | 0.9753 | 35.9633 | 131.9588 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 50.6988 | 124.3759 | 129.0401 | 111.2096 | 110.6664 | 98.3191 | 99.2745 | 82.505 | 77.9575 | 59.8532 | 53.1365 | 50.6988 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.1865 | 153.2974 | 82 | Complete curve; high efficacy | -6.7292 | 0.4 | 0.9838 | -19.1976 | 134.0998 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 1.5971 | 128.3939 | 102.501 | 95.9576 | 90.3493 | 76.1127 | 59.6546 | 43.6414 | 25.0549 | 4.9279 | 1.7 | 1.5971 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 0.4686 | 112.6369 | 82 | Complete curve; high efficacy | -6.3292 | 0.7 | 0.966 | 16.772 | 129.4089 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.877 | 117.2722 | 122.3984 | 135.2437 | 130.0817 | 105.7415 | 80.3609 | 67.0393 | 51.7534 | 40.541 | 30.1694 | 13.877 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0132 | 78.8888 | 88 | Complete curve; high efficacy | -7.8792 | 3.5117 | 0.9951 | 47.2347 | 126.1235 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 42.2827 | 127.6613 | 122.708 | 120.2024 | 61.1126 | 51.2885 | 45.5161 | 47.7407 | 46.3578 | 47.5339 | 48.0543 | 42.2827 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.0187 | 94.4991 | 87 | Complete curve; high efficacy | -7.7292 | 1.9673 | 0.9923 | 43.1973 | 137.6963 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.5181 | 141.319 | 129.8171 | 127.5041 | 86.8076 | 49.0942 | 47.0499 | 42.277 | 40.9385 | 37.8151 | 44.8621 | 47.5181 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.5258 | 73.9868 | 87 | Complete curve; high efficacy | -6.2792 | 1.5386 | 0.9608 | 75.2185 | 149.2053 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 66.1566 | 142.7053 | 154.8249 | 147.903 | 146.0134 | 146.4254 | 144.006 | 104.2739 | 88.0969 | 90.9594 | 71.6495 | 66.1566 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.0059 | 140.4545 | 87 | Complete curve; high efficacy | -8.2292 | 1.4163 | 0.9687 | 36.1127 | 176.5672 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 10.8624 | 168.6765 | 147.5154 | 96.3491 | 54.2002 | 41.5445 | 37.5728 | 42.2093 | 41.7422 | 40.4833 | 43.4946 | 10.8624 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0132 | 79.7444 | 87 | Complete curve; high efficacy | -7.8792 | 0.6 | 0.8986 | 41.6151 | 121.3595 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.1462 | 113.0499 | 103.1376 | 82.2031 | 81.4852 | 58.6938 | 53.3145 | 53.6692 | 54.5379 | 37.1186 | 56.479 | 26.1462 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.1663 | 78.9427 | 86 | Complete curve; high efficacy | -6.7792 | 3.9295 | 0.9459 | 49.4968 | 128.4395 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 39.1638 | 119.9619 | 118.7114 | 121.8873 | 145.134 | 135.6602 | 77.5019 | 49.3716 | 42.7048 | 55.4887 | 60.9156 | 39.1638 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.1177 | 99.5229 | 86 | Complete curve; high efficacy | -6.9292 | 0.5 | 0.9784 | 53.5004 | 153.0233 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.2364 | 146.2425 | 146.4285 | 127.5196 | 118.6607 | 112.3725 | 102.0037 | 86.3517 | 70.5974 | 62.7254 | 70.1683 | 54.2364 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2348 | 79.9222 | 86 | Complete curve; high efficacy | -6.6292 | 1.4641 | 0.9791 | 58.9416 | 138.8638 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 62.4132 | 143.4278 | 135.9313 | 129.1028 | 144.3799 | 129.2524 | 105.2039 | 73.5025 | 70.4619 | 53.7397 | 57.6396 | 62.4132 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0187 | 133.2619 | 86 | Complete curve; high efficacy | -7.7292 | 0.6 | 0.9441 | 35.7906 | 169.0525 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.5582 | 156.1894 | 139.4018 | 135.4374 | 91.1086 | 61.2241 | 66.0949 | 67.7171 | 53.5961 | 42.5842 | 30.9652 | 27.5582 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.0296 | 79.812 | 85 | Complete curve; high efficacy | -7.5292 | 3.132 | 0.8367 | 30.4945 | 110.3065 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -0.4219 | 91.4427 | 118.502 | 121.2802 | 87.4178 | 39.06 | 30.3783 | 26.004 | 28.8116 | 31.886 | 64.9696 | -0.4219 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.4686 | 72.5584 | 85 | Complete curve; high efficacy | -6.3292 | 1.4781 | 0.898 | 58.4082 | 130.9666 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.5241 | 121.5091 | 138.67 | 123.1995 | 141.6082 | 124.8321 | 119.0843 | 85.2035 | 70.5438 | 62.7606 | 78.2039 | 36.5241 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.5749 | 89.3171 | 85 | Complete curve; high efficacy | -6.2404 | 3.5117 | 0.9381 | 53.4216 | 142.7387 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 42.1397 | 122.2594 | 133.5752 | 138.8262 | 155.9137 | 150.9759 | 155.3277 | 133.8332 | 70.1507 | 56.1404 | 64.459 | 42.1397 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1049 | 90.1126 | 85 | Complete curve; high efficacy | -6.9792 | 1.1 | 0.96 | 42.4601 | 132.5727 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 48.0597 | 134.7202 | 138.2028 | 122.4795 | 111.2704 | 105.466 | 77.8849 | 45.233 | 45.4972 | 30.8237 | 55.2725 | 48.0597 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0418 | 80.3578 | 85 | Complete curve; high efficacy | -7.3792 | 0.6 | 0.8511 | 33.6315 | 113.9892 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.0841 | 101.2736 | 106.7715 | 96.7166 | 82.135 | 70.4809 | 40.1055 | 51.5054 | 51.4536 | 54.1375 | 41.9436 | 11.0841 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.6619 | 94.773 | 85 | Complete curve; high efficacy | -6.1792 | 1.4781 | 0.9803 | 53.7716 | 148.5446 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 55.0629 | 148.0214 | 138.5482 | 154.1536 | 143.4321 | 157.4598 | 136.5884 | 99.8634 | 77.2433 | 58.4344 | 52.8195 | 55.0629 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2093 | 116.5034 | 85 | Complete curve; high efficacy | -6.6792 | 1.331 | 0.9045 | 46.5044 | 163.0078 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.0869 | 143.6239 | 161.4686 | 168.1578 | 159.9801 | 164.4887 | 97.6706 | 64.7846 | 68.4913 | 71.4763 | 50.625 | 13.0869 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2957 | 96.4482 | 84 | Complete curve; high efficacy | -6.5292 | 1.8265 | 0.9793 | 36.1131 | 132.5613 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.7595 | 137.6757 | 133.1247 | 125.0579 | 141.4133 | 118.8792 | 106.6696 | 52.9758 | 40.6195 | 40.7565 | 44.3485 | 27.7595 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.3722 | 96.57 | 84 | Complete curve; high efficacy | -6.4292 | 1.4787 | 0.9808 | 40.3311 | 136.901 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 41.4841 | 141.6948 | 138.6029 | 123.988 | 145.2114 | 122.9084 | 114.8164 | 75.0526 | 46.3655 | 45.8328 | 38.6829 | 41.4841 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0132 | 99.5422 | 84 | Complete curve; high efficacy | -7.8792 | 0.5 | 0.8598 | 25.2368 | 124.779 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.6254 | 113.8403 | 106.9304 | 67.8854 | 57.7379 | 56.7173 | 56.0064 | 46.2734 | 43.489 | 29.1571 | 4.4532 | 33.6254 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 2.0931 | 75.0602 | 84 | Complete curve; high efficacy | -5.6792 | 4.9549 | 0.9483 | 60.3489 | 135.4091 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 60.7384 | 119.1757 | 138.3496 | 139.0789 | 136.1425 | 149.2097 | 137.4143 | 127.2154 | 116.9325 | 54.5422 | 66.8667 | 60.7384 | QC'd by ChemAxon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inconclusive | 2.0931 | 52.3778 | 10 | Complete curve; partial efficacy; poor fit | -5.6792 | 1.21 | 0.8868 | 207.717 | 155.3392 | 1.4 | 0 0 0 0 1 0 0 0 0 0 1 | 147.1 | 164.4833 | 155.0085 | 150.5868 | 148.3401 | 116.6514 | 156.9711 | 173.7174 | 168.6881 | 199.2135 | 202.8962 | 147.1 | QC'd by Microsource | |||||||||||||||
| Inconclusive | 0.0057 | 12.5196 | 10 | Complete curve; partial efficacy; poor fit | -8.2404 | 4.9549 | 0.312 | 131.5823 | 119.0627 | 1.4 | 0 0 0 0 0 0 0 0 0 0 1 | 127.1473 | 120.0823 | 122.1295 | 115.8993 | 137.6706 | 122.1335 | 127.163 | 123.7971 | 150.7316 | 133.1825 | 125.6113 | 127.1473 | QC'd by SIGMA | |||||||||||||||
| Inconclusive | 0.0019 | 21 | 10 | Complete curve; partial efficacy; poor fit | -8.7292 | 1.1 | 0.8356 | 134.2114 | 113.2114 | 1.4 | 0 0 0 0 0 0 0 0 0 0 1 | 119.1302 | 117.2114 | 127.4759 | 130.4637 | 129.9536 | 131.9164 | 134.6866 | 133.4534 | 131.6405 | 137.8111 | 137.2931 | 119.1302 | QC'd by Pharmeks | |||||||||||||||
| Inconclusive | 0.0662 | 21.5 | 10 | Complete curve; partial efficacy; poor fit | -7.1792 | 1.9673 | 0.9617 | 136.1907 | 114.6907 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 137.9456 | 114.6907 | 115.3457 | 114.9342 | 114.9118 | 125.4369 | 132.2852 | 136.9063 | 134.4597 | 139.5384 | 132.1379 | 137.9456 | QC'd by Sequoia | |||||||||||||||
| Inconclusive | 0.1482 | 21.0998 | 10 | Complete curve; partial efficacy; poor fit | -6.8292 | 0.8 | 0.8442 | 149.6919 | 128.5921 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 151.9116 | 131.6919 | 128.2754 | 129.76 | 129.967 | 133.7039 | 147.8377 | 137.7359 | 147.2819 | 148.9579 | 147.0679 | 151.9116 | QC'd by Tocris | |||||||||||||||
| Inconclusive | 0.0833 | 30.5 | 10 | Complete curve; partial efficacy; poor fit | -7.0792 | 0.3 | 0.9065 | 152.817 | 122.317 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 149.8479 | 126.317 | 131.9239 | 133.2597 | 133.1414 | 138.2988 | 138.8257 | 144.3744 | 142.6826 | 141.1244 | 150.4849 | 149.8479 | QC'd by APAC | |||||||||||||||
| Inconclusive | 0.003 | 23 | 10 | Complete curve; partial efficacy; poor fit | -8.5292 | 0.7 | 0.9042 | 116.6731 | 93.6731 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 115.0235 | 97.6731 | 106.1567 | 108.9656 | 113.5207 | 111.3295 | 114.3155 | 115.674 | 116.5526 | 117.8964 | 119.9437 | 115.0235 | QC'd by SigmaAldrich | |||||||||||||||
| Inconclusive | 0.0019 | 25.5 | 10 | Complete curve; partial efficacy | -8.7292 | 1.5579 | 0.7725 | 134.9997 | 109.4997 | 1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 138.6831 | 113.4997 | 125.8748 | 129.6566 | 135.9028 | 133.275 | 139.8144 | 131.171 | 127.5454 | 138.1274 | 135.3784 | 138.6831 | QC'd by SigmaAldrich | |||||||||||||||
| Inactive | 0 | -5.0292 | 0.8 | 0.4643 | 103.7426 | 121.9544 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 106.6946 | 111.4544 | 125.2432 | 128.5053 | 127.1929 | 113.4715 | 124.3917 | 121.815 | 114.296 | 116.6521 | 111.8738 | 106.6946 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | 4 | 125.6815 | 122.8795 | 130.2888 | 125.1136 | 125.6652 | 130.3074 | 128.7078 | 129.9384 | 126.7494 | 127.6785 | 129.7132 | 125.6815 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | 4 | 136.2326 | 163.4273 | 142.6615 | 146.3348 | 166.6634 | 150.6103 | 158.3404 | 165.0578 | 162.7658 | 150.3198 | 139.9664 | 136.2326 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -7.3792 | 0.8 | 0.6066 | 126.3684 | 141.9019 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 126.5818 | 144.4019 | 133.558 | 143.8479 | 137.0521 | 128.3337 | 135.1801 | 122.2906 | 134.5644 | 123.4653 | 125.8628 | 126.5818 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.9292 | 4.9549 | 0.7372 | 120.4574 | 134.0138 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 120.7168 | 134.5138 | 134.0383 | 138.0285 | 138.2397 | 129.2732 | 130.6596 | 135.9635 | 130.2877 | 134.4747 | 123.0085 | 120.7168 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -6.8792 | 3.132 | 0.4017 | 111.9315 | 106.5265 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 105.5505 | 105.9315 | 109.5176 | 101.4274 | 110.4744 | 106.5334 | 110.4821 | 115.977 | 107.3312 | 113.281 | 111.1989 | 105.5505 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.6792 | 4.5045 | 0.6481 | 132.5399 | 143.839 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 132.7564 | 143.839 | 141.5609 | 139.3268 | 147.1235 | 144.923 | 140.6337 | 146.4103 | 146.2306 | 145.3224 | 141.4193 | 132.7564 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.5792 | 0.9 | 0.6882 | 159.3525 | 129.3525 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 151.1525 | 125.3525 | 127.8444 | 130.5681 | 128.6677 | 140.8596 | 130.7582 | 127.8002 | 131.1106 | 130.9549 | 139.8805 | 151.1525 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -6.9792 | 0.4 | 0.9481 | 115.5257 | 97.0483 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 114.5356 | 99.5257 | 98.7112 | 102.3247 | 103.7206 | 107.7162 | 106.0966 | 108.4061 | 110.7209 | 110.6769 | 114.5412 | 114.5356 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -5.1792 | 2.4064 | 0.5201 | 113.1718 | 140.1235 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 115.0077 | 144.1235 | 142.7954 | 132.4372 | 151.4407 | 117.6804 | 133.3272 | 147.8257 | 140.0962 | 131.6466 | 114.5804 | 115.0077 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | 4 | 129.9994 | 131.8514 | 126.6454 | 132.768 | 130.4791 | 123.0823 | 132.8921 | 130.718 | 134.7376 | 125.1039 | 126.4003 | 129.9994 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -5.9792 | 3.5117 | 0.878 | 99.8725 | 117.8095 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 106.7355 | 120.8095 | 114.2948 | 118.894 | 116.6347 | 119.8485 | 116.4782 | 116.0413 | 102.2434 | 98.241 | 95.0287 | 106.7355 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0105 | 87.3903 | 86 | Complete curve; high efficacy | -7.9792 | 1.5579 | 0.9893 | 32.5525 | 119.9428 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 32.5973 | 120.122 | 108.6701 | 92.3587 | 49.688 | 44.8549 | 32.1314 | 33.6031 | 34.7632 | 28.33 | 32.0483 | 32.5973 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0083 | 76.0847 | 86 | Complete curve; high efficacy | -8.0792 | 2.4064 | 0.9788 | 34.0695 | 110.1542 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 24.173 | 108.041 | 107.7583 | 81.9136 | 39.5165 | 42.5568 | 37.701 | 32.5007 | 33.6579 | 37.0598 | 31.0166 | 24.173 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.0187 | 77.5428 | 86 | Complete curve; high efficacy | -7.7292 | 1.7885 | 0.9627 | 34.3529 | 111.8957 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.0008 | 112.3533 | 115.0658 | 89.9199 | 78.4117 | 30.4902 | 34.7307 | 34.3546 | 33.0928 | 38.5201 | 40.8034 | 33.0008 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.059 | 88.7005 | 85 | Complete curve; high efficacy | -7.2292 | 0.6 | 0.9694 | 36.3948 | 125.0953 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.5989 | 117.1885 | 119.5312 | 102.4696 | 90.6458 | 85.8623 | 60.6364 | 51.8299 | 52.2662 | 49.7345 | 41.1285 | 28.5989 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 77.1281 | 85 | Complete curve; high efficacy | -7.4792 | 0.7 | 0.9655 | 31.2029 | 108.331 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.5571 | 101.2018 | 101.2655 | 88.8456 | 70.1845 | 69.8422 | 43.6821 | 40.237 | 39.3066 | 37.258 | 36.4047 | 22.5571 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0187 | 79.8587 | 85 | Complete curve; high efficacy | -7.7292 | 3.5117 | 0.9584 | 32.0611 | 111.9199 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.2093 | 112.4294 | 107.1384 | 115.1252 | 60.4131 | 41.9245 | 37.3163 | 31.476 | 37.277 | 35.9287 | 30.8432 | 13.2093 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0935 | 86.4491 | 85 | Complete curve; high efficacy | -7.0292 | 1.1 | 0.9449 | 37.248 | 123.6972 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.2605 | 129.9165 | 117.2503 | 108.9438 | 120.538 | 91.5155 | 51.1197 | 56.1591 | 51.8607 | 42.0573 | 32.8998 | 26.2605 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0209 | 93.1293 | 85 | Complete curve; high efficacy | -7.6792 | 1.4641 | 0.9618 | 33.1188 | 126.2481 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.4794 | 117.474 | 125.7046 | 121.8447 | 67.9661 | 56.0556 | 41.3261 | 42.2157 | 33.9271 | 32.3517 | 29.6972 | 22.4794 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 100.485 | 85 | Complete curve; high efficacy | -7.4792 | 1 | 0.9707 | 31.2298 | 131.7149 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.5067 | 135.567 | 116.3384 | 110.9262 | 105.2526 | 53.9153 | 47.8749 | 42.0574 | 35.3066 | 32.79 | 30.9695 | 25.5067 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.0296 | 93.4421 | 84 | Complete curve; high efficacy | -7.5292 | 3.9295 | 0.9748 | 23.6719 | 117.114 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.7428 | 100 | 130.2442 | 120.833 | 97.5583 | 27.8225 | 21.548 | 19.8313 | 23.189 | 26.6834 | 24.6437 | 25.7428 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.3722 | 76.551 | 84 | Complete curve; high efficacy | -6.4292 | 1.21 | 0.9308 | 41.5458 | 118.0968 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.8735 | 126.0105 | 102.8329 | 112.503 | 124.3981 | 120.1789 | 87.8304 | 70.2014 | 54.1079 | 49.9172 | 50.885 | 26.8735 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.1321 | 81.2414 | 84 | Complete curve; high efficacy | -6.8792 | 4.9549 | 0.9422 | 34.404 | 115.6454 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 26.3475 | 111.8181 | 103.4247 | 109.6276 | 115.8533 | 135.6981 | 44.7754 | 39.681 | 48.6523 | 28.6518 | 29.1124 | 26.3475 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.1482 | 82.7015 | 84 | Complete curve; high efficacy | -6.8292 | 3.9295 | 0.9807 | 32.7831 | 115.4845 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.9601 | 112.1327 | 117.5155 | 121.9023 | 104.2805 | 119.0695 | 55.4553 | 42.5564 | 33.0266 | 30.9156 | 28.9386 | 29.9601 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.059 | 76.7002 | 84 | Complete curve; high efficacy | -7.2292 | 1.5095 | 0.9763 | 29.9655 | 106.6658 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.9818 | 106.9151 | 109.4753 | 101.0757 | 90.3292 | 71.8808 | 34.5614 | 30.8078 | 40.7566 | 34.0928 | 28.4921 | 21.9818 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.0209 | 88.8023 | 83 | Complete curve; high efficacy | -7.6792 | 3.5117 | 0.9512 | 16.2799 | 105.0822 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 3.7081 | 100.414 | 107.4471 | 102.6609 | 64.9713 | 4.9833 | 9.8401 | 14.9979 | 17.739 | 26.4967 | 34.0224 | 3.7081 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.0418 | 93.5745 | 83 | Complete curve; high efficacy | -7.3792 | 2.1876 | 0.9984 | 17.8156 | 111.39 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.4361 | 109.284 | 114.2073 | 106.6704 | 95.6714 | 45.8603 | 21.918 | 18.8834 | 16.5069 | 16.3283 | 16.9846 | 17.4361 | QC'd by ACC | |||||||||||||||
| Cytotoxic | 0.0833 | 78.2328 | 83 | Complete curve; high efficacy | -7.0792 | 0.8 | 0.9055 | 21.999 | 100.2318 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.1095 | 90.1163 | 103.2646 | 89.0182 | 86.3226 | 67.7142 | 35.3475 | 39.8085 | 35.9143 | 36.9216 | 28.8365 | 2.1095 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0743 | 90.1373 | 83 | Complete curve; high efficacy | -7.1292 | 0.6 | 0.9394 | 23.0787 | 113.2161 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 14.6398 | 104.4157 | 102.1008 | 106.6361 | 85.9834 | 63.3333 | 50.6564 | 40.159 | 53.4023 | 31.9176 | 25.5587 | 14.6398 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.0418 | 84.7687 | 83 | Complete curve; high efficacy | -7.3792 | 1.2221 | 0.9654 | 21.7645 | 106.5332 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 18.8147 | 105.5736 | 99.2727 | 109.2188 | 68.5704 | 62.9029 | 25.883 | 28.2112 | 25.4089 | 22.8606 | 21.0498 | 18.8147 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0469 | 101.0674 | 83 | Complete curve; high efficacy | -7.3292 | 0.9 | 0.9567 | 22.9637 | 124.0311 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.6524 | 111.1073 | 130.7357 | 106.6193 | 90.5192 | 65.0382 | 38.8797 | 39.5498 | 34.1324 | 32.2425 | 24.9349 | 7.6524 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.2348 | 112.8849 | 84 | Complete curve; high efficacy | -6.6292 | 0.4 | 0.9392 | 37.0886 | 149.9734 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 47.4866 | 100.2991 | 140.8419 | 123.7999 | 110.5725 | 117.5645 | 87.8253 | 78.2498 | 85.5312 | 67.1052 | 48.088 | 47.4866 | QC'd by SantaCruz Bio | |||||||||||||||
| Cytotoxic | 0.0332 | 135.8677 | 84 | Complete curve; high efficacy | -7.4792 | 0.4 | 0.8686 | 24.8504 | 160.7181 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 9.5856 | 132.6885 | 149.7338 | 116.7486 | 73.7789 | 73.9897 | 69.7305 | 68.0186 | 54.4158 | 55.9508 | 40.4479 | 9.5856 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 2.0931 | 100.1183 | 83 | Complete curve; high efficacy | -5.6792 | 0.4 | 0.9534 | 50.966 | 151.0844 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 67.4421 | 149.8224 | 143.8978 | 144.1774 | 136.6925 | 121.0787 | 121.338 | 115.4935 | 112.6965 | 98.7929 | 74.8281 | 67.4421 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0132 | 104.0082 | 83 | Complete curve; high efficacy | -7.8792 | 1.9282 | 0.9887 | 15.4484 | 119.4565 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.6572 | 119.4565 | 113.3958 | 98.0703 | 46.3447 | 19.7386 | 22.7636 | 17.9014 | 20.6219 | 15.882 | 12.5126 | 4.6572 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0235 | 123.0254 | 83 | Complete curve; high efficacy | -7.6292 | 0.4 | 0.8337 | 19.8641 | 142.8896 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.2641 | 131.0145 | 115.5436 | 90.2951 | 53.9052 | 71.2151 | 62.3387 | 57.1604 | 61.9695 | 14.8102 | 35.3827 | 12.2641 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.2093 | 85.2987 | 83 | Complete curve; high efficacy | -6.6792 | 0.7 | 0.9334 | 25.0186 | 110.3173 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.0991 | 109.8173 | 117.7375 | 96.0653 | 79.1894 | 96.8309 | 75.5364 | 51.6992 | 33.8263 | 28.1861 | 36.4133 | 27.0991 | QC'd by NCGCChem | |||||||||||||||
| Cytotoxic | 3.3173 | 81.3074 | 83 | Complete curve; high efficacy | -5.4792 | 2.3332 | 0.9315 | 57.6371 | 138.9446 | -1.1 | 0 0 0 0 1 0 0 0 0 0 0 | 49.2543 | 138.4338 | 143.9848 | 151.4142 | 126.0089 | 95.5126 | 125.5596 | 148.3456 | 124.313 | 78.153 | 69.7657 | 49.2543 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0059 | 36.9664 | 82 | Complete curve; partial efficacy | -8.2292 | 2.3332 | 0.9077 | 119.6572 | 156.6236 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 121.5044 | 156.5384 | 152.389 | 136.5428 | 116.1001 | 121.0618 | 114.6459 | 112.3913 | 119.9242 | 122.9008 | 128.5083 | 121.5044 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0235 | 114.2094 | 82 | Complete curve; high efficacy | -7.6292 | 0.5 | 0.9763 | 14.7696 | 128.979 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 10.4187 | 119.1896 | 95.7224 | 79.6245 | 80.2426 | 57.6913 | 43.0075 | 36.2366 | 30.0952 | 23.1099 | 20.651 | 10.4187 | QC'd by FLUKA | |||||||||||||||
| Cytotoxic | 3.7221 | 80.8703 | 82 | Complete curve; high efficacy | -5.4292 | 4.9549 | 0.9032 | 34.983 | 115.8532 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 31.7555 | 109.5885 | 98.898 | 113.8737 | 107.8306 | 136.1674 | 134.0604 | 103.0938 | 120.47 | 49.9278 | 37.4029 | 31.7555 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0935 | 90.5119 | 82 | Complete curve; high efficacy | -7.0292 | 2.4064 | 0.9076 | 11.9163 | 102.4282 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.6066 | 79.817 | 96.8282 | 103.1563 | 135.2423 | 67.228 | 33.4551 | 13.6779 | 9.6245 | 10.7757 | 11.223 | 12.6066 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1663 | 94.7615 | 82 | Complete curve; high efficacy | -6.7792 | 2.2526 | 0.986 | 16.386 | 111.1475 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.149 | 108.3556 | 124.8245 | 103.3906 | 106.2074 | 102.2469 | 58.7851 | 21.2153 | 18.0773 | 19.6772 | 16.0325 | 13.149 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.5258 | 104.1543 | 82 | Complete curve; high efficacy | -6.2792 | 1 | 0.9414 | 18.3838 | 122.5381 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.0314 | 104.3828 | 126.1461 | 116.2417 | 132.0669 | 128.1681 | 83.3544 | 61.5529 | 52.6567 | 32.9587 | 21.7534 | 11.0314 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.1321 | 103.7873 | 82 | Complete curve; high efficacy | -6.8792 | 0.9 | 0.966 | 14.4792 | 118.2664 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.9536 | 125.3305 | 107.6763 | 112.1488 | 100.7026 | 73.0699 | 75.9515 | 28.2884 | 18.6045 | 19.0646 | 16.6527 | 17.9536 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.0132 | 114.5121 | 82 | Complete curve; high efficacy | -7.8792 | 2.0479 | 0.9903 | 14.6838 | 129.1959 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.3585 | 136.7296 | 116.4775 | 107.7082 | 42.6989 | 23.6219 | 11.1681 | 15.7268 | 18.0954 | 13.3214 | 14.3346 | 13.3585 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.1321 | 156.0134 | 82 | Complete curve; high efficacy | -6.8792 | 0.4 | 0.9789 | -13.9595 | 142.0539 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.982 | 129.411 | 119.3857 | 103.9503 | 100.8911 | 63.908 | 56.4902 | 49.4204 | 32.4488 | 5.1022 | 3.5537 | 2.982 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 3.7221 | 84.0366 | 82 | Complete curve; high efficacy | -5.4292 | 1.9887 | 0.8892 | 33.1062 | 117.1428 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.583 | 104.9664 | 128.4651 | 118.0164 | 124.0429 | 93.0546 | 124.0918 | 125.7379 | 103.1971 | 56.4284 | 52.5045 | 22.583 | QC'd by XcessBio | |||||||||||||||
| Cytotoxic | 1.3207 | 84.3781 | 82 | Complete curve; high efficacy | -5.8792 | 4.4495 | 0.9108 | 28.6573 | 113.0354 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 50.6955 | 98.1375 | 111.271 | 125.1555 | 106.5195 | 116.7283 | 107.7109 | 122.3031 | 49.8241 | 27.9365 | 5.972 | 50.6955 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.5258 | 93.3798 | 82 | Complete curve; high efficacy | -6.2792 | 2.3332 | 0.983 | 19.1033 | 112.4831 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.8591 | 105.468 | 124.7832 | 114.5473 | 109.601 | 102.2654 | 109.9065 | 61.3632 | 23.8506 | 21.1462 | 20.5224 | 16.8591 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0526 | 98.0552 | 82 | Complete curve; high efficacy | -7.2792 | 1.5095 | 0.9868 | 15.7184 | 113.7736 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.9644 | 114.8405 | 118.2779 | 99.4879 | 95.3835 | 61.4123 | 21.1637 | 23.8746 | 15.9208 | 20.0472 | 11.5883 | 12.9644 | QC'd by Axon Medchem |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0105 | 76.7421 | 98 | Complete curve; high efficacy | -7.9792 | 0.4 | 0.8143 | 106.1488 | 182.891 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 97.0213 | 175.2098 | 149.2496 | 135.4049 | 151.407 | 123.166 | 130.2765 | 116.1855 | 114.3842 | 112.5027 | 122.7118 | 97.0213 | QC'd by SigmaAldrich | |||||||||||||||
| Cytotoxic | 0.0209 | 59.6064 | 90 | Complete curve; high efficacy | -7.6792 | 2.3332 | 0.8743 | 65.0446 | 124.6509 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 42.5491 | 114.2054 | 125.0887 | 133.6383 | 90.3996 | 69.0769 | 75.4333 | 62.8924 | 74.9842 | 66.9826 | 68.2413 | 42.5491 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0187 | 99.3872 | 89 | Complete curve; high efficacy | -7.7292 | 0.7 | 0.9809 | 54.5973 | 153.9845 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 52 | 144.7606 | 143.678 | 116.2189 | 96.5819 | 92.3133 | 70.1166 | 62.4789 | 59.1128 | 61.5841 | 52.5675 | 52 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.4176 | 68.9597 | 88 | Complete curve; high efficacy | -6.3792 | 3.5117 | 0.8951 | 89.8298 | 158.7896 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 95.9522 | 121.7497 | 145.5234 | 145.5172 | 164.4127 | 183.3401 | 150.4309 | 108.3356 | 77.5118 | 95.8824 | 89.8236 | 95.9522 | QC'd by Axon Medchem | |||||||||||||||
| Cytotoxic | 0.5899 | 69.1819 | 88 | Complete curve; high efficacy | -6.2292 | 3.99 | 0.7629 | 95.3406 | 164.5224 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 109.573 | 149.3937 | 173.4718 | 129.8513 | 191.2497 | 150.3213 | 190.3378 | 133.8647 | 83.1872 | 96.4136 | 91.5262 | 109.573 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0743 | 107.0548 | 87 | Complete curve; high efficacy | -7.1292 | 0.8 | 0.9845 | 54.8206 | 161.8754 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 57.9387 | 151.8563 | 163.9611 | 143.7973 | 136.7288 | 112.9196 | 83.162 | 76.8733 | 68.1774 | 53.2269 | 52.6378 | 57.9387 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1482 | 83.5427 | 87 | Complete curve; high efficacy | -6.8292 | 4.4495 | 0.958 | 60.4745 | 144.0173 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 69.2734 | 130.5346 | 130.6652 | 147.3751 | 155.1668 | 153.9418 | 81.6955 | 63.296 | 59.2608 | 55.6163 | 55.5134 | 69.2734 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 1.177 | 117.976 | 87 | Complete curve; high efficacy | -5.9292 | 0.3 | 0.8809 | 103.6252 | 221.6012 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 124.3584 | 204.1012 | 213.7323 | 210.6584 | 195.2614 | 187.4914 | 165.4267 | 159.6533 | 180.5857 | 156.7486 | 132.0473 | 124.3584 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.0059 | 86.112 | 87 | Complete curve; high efficacy | -8.2292 | 3.9295 | 0.9408 | 35.788 | 121.9 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.9728 | 119.2292 | 123.804 | 60.9061 | 49.6123 | 39.0107 | 36.6521 | 41.3552 | 44.3418 | 29.6223 | 31.9796 | 16.9728 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.6619 | 77.7986 | 87 | Complete curve; high efficacy | -6.1792 | 1.4641 | 0.9055 | 87.7533 | 165.5518 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 81.2811 | 136.4201 | 144.0668 | 155.7612 | 179.4399 | 178.5787 | 159.509 | 126.3915 | 103.3855 | 100.1929 | 87.1849 | 81.2811 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1321 | 89.8904 | 86 | Complete curve; high efficacy | -6.8792 | 0.8 | 0.951 | 49.0129 | 138.9033 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 40.8231 | 126.0203 | 148.1813 | 124.8099 | 131.8805 | 103.3715 | 79.0164 | 73.446 | 67.021 | 55.4405 | 53.3845 | 40.8231 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.4176 | 102.2587 | 86 | Complete curve; high efficacy | -6.3792 | 0.9 | 0.9558 | 64.4239 | 166.6826 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 62.0508 | 169.9186 | 163.4857 | 169.1241 | 146.548 | 155.8497 | 143.5232 | 95.5095 | 85.8266 | 89.7822 | 63.0216 | 62.0508 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 1.4818 | 76.0482 | 86 | Complete curve; high efficacy | -5.8292 | 1.6436 | 0.9611 | 86.8287 | 162.8769 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 82.8262 | 126.6031 | 167.7674 | 148.1546 | 170.4052 | 160.7596 | 163.2256 | 153.9322 | 115.8888 | 102.7391 | 87.3843 | 82.8262 | QC'd by Microsource | |||||||||||||||
| Cytotoxic | 0.935 | 70.2991 | 85 | Complete curve; high efficacy | -6.0292 | 1.1 | 0.9449 | 64.9721 | 135.2712 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.1264 | 136.8416 | 133.7919 | 124.0367 | 139.8306 | 136.3935 | 126.542 | 109.4313 | 83.562 | 79.4602 | 79.2579 | 54.1264 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1049 | 113.2337 | 85 | Complete curve; high efficacy | -6.9792 | 1.1 | 0.9467 | 39.4295 | 152.6631 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 32.5405 | 140.1803 | 150.363 | 153.1014 | 157.3692 | 94.8722 | 71.3759 | 73.0522 | 48.5931 | 36.3782 | 39.1494 | 32.5405 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0166 | 145.9135 | 85 | Complete curve; high efficacy | -7.7792 | 0.7 | 0.9824 | 29.6583 | 175.5718 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 34.6378 | 162.9357 | 140.528 | 136.1473 | 83.9944 | 77.3378 | 54.5051 | 36.9278 | 32.9789 | 33.614 | 29.9243 | 34.6378 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.7427 | 87.8078 | 85 | Complete curve; high efficacy | -6.1292 | 1.8265 | 0.89 | 61.3799 | 149.1877 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 43.6517 | 125.4482 | 151.4934 | 151.5693 | 138.7177 | 162.0934 | 165.3929 | 104.4842 | 85.5886 | 70.2374 | 69.1832 | 43.6517 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0026 | 72.1457 | 85 | Complete curve; high efficacy | -8.5792 | 1.2221 | 0.9437 | 24.7418 | 96.8875 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.2124 | 89.7403 | 60.5669 | 40.6941 | 33.8688 | 35.3476 | 27.5307 | 28.4133 | 21.9975 | 21.2917 | 22.4943 | 16.2124 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.935 | 100.6421 | 85 | Complete curve; high efficacy | -6.0292 | 0.7 | 0.923 | 61.7833 | 162.4254 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 57.3523 | 168.1282 | 144.1115 | 151.7026 | 171.4086 | 158.4019 | 133.5552 | 112.5955 | 103.3282 | 85.4669 | 88.3683 | 57.3523 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 2.6351 | 88.8323 | 85 | Complete curve; high efficacy | -5.5792 | 0.8 | 0.9009 | 92.8317 | 181.664 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 98.7032 | 172.664 | 175.775 | 187.4451 | 189.4966 | 178.714 | 170.8024 | 149.3555 | 161.8016 | 111.5356 | 120.777 | 98.7032 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.0935 | 83.1337 | 87 | Complete curve; high efficacy | -7.0292 | 0.6 | 0.9732 | 52.9139 | 136.0477 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 54.7559 | 135.1374 | 118.648 | 125.1116 | 118.3367 | 96.3669 | 79.5974 | 75.1495 | 71.3903 | 59.6922 | 54.2396 | 54.7559 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0332 | 111.7251 | 86 | Complete curve; high efficacy | -7.4792 | 0.3 | 0.9262 | 42.1257 | 153.8508 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 51.7825 | 144.6362 | 112.8549 | 103.8285 | 95.2192 | 88.9231 | 87.265 | 80.9661 | 70.7181 | 65.5995 | 53.4647 | 51.7825 | QC'd by Cayman | |||||||||||||||
| Cytotoxic | 0.0418 | 82.7514 | 85 | Complete curve; high efficacy | -7.3792 | 0.5 | 0.9759 | 33.8657 | 116.617 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 28.5726 | 108.622 | 98.6869 | 93.7987 | 83.8286 | 67.4168 | 56.4383 | 56.9697 | 48.1109 | 46.3428 | 37.7443 | 28.5726 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0296 | 92.0907 | 85 | Complete curve; high efficacy | -7.5292 | 0.5 | 0.9383 | 35.476 | 127.5667 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.5556 | 114.1336 | 120.8945 | 88.7261 | 81.5755 | 76.2025 | 54.6824 | 55.6484 | 57.3045 | 45.911 | 37.1374 | 29.5556 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.1865 | 70.3869 | 84 | Complete curve; high efficacy | -6.7292 | 2.7202 | 0.9761 | 38.0815 | 108.4684 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 47.1917 | 108.8739 | 108.2531 | 101.5408 | 112.4163 | 108.1385 | 70.3357 | 43.6652 | 34.5392 | 28.361 | 41.6648 | 47.1917 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.4176 | 71.6673 | 84 | Complete curve; high efficacy | -6.3792 | 2.4064 | 0.9479 | 43.4067 | 115.074 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 33.3089 | 105.574 | 126.981 | 118.3238 | 117.612 | 103.7019 | 109.6834 | 63.4438 | 52.5864 | 53.6306 | 39.1222 | 33.3089 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.1049 | 108.1591 | 84 | Complete curve; high efficacy | -6.9792 | 0.3 | 0.955 | 31.5875 | 139.7466 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 43.3364 | 131.0144 | 114.5692 | 101.7563 | 97.1956 | 81.0289 | 79.2851 | 79.034 | 69.8399 | 55.065 | 52.7031 | 43.3364 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0166 | 112.884 | 83 | Complete curve; high efficacy | -7.7792 | 2.7202 | 0.9889 | 16.1533 | 129.0373 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.2676 | 116.3272 | 134.3166 | 126.0141 | 55.7945 | 23.8385 | 15.9339 | 16.9523 | 14.5303 | 14.2658 | 15.8321 | 13.2676 | QC'd by SIGMA | |||||||||||||||
| Cytotoxic | 0.4686 | 94.7258 | 83 | Complete curve; high efficacy | -6.3292 | 0.6 | 0.9557 | 29.0284 | 123.7542 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 35.6827 | 133.5399 | 103.9822 | 117.9539 | 112.0859 | 105.559 | 83.2992 | 74.0842 | 64.5113 | 41.0297 | 41.6372 | 35.6827 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2635 | 100.8755 | 83 | Complete curve; high efficacy | -6.5792 | 0.9 | 0.8969 | 25.7615 | 126.637 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.542 | 104.9981 | 131.3946 | 122.3505 | 135.6872 | 112.05 | 66.0485 | 57.8396 | 53.7976 | 41.5332 | 37.9975 | 4.542 | QC'd by ChemAxon | |||||||||||||||
| Cytotoxic | 0.0469 | 103.2658 | 83 | Complete curve; high efficacy | -7.3292 | 1.4787 | 0.9945 | 24.4756 | 127.7413 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.0142 | 133.8948 | 120.7681 | 119.4508 | 105.6156 | 65.7525 | 34.7398 | 31.8181 | 24.4769 | 24.1709 | 24.9208 | 22.0142 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4686 | 92.4712 | 83 | Complete curve; high efficacy | -6.3292 | 2.3332 | 0.972 | 28.9592 | 121.4304 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 29.8907 | 112.9759 | 141.5986 | 120.5517 | 113.8929 | 115.8225 | 112.4976 | 62.8706 | 33.5238 | 28.9592 | 28.8711 | 29.8907 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2348 | 89.2044 | 83 | Complete curve; high efficacy | -6.6292 | 1.4641 | 0.9775 | 29.1453 | 118.3497 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 30.577 | 122.3185 | 120.0124 | 103.9641 | 116.9025 | 116.6825 | 75.5785 | 53.397 | 29.7764 | 27.6303 | 31.594 | 30.577 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 2.6351 | 88.3639 | 83 | Complete curve; high efficacy | -5.5792 | 1 | 0.8333 | 53.4354 | 141.7993 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 69.1826 | 150.707 | 126.8073 | 140.1173 | 122.6532 | 128.5218 | 127.1755 | 136.3873 | 123.3444 | 63.4982 | 61.6305 | 69.1826 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 1.049 | 94.6969 | 82 | Complete curve; high efficacy | -5.9792 | 1.9282 | 0.9864 | 26.5166 | 121.2135 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.4036 | 111.8163 | 115.5011 | 118.7274 | 126.8177 | 125.7155 | 124.4111 | 99.2392 | 53.4896 | 34.1597 | 26.654 | 22.4036 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.1321 | 81.4391 | 82 | Complete curve; high efficacy | -6.8792 | 1 | 0.9705 | 13.2025 | 94.6416 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.2699 | 84.6416 | 100.2144 | 88.0054 | 89.8294 | 66.8701 | 45.1052 | 25.589 | 27.2655 | 21.168 | 10.1269 | 6.2699 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0833 | 92.8523 | 82 | Complete curve; high efficacy | -7.0792 | 0.4 | 0.9706 | 12.2421 | 105.0944 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 15.2318 | 97.3014 | 84.0705 | 87.115 | 64.4661 | 59.8416 | 48.8602 | 38.5001 | 40.2779 | 31.4269 | 21.9661 | 15.2318 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0235 | 80.8069 | 82 | Complete curve; high efficacy | -7.6292 | 0.6 | 0.9889 | 14.6909 | 95.4978 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.7976 | 88.1312 | 84.022 | 66.5827 | 54.9265 | 41.2161 | 33.272 | 29.0748 | 23.7083 | 16.2035 | 15.8475 | 11.7976 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0012 | 59.1239 | 82 | Complete curve; partial efficacy | -8.9292 | 4.9549 | 0.8587 | 99.4449 | 158.5687 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 103.2631 | 152.6148 | 94.4922 | 95.0001 | 94.3426 | 94.4109 | 100.4664 | 111.3588 | 107.5709 | 103.8685 | 92.1541 | 103.2631 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.4176 | 94.6905 | 82 | Complete curve; high efficacy | -6.3792 | 2.1876 | 0.9861 | 24.3029 | 118.9934 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.4583 | 113.0531 | 121.9635 | 115.8336 | 128.0296 | 109.3466 | 109.2746 | 55.2918 | 34.1038 | 26.5126 | 20.0235 | 21.4583 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 0.1482 | 96.1905 | 85 | Complete curve; high efficacy | -6.8292 | 3.9295 | 0.9924 | 44.5048 | 140.6953 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 37.5464 | 136.9515 | 141.9942 | 144.5132 | 137.0086 | 139.2747 | 69.4708 | 50.2051 | 43.4747 | 41.4134 | 50.9304 | 37.5464 | QC'd by JohnsHopkins | |||||||||||||||
| Cytotoxic | 0.0129 | 83.5366 | 84 | Complete curve; high efficacy | -7.8904 | 1.4787 | 0.9978 | 23.8147 | 107.3513 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 23.9151 | 110.1823 | 102.3434 | 96.9951 | 70.7527 | 40.6202 | 28.66 | 25.8815 | 24.6553 | 21.8719 | 25.2135 | 23.9151 | QC'd by Chemscene | |||||||||||||||
| Cytotoxic | 0.0235 | 92.4647 | 84 | Complete curve; high efficacy | -7.6292 | 1.9673 | 0.9567 | 23.2254 | 115.6902 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.0573 | 111.7434 | 116.8232 | 109.3919 | 75.4472 | 32.9909 | 33.7059 | 30.0263 | 30.2649 | 32.1706 | 12.7685 | 4.0573 | QC'd by ChemieTek | |||||||||||||||
| Cytotoxic | 0.2881 | 75.8805 | 84 | Complete curve; high efficacy | -6.5404 | 1.8265 | 0.9683 | 41.6685 | 117.5491 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 36.3204 | 119.5479 | 107.4971 | 113.5971 | 126.3084 | 112.3175 | 118.4846 | 79.9745 | 45.9661 | 45.1223 | 48.3071 | 36.3204 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.2957 | 81.0096 | 84 | Complete curve; high efficacy | -6.5292 | 3.1925 | 0.9261 | 40.4734 | 121.483 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.322 | 115.4342 | 118.2478 | 121.3497 | 132.2979 | 117.0883 | 107.0927 | 49.9135 | 46.6548 | 51.6487 | 50.6374 | 11.322 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Cytotoxic | 0.2635 | 116.5095 | 84 | Complete curve; high efficacy | -6.5792 | 0.6 | 0.9706 | 41.249 | 157.7585 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 40.8193 | 148.2389 | 152.8144 | 145.5181 | 150.8832 | 117.9007 | 95.7355 | 82.3682 | 80.7695 | 61.7212 | 51.1085 | 40.8193 | QC'd by Toronto Research | |||||||||||||||
| Cytotoxic | 0.0526 | 88.208 | 83 | Complete curve; high efficacy | -7.2792 | 1.2876 | 0.9942 | 23.4223 | 111.6302 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.5003 | 110.0308 | 111.5061 | 103.8454 | 94.6012 | 59.3844 | 38.8394 | 30.8492 | 24.8325 | 26.4131 | 22.2217 | 17.5003 | QC'd by LC Labs | |||||||||||||||
| Cytotoxic | 0.0526 | 75.9024 | 83 | Complete curve; high efficacy | -7.2792 | 2.0479 | 0.9737 | 21.1749 | 97.0774 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 18.3476 | 101.8034 | 86.0254 | 99.4825 | 90.0803 | 50.3844 | 29.2288 | 30.8578 | 23.3748 | 16.2456 | 14.5431 | 18.3476 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0526 | 79.9256 | 83 | Complete curve; high efficacy | -7.2792 | 1.3723 | 0.9663 | 23.9977 | 103.9232 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.6139 | 98.4232 | 100.1087 | 114.2863 | 77.5004 | 61.6508 | 32.0154 | 31.6054 | 25.7323 | 23.8408 | 27.9084 | 17.6139 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0209 | 90.4807 | 83 | Complete curve; high efficacy | -7.6792 | 0.9 | 0.9775 | 17.1515 | 107.6322 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.4719 | 96.9766 | 103.3615 | 85.5749 | 58.3174 | 41.0676 | 31.1754 | 22.0076 | 23.023 | 21.4144 | 19.2811 | 6.4719 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0053 | 93.6423 | 83 | Complete curve; high efficacy | -8.2792 | 1 | 0.9697 | 14.5291 | 108.1714 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.1496 | 99.2849 | 81.9982 | 49.1336 | 31.0686 | 31.2874 | 22.5896 | 21.2096 | 13.4352 | 11.2475 | 10.2585 | 8.1496 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0148 | 94.6905 | 83 | Complete curve; high efficacy | -7.8292 | 1.1705 | 0.982 | 17.423 | 112.1135 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.0947 | 103.9614 | 109.0536 | 82.8529 | 55.0007 | 27.8871 | 30.3566 | 24.6009 | 18.1235 | 14.688 | 13.7931 | 12.0947 | QC'd by SynKinase | |||||||||||||||
| Cytotoxic | 0.0935 | 96.6424 | 83 | Complete curve; high efficacy | -7.0292 | 1.6604 | 0.9922 | 24.5734 | 121.2158 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.6091 | 121.7166 | 119.6038 | 122.5533 | 110.0231 | 90.718 | 41.6609 | 37.9316 | 22.3882 | 22.6779 | 22.4003 | 25.6091 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0469 | 82.9678 | 83 | Complete curve; high efficacy | -7.3292 | 4.9549 | 0.9179 | 22.6763 | 105.644 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.6388 | 101.9106 | 107.1814 | 103.9277 | 109.2884 | 34.5811 | 38.9659 | 38.5481 | 33.3514 | 23.3035 | 2.6195 | 2.6388 | QC'd by NCI | |||||||||||||||
| Cytotoxic | 0.0296 | 105.7871 | 83 | Complete curve; high efficacy | -7.5292 | 0.5 | 0.8834 | 22.0136 | 127.8007 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.7056 | 117.0952 | 117.3948 | 102.7791 | 58.6408 | 55.6178 | 51.2518 | 52.8649 | 46.0625 | 39.7928 | 25.4459 | 4.7056 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0209 | 126.3344 | 83 | Complete curve; high efficacy | -7.6792 | 0.8 | 0.989 | 17.1119 | 143.4463 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 16.0678 | 134.7593 | 122.167 | 111.5868 | 76.2473 | 54.6662 | 37.3452 | 23.489 | 31.1023 | 10.6587 | 18.9539 | 16.0678 | QC'd by Tocris | |||||||||||||||
| Cytotoxic | 0.0074 | 100.2703 | 83 | Complete curve; high efficacy | -8.1292 | 2.0479 | 0.9936 | 16.8213 | 117.0916 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 23.4575 | 117.6101 | 105.1974 | 73.0401 | 25.8505 | 13.918 | 14.8472 | 15.0411 | 16.0162 | 16.5042 | 18.3596 | 23.4575 | QC'd by Selleck | |||||||||||||||
| Cytotoxic | 0.0235 | 108.8889 | 82 | Complete curve; high efficacy | -7.6292 | 0.7 | 0.994 | 11.7255 | 120.6144 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 13.4791 | 114.5312 | 97.3221 | 86.1436 | 74.135 | 46.9964 | 29.7854 | 23.381 | 15.473 | 13.1449 | 13.4733 | 13.4791 | QC'd by BIOMOL | |||||||||||||||
| Cytotoxic | 0.0235 | 110.596 | 82 | Complete curve; high efficacy | -7.6292 | 1.6266 | 0.9764 | 12.0566 | 122.6526 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.2889 | 128.4612 | 120.2462 | 94.575 | 86.249 | 20.7415 | 16.1119 | 13.6858 | 12.9514 | 13.591 | 13.5681 | 12.2889 | QC'd by FLUKA | |||||||||||||||
| Cytotoxic | 0.0418 | 84.2481 | 82 | Complete curve; high efficacy | -7.3792 | 0.8 | 0.9425 | 13.6326 | 97.8807 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.9077 | 82.5934 | 102.655 | 86.9085 | 64 | 41.114 | 32.793 | 28.1192 | 27.8185 | 19.7373 | 7.4804 | 6.9077 | QC'd by Otava |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 9.3495 | 37.1145 | 0 | Partial curve; high efficacy; poor fit | -5.0292 | 4.5045 | 0.3394 | 139.866 | 102.7515 | 2.3 | 0 0 0 0 0 0 0 1 0 0 1 | 88.0524 | 128.0096 | 112.7233 | 88.6255 | 79.2461 | 88.4591 | 116.5125 | 107.4342 | 40.612 | 105.1422 | 136.3749 | 88.0524 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 142.8394 | 114.1417 | 111.508 | 167.841 | 110.3078 | 162.3881 | 116.8787 | 143.5866 | 138.3617 | 142.2804 | 96.0848 | 142.8394 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 0.0066 | 105.2593 | 0 | Complete curve; high efficacy; poor fit | -8.1792 | 0.7 | 0.8893 | 112.3492 | 217.6086 | 1.3 | 0 0 1 0 0 0 0 0 0 0 1 | 149.7744 | 206.0416 | 175.7962 | 99.9709 | 145.4635 | 125.3281 | 120.2334 | 135.1946 | 115.4803 | 122.2618 | 90.372 | 149.7744 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 29.4231 | 126.3953 | 81.165 | 86.1405 | 110.3352 | 124.4199 | 134.8609 | 111.8128 | 89.3843 | 231.3882 | 107.4383 | 29.4231 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 0 | 5 | 143.6153 | 87.7329 | 109.6233 | 117.133 | 130.2435 | 108.0073 | 71.945 | 131.4159 | 458.2894 | 127.4181 | 102.4514 | 143.6153 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 20.931 | 115.7607 | 0 | Partial curve; high efficacy; poor fit | -4.6792 | 4.5045 | 0.6728 | 52.682 | 168.4428 | 2.3 | 0 0 0 0 0 0 0 0 1 0 0 | 57.3383 | 156.9875 | 210.0745 | 196.4426 | 169.3007 | 145.4793 | 168.5143 | 122.6219 | 177.1228 | 240.8839 | 147.1926 | 57.3383 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -4.8792 | 3.5117 | 0.7454 | 3.7363 | 121.3761 | 4 | 1 0 0 0 0 0 0 0 0 0 0 | 4.9959 | 69.8483 | 72.4018 | 110.8591 | 122.5541 | 161.1408 | 130.7083 | 144.5237 | 100.537 | 122.3534 | 47.4563 | 4.9959 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 11.7704 | 120.3803 | 0 | Partial curve; high efficacy; poor fit | -4.9292 | 4.9549 | 0.6857 | 256.5786 | 136.1982 | 2.3 | 0 0 0 0 0 0 0 0 0 0 1 | 129.6573 | 124.8033 | 153.6337 | 147.2807 | 166.633 | 130.3024 | 101.8421 | 144.7083 | 155.0295 | 116.7688 | 231.6699 | 129.6573 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 123.0403 | 128.8699 | 210.7699 | 190.2566 | 146.8479 | 215.4495 | 109.2714 | 124.0291 | 164.0907 | 204.8081 | 137.4596 | 123.0403 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 3.7221 | 32.6568 | 0 | Complete curve; high efficacy; poor fit | -5.4292 | 4.9549 | 0.4276 | 89.2254 | 121.8822 | 1.3 | 0 1 0 0 0 0 0 0 0 0 0 | 100.4672 | 87.1822 | 158.1858 | 123.8552 | 104.2031 | 121.5711 | 143.849 | 137.3495 | 134.3819 | 92.8337 | 79.7182 | 100.4672 | QC'd by BIOMOL | |||||||||||||||
| Activator | 1.4818 | 129.4082 | 0 | Complete curve; high efficacy; poor fit | -5.8292 | 0.9 | 0.78 | 36.537 | 165.9452 | 1.3 | 0 0 1 0 0 0 0 0 0 0 0 | 42.5687 | 179.6537 | 123.5264 | 118.8734 | 141.6283 | 179.6193 | 162.4189 | 95.5446 | 129.6678 | 48.1471 | 54.8755 | 42.5687 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0.0662 | 23.8999 | 0 | Complete curve; high efficacy; poor fit | -7.1792 | 4.9549 | 0.3972 | 157.0608 | 133.1609 | 1.3 | 0 0 0 0 1 0 0 0 0 0 0 | 156.4182 | 131.6383 | 146.4008 | 133.9209 | 120.0163 | 196.9193 | 161.7274 | 189.7061 | 147.8016 | 155.1127 | 132.5334 | 156.4182 | QC'd by BIOMOL | |||||||||||||||
| Activator | 1.6626 | 39.682 | 0 | Complete curve; high efficacy; poor fit | -5.7792 | 4.9549 | 0.6393 | 68.8456 | 108.5275 | 1.3 | 0 0 0 0 0 0 0 0 1 0 0 | 58.2968 | 104.9015 | 85.3011 | 114.5667 | 123.321 | 105.3304 | 99.8094 | 125.7757 | 85.4017 | 139.4605 | 80.254 | 58.2968 | QC'd by BIOMOL | |||||||||||||||
| Activator | 7.4266 | 132.8913 | 0 | Complete curve; high efficacy; poor fit | -5.1292 | 1.9673 | 0.5196 | 45.9316 | 178.823 | 1.3 | 0 0 0 0 0 0 1 0 0 0 0 | 46.3684 | 155.3315 | 110.8327 | 150.523 | 132.3744 | 223.2312 | 259.9272 | 370.7888 | 225.3172 | 120.4312 | 80.8278 | 46.3684 | QC'd by BIOMOL | |||||||||||||||
| Activator | 26.3506 | 64.9742 | 0 | Partial curve; high efficacy; poor fit | -4.5792 | 4.5045 | 0.7787 | 65.5932 | 130.5675 | 2.3 | 0 0 0 0 0 0 0 1 0 0 0 | 70.9665 | 137.7579 | 130.009 | 140.9582 | 142.8709 | 108.0684 | 128.1229 | 122.7238 | 83.1025 | 134.1418 | 125.1981 | 70.9665 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0.0662 | 42.9607 | 0 | Complete curve; high efficacy; poor fit | -7.1792 | 4.9549 | 0.3774 | 171.918 | 128.9573 | 1.3 | 0 0 0 0 1 0 0 0 0 0 0 | 186.2327 | 131.3763 | 114.3898 | 169.2145 | 100.0259 | 417.4076 | 185.7832 | 137.3011 | 196.8317 | 196.7498 | 128.9228 | 186.2327 | QC'd by BIOMOL | |||||||||||||||
| Activator | 20.931 | 357.0759 | 0 | Partial curve; high efficacy | -4.6792 | 1.6266 | 0.9443 | 496.1622 | 139.0863 | 2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 450.0879 | 120.9857 | 123.3915 | 150.1624 | 127.9468 | 154.6912 | 129.5912 | 127.2593 | 186.5804 | 191.2598 | 245.2113 | 450.0879 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -5.5292 | 3.1925 | 0.6838 | 22.4254 | 105.7286 | 4 | 0 0 0 0 0 1 0 0 0 0 0 | 26.5078 | 99.369 | 74.6534 | 92.2028 | 101.9959 | 99.5674 | 165.511 | 173.0397 | 87.2348 | 39.9146 | 14.0508 | 26.5078 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 4.6859 | 57.8133 | 0 | Complete curve; high efficacy; poor fit | -5.3292 | 4.9549 | 0.7192 | 154.7956 | 96.9823 | 1.3 | 0 0 0 1 0 0 0 0 0 0 0 | 156.3746 | 97.7645 | 116.0346 | 97.6905 | 140.5417 | 97.0357 | 110.7006 | 102.9928 | 57.4166 | 132.01 | 153.4092 | 156.3746 | QC'd by BIOMOL | |||||||||||||||
| Activator | 23.485 | 41.3394 | 0 | Partial curve; high efficacy; poor fit | -4.6292 | 1 | 0.5264 | 88.6415 | 129.9809 | 2.3 | 0 1 0 0 0 0 0 0 0 0 0 | 97.9229 | 133.6208 | 96.1141 | 131.6403 | 139.2531 | 128.2736 | 113.9247 | 123.5101 | 139.3218 | 112.8157 | 122.8129 | 97.9229 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001248848 uM | Activity at 0.0002290931 uM | Activity at 0.0004033765 uM | Activity at 0.0007802858 uM | Activity at 0.00138 uM | Activity at 0.00235 uM | Activity at 0.00481 uM | Activity at 0.00706 uM | Activity at 0.021 uM | Activity at 0.031 uM | Activity at 0.063 uM | Activity at 0.111 uM | Activity at 0.190 uM | Activity at 0.335 uM | Activity at 0.569 uM | Activity at 1.004 uM | Activity at 1.715 uM | Activity at 3.506 uM | Activity at 5.147 uM | Activity at 15.26 uM | Activity at 23.20 uM | Activity at 45.80 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Activator | 0 | 5 | 96.9812 | 124.7788 | 111.8627 | 99.1911 | 109.8132 | 115.8543 | 122.7029 | 124.9787 | 11.9636 | 106.6618 | 115.32 | 96.9812 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Activator | 5.8992 | 18.5523 | 0 | Partial curve; high efficacy; poor fit | -5.2292 | 1.5936 | 0.4036 | 98.2719 | 116.8242 | 2.3 | 0 0 0 0 0 0 0 0 0 0 1 | 112.1416 | 116.3242 | 116.0395 | 124.1925 | 105.021 | 117.4347 | 113.456 | 126.6776 | 109.8792 | 109.999 | 101.2806 | 112.1416 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0.0053 | 14 | 0 | Complete curve; high efficacy; poor fit | -8.2792 | 1.01 | 0.4672 | 116.3066 | 102.3066 | 1.3 | 0 0 0 0 0 0 0 0 0 0 0 | 115.6225 | 103.8066 | 106.9288 | 110.734 | 112.8603 | 113.7842 | 118.7801 | 117.453 | 127.3511 | 110.7768 | 108.9356 | 115.6225 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -4.7792 | 2.7202 | 0.9256 | 7.4047 | 112.2611 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 11.7612 | 91.0017 | 111.0572 | 112.5676 | 117.0089 | 126.6768 | 110.9798 | 121.4511 | 106.8272 | 107.2462 | 67.7802 | 11.7612 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 0 | 5 | 113.2428 | 112.6901 | 103.509 | 103.9003 | 102.6066 | 116.1617 | 101.937 | 105.5529 | 69.0952 | 107.2108 | 101.4004 | 113.2428 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -4.7792 | 3.132 | 0.9526 | 8.0992 | 113.0586 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 3.8949 | 109.004 | 119.742 | 107.3798 | 101.7335 | 102.3462 | 118.5813 | 117.9993 | 118.1915 | 117.6295 | 71.8786 | 3.8949 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.8792 | 1.7529 | 0.9755 | -3.302 | 111.2729 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 9.2164 | 111.826 | 113.9215 | 114.6486 | 108.2664 | 119.8515 | 109.8219 | 108.5622 | 95.889 | 98.5807 | 43.5668 | 9.2164 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 16.6261 | 24.8763 | 0 | Partial curve; high efficacy; poor fit | -4.7792 | 1.6924 | 0.3474 | 92.6528 | 117.529 | 2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 95.2635 | 108.3173 | 105.9493 | 113.7331 | 109.0795 | 117.0458 | 137.3809 | 129.6073 | 122.6355 | 108.5839 | 108.1314 | 95.2635 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 112.755 | 117.1575 | 116.8914 | 112.2579 | 112.3712 | 121.4293 | 115.3043 | 115.3089 | 107.1441 | 121.4021 | 110.4386 | 112.755 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -4.7792 | 2.1876 | 0.9885 | 10.0687 | 113.7476 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 17.4423 | 109.6122 | 112.2788 | 114.0082 | 120.8283 | 115.6809 | 111.1114 | 117.7232 | 111.2532 | 104.4167 | 66.1423 | 17.4423 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -5.5292 | 4.5045 | 0.983 | 17.5135 | 117.5997 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 12.8583 | 129.2377 | 109.7349 | 118.9217 | 115.1912 | 116.2997 | 113.6696 | 110.2515 | 109.5472 | 23.6461 | 24.0475 | 12.8583 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 18.6548 | 46.1917 | 0 | Partial curve; high efficacy; poor fit | -4.7292 | 4.5045 | 0.8247 | 65.8443 | 112.0361 | 2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 66.8775 | 99.5341 | 112.8886 | 111.9402 | 121.8966 | 115.7352 | 104.7994 | 116.4969 | 106.3102 | 117.5636 | 97.7297 | 66.8775 | QC'd by BIOMOL | |||||||||||||||
| Activator | 23.485 | 62.9557 | 0 | Partial curve; high efficacy; poor fit | -4.6292 | 4.095 | 0.8722 | 43.341 | 106.2967 | 2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 48.3003 | 107.43 | 119.6331 | 100.9738 | 99.0434 | 113.2845 | 112.3172 | 103.1487 | 97.5313 | 103.1683 | 98.0579 | 48.3003 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -6.1792 | 0.9 | 0.9914 | 13.9467 | 122.2757 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 16.0493 | 121.1837 | 125.2456 | 121.294 | 112.6383 | 110.2161 | 103.736 | 66.186 | 43.9935 | 33.7622 | 19.0904 | 16.0493 | QC'd by BIOMOL | ||||||||||||||||||
| Inactive | 0 | -4.7292 | 2.7202 | 0.9798 | 10.0162 | 112.8615 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 12.0535 | 113.9203 | 107.621 | 117.2056 | 105.2005 | 113.2177 | 112.1472 | 115.6483 | 117.9416 | 106.7652 | 77.548 | 12.0535 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 10.4904 | 33.9355 | 0 | Complete curve; high efficacy; poor fit | -4.9792 | 4.9549 | 0.8133 | 87.1253 | 121.0609 | 1.3 | 0 0 0 0 0 0 0 0 0 0 0 | 87.3266 | 113.333 | 118.7195 | 122.2141 | 120.0529 | 128.8421 | 109.7936 | 131.8841 | 120.4381 | 122.1734 | 91.044 | 87.3266 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 106.0617 | 105.15 | 95.4872 | 110.3326 | 113.665 | 116.9489 | 116.2338 | 108.1254 | 105.7991 | 103.2361 | 100.4977 | 106.0617 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inactive | 0 | -5.9792 | 1.1 | 0.9829 | 13.8927 | 96.7448 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 17.662 | 101.5453 | 96.4145 | 90.1277 | 94.5053 | 100.6076 | 78.93 | 71.9789 | 45.249 | 27.2076 | 13.5407 | 17.662 | QC'd by BIOMOL | ||||||||||||||||||
| Activator | 0.7427 | 5.4328 | 0 | Complete curve; high efficacy; poor fit | -6.1292 | 4.9549 | 0.4642 | 117.2092 | 111.7764 | 1.3 | 0 0 0 0 0 0 0 0 0 0 1 | 111.9075 | 115.2092 | 111.9615 | 115.9844 | 108.9243 | 109.7763 | 107.7652 | 113.0327 | 118.4395 | 118.7792 | 114.168 | 111.9075 | QC'd by BIOMOL | |||||||||||||||
| Activator | 0 | 5 | 109.5103 | 113.4756 | 109.9484 | 115.0474 | 114.0506 | 116.6804 | 107.3915 | 105.6838 | 121.9588 | 114.747 | 114.6431 | 109.5103 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001529332 uM | Activity at 0.0003637214 uM | Activity at 0.0006049985 uM | Activity at 0.0007847206 uM | Activity at 0.00233 uM | Activity at 0.00410 uM | Activity at 0.00702 uM | Activity at 0.012 uM | Activity at 0.021 uM | Activity at 0.043 uM | Activity at 0.064 uM | Activity at 0.189 uM | Activity at 0.345 uM | Activity at 0.568 uM | Activity at 0.973 uM | Activity at 1.726 uM | Activity at 4.529 uM | Activity at 9.061 uM | Activity at 15.16 uM | Activity at 20.54 uM | Activity at 45.68 uM | Activity at 92.75 uM | Activity at 177.7 uM | Activity at 231.2 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6.5792 | 4.9549 | 0.3504 | -2.2299 | 14.5851 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -5.3569 | 15.4746 | 25.1469 | 1.3289 | 1.4579 | 30.0921 | 12.8619 | -9.5062 | -12.2483 | -4.4439 | 20.4415 | -5.3569 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.1405 | 59.2922 | 4.5279 | 17.637 | 13.7804 | 10.6882 | -1.5038 | -3.3709 | 4.2039 | 30.3994 | -1.9986 | 0.1405 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | -8.3292 | 4.9549 | 0.7822 | -3.2687 | 22.5 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -5.2219 | 15.9277 | 28.3896 | -3.4459 | 0.9788 | -0.6642 | -4.0601 | -8.1409 | 6.6432 | -8.9739 | -5.0251 | -5.2219 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -7.1792 | 3.0654 | 0.4254 | 9 | 32.1457 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 35.3029 | 5.2775 | 41.4344 | 33.1523 | 50.3036 | 20.2436 | 7.3329 | 9.2103 | 16.6719 | 9.4507 | 14.4231 | 35.3029 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -8.3792 | 4.9549 | 0.3583 | 0.93 | 15.5 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 19.3191 | 11.4101 | 19.1762 | -0.614 | -5.8917 | -0.0058 | 21.4835 | -3.8557 | 1.8137 | -0.8127 | -2.8224 | 19.3191 | QC'd by BIOMOL | |||||||||||||||||||
| Activator | 26.3506 | 106.3181 | 0 | Single point of activity | -4.5792 | 4.9549 | 0.9501 | 95.6321 | -10.6859 | 3 | 0 0 0 0 0 0 0 0 0 0 0 | 89.5669 | -8.1996 | -4.634 | -16.5004 | -16.3027 | -20.3551 | -20.1104 | -2.4639 | -1.956 | -4.3704 | -4.1647 | 89.5669 | QC'd by BIOMOL | ||||||||||||||||
| Inactive | 0 | -9.0292 | 4.9549 | 0.3986 | 4 | -15.1512 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 11.3272 | -9.7093 | 7.8423 | 3.3761 | 3.3993 | 12.5003 | -0.1871 | -0.4744 | -2.7008 | 3.131 | -0.5831 | 11.3272 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -4.4792 | 0.8 | 0.6034 | -34.4978 | -4 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -27.0815 | -0.6401 | -2.5148 | -2.2817 | -11.0081 | 1.0964 | -8.2348 | -11.6629 | -9.9639 | -6.098 | -9.2602 | -27.0815 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -0.5346 | 21.1593 | 8.3572 | 33.0086 | 10.5883 | 22.2102 | 40.9143 | 0.4509 | 15.3039 | 15.2483 | 15.763 | -0.5346 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | -7.3792 | 4.9549 | 0.7214 | 0.1942 | 24.8634 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 4.0666 | 15.5309 | 28.0524 | 23.0389 | 33.3812 | -2.1843 | -9.3457 | 8.1115 | 11.7564 | -7.393 | -1.8671 | 4.0666 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -29.782 | -16.4018 | -13.9219 | -14.5268 | -17.1479 | -18.8724 | 16.6048 | -0.8381 | -12.8788 | -19.3078 | -27.9636 | -29.782 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -9.6121 | -3.3856 | -4.2081 | -0.1463 | -6.8307 | -5.5043 | 3.9502 | -1.1496 | -1.2765 | -3.5332 | -1.7407 | -9.6121 | QC'd by BIOMOL | |||||||||||||||||||||||
| Activator | 0.3317 | 33.6033 | 0 | Complete curve; partial efficacy; poor fit | -6.4792 | 0.7 | 0.7143 | 30.0135 | -3.5898 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 22.2786 | -3.1933 | -2.4551 | -4.0417 | 0.0215 | 12.0732 | 5.3241 | 19.2039 | 7.3986 | 43.3559 | 28.5427 | 22.2786 | QC'd by BIOMOL | ||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -9.5858 | 0.041 | -18.5471 | 2.7931 | -0.1637 | -0.4717 | -3.0273 | -11.8154 | -12.2288 | -9.8437 | -6.1918 | -9.5858 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.5442 | 42.3006 | -2.9992 | 22.39 | 37.6161 | -4.1163 | 32.1707 | 0.342 | -5.1772 | 42.8575 | -0.9173 | 3.5442 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | -6.3792 | 4.9549 | 0.3244 | -0.642 | 10 | 4 | 0 0 0 1 0 0 0 0 0 0 1 | 5.1111 | 9.829 | 12.0079 | 3.1136 | 38.3079 | -0.5321 | 25.7035 | -1.3518 | -3.035 | -0.4212 | 4.2273 | 5.1111 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -6.8792 | 4.9549 | 0.3907 | 0.623 | 8.5 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 7.3318 | 6.6121 | -0.5158 | 8.0808 | 9.1773 | 18.9883 | -0.8974 | 4.1363 | 2.4077 | -2.3975 | -0.5411 | 7.3318 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | -7.6292 | 2.2526 | 0.4672 | 6 | -9.6735 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 4.0434 | -5.2371 | -12.2279 | -11.2597 | -1.2292 | 3.2718 | -0.8651 | 26.0229 | -0.0171 | -0.6029 | 8.9518 | 4.0434 | QC'd by BIOMOL | |||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -0.5003 | -6.9544 | 28.7797 | -7.1636 | -6.641 | 1.8449 | -16.4193 | -9.0529 | -12.5437 | -4.3363 | -10.7171 | -0.5003 | QC'd by BIOMOL | |||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 9.9428 | -15.6543 | 18.1375 | -12.36 | -2.5628 | 16.0422 | -19.5863 | -8.3403 | -1.4148 | -7.2678 | 0.1307 | 9.9428 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000311982 uM | Activity at 0.0000854986 uM | Activity at 0.0001529332 uM | Activity at 0.0003637214 uM | Activity at 0.0006049985 uM | Activity at 0.0007847206 uM | Activity at 0.00233 uM | Activity at 0.00410 uM | Activity at 0.00702 uM | Activity at 0.012 uM | Activity at 0.021 uM | Activity at 0.043 uM | Activity at 0.064 uM | Activity at 0.189 uM | Activity at 0.345 uM | Activity at 0.568 uM | Activity at 0.973 uM | Activity at 1.726 uM | Activity at 4.529 uM | Activity at 9.061 uM | Activity at 15.16 uM | Activity at 20.54 uM | Activity at 45.68 uM | Activity at 92.75 uM | Activity at 177.7 uM | Activity at 231.2 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 1.177 | 177.9558 | 93 | Complete curve; high efficacy | -5.9292 | 4.4495 | 0.9941 | -184.5509 | -6.595 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -185.5575 | -4.6679 | -6.0764 | 2.0148 | -8.4168 | -11.0338 | -21.5021 | -2.901 | -155.7275 | -182.4713 | -186.415 | -185.5575 | QC'd by Toronto Research | ||||||||||||||||
| Inhibitor | 1.1471 | 185.2071 | 93 | Complete curve; high efficacy | -5.9404 | 1.21 | 0.97 | -180.9352 | 4.2719 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -177.4789 | -1.8992 | -5.8756 | 3.9529 | 36.1181 | -2.14 | -22.9111 | -15.9848 | -71.7614 | -129.8809 | -162.4978 | -177.4789 | QC'd by Selleck | ||||||||||||||||
| Inhibitor | 1.6626 | 168.1274 | 91 | Complete curve; high efficacy | -5.7792 | 3.132 | 0.9837 | -169.0446 | -0.9171 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -168.1209 | -22.0426 | -2.082 | -5.3204 | 5.5407 | 1.319 | -1.4501 | 14.7212 | -89.7232 | -163.7665 | -168.7071 | -168.1209 | QC'd by Toronto Research | ||||||||||||||||
| Inhibitor | 1.6626 | 180.9167 | 91 | Complete curve; high efficacy | -5.7792 | 3.0654 | 0.9946 | -179.0078 | 1.9089 | -1.1 | 1 0 0 0 0 0 0 0 0 0 0 | -184.1644 | 24.6062 | -0.2533 | 6.7266 | -4.2589 | 5.2703 | -6.9623 | 3.8251 | -93.9542 | -164.0777 | -181.1503 | -184.1644 | QC'd by Microsource | ||||||||||||||||
| Inhibitor | 2.5119 | 207.74 | 91 | Complete curve; high efficacy | -5.6 | 1.2876 | 1 | -191.8317 | 15.9083 | -1.1 | 0 0 0 0 | -186.9705 | 0.1857 | -67.9483 | -158.9713 | -186.9705 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 2.6351 | 194.9538 | 90 | Complete curve; high efficacy | -5.5792 | 3.132 | 0.9719 | -181.5277 | 13.4261 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -182.0412 | -10.1591 | -4.3271 | 41.7265 | 2.8061 | 30.912 | 14.2918 | 18.2215 | -27.3816 | -157.9177 | -180.8355 | -182.0412 | QC'd by Microsource | ||||||||||||||||
| Inhibitor | 2.6351 | 187.8571 | 90 | Complete curve; high efficacy | -5.5792 | 1.9673 | 0.9892 | -184.816 | 3.0411 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -185.5582 | -11.9648 | 9.2141 | -3.27 | 11.0994 | 17.1828 | -3.5684 | -6.2672 | -52.0668 | -151.5101 | -173.32 | -185.5582 | QC'd by NCGCChem | ||||||||||||||||
| Inhibitor | 1.049 | 135.3045 | 90 | Complete curve; high efficacy | -5.9792 | 1.21 | 0.9819 | -141.7236 | -6.4191 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -147.6287 | -12.4793 | -9.977 | -7.7012 | -7.9502 | -2.9377 | -8.1662 | -64.6761 | -88.8563 | -120.3966 | -133.137 | -147.6287 | QC'd by SantaCruz Bio | ||||||||||||||||
| Inhibitor | 2.8184 | 216.3846 | 90 | Complete curve; high efficacy | -5.55 | 1.6924 | 0.9997 | -186.2959 | 30.0887 | -1.1 | 0 0 0 0 | -182.6431 | 24.865 | -42.6314 | -161.1067 | -182.6431 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 2.3485 | 163.714 | 89 | Complete curve; high efficacy | -5.6292 | 2.2526 | 0.9797 | -163.714 | 0 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -160.5039 | -3.8215 | -6.7268 | -7.2153 | 21.4522 | 3.6974 | -17.7659 | -0.4266 | -46.4433 | -147.1554 | -160.0245 | -160.5039 | QC'd by Chemscene | ||||||||||||||||
| Inhibitor | 2.6351 | 163.4895 | 89 | Complete curve; high efficacy | -5.5792 | 2.9023 | 0.9893 | -160.8371 | 2.6524 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -164.4551 | -6.4389 | 12.3743 | 8.8055 | 8.3741 | 8.3794 | -11.7519 | -4.8192 | -29.5494 | -138.8745 | -157.2471 | -164.4551 | QC'd by NCGCChem | ||||||||||||||||
| Inhibitor | 4.6859 | 191.4425 | 87 | Complete curve; high efficacy | -5.3292 | 3.132 | 0.9826 | -168.3143 | 23.1281 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -166.8767 | 18.2901 | 14.4046 | 9.0452 | 34.109 | 42.8357 | 21.6911 | 10.3813 | 25.2215 | -83.459 | -167.42 | -166.8767 | QC'd by Selleck | ||||||||||||||||
| Inhibitor | 4.6859 | 162.9612 | 87 | Complete curve; high efficacy | -5.3292 | 2.2481 | 0.9856 | -169.2903 | -6.3291 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -177.4531 | -11.7541 | 3.3773 | -4.3533 | -18.2902 | -11.7259 | -2.3524 | -8.7407 | -13.4287 | -99.7645 | -147.5191 | -177.4531 | QC'd by XcessBio | ||||||||||||||||
| Inhibitor | 3.7221 | 126.7841 | 86 | Complete curve; high efficacy | -5.4292 | 1.4641 | 0.957 | -135.7206 | -8.9365 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -142.2647 | -0.6771 | -6.2358 | -11.2121 | -16.6768 | -27.3011 | -0.3514 | -8.3109 | -35.4059 | -95.2772 | -106.0275 | -142.2647 | QC'd by Toronto Research | ||||||||||||||||
| Inhibitor | 9.3495 | 220.0109 | 85 | Complete curve; high efficacy | -5.0292 | 2.3332 | 0.9927 | -186.755 | 33.2559 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -173.5087 | 27.1661 | 26.0463 | 40.0162 | 35.5618 | 41.0454 | 34.7298 | 24.2825 | 29.7949 | -6.87 | -142.7818 | -173.5087 | QC'd by Selleck | ||||||||||||||||
| Inhibitor | 10 | 130.3003 | 84 | Complete curve; high efficacy | -5 | 2.7868 | 0.9985 | -148.0456 | -17.7453 | -1.1 | 0 0 0 0 | -146.7041 | -67.4842 | -127.8599 | -147.7501 | -146.7041 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 10 | 145.2603 | 84 | Complete curve; high efficacy | -5 | 1.7885 | 0.9997 | -161.3387 | -16.0784 | -1.1 | 0 0 0 0 | -152.7828 | -41.646 | -82.1916 | -129.7354 | -152.7828 | QC'd by GVK | |||||||||||||||||||||||
| Inhibitor | 3.1623 | 82.1469 | 84 | Complete curve; high efficacy | -5.5 | 2.1876 | 1 | -81.0655 | 1.0814 | -1.1 | 0 0 0 0 | -79.882 | -22.1789 | -55.8956 | -75.2948 | -79.882 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 10 | 127.8972 | 83 | Complete curve; high efficacy | -5 | 1.6259 | 0.9999 | -122.4842 | 5.4131 | -1.1 | 0 0 0 0 | -119.3803 | -48.5016 | -88.2414 | -110.9773 | -119.3803 | QC'd by SIGMA | |||||||||||||||||||||||
| Inhibitor | 9.3495 | 66.4535 | 82 | Complete curve; high efficacy | -5.0292 | 2.2526 | 0.9036 | -65.8754 | 0.5781 | -1.1 | 0 0 0 0 0 0 1 0 0 0 0 | -62.9964 | -8.1444 | 9.5224 | 4.2202 | 2.8496 | 11.2227 | -15.5853 | 28.5669 | -1.4504 | -13.5243 | -50.6989 | -62.9964 | QC'd by Toronto Research |
| Standard Type | Standard Relation | Standard Value | Standard Units |
|---|---|---|---|
| Inhibition | = | 0.24 | % |
| Inhibition | = | 4.58 | % |
| Inhibition | = | -0.3 | % |
| Inhibition | = | -0.3 | % |
| Inhibition | = | -0.04 | % |
| Inhibition | = | -0.04 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | 0.03 | % |
| Inhibition | = | 0 | % |
| Inhibition | = | 0.03 | % |
| Inhibition | = | 0 | % |
| Inhibition | = | -0.27 | % |
| Inhibition | = | -0.27 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | -0.08 | % |
| Inhibition | = | 14.41 | % |
| Inhibition | = | 0.39 | % |
| PubChem Standard Value | Standard Type | Standard Value | Standard Units |
|---|---|---|---|
| 0.2 | Solubility | 200 | nM |
| 0.1 | Solubility | 100 | nM |
| 79.4 | Solubility | 79400 | nM |
| 741.3 | Solubility | 741300 | nM |
| 1445.4 | Solubility | 1445400 | nM |
| 151.4 | Solubility | 151400 | nM |
| 245.5 | Solubility | 245500 | nM |
| 239.9 | Solubility | 239900 | nM |
| 1445.4 | Solubility | 1445400 | nM |
| 1445.4 | Solubility | 1445400 | nM |
| 50.1 | Solubility | 50100 | nM |
| 154.9 | Solubility | 154900 | nM |
| 144.5 | Solubility | 144500 | nM |
| 10.5 | Solubility | 10500 | nM |
| 426.6 | Solubility | 426600 | nM |
| 407.4 | Solubility | 407400 | nM |
| 457.1 | Solubility | 457100 | nM |
| 9.1 | Solubility | 9100 | nM |
| 2.1 | Solubility | 2100 | nM |
| 158.5 | Solubility | 158500 | nM |
| CAS | Cell_line | rucaparib_conc | compound_conc | normalized_percent_viability | compound_name | SMILES |
|---|---|---|---|---|---|---|
| 387867-13-2 | OCI-C5x | 0 | 1.95E-8 | 98.44581603 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 0 | 7.81E-8 | 105.4182649 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 0 | 3.05E-10 | 103.4653304 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 0 | 1.25E-6 | 116.6830792 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-P5x | 0 | 5.0E-6 | 86.18167609 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-P5x | 2.0E-5 | 3.13E-7 | 146.2440526 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-P5x | 2.0E-5 | 7.81E-8 | 115.2946934 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 387867-13-2 | OCI-C5x | 1.0E-5 | 4.88E-9 | 111.5049869 | Tandutinib (MLN518) | C1=C(C(=CC2=C1N=CN=C2N3CCN(CC3)C(NC4=CC=C(C=C4)OC(C)C)=O)OC)OCCCN5CCCCC5 |
| 171235-71-5 | OCI-C5x | 0 | 1.22E-9 | 110.3190489 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 2.0E-5 | 3.13E-7 | 91.298805 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 2.0E-5 | 7.81E-8 | 90.00294196 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 5.0E-6 | 88.26242556 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 0 | 3.05E-10 | 119.5103986 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 3.13E-7 | 92.31053176 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 7.81E-8 | 92.60337348 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 1.95E-8 | 99.98664107 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-P5x | 0 | 1.25E-6 | 86.03710969 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 1.0E-5 | 5.0E-6 | 112.1402411 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 1.0E-5 | 1.25E-6 | 134.2448013 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| 171235-71-5 | OCI-C5x | 1.0E-5 | 3.13E-7 | 113.9128147 | TAPI-1 | C1=CC=C2C(=C1)C=CC(=C2)C[C@@H](C(N[C@H](C(NCCN)=O)C)=O)NC(C(CC(C)C)CC(NO)=O)=O |
| TotalNuclei_24h_A | %Pos_24h_A | TotalNuclei_24h_B | %Pos_24h_B | TotalNuclei_48h_A | %Pos_48h_A | TotalNuclei_48h_B | %Pos_48h_B | TotalNuclei_Norm_A_24h | %Pos_Norm_A_24h | TotalNuclei_Norm_B_24h | %Pos_Norm_B_24h | TotalNuclei_Norm_A_48h | %Pos_Norm_A_48h | TotalNuclei_Norm_B_48h | %Pos_Norm_B_48h | Avg_TotalNuclei_Norm_24h | Avg_%Pos_Norm_24h | Avg_TotalNuclei_Norm_48h | Avg_%Pos_Norm_48h | Viability 24h | Viability 48h | Hit 24h | Hit 48h | Molar Concentration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1208 | 0.166 | 1233 | 0.324 | 1534 | 0.0652 | 1567 | 0.128 | 107.5241301 | 0.014207932 | 114.2526206 | 0.301056209 | 111.5408212 | -0.200936304 | 115.8595194 | -0.078440722 | 110.8883753 | 0.15763207 | 113.7001703 | -0.139688513 | High | High | Low | Low | 123 uM |
| 1278 | 0.0782 | 1173 | 0.341 | 1644 | 0.304 | 1525 | 0.262 | 113.754833 | -0.105094533 | 108.6928824 | 0.324276435 | 119.5391852 | 0.073652809 | 112.754159 | 0.076453966 | 111.2238577 | 0.109590951 | 116.1466721 | 0.075053388 | High | High | Low | Low | 41 uM |
| 1191 | 0.336 | 1251 | 0.24 | 1484 | 0.135 | 1553 | 0.258 | 106.0109594 | 0.245203592 | 115.9205421 | 0.186320973 | 107.9052012 | -0.120675332 | 114.8243993 | 0.071830244 | 110.9657507 | 0.215762282 | 111.3648002 | -0.024422544 | High | High | Low | Low | 13.7 uM |
| 1235 | 0.081 | 1129 | 0 | 1539 | 0.065 | 1463 | 0.273 | 109.9274012 | -0.101289898 | 104.615741 | -0.141493985 | 111.9043832 | -0.201166278 | 108.1700555 | 0.089169202 | 107.2715711 | -0.121391942 | 110.0372193 | -0.055998538 | High | High | Low | Low | 4.6 uM |
| 1274 | 0.0785 | 1127 | 0.177 | 1643 | 0.365 | 1410 | 0.213 | 113.3987928 | -0.104686893 | 104.4304164 | 0.100269547 | 119.4664728 | 0.143794919 | 104.2513863 | 0.019813371 | 108.9146046 | -0.002208673 | 111.8589295 | 0.081804145 | High | High | Low | Low | 1.5 uM |
| 1212 | 0 | 1184 | 0 | 1575 | 0 | 1383 | 0.0723 | 107.8801702 | -0.211352536 | 109.7121677 | -0.141493985 | 114.5220296 | -0.27590787 | 102.2550832 | -0.142826051 | 108.796169 | -0.176423261 | 108.3885564 | -0.209366961 | High | High | Low | Low | 500 nM |
| 1232 | 0 | 1268 | 0 | 1361 | 0.0735 | 1411 | 0.142 | 109.6603711 | -0.211352536 | 117.4958012 | -0.141493985 | 98.96157604 | -0.191392377 | 104.3253235 | -0.062257695 | 113.5780861 | -0.176423261 | 101.6434498 | -0.126825036 | High | High | Low | Low | 10 mM |
| 1145 | 0.0873 | 1164 | 0.258 | 1473 | 0.0679 | 1479 | 0.203 | 101.9164975 | -0.092729471 | 107.8589216 | 0.210907095 | 107.1053648 | -0.197831653 | 109.3530499 | 0.008254066 | 104.8877095 | 0.059088812 | 108.2292074 | -0.094788793 | High | High | Low | Low | 3.333 mM |
| 1374 | 0.291 | 1147 | 0.0872 | 1603 | 0.374 | 1447 | 0.0691 | 122.2997969 | 0.184057682 | 106.2836625 | -0.022387884 | 116.5579768 | 0.154143755 | 106.987061 | -0.146525029 | 114.2917297 | 0.080834899 | 111.7725189 | 0.003809363 | High | High | Low | Low | 1.111 mM |
| 1208 | 0.166 | 1215 | 0 | 1445 | 0.138 | 1552 | 0.0644 | 107.5241301 | 0.014207932 | 112.5846991 | -0.141493985 | 105.0694176 | -0.11722572 | 114.7504621 | -0.151957902 | 110.0544146 | -0.063643027 | 109.9099399 | -0.134591811 | High | High | Low | Low | 370 uM |
| 1127 | 0.177 | 1208 | 0.248 | 1448 | 0.207 | 1355 | 0.221 | 100.3143167 | 0.02915471 | 111.936063 | 0.197248139 | 105.2875548 | -0.037884645 | 100.1848429 | 0.029060815 | 106.1251899 | 0.113201424 | 102.7361989 | -0.004411915 | High | High | Low | Low | 123 uM |
| 1264 | 0.0791 | 1133 | 0.0883 | 1421 | 0.493 | 1365 | 0.147 | 112.5086924 | -0.103871615 | 104.9863902 | -0.020885398 | 103.32432 | 0.290978363 | 100.9242144 | -0.056478042 | 108.7475413 | -0.062378506 | 102.1242672 | 0.11725016 | High | High | Low | Low | 41 uM |
| 1316 | 0.076 | 1210 | 0 | 1570 | 0.318 | 1472 | 0.204 | 117.1372145 | -0.108083888 | 112.1213876 | -0.141493985 | 114.1584676 | 0.089750998 | 108.8354898 | 0.009409997 | 114.6293011 | -0.124788937 | 111.4969787 | 0.049580497 | High | High | Low | Low | 13.7 uM |
| 1347 | 0.148 | 1270 | 0.0787 | 1558 | 0.257 | 1546 | 0.259 | 119.8965258 | -0.010250432 | 117.6811258 | -0.033997997 | 113.2859188 | 0.019608888 | 114.3068392 | 0.072986175 | 118.7888258 | -0.022124215 | 113.796379 | 0.046297531 | High | High | Low | Low | 4.6 uM |
| 1211 | 0.165 | 1181 | 0.339 | 1480 | 0.27 | 1451 | 0.276 | 107.7911602 | 0.012849134 | 109.4341808 | 0.321544644 | 107.6143516 | 0.034557207 | 107.2828096 | 0.092636994 | 108.6126705 | 0.167196889 | 107.4485806 | 0.0635971 | High | High | Low | Low | 1.5 uM |
| 1192 | 0.0839 | 1269 | 0.0788 | 1480 | 0.27 | 1536 | 0.13 | 106.0999694 | -0.097349384 | 117.5884635 | -0.033861407 | 107.6143516 | 0.034557207 | 113.5674677 | -0.076128861 | 111.8442165 | -0.065605396 | 110.5909096 | -0.020785827 | High | High | Low | Low | 500 nM |
| 1241 | 0 | 1168 | 0.171 | 1489 | 0.269 | 1469 | 0.136 | 110.4614614 | -0.211352536 | 108.2295709 | 0.092074173 | 108.2687632 | 0.033407336 | 108.6136784 | -0.069193278 | 109.3455161 | -0.059639182 | 108.4412208 | -0.017892971 | High | High | Low | Low | 10 mM |
| 1139 | 0.0878 | 1049 | 0 | 1346 | 0.297 | 1327 | 0.226 | 101.3824372 | -0.092050072 | 97.2027567 | -0.141493985 | 97.87089005 | 0.065603714 | 98.11460259 | 0.034840468 | 99.29259695 | -0.116772029 | 97.99274632 | 0.050222091 | High | High | Low | Low | 3.333 mM |
| 1189 | 0.0841 | 1149 | 0.087 | 1470 | 0.34 | 1403 | 0.214 | 105.8329393 | -0.097077625 | 106.4689871 | -0.022661063 | 106.8872276 | 0.115048152 | 103.7338262 | 0.020969302 | 106.1509632 | -0.059869344 | 105.3105269 | 0.068008727 | High | High | Low | Low | 1.111 mM |
| 1239 | 0 | 1133 | 0.265 | 1476 | 0.203 | 1391 | 0.431 | 110.2834414 | -0.211352536 | 104.9863902 | 0.220468365 | 107.323502 | -0.042484127 | 102.8465804 | 0.271806223 | 107.6349158 | 0.004557914 | 105.0850412 | 0.114661048 | High | High | Low | Low | 370 uM |
| Luminescence_A_48H | Luminescence_B_48H | Luminescence_A_72H | Luminescence_B_72H | MELAS Plate 1 Z-score | MELAS Plate 2 Z-score | Rieske Plate 1 Z-score | Rieske Plate 2 Z-score | MELAS Z-score | Rieske Z-score | Positive Type |
|---|---|---|---|---|---|---|---|---|---|---|
| 165158 | 155927 | 170154 | 247648 | -0.91114795 | -0.750334054 | -0.604348285 | 0.41730416 | -0.830741002 | -0.093522062 | |
| 472324 | 375710 | 159329 | 108347 | 0.313893621 | 0.271403418 | -0.708077714 | -1.033704551 | 0.29264852 | -0.870891132 | |
| 501171 | 341374 | 180003 | 171286 | 0.428941427 | 0.111780618 | -0.509971274 | -0.378109564 | 0.270361022 | -0.444040419 | |
| 169870 | 144188 | 272757 | 235867 | -0.892355519 | -0.804906865 | 0.378834218 | 0.294589079 | -0.848631192 | 0.336711648 | |
| 98016 | 62719 | 154247 | 123580 | -1.17892414 | -1.183643756 | -0.756775447 | -0.87503221 | -1.181283948 | -0.815903829 | |
| 308171 | 142888 | 171447 | 189029 | -0.340782511 | -0.810950366 | -0.591958248 | -0.193292171 | -0.575866439 | -0.39262521 | |
| 452693 | 140371 | 108829 | 81089 | 0.235601131 | -0.822651513 | -1.191988676 | -1.317633564 | -0.293525191 | -1.25481112 | |
| 510478 | 389336 | 244397 | 68444 | 0.466059669 | 0.334748603 | 0.107077488 | -1.449348377 | 0.400404136 | -0.671135444 | |
| 497826 | 445194 | 163998 | 139340 | 0.415600875 | 0.594423881 | -0.663337511 | -0.71087045 | 0.505012378 | -0.687103981 | |
| 469027 | 415864 | 153242 | 186799 | 0.300744503 | 0.458073208 | -0.766405754 | -0.216520644 | 0.379408855 | -0.491463199 | |
| 512832 | 270806 | 216462 | 282011 | 0.475447908 | -0.216279195 | -0.160606724 | 0.775241378 | 0.129584356 | 0.307317327 | |
| 475733 | 225262 | 573472 | 467191 | 0.327489419 | -0.428006269 | 3.260404217 | 2.704142054 | -0.050258425 | 2.982273136 | Rieske |
| 508714 | 382882 | 212542 | 309826 | 0.459024472 | 0.304744946 | -0.198169714 | 1.064972301 | 0.381884709 | 0.433401293 | |
| 410000 | 370715 | 313485 | 300966 | 0.065332612 | 0.248182429 | 0.769106014 | 0.972683393 | 0.156757521 | 0.870894703 | |
| 267003 | 116383 | 227782 | 90794 | -0.504969015 | -0.934168047 | -0.05213401 | -1.216542835 | -0.719568531 | -0.634338423 | |
| 385587 | 111421 | 112292 | 108485 | -0.032031483 | -0.957235625 | -1.158804841 | -1.032267094 | -0.494633554 | -1.095535968 | |
| 205007 | 459679 | 137445 | 123652 | -0.752221892 | 0.661762425 | -0.917778853 | -0.874282233 | -0.045229733 | -0.896030543 | |
| 272034 | 316037 | 136675 | 182553 | -0.484904345 | -0.006007211 | -0.925157297 | -0.260748488 | -0.245455778 | -0.592952893 | |
| 339662 | 259651 | 116664 | 155263 | -0.215189887 | -0.26813708 | -1.116910609 | -0.545010825 | -0.241663483 | -0.830960717 | |
| 329885 | 204630 | 182799 | 151543 | -0.254182586 | -0.523921274 | -0.483178897 | -0.583759667 | -0.38905193 | -0.533469282 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000259387 uM | Activity at 0.0000710850 uM | Activity at 0.0001271514 uM | Activity at 0.0003024044 uM | Activity at 0.0005030064 uM | Activity at 0.0006524306 uM | Activity at 0.00193 uM | Activity at 0.00341 uM | Activity at 0.00584 uM | Activity at 0.010 uM | Activity at 0.018 uM | Activity at 0.052 uM | Activity at 0.078 uM | Activity at 0.156 uM | Activity at 0.276 uM | Activity at 0.478 uM | Activity at 0.883 uM | Activity at 1.507 uM | Activity at 3.884 uM | Activity at 7.354 uM | Activity at 12.96 uM | Activity at 21.63 uM | Activity at 38.41 uM | Activity at 76.33 uM | Activity at 137.0 uM | Activity at 204.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 1 | 104.9664 | 88 | Complete curve; high efficacy | -6 | 3.5117 | 0.6658 | -104.9664 | 0 | -1.1 | 0 0 0 | -97.13 | -85.6484 | -112.8671 | -97.13 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 0.3162 | 59.3278 | 88 | Complete curve; high efficacy | -6.5 | 0.8 | 1 | -84.7193 | -25.3915 | -1.1 | 0 0 0 | -83.9327 | -75.7429 | -81.922 | -83.9327 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inhibitor | 3.1623 | 20.4987 | 85 | Complete curve; high efficacy | -5.5 | 4.9549 | 0.4756 | -107.8212 | -87.3224 | -1.1 | 0 0 0 | -101.1849 | -96.9354 | -114.4343 | -101.1849 | QC'd by SIGMA | ||||||||||||||||||||||||
| Inhibitor | 0.7492 | 66.1511 | 66 | Complete curve; partial efficacy | -6.1254 | 1 | 0.8229 | -74.6135 | -8.4624 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | -67.099 | -7.8787 | -22.7216 | -1.4525 | -29.6562 | -23.5194 | -8.332 | -25.0891 | -62.4832 | -68.6466 | -63.9027 | -67.099 | QC'd by Microsource | ||||||||||||||||
| Inhibitor | 1 | 21.6845 | 66 | Complete curve; partial efficacy | -6 | 4.9549 | 0.9699 | -77.7873 | -56.1028 | -1.2 | 0 0 0 | -76.43 | -65.0857 | -78.9894 | -76.43 | QC'd by BIOMOL | ||||||||||||||||||||||||
| Inhibitor | 1.122 | 59.6758 | 65 | Complete curve; partial efficacy | -5.95 | 1.21 | 0.9999 | -66.8495 | -7.1736 | -1.2 | 0 0 0 | -66.096 | -42.6313 | -61.4055 | -66.096 | QC'd by Vitas | ||||||||||||||||||||||||
| Inhibitor | 1.9953 | 34.0263 | 64 | Complete curve; partial efficacy | -5.7 | 4.9549 | 0.9891 | -73.9118 | -39.8855 | -1.2 | 0 0 0 | -72.1972 | -47.1162 | -75.3813 | -72.1972 | QC'd by SigmaAldrich | ||||||||||||||||||||||||
| Inhibitor | 12.5893 | 37.2665 | 62 | Complete curve; partial efficacy | -4.9 | 1 | 1 | -78.1117 | -40.8452 | -1.2 | 0 0 0 | -68.8431 | -44.9463 | -54.9089 | -68.8431 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 14.1254 | 32.4297 | 62 | Complete curve; partial efficacy | -4.85 | 1.2216 | 0.9999 | -88.7022 | -56.2725 | -1.2 | 0 0 0 | -81.3177 | -58.1227 | -66.7029 | -81.3177 | QC'd by Enzo | ||||||||||||||||||||||||
| Inhibitor | 10 | 29.8983 | 62 | Complete curve; partial efficacy | -5 | 3.2975 | 0.9999 | -76.1051 | -46.2067 | -1.2 | 0 0 0 | -75.9694 | -46.234 | -54.866 | -75.9694 | QC'd by Microsource | ||||||||||||||||||||||||
| Inhibitor | 11.2202 | 26.8497 | 61 | Complete curve; partial efficacy | -4.95 | 4.095 | 0.9996 | -65.1082 | -38.2585 | -1.2 | 0 0 0 | -65.0072 | -38.2023 | -43.2866 | -65.0072 | QC'd by SigmaAldrich | ||||||||||||||||||||||||
| Inhibitor | 25.1189 | 45.7844 | 61 | Complete curve; partial efficacy | -4.6 | 1.5386 | 1 | -101.459 | -55.6745 | -1.2 | 0 0 0 | -85.8367 | -56.2934 | -62.0903 | -85.8367 | QC'd by SigmaAldrich | ||||||||||||||||||||||||
| Inhibitor | 31.6228 | 32.298 | 60 | Complete curve; partial efficacy | -4.5 | 2.1876 | 0.9999 | -141.8428 | -109.5448 | -1.2 | 0 0 0 | -129.0357 | -109.6207 | -111.066 | -129.0357 | QC'd by Microsource | ||||||||||||||||||||||||
| Inhibitor | 31.6228 | 35.9772 | 60 | Complete curve; partial efficacy | -4.5 | 1.1 | 0.9999 | -99.0432 | -63.0659 | -1.2 | 0 0 0 | -82.9526 | -64.2216 | -69.1965 | -82.9526 | QC'd by Microsource | ||||||||||||||||||||||||
| Inhibitor | 35.4813 | 37.6242 | 60 | Complete curve; partial efficacy | -4.45 | 4.9549 | 0.9762 | -81.2779 | -43.6537 | -1.2 | 0 0 0 | -66.0936 | -45.7944 | -41.8015 | -66.0936 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 35.4813 | 50.1885 | 60 | Complete curve; partial efficacy | -4.45 | 4.4495 | 0.9982 | -87.6877 | -37.4992 | -1.2 | 0 0 0 | -66.8089 | -38.2236 | -36.8414 | -66.8089 | QC'd by Pharmacopeia | ||||||||||||||||||||||||
| Inhibitor | 35.4813 | 47.3405 | 60 | Complete curve; partial efficacy | -4.45 | 4.9549 | 0.9906 | -107.1544 | -59.8139 | -1.2 | 0 0 0 | -87.9757 | -61.3159 | -58.1701 | -87.9757 | QC'd by Prestwick Chemical; Inc. | ||||||||||||||||||||||||
| Inhibitor | 5.9508 | 124.6251 | 45 | Partial curve; high efficacy | -5.2254 | 2.7202 | 0.864 | -126.7319 | -2.1068 | -2.1 | 0 0 0 0 0 0 0 0 0 0 1 | 0 | 0 | 0 | -13.748 | -1.3723 | -25.9483 | -11.2825 | 26.6518 | 8.4521 | -36.83 | -113.8031 | 0 | QC'd by ChemAxon | ||||||||||||||||
| Inhibitor | 11.8734 | 89.5441 | 42 | Partial curve; partial efficacy | -4.9254 | 1.2475 | 0.9863 | -91.1278 | -1.5837 | -2.2 | 0 0 0 0 0 1 0 0 0 0 0 | -74.7046 | 0 | 0 | 0 | -4.6868 | -8.0974 | -38.1516 | 1.1319 | -8.2196 | -21.8072 | -47.3218 | -74.7046 | QC'd by Cayman | ||||||||||||||||
| Inhibitor | 25.1189 | 267.3838 | 41 | Partial curve; partial efficacy | -4.6 | 4.9549 | 0.8835 | -100.7065 | 166.6773 | -2.2 | 0 0 0 | -71.9482 | 116.4983 | 215.4265 | -71.9482 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | FF-overN-Activity_Score | FF-overN-Curve_Description | FF-overN-Fit_LogAC50 | FF-overN-Fit_HillSlope | FF-overN-Fit_R2 | FF-overN-Fit_InfiniteActivity | FF-overN-Fit_ZeroActivity | FF-overN-Fit_CurveClass | FF-overN-Excluded_Points | FF-overN-Max_Response | FF-overN-Activity at 0.0000389080 uM | FF-overN-Activity at 0.0001066275 uM | FF-overN-Activity at 0.0001907270 uM | FF-overN-Activity at 0.0004536066 uM | FF-overN-Activity at 0.0007545096 uM | FF-overN-Activity at 0.0009786459 uM | FF-overN-Activity at 0.00290 uM | FF-overN-Activity at 0.00503 uM | FF-overN-Activity at 0.00876 uM | FF-overN-Activity at 0.015 uM | FF-overN-Activity at 0.026 uM | FF-overN-Activity at 0.052 uM | FF-overN-Activity at 0.080 uM | FF-overN-Activity at 0.235 uM | FF-overN-Activity at 0.459 uM | FF-overN-Activity at 0.740 uM | FF-overN-Activity at 1.165 uM | FF-overN-Activity at 2.228 uM | FF-overN-Activity at 5.999 uM | FF-overN-Activity at 11.47 uM | FF-overN-Activity at 19.13 uM | FF-overN-Activity at 25.10 uM | FF-overN-Activity at 57.49 uM | FF-overN-Activity at 115.7 uM | FF-overN-Activity at 221.8 uM | FF-overN-Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | -8.5233 | -2.8988 | -12.5908 | -2.7412 | -8.5233 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.3 | 4.9549 | 0.5242 | -0.0894 | -10.9265 | 4 | 0 0 0 0 | -0.0745 | -3.5393 | -17.8554 | -0.1186 | -0.0745 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.5515 | -1.0417 | -4.8967 | 0.166 | -2.5515 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.25 | 2.6384 | 0.9993 | 6 | -4.4279 | 4 | 0 0 0 0 | 5.847 | -4.5232 | -4.121 | 4.7547 | 5.847 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.2043 | 0.5279 | -0.6989 | -3.0106 | 0.2043 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -20.4584 | -16.0227 | -10.542 | -12.7 | -20.4584 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.3811 | 1.9328 | 2.0137 | 3.5425 | 0.3811 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.6 | 1.8617 | 0.9679 | -30.78 | -11.3123 | 4 | 0 0 0 0 | -27.3167 | -13.1248 | -9.8436 | -15.1075 | -27.3167 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 1.8851 | 0.9245 | -20.4108 | -4.6526 | 4 | 0 0 0 0 | -18.259 | -6.997 | -2.6272 | -8.4549 | -18.259 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 7.0749 | 12.0764 | 9.4363 | 10.9955 | 7.0749 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 2.3332 | 0.9933 | -31.579 | -4.4538 | 4 | 0 0 0 0 | -28.8158 | -5.5887 | -3.2948 | -9.4116 | -28.8158 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.8635 | 4.4516 | 3.8206 | 7.1937 | 2.8635 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -5.65 | 1.7529 | 0.9999 | 3.5 | -15.007 | 4 | 0 0 0 1 | -13.3605 | -15.0059 | -10.5774 | 2.4893 | -13.3605 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 1.9673 | 0.9934 | -42.2319 | -13.8044 | 4 | 0 0 0 0 | -38.812 | -14.9413 | -12.7536 | -21.2969 | -38.812 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.9 | 3.132 | 0.6223 | -3.5849 | -13.7261 | 4 | 0 0 0 0 | -3.8208 | -9.1712 | -18.1051 | -9.386 | -3.8208 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.45 | 0.4 | 0.8262 | 1.069 | -18.8346 | 4 | 0 0 0 0 | -2.4425 | -15.6955 | -9.0343 | -9.4911 | -2.4425 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.95 | 3.132 | 0.7705 | 1.5 | -12.3707 | 4 | 0 0 0 0 | 1.5975 | -7.9378 | -16.9756 | -5.1738 | 1.5975 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.5045 | 0.3905 | -9.2851 | -1.5746 | 4 | 0 0 0 0 | -7.9625 | -2.9788 | -14.4042 | -5.0533 | -7.9625 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.4 | 4.9549 | 0.8608 | -22.7116 | -5.6684 | 4 | 0 0 0 0 | -20.1763 | -4.2865 | -9.9046 | -3.4737 | -20.1763 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.15 | 4.9549 | 0.5637 | 1 | -8.3478 | 4 | 0 0 0 1 | -11.1241 | -3.9652 | -12.7899 | 0.2253 | -11.1241 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00457 uM | Activity at 0.00705 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.070 uM | Activity at 0.104 uM | Activity at 0.147 uM | Activity at 0.228 uM | Activity at 0.454 uM | Activity at 0.702 uM | Activity at 0.990 uM | Activity at 1.179 uM | Activity at 2.205 uM | Activity at 3.547 uM | Activity at 5.245 uM | Activity at 6.528 uM | Activity at 11.35 uM | Activity at 18.98 uM | Activity at 27.12 uM | Activity at 37.89 uM | Activity at 57.10 uM | Activity at 85.70 uM | Activity at 114.4 uM | Activity at 171.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 2.5119 | 89.963 | 85 | Complete curve; high efficacy | -5.6 | 2.4064 | 0.9988 | -81.963 | 8 | -1.1 | 0 0 0 0 | -81.0256 | 4.3424 | -26.1944 | -82.8623 | -81.0256 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 3.1623 | 94.5377 | 85 | Complete curve; high efficacy | -5.5 | 4.5045 | 0.9999 | -94.3225 | 0.2153 | -1.1 | 0 0 0 0 | -94.7013 | -0.2373 | -13.1526 | -93.6408 | -94.7013 | QC'd by SIGMA | |||||||||||||||||||||
| Cytotoxic | 2.8184 | 94.817 | 85 | Complete curve; high efficacy | -5.55 | 2.0479 | 0.9999 | -95.8221 | -1.005 | -1.1 | 0 0 0 0 | -95.0616 | -6.2542 | -35.3146 | -94.5292 | -95.0616 | QC'd by APExBIO | |||||||||||||||||||||
| Cytotoxic | 2.8184 | 90.5207 | 85 | Complete curve; high efficacy | -5.55 | 3.0654 | 0.9989 | -88.5207 | 2 | -1.1 | 0 0 0 0 | -86.8835 | 0 | -24.056 | -89.9601 | -86.8835 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 5.6234 | 96.9742 | 84 | Complete curve; high efficacy | -5.25 | 4.095 | 1 | -95.4742 | 1.5 | -1.1 | 0 0 0 0 | -95.8576 | 1.6559 | 0 | -94.7507 | -95.8576 | QC'd by SynKinase | |||||||||||||||||||||
| Cytotoxic | 3.9811 | 96.1006 | 84 | Complete curve; high efficacy | -5.4 | 4.5045 | 1 | -95.1006 | 1 | -1.1 | 0 0 0 0 | -94.9108 | 0.5692 | -4.2795 | -94.8159 | -94.9108 | QC'd by Tocris | |||||||||||||||||||||
| Cytotoxic | 2.5119 | 77.6563 | 84 | Complete curve; high efficacy | -5.6 | 2.0479 | 0.9997 | -80.7421 | -3.0858 | -1.1 | 0 0 0 0 | -80.0369 | -5.0715 | -39.0219 | -77.613 | -80.0369 | QC'd by Microsource | |||||||||||||||||||||
| Cytotoxic | 7.9433 | 99.4986 | 83 | Complete curve; high efficacy | -5.1 | 4.9549 | 0.9997 | -96.9986 | 2.5 | -1.1 | 0 0 0 0 | -96.805 | 1.2306 | 3.5418 | -95.9316 | -96.805 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 97.8358 | 83 | Complete curve; high efficacy | -5.15 | 4.9549 | 0.9993 | -95.8358 | 2 | -1.1 | 0 0 0 0 | -95.6445 | 0 | 3.4249 | -95.1788 | -95.6445 | QC'd by Tocris | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 97.3751 | 83 | Complete curve; high efficacy | -5.15 | 4.095 | 1 | -97.3751 | 0 | -1.1 | 0 0 0 0 | -97.1807 | 0 | -0.6843 | -95.5282 | -97.1807 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 102.4399 | 83 | Complete curve; high efficacy | -5.15 | 1.6924 | 0.9998 | -100.4399 | 2 | -1.1 | 0 0 0 0 | -96.7629 | 0 | -9.8984 | -85.0051 | -96.7629 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 96.3568 | 83 | Complete curve; high efficacy | -5.15 | 4.9549 | 1 | -96.3568 | 0 | -1.1 | 0 0 0 0 | -96.1644 | 0 | 0 | -95.5939 | -96.1644 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 7.0795 | 93.6127 | 83 | Complete curve; high efficacy | -5.15 | 4.9549 | 1 | -93.6127 | 0 | -1.1 | 0 0 0 0 | -93.4258 | 0 | 0 | -92.8807 | -93.4258 | QC'd by MedChem Express | |||||||||||||||||||||
| Cytotoxic | 8.9125 | 97.1357 | 83 | Complete curve; high efficacy | -5.05 | 4.9549 | 1 | -97.1357 | 0 | -1.1 | 0 0 0 0 | -96.9418 | 0 | 0 | -94.9322 | -96.9418 | QC'd by APExBIO | |||||||||||||||||||||
| Cytotoxic | 8.9125 | 105.034 | 83 | Complete curve; high efficacy | -5.05 | 1.6436 | 0.9999 | -100.034 | 5 | -1.1 | 0 0 0 0 | -94.7292 | 3.0536 | -3.9173 | -76.9038 | -94.7292 | QC'd by Glixx | |||||||||||||||||||||
| Cytotoxic | 10 | 91.3037 | 82 | Complete curve; high efficacy | -5 | 2.1876 | 1 | -85.8037 | 5.5 | -1.1 | 0 0 0 0 | -84.1212 | 4.8646 | 2.5388 | -67.7158 | -84.1212 | QC'd by SIGMA | |||||||||||||||||||||
| Cytotoxic | 10 | 98.1252 | 82 | Complete curve; high efficacy | -5 | 2.8473 | 0.9999 | -97.6252 | 0.5 | -1.1 | 0 0 0 0 | -96.8504 | 0 | 0 | -83.9555 | -96.8504 | QC'd by Cayman | |||||||||||||||||||||
| Cytotoxic | 11.2202 | 93.8772 | 82 | Complete curve; high efficacy | -4.95 | 2.4064 | 0.9998 | -92.8772 | 1 | -1.1 | 0 0 0 0 | -91.0561 | 0 | 0 | -72.1776 | -91.0561 | QC'd by Selleck | |||||||||||||||||||||
| Cytotoxic | 0.8913 | 60.2348 | 67 | Complete curve; partial efficacy | -6.05 | 3.5117 | 0.9985 | -93.1767 | -32.9418 | -1.2 | 0 0 0 0 | -93.5509 | -51.1212 | -90.8041 | -91.9137 | -93.5509 | QC'd by Selleck | |||||||||||||||||||||
| Cytotoxic | 0.7943 | 56.6802 | 67 | Complete curve; partial efficacy | -6.1 | 3.9295 | 0.9999 | -91.2497 | -34.5695 | -1.2 | 0 0 0 0 | -91.0675 | -40.2642 | -90.3425 | -90.8279 | -91.0675 | QC'd by MedChem Express |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.00457 uM | Activity at 0.00705 uM | Activity at 0.023 uM | Activity at 0.046 uM | Activity at 0.070 uM | Activity at 0.104 uM | Activity at 0.147 uM | Activity at 0.228 uM | Activity at 0.454 uM | Activity at 0.702 uM | Activity at 0.990 uM | Activity at 1.179 uM | Activity at 2.205 uM | Activity at 3.547 uM | Activity at 5.245 uM | Activity at 6.528 uM | Activity at 11.35 uM | Activity at 18.98 uM | Activity at 27.12 uM | Activity at 37.89 uM | Activity at 57.10 uM | Activity at 85.70 uM | Activity at 114.4 uM | Activity at 171.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 0.7079 | 34.8288 | 10 | Complete curve; partial efficacy; poor fit | -6.15 | 4.9549 | 0.7525 | -34.8113 | 0.0174 | -1.4 | 0 0 0 0 | -43.6793 | -3.7355 | -37.8905 | -22.6342 | -43.6793 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 35.4813 | 36.7648 | 10 | Single point of activity | -4.45 | 2.4064 | 0.8748 | -40.7648 | -4 | -3 | 0 0 0 0 | -31.8873 | -11.4596 | 0 | -6.0521 | -31.8873 | QC'd by Pharmaron | |||||||||||||||||||||
| Inhibitor | 39.8107 | 40.3927 | 10 | Single point of activity | -4.4 | 4.4495 | 0.7948 | -48.5731 | -8.1804 | -3 | 0 0 0 0 | -41.7275 | -5.1127 | -20.8986 | -3.4837 | -41.7275 | QC'd by FLUKA | |||||||||||||||||||||
| Inhibitor | 39.8107 | 36.3021 | 10 | Single point of activity | -4.4 | 4.4495 | 0.9302 | -39.3021 | -3 | -3 | 0 0 0 0 | -33.1684 | -8.7659 | 0 | -0.1246 | -33.1684 | QC'd by Prestwick | |||||||||||||||||||||
| Inhibitor | 10 | 91.8254 | 10 | Partial curve; high efficacy; poor fit | -5 | 3.9295 | 1 | -91.3254 | 0.5 | -2.3 | 1 0 0 0 | -91.1431 | -30.038 | 0 | -57.0259 | -91.1431 | QC'd by APExBIO | |||||||||||||||||||||
| Inhibitor | 39.8107 | 88.8726 | 10 | Single point of activity | -4.4 | 4.9549 | 0.9981 | -87.8726 | 1 | -3 | 0 0 0 0 | -75.3105 | 0 | 0 | 3.3645 | -75.3105 | QC'd by Microsource | |||||||||||||||||||||
| Inhibitor | 39.8107 | 39.074 | 10 | Single point of activity | -4.4 | 4.9549 | 0.9982 | -38.574 | 0.5 | -3 | 0 0 0 0 | -32.9783 | 0 | 0 | 1.4313 | -32.9783 | QC'd by Carbosynth | |||||||||||||||||||||
| Inhibitor | 17.7828 | 45.6593 | 10 | Partial curve; partial efficacy; poor fit | -4.75 | 1.9673 | 0.9887 | -54.3257 | -8.6664 | -2.4 | 0 0 0 0 | -50.2467 | -11.0836 | -6.8054 | -21.6158 | -50.2467 | QC'd by TargetMol | |||||||||||||||||||||
| Inhibitor | 39.8107 | 74.9786 | 10 | Single point of activity | -4.4 | 4.4495 | 0.9815 | -77.9786 | -3 | -3 | 0 0 0 0 | -65.3989 | -8.9317 | 0 | 0 | -65.3989 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 39.8107 | 35.788 | 10 | Single point of activity | -4.4 | 4.4495 | 0.945 | -39.8408 | -4.0529 | -3 | 0 0 0 0 | -34.034 | -8.1712 | -5.8755 | -0.0441 | -34.034 | QC'd by Adooq | |||||||||||||||||||||
| Inhibitor | 19.9526 | 98.5475 | 10 | Partial curve; high efficacy; poor fit | -4.7 | 1.9673 | 0.9936 | -101.5475 | -3 | -2.3 | 0 0 0 0 | -90.5058 | -6.6702 | 0 | -28.4282 | -90.5058 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 39.8107 | 94.2096 | 10 | Partial curve; high efficacy; poor fit | -4.4 | 4.4495 | 0.9731 | -106.3898 | -12.1802 | -2.3 | 0 0 0 0 | -90.4675 | -6.8168 | -21.693 | -10.2877 | -90.4675 | QC'd by Axon Medchem | |||||||||||||||||||||
| Inhibitor | 39.8107 | 68.3394 | 10 | Single point of activity | -4.4 | 4.9549 | 0.8933 | -61.3394 | 7 | -3 | 0 0 0 0 | -51.5329 | 0 | 0 | 21.3412 | -51.5329 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 11.2202 | 45.0575 | 10 | Partial curve; partial efficacy; poor fit | -4.95 | 1.8579 | 0.9996 | -42.5575 | 2.5 | -2.4 | 1 0 0 0 | -40.794 | -21.6798 | 0 | -20.0057 | -40.794 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 22.3872 | 113.3323 | 10 | Partial curve; high efficacy; poor fit | -4.65 | 1.6924 | 1 | -111.3323 | 2 | -2.3 | 1 0 0 0 | -91.8583 | -33.8793 | 0 | -25.3979 | -91.8583 | QC'd by Microsource | |||||||||||||||||||||
| Inhibitor | 7.0795 | 44.42 | 10 | Single point of activity | -5.15 | 4.9549 | 0.6152 | -48.42 | -4 | -3 | 0 0 0 0 | -44.8333 | -14.7954 | -20.376 | 0 | -44.8333 | QC'd by SIGMA | |||||||||||||||||||||
| Inhibitor | 39.8107 | 32.9185 | 10 | Single point of activity | -4.4 | 4.9549 | 0.6127 | -36.9185 | -4 | -3 | 0 0 0 0 | -32.0154 | 2.7163 | -20.0828 | 0 | -32.0154 | QC'd by Selleck | |||||||||||||||||||||
| Inhibitor | 39.8107 | 51.1844 | 10 | Single point of activity | -4.4 | 4.4495 | 1 | -51.1844 | 0 | -3 | 0 0 0 0 | -42.6537 | 0 | 0 | 0 | -42.6537 | QC'd by MedChem Express | |||||||||||||||||||||
| Inhibitor | 10 | 58.1799 | 10 | Partial curve; partial efficacy; poor fit | -5 | 3.5117 | 0.9887 | -59.1799 | -1 | -2.4 | 0 0 0 0 | -59.8069 | -4.8747 | 2.0564 | -35.7833 | -59.8069 | QC'd by DC Chemicals | |||||||||||||||||||||
| Inhibitor | 39.8107 | 40.2901 | 10 | Single point of activity | -4.4 | 4.4495 | 0.7334 | -45.6865 | -5.3964 | -3 | 0 0 0 0 | -38.9054 | -16.4277 | -13.0282 | -1.1636 | -38.9054 | QC'd by Adooq |
| Phenotype | Potency | Efficacy | Analysis Comment | FF-overN-Activity_Score | FF-overN-Curve_Description | FF-overN-Fit_LogAC50 | FF-overN-Fit_HillSlope | FF-overN-Fit_R2 | FF-overN-Fit_InfiniteActivity | FF-overN-Fit_ZeroActivity | FF-overN-Fit_CurveClass | FF-overN-Excluded_Points | FF-overN-Max_Response | FF-overN-Activity at 0.0000389080 uM | FF-overN-Activity at 0.0001066275 uM | FF-overN-Activity at 0.0001907270 uM | FF-overN-Activity at 0.0004536066 uM | FF-overN-Activity at 0.0007545096 uM | FF-overN-Activity at 0.0009784578 uM | FF-overN-Activity at 0.00290 uM | FF-overN-Activity at 0.00507 uM | FF-overN-Activity at 0.00876 uM | FF-overN-Activity at 0.016 uM | FF-overN-Activity at 0.026 uM | FF-overN-Activity at 0.052 uM | FF-overN-Activity at 0.080 uM | FF-overN-Activity at 0.235 uM | FF-overN-Activity at 0.459 uM | FF-overN-Activity at 0.739 uM | FF-overN-Activity at 1.169 uM | FF-overN-Activity at 2.226 uM | FF-overN-Activity at 6.007 uM | FF-overN-Activity at 11.47 uM | FF-overN-Activity at 19.12 uM | FF-overN-Activity at 25.20 uM | FF-overN-Activity at 57.49 uM | FF-overN-Activity at 115.7 uM | FF-overN-Activity at 221.8 uM | FF-overN-Activity at 288.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -6 | 3.5722 | 0.9998 | 8 | -4.573 | 4 | 0 0 0 1 | 0.0919 | -4.6442 | 3.1713 | 7.9059 | 0.0919 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.7 | 3.5722 | 0.955 | 11 | -10.4556 | 4 | 0 0 0 0 | 10.3819 | -7.9209 | -13.2963 | -7.8629 | 10.3819 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 3.9295 | 0.9982 | -20.5535 | -1.4154 | 4 | 0 0 0 0 | -20.4612 | -1.7364 | -0.7629 | -17.0693 | -20.4612 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.5 | 1 | 0.6282 | -19.163 | -1 | 4 | 0 0 0 0 | -14.3025 | 0.9125 | -7.5415 | -3.4541 | -14.3025 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.95 | 2.2526 | 0.9995 | -16.7735 | 3.5 | 4 | 0 0 0 0 | -16.7304 | 3.5028 | -6.5545 | -16.8946 | -16.7304 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5 | 0.6 | 0.9765 | -26.0622 | 0.057 | 4 | 0 0 0 0 | -20.0519 | -0.7858 | -6.9465 | -12.3383 | -20.0519 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.5 | 1.4487 | 0.9277 | -11.1274 | 1 | 4 | 0 0 0 0 | -7.6062 | 2.4742 | -0.4153 | -0.9904 | -7.6062 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.35 | 0.6 | 0.9824 | -10.0654 | 9.5 | 4 | 0 0 0 0 | -7.5545 | 7.8538 | 2.9441 | -1.9949 | -7.5545 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.4936 | 1.9596 | 1.2945 | 6.6505 | 2.4936 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.55 | 2.5334 | 0.6159 | -11.4423 | -23.9956 | 4 | 0 0 0 0 | -13.2853 | -18.831 | -28.7463 | -22.7697 | -13.2853 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.0756 | 0 | 0 | -9.752 | -4.0756 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -4.65 | 1.6436 | 0.9984 | -26.3723 | 6.5 | 4 | 0 0 0 0 | -20.7269 | 6.8952 | 5.4769 | -1.6781 | -20.7269 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.35 | 4.9549 | 0.8085 | -22.1835 | 1.5 | 4 | 0 0 0 0 | -16.8196 | 1.0548 | -3.7533 | 7.1078 | -16.8196 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -9.2421 | -7.2234 | -5.2389 | -3.1916 | -9.2421 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -12.9119 | -16.3463 | -12.7285 | -15.6237 | -12.9119 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.468 | -15.2266 | 3 | 4 | 0 0 0 0 | -8.9707 | 0 | -26.8555 | -10.0921 | -8.9707 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6823 | 3.8566 | 7.6151 | 8.0028 | 2.6823 | QC'd by Sytravon | ||||||||||||||||||||||||||||||
| Inactive | 0 | -6.8 | 4.9549 | 0.4875 | -11.1688 | 2 | 4 | 0 0 0 1 | -1.2431 | 0 | -17.6407 | -4.4754 | -1.2431 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -4.55 | 2.3531 | 0.986 | -25.9932 | 3.5 | 4 | 0 0 0 0 | -21.2443 | 5.1247 | 1.651 | 0.2461 | -21.2443 | QC'd by Sytravon | ||||||||||||||||||||||||||
| Inactive | 0 | -5.1 | 4.095 | 0.7467 | -1.9217 | 6 | 4 | 0 0 0 0 | -2.0181 | 2.9034 | 8.923 | -0.4967 | -2.0181 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000386857 uM | Activity at 0.0001060182 uM | Activity at 0.0002019424 uM | Activity at 0.0004510146 uM | Activity at 0.0009668607 uM | Activity at 0.00168 uM | Activity at 0.00290 uM | Activity at 0.00509 uM | Activity at 0.00877 uM | Activity at 0.025 uM | Activity at 0.041 uM | Activity at 0.083 uM | Activity at 0.136 uM | Activity at 0.247 uM | Activity at 0.490 uM | Activity at 1.070 uM | Activity at 2.238 uM | Activity at 4.221 uM | Activity at 6.448 uM | Activity at 12.37 uM | Activity at 30.23 uM | Activity at 57.68 uM | Activity at 114.0 uM | Activity at 227.8 uM | Activity at 383.5 uM | Activity at 573.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 3.7924 | 3.15 | 0.963 | 2.3829 | 3.4088 | 3.7221 | 3.7924 | QC'd by MedChem Express | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.2789 | 3.5102 | 1.528 | 1.9238 | 4.6346 | 6.4182 | 1.2789 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.0037 | -4.4248 | -0.615 | -1.2841 | -0.0588 | -4.0514 | 0.0037 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -3.0131 | -5.3427 | -2.388 | -5.1553 | -1.5524 | -1.7506 | -3.0131 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.373 | 0.8235 | 0.0316 | 2.107 | 1.7002 | -1.9138 | 3.373 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.2123 | -4.9482 | 0.0182 | 2.4902 | -0.0466 | 3.4729 | 2.2123 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -6.8722 | -2.3397 | -1.6401 | -4.488 | -0.7912 | -2.054 | -6.8722 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6887 | 2.9795 | 4.8757 | 2.0264 | 2.2902 | 4.458 | 2.6887 | QC'd by MedChem Express | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -3.8031 | -1.1794 | -1.5257 | -1.5947 | 1.0625 | -2.7807 | -3.8031 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -10.2079 | -6.2462 | -2.2383 | -3.1976 | -2.6796 | -7.2482 | -10.2079 | QC'd by Selleck | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.2044 | 1.1558 | 1.2797 | 1.8267 | -0.4088 | 0.0627 | 3.2044 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -8.9309 | -1.3351 | -3.9232 | -1.9433 | -5.1495 | -5.1305 | -8.9309 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.583 | -2.8916 | -5.1264 | -4.8462 | -1.1066 | 0.1205 | -2.583 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.7511 | 0.2404 | -3.0231 | -3.8049 | -6.4833 | 1.0107 | -2.7511 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.502 | 1.0269 | 0.0012 | 1.2652 | 0.3956 | 0.7999 | -4.502 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.2916 | 1.5967 | 1.7255 | 4.1293 | 0.6629 | 1.259 | 2.2916 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.0438 | -1.4768 | -0.4907 | 0.2776 | 2.287 | -0.8523 | 3.0438 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -4.3119 | -0.9159 | -1.5721 | -0.7878 | 0.5085 | -2.4781 | -4.3119 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.058 | 5.2803 | 5.2865 | 7.8954 | 10.1632 | 4.5574 | 1.058 | QC'd by Analyticon | ||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.9292 | -2.6967 | -2.5902 | -0.5082 | 2.8487 | 4.351 | 2.9292 | QC'd by Analyticon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000062633 uM | Activity at 0.0000234000 uM | Activity at 0.0000299492 uM | Activity at 0.0000680174 uM | Activity at 0.0001469594 uM | Activity at 0.0003236290 uM | Activity at 0.0006759500 uM | Activity at 0.00129 uM | Activity at 0.00271 uM | Activity at 0.00485 uM | Activity at 0.00758 uM | Activity at 0.016 uM | Activity at 0.038 uM | Activity at 0.071 uM | Activity at 0.177 uM | Activity at 0.355 uM | Activity at 0.588 uM | Activity at 1.399 uM | Activity at 1.898 uM | Activity at 4.965 uM | Activity at 9.229 uM | Activity at 17.27 uM | Activity at 44.90 uM | Activity at 91.89 uM | Activity at 155.1 uM | Activity at 231.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 9.3597 | 0 | 0 | 0 | 0 | 0 | 2.2289 | 0 | 9.3597 | QC'd by Microsource | ||||||||||||||||||||||||||
| Inactive | 0 | -4.475 | 4.9549 | 0.8748 | -21.4867 | 4 | 4 | 0 0 0 0 0 0 0 0 | -17.0722 | 6.1042 | 2.8293 | 0 | 7.4025 | 0 | 6.1286 | 5.2151 | -17.0722 | QC'd by Vitas | ||||||||||||||||||||||
| Inactive | 0 | -8.275 | 1.1705 | 0.6611 | 2 | -6.667 | 4 | 0 0 0 0 0 0 0 0 | -1.0776 | -6.3892 | -2.9698 | -1.7372 | 5.874 | 0.3532 | 2.419 | 2.3477 | -1.0776 | QC'd by Labotest | ||||||||||||||||||||||
| Inactive | 0 | -4.425 | 4.9549 | 0.4933 | -23.5282 | -3 | 4 | 0 0 0 0 0 0 0 0 | -17.9402 | 0.3948 | -8.1012 | -10.4184 | -5.5544 | 1.8102 | -4.7765 | 5.7051 | -17.9402 | QC'd by Vitas | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 7.8331 | 0 | 0 | 9.3496 | 0 | 8.3936 | 8.8574 | 0 | QC'd by Sequoia | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 2.1346 | 2.0873 | 2.8787 | 2.1981 | 0 | 1.0717 | 0 | 0 | QC'd by SIGMA | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 6.7477 | 0 | 7.719 | 6.3706 | 0 | 0 | 0 | 0 | QC'd by Prestwick | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.3259 | 8.1273 | 0 | 0 | 7.3085 | 6.1485 | 9.7634 | 0 | 1.3259 | QC'd by Enzo | ||||||||||||||||||||||||||
| Inactive | 0 | -6.775 | 4.9549 | 0.7871 | -25.4234 | -14.7892 | 4 | 1 0 0 0 0 0 0 1 | -14.8266 | -40.4001 | -18.8558 | -14.3881 | -11.9076 | -28.2695 | -23.675 | -23.6904 | -14.8266 | QC'd by Microsource | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | 0 | 3.2238 | 5.3823 | 0 | 7.5034 | 0 | 0 | QC'd by Microsource | ||||||||||||||||||||||||||
| Inactive | 0 | -4.475 | 4.9549 | 0.4377 | -10.0741 | 2 | 4 | 0 0 0 0 0 0 0 0 | -7.9784 | 0 | 0 | 6.8904 | -2.1283 | 0 | 0.7614 | 9.8865 | -7.9784 | QC'd by Labotest | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.1184 | 4.7394 | 4.4107 | -0.6138 | 5.1674 | 0 | 2.3218 | -1.3941 | -2.1184 | QC'd by Microsource | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0.2342 | 2.9725 | 5.1318 | 0 | 2.0235 | 0 | 0.0589 | 0 | QC'd by Enzo | ||||||||||||||||||||||||||
| Inactive | 0 | -8.725 | 0.6 | 0.7945 | 4.5 | -11.9886 | 4 | 0 0 0 0 0 0 0 1 | -9.0185 | -8.3238 | -0.4567 | 0.9031 | 0.0721 | 3.3394 | 7.7262 | 3.0826 | -9.0185 | QC'd by Vitas | ||||||||||||||||||||||
| Inactive | 0 | -9.125 | 4.9549 | 0.5569 | 5 | -5.3552 | 4 | 0 0 0 0 0 0 0 1 | -2.6103 | -2.796 | 6.9995 | 3.4228 | 1.6101 | 8.0983 | 7.0134 | 2.0138 | -2.6103 | QC'd by Specs | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.9896 | 0 | 0 | 9.6344 | 0 | 0 | 4.2786 | 0 | 0.9896 | QC'd by GVK | ||||||||||||||||||||||||||
| Inactive | 0 | -5.525 | 4.095 | 0.6337 | -3.6963 | 3 | 4 | 0 0 0 0 0 0 0 0 | -3.4671 | 3.2926 | 6.7211 | 0 | 4.9171 | 0 | 2.2046 | -3.4969 | -3.4671 | QC'd by Prestwick | ||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.1269 | 3.0732 | 0 | 6.5383 | 2.8274 | 0 | -3.4128 | 8.3114 | 3.1269 | QC'd by Labotest | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | 2.578 | 6.6592 | 0 | 0 | 0 | 3.3663 | 0 | QC'd by Prestwick | ||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.6761 | 0 | 0 | 8.9375 | 0 | 0 | 0.408 | 0 | 2.6761 | QC'd by Prestwick Chemical; Inc. |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000062633 uM | Activity at 0.0000234000 uM | Activity at 0.0000299492 uM | Activity at 0.0000680174 uM | Activity at 0.0001469594 uM | Activity at 0.0003236290 uM | Activity at 0.0006759500 uM | Activity at 0.00129 uM | Activity at 0.00271 uM | Activity at 0.00485 uM | Activity at 0.00758 uM | Activity at 0.016 uM | Activity at 0.038 uM | Activity at 0.071 uM | Activity at 0.177 uM | Activity at 0.355 uM | Activity at 0.588 uM | Activity at 1.399 uM | Activity at 1.898 uM | Activity at 4.965 uM | Activity at 9.229 uM | Activity at 17.27 uM | Activity at 44.90 uM | Activity at 91.89 uM | Activity at 155.1 uM | Activity at 231.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 0.0015 | 95.0131 | 100 | Complete curve; high efficacy | -8.8295 | 4.9549 | 0.995 | -92.9859 | 2.0272 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.2587 | -1.6791 | -84.9271 | -90.9202 | -90.8631 | -90.7375 | -92.2911 | -92.6732 | -94.1019 | -94.0673 | -96.0913 | -96.2587 | QC'd by SIGMA | ||||||||||||||||
| Inhibitor | 0.0017 | 96.0144 | 100 | Complete curve; high efficacy | -8.7683 | 3.2475 | 0.9987 | -95.3786 | 0.6358 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.9294 | 1.7123 | -0.1391 | -34.4453 | -93.3159 | -93.9442 | -94.1795 | -94.3745 | -94.7424 | -94.9325 | -95.6129 | -96.9294 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0017 | 101.1335 | 100 | Complete curve; high efficacy | -8.7683 | 4.5045 | 0.9988 | -96.4557 | 4.6778 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -98.6254 | 2.9383 | 5.3252 | -23.8352 | -93.6078 | -94.3407 | -94.7755 | -96.5382 | -96.9802 | -98.093 | -97.488 | -98.6254 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0014 | 95.7664 | 100 | Complete curve; high efficacy | -8.8683 | 3.0654 | 0.9932 | -91.7312 | 4.0352 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -94.3736 | 0 | 6.5073 | -50.3576 | -85.2142 | -89.4583 | -90.3553 | -90.6328 | -93.2878 | -91.6178 | -92.6738 | -94.3736 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0027 | 92.0567 | 99 | Complete curve; high efficacy | -8.575 | 3.99 | 0.9971 | -93.082 | -1.0254 | -1.1 | 0 0 0 0 0 0 0 0 | -97.5703 | -1.153 | -56.5542 | -91.9507 | -92.331 | -93.0234 | -92.9105 | -92.2466 | -97.5703 | QC'd by Alfa Aesar | |||||||||||||||||||
| Inhibitor | 0.0027 | 86.1528 | 99 | Complete curve; high efficacy | -8.575 | 4.9549 | 0.9984 | -92.0573 | -5.9045 | -1.1 | 0 0 0 0 0 0 0 0 | -92.9872 | -5.0961 | -62.3948 | -91.5014 | -91.2009 | -92.0539 | -90.8793 | -91.9519 | -92.9872 | QC'd by Microsource | |||||||||||||||||||
| Inhibitor | 0.0021 | 98.4878 | 99 | Complete curve; high efficacy | -8.675 | 4.5045 | 0.9983 | -91.9795 | 6.5083 | -1.1 | 0 0 0 0 0 0 0 0 | -94.0485 | 5.8681 | -73.3835 | -89.9758 | -90.798 | -91.9458 | -91.2065 | -93.7497 | -94.0485 | QC'd by Bosche | |||||||||||||||||||
| Inhibitor | 7.0E-4 | 82.7334 | 99 | Complete curve; high efficacy | -9.175 | 0.6 | 0.8847 | -82.6567 | 0.0767 | -1.1 | 0 0 0 0 0 0 0 0 | -94.3569 | -37.5208 | -62.7186 | -72.7916 | -74.3825 | -79.8918 | -76.6331 | -78.5528 | -94.3569 | QC'd by Selleck | |||||||||||||||||||
| Inhibitor | 0.0037 | 95.0819 | 99 | Complete curve; high efficacy | -8.4362 | 1.2221 | 0.9994 | -94.5205 | 0.5614 | -1.1 | 0 0 0 0 0 0 0 | -93.7704 | -1.1631 | 0.6157 | -11.9264 | -47.6173 | -82.383 | -92.7843 | -93.7704 | QC'd by Adooq | ||||||||||||||||||||
| Inhibitor | 0.0033 | 94.0479 | 99 | Complete curve; high efficacy | -8.4795 | 3.5117 | 0.9958 | -93.9623 | 0.0856 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -97.8774 | 1.2665 | -23.1756 | -88.8678 | -90.2585 | -91.8229 | -92.3997 | -94.1271 | -95.2991 | -93.6757 | -95.8566 | -97.8774 | QC'd by MedChem Express | ||||||||||||||||
| Inhibitor | 0.0047 | 102.0075 | 98 | Complete curve; high efficacy | -8.3295 | 2.2481 | 0.997 | -94.1763 | 7.8312 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -98.7173 | 5.6987 | -9.7434 | -65.3554 | -90.638 | -91.2058 | -92.371 | -92.7427 | -94.2549 | -94.3053 | -96.979 | -98.7173 | QC'd by GVK | ||||||||||||||||
| Inhibitor | 0.0047 | 100.429 | 98 | Complete curve; high efficacy | -8.325 | 3.6772 | 0.9994 | -93.2276 | 7.2013 | -1.1 | 0 0 0 0 0 0 0 0 | -94.7435 | 8.1328 | -8.6557 | -90.5176 | -92.1158 | -93.5383 | -93.4255 | -92.4974 | -94.7435 | QC'd by Prestwick | |||||||||||||||||||
| Inhibitor | 0.0038 | 96.7634 | 98 | Complete curve; high efficacy | -8.425 | 3.99 | 0.9994 | -92.0205 | 4.743 | -1.1 | 0 0 0 0 0 0 0 0 | -93.5167 | 4.0536 | -21.1619 | -91.8053 | -91.1174 | -91.9789 | -90.7784 | -91.2901 | -93.5167 | QC'd by Selleck | |||||||||||||||||||
| Inhibitor | 0.0045 | 90.5397 | 98 | Complete curve; high efficacy | -8.3466 | 4.5045 | 0.9995 | -92.4565 | -1.9167 | -1.1 | 0 0 0 0 0 0 0 | -93.156 | -4.128 | -89.5728 | -91.2217 | -93.3904 | -92.524 | -93.0057 | -93.156 | QC'd by Selleck | ||||||||||||||||||||
| Inhibitor | 0.0052 | 98.2987 | 98 | Complete curve; high efficacy | -8.288 | 4.9549 | 0.9993 | -92.6581 | 5.6406 | -1.1 | 0 0 0 0 0 0 0 | -93.5941 | 0 | -91.9394 | -91.381 | -91.3804 | -93.5391 | -93.3571 | -93.5941 | QC'd by ChemieTek | ||||||||||||||||||||
| Inhibitor | 0.0052 | 98.8546 | 98 | Complete curve; high efficacy | -8.288 | 0.6 | 0.9861 | -94.1197 | 4.7349 | -1.1 | 0 0 0 0 0 0 0 | -93.9318 | -33.6729 | -64.3585 | -76.1096 | -84.2151 | -92.4038 | -93.1111 | -93.9318 | QC'd by MedChem Express | ||||||||||||||||||||
| Inhibitor | 0.004 | 86.0426 | 98 | Complete curve; high efficacy | -8.3992 | 4.5045 | 0.9996 | -92.288 | -6.2454 | -1.1 | 0 0 0 0 0 0 0 | -91.795 | -7.0299 | -86.4668 | -91.4418 | -93.2202 | -92.6549 | -92.4417 | -91.795 | QC'd by Selleck | ||||||||||||||||||||
| Inhibitor | 0.0046 | 98.0203 | 98 | Complete curve; high efficacy | -8.338 | 3.5117 | 0.9996 | -93.1684 | 4.8519 | -1.1 | 0 0 0 0 0 0 0 | -93.7644 | -11.8828 | -91.4502 | -92.2553 | -94.1095 | -92.9439 | -93.2642 | -93.7644 | QC'd by SIGMA | ||||||||||||||||||||
| Inhibitor | 0.0042 | 104.4497 | 98 | Complete curve; high efficacy | -8.3795 | 4.9549 | 0.9968 | -93.9204 | 10.5293 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.6259 | 8.6675 | 7.5142 | -90.2575 | -91.0844 | -91.1114 | -92.6871 | -93.2743 | -95.4523 | -94.079 | -95.5345 | -96.6259 | QC'd by BioAustralis | ||||||||||||||||
| Inhibitor | 0.0042 | 94.9421 | 98 | Complete curve; high efficacy | -8.3795 | 2.8473 | 0.9968 | -94.7591 | 0.183 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -96.9399 | 0.6808 | -16.1375 | -78.234 | -91.1234 | -91.9081 | -92.3507 | -95.4781 | -97.4887 | -95.7111 | -95.4747 | -96.9399 | QC'd by ActiveBioChem |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000420468 uM | Activity at 0.0001060182 uM | Activity at 0.0001893301 uM | Activity at 0.0004489405 uM | Activity at 0.0009664426 uM | Activity at 0.00171 uM | Activity at 0.00292 uM | Activity at 0.00536 uM | Activity at 0.00931 uM | Activity at 0.020 uM | Activity at 0.041 uM | Activity at 0.085 uM | Activity at 0.146 uM | Activity at 0.251 uM | Activity at 0.501 uM | Activity at 1.073 uM | Activity at 2.225 uM | Activity at 4.221 uM | Activity at 6.452 uM | Activity at 12.64 uM | Activity at 29.84 uM | Activity at 57.50 uM | Activity at 114.0 uM | Activity at 227.6 uM | Activity at 379.2 uM | Activity at 573.0 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | -8.3336 | -1.4117 | -0.6141 | -1.8079 | 0.0446 | -8.3336 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5.75 | 4.9549 | 0.364 | -29.4824 | 3.3805 | 4 | 0 0 0 0 1 | -1.3954 | 3.2535 | 0.7839 | -59.1373 | 6.0E-4 | -1.3954 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -6.75 | 3.132 | 0.7843 | 0.8702 | 12.5 | 4 | 0 0 0 0 0 | 4.4963 | 10.2975 | -0.4426 | -1.3582 | 0.1626 | 4.4963 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 2.0548 | -1.7066 | -2.8833 | -2.005 | 0.3693 | 2.0548 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -5.6422 | 0.4339 | -3.0268 | -4.4255 | -2.8516 | -5.6422 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0.2315 | -0.9193 | -0.9625 | 13.7196 | -1.9704 | 0.2315 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5.05 | 4.9549 | 0.5023 | -0.0525 | 7.5 | 4 | 0 0 0 0 1 | 5.313 | 2.7111 | 12.7202 | 1.5451 | -0.0438 | 5.313 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3883 | -3.3207 | -0.3808 | -0.1461 | -2.971 | 4.3883 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 5.7635 | -0.6995 | -1.7294 | 6.1024 | 1.8317 | 5.7635 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4.3 | 1.0693 | 0.8616 | -4.2573 | 9.5 | 4 | 0 0 0 0 0 | -1.8811 | 11.1484 | 8.5502 | 5.9885 | 4.608 | -1.8811 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -1.7273 | -3.4115 | -0.1881 | -2.6331 | -1.6916 | -1.7273 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 4.3895 | -3.0627 | -1.1001 | 4.7802 | 0.8642 | 4.3895 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -5 | 4.9549 | 0.6649 | 10.5 | 0.7021 | 4 | 0 0 0 0 0 | 13.7837 | 4.4863 | -3.5816 | 7.2204 | 7.3678 | 13.7837 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 6.0179 | 3.343 | 6.8931 | 2.2936 | 4.5224 | 6.0179 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 11.3207 | 3.0878 | 5.164 | 2.5572 | 5.3615 | 11.3207 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 8.7383 | 3.2664 | 2.7307 | 3.2405 | 1.8463 | 8.7383 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4.05 | 2.7202 | 0.9497 | -18.9142 | -2.2922 | 4 | 0 0 0 0 0 | -14.0952 | -1.0768 | -4.0059 | -2.4795 | -5.6228 | -14.0952 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -7.7765 | -2.2569 | -3.9959 | -1.3451 | 0.1566 | -7.7765 | QC'd by Sytravon | |||||||||||||||||||||||||||||
| Inactive | 0 | -4 | 4.9549 | 0.7054 | -25.0658 | -0.5 | 4 | 0 0 0 0 0 | -17.5549 | -2.6051 | -3.8192 | -2.6993 | 6.0774 | -17.5549 | QC'd by Sytravon | |||||||||||||||||||||||||
| Inactive | 0 | -5.8 | 4.9549 | 0.4109 | -5.3905 | 4 | 4 | 0 0 0 0 0 | -2.4904 | 3.804 | 2.4492 | -14.0754 | 0.8551 | -2.4904 | QC'd by Sytravon |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003926931 uM | Activity at 0.0007804147 uM | Activity at 0.00118 uM | Activity at 0.00232 uM | Activity at 0.00353 uM | Activity at 0.00468 uM | Activity at 0.00703 uM | Activity at 0.014 uM | Activity at 0.021 uM | Activity at 0.041 uM | Activity at 0.063 uM | Activity at 0.122 uM | Activity at 0.190 uM | Activity at 0.286 uM | Activity at 0.563 uM | Activity at 0.859 uM | Activity at 1.138 uM | Activity at 1.709 uM | Activity at 3.373 uM | Activity at 5.124 uM | Activity at 9.921 uM | Activity at 15.37 uM | Activity at 29.76 uM | Activity at 46.08 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 14.818 | 50.7231 | 41 | Partial curve; partial efficacy | -4.8292 | 0.9 | 0.8807 | 54.2209 | 104.944 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 66.2656 | 101.903 | 115.439 | 103.799 | 102.567 | 102.876 | 104.948 | 97.8775 | 93.2447 | 97.159 | 78.0412 | 66.2656 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 1.049 | 79.5313 | 81 | Complete curve; high efficacy | -5.9792 | 1.8851 | 0.9646 | 10.5281 | 90.0594 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -3.7821 | 92.9084 | 86.5524 | 88.9758 | 94.7082 | 82.8235 | 87.7033 | 74.8976 | 28.5615 | 19.9506 | 21.5684 | -3.7821 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 16.6261 | 118.628 | 40 | Partial curve; high efficacy | -4.7792 | 1 | 0.9709 | -16.0121 | 102.616 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.7778 | 104.124 | 95.7465 | 109.29 | 105.625 | 98.8238 | 98.1055 | 101.703 | 89.9585 | 69.8008 | 53.5069 | 8.7778 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 18.6548 | 77.5002 | 20 | Partial curve; partial efficacy | -4.7292 | 2.3332 | 0.9434 | 18.2554 | 95.7555 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 19.8347 | 98.8022 | 92.8907 | 105.302 | 94.7617 | 86.4328 | 101.168 | 96.5676 | 90.4798 | 91.2243 | 70.3799 | 19.8347 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 4.6859 | 68.1888 | 21 | Complete curve; partial efficacy | -5.3292 | 3.0654 | 0.9327 | 29.2373 | 97.4261 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 33.394 | 93.72 | 98.6553 | 91.3219 | 100.534 | 101.289 | 113.289 | 83.2851 | 94.1473 | 57.7627 | 27.4112 | 33.394 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 1.3207 | 98.8766 | 80 | Complete curve; high efficacy | -5.8792 | 0.7 | 0.97 | 6.1967 | 105.073 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.7624 | 107.441 | 91.8586 | 106.704 | 98.4748 | 102.706 | 86.2461 | 62.8478 | 52.8198 | 31.9999 | 28.8143 | 8.7624 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.7292 | 0.9 | 0.6041 | 78.2653 | 102.744 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 82.345 | 102.744 | 105.642 | 94.2843 | 101.161 | 107.516 | 108.028 | 103.339 | 94.1169 | 95.3866 | 97.5226 | 82.345 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 1.3207 | 110.775 | 80 | Complete curve; high efficacy | -5.8792 | 0.8 | 0.9696 | -3.6427 | 107.132 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -3.4271 | 104.368 | 107.148 | 100.937 | 105.181 | 104.184 | 92.5459 | 64.8811 | 33.7264 | 39.5354 | 11.2501 | -3.4271 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 18.6548 | 105.111 | 20 | Partial curve; partial efficacy | -4.7292 | 0.9 | 0.9255 | -5.8485 | 99.2621 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 21.7215 | 107.878 | 91.2729 | 89.9385 | 104.02 | 105.705 | 88.3306 | 100.518 | 80.9433 | 76.5259 | 53.1208 | 21.7215 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 8.3328 | 86.2777 | 20 | Partial curve; partial efficacy | -5.0792 | 1.1 | 0.9442 | 7.2248 | 93.5025 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 17.7991 | 91.4686 | 94.9323 | 90.045 | 102.304 | 79.2054 | 102.459 | 88.2356 | 81.1333 | 58.7329 | 39.0636 | 17.7991 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 20.931 | 52.2091 | 20 | Partial curve; partial efficacy | -4.6792 | 1.8265 | 0.9328 | 52.9832 | 105.192 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 59.944 | 109.664 | 107.488 | 105.075 | 99.4401 | 103.379 | 104.521 | 109.426 | 104.787 | 95.3915 | 89.497 | 59.944 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 6.619 | 108.406 | 40 | Partial curve; high efficacy | -5.1792 | 0.8 | 0.9452 | -14.1974 | 94.2085 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | -0.5296 | 97.0972 | 92.5882 | 98.3581 | 80.5704 | 97.5771 | 87.5474 | 81.5007 | 72.1201 | 33.6196 | 35.4888 | -0.5296 | QC'd by Tocris | |||||||||||||||
| Activator | 0 | 5 | 98.367 | 100.411 | 125.501 | 101.237 | 104.372 | 114.69 | 111.449 | 113.578 | 109.066 | 104.641 | 105.572 | 98.367 | QC'd by Microsource | ||||||||||||||||||||||||
| Inactive | 0 | -4.8292 | 4.9549 | 0.5127 | 87.2712 | 99.6046 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 87.4934 | 96.1046 | 106.281 | 97.5888 | 91.2571 | 100.115 | 100.653 | 99.8934 | 101.313 | 103.822 | 92.9555 | 87.4934 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 18.6548 | 123.677 | 40 | Partial curve; high efficacy | -4.7292 | 0.9 | 0.959 | -23.8326 | 99.8445 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.9869 | 103.298 | 104.486 | 100.971 | 106.52 | 95.1676 | 95.2122 | 85.2723 | 83.2248 | 70.7812 | 53.474 | 6.9869 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.7292 | 3.0654 | 0.4521 | 75.5242 | 101.45 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 76.9764 | 94.831 | 94.8766 | 98.8404 | 87.2962 | 104.404 | 109.036 | 119.352 | 100.091 | 102.064 | 92.4269 | 76.9764 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 0.0021 | 38.4642 | 10 | Complete curve; partial efficacy; poor fit | -8.6792 | 3.5117 | 0.735 | 38.6755 | 77.1397 | -1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 50.4013 | 75.9997 | 53.8566 | 29.664 | 27.3995 | 31.871 | 38.878 | 41.9871 | 44.1 | 44.0222 | 42.1015 | 50.4013 | QC'd by BIOMOL | |||||||||||||||
| Inhibitor | 0.0053 | 59.1285 | 28 | Complete curve; partial efficacy | -8.2792 | 4.9549 | 0.958 | 43.5239 | 102.652 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 35.927 | 100.849 | 102.892 | 55.3229 | 38.8921 | 45.1454 | 52.901 | 48.6458 | 46.1041 | 42.1005 | 38.1565 | 35.927 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Inhibitor | 5.8992 | 73.8782 | 21 | Complete curve; partial efficacy | -5.2292 | 1.7137 | 0.9798 | 31.677 | 105.555 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 31.9936 | 110.951 | 110.702 | 101.775 | 102.835 | 105.882 | 102.962 | 99.3522 | 102.587 | 70.3484 | 46.6733 | 31.9936 | QC'd by Bosche | |||||||||||||||
| Inhibitor | 0.0332 | 70.0249 | 23 | Complete curve; partial efficacy | -7.4792 | 1.5579 | 0.9305 | 21.9114 | 91.9363 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 23.5109 | 91.7062 | 100.195 | 73.5537 | 72.6164 | 43.5294 | 21.1546 | 12.4956 | 13.1856 | 33.0778 | 31.9538 | 23.5109 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003926931 uM | Activity at 0.0007804147 uM | Activity at 0.00118 uM | Activity at 0.00232 uM | Activity at 0.00353 uM | Activity at 0.00468 uM | Activity at 0.00703 uM | Activity at 0.014 uM | Activity at 0.021 uM | Activity at 0.041 uM | Activity at 0.063 uM | Activity at 0.122 uM | Activity at 0.190 uM | Activity at 0.286 uM | Activity at 0.563 uM | Activity at 0.859 uM | Activity at 1.138 uM | Activity at 1.709 uM | Activity at 3.373 uM | Activity at 5.124 uM | Activity at 9.921 uM | Activity at 15.37 uM | Activity at 29.76 uM | Activity at 46.08 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 18.6548 | 34.4951 | 41 | Partial curve; partial efficacy | -4.7292 | 1.9673 | 0.9274 | 69.9387 | 104.434 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 73.1879 | 99.4338 | 106.452 | 103.657 | 105.931 | 103.698 | 108.954 | 106.235 | 100.971 | 99.7778 | 91.1091 | 73.1879 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 16.6261 | 125.293 | 40 | Partial curve; high efficacy | -4.7792 | 1.2475 | 0.9775 | -21.6097 | 103.683 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.3192 | 94.3532 | 105.391 | 101.484 | 107.355 | 105.386 | 112.085 | 102.539 | 90.757 | 78.832 | 46.9198 | 2.3192 | QC'd by Tocris | |||||||||||||||
| Activator | 0 | 5 | 94.6877 | 113.378 | 111.094 | 106.78 | 107.557 | 101.675 | 111.61 | 115.235 | 115.47 | 105.821 | 109.28 | 94.6877 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 23.485 | 37.4969 | 10 | Partial curve; partial efficacy; poor fit | -4.6292 | 1.1 | 0.8115 | 70.3954 | 107.892 | -2.4 | 0 0 0 0 0 0 0 0 0 0 0 | 80.5616 | 111.392 | 111.445 | 104.219 | 112.837 | 110.525 | 103.092 | 99.7926 | 104.941 | 104.267 | 95.8227 | 80.5616 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 13.2066 | 95.7205 | 40 | Partial curve; high efficacy | -4.8792 | 3.5722 | 0.9844 | 7.9202 | 103.641 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.0981 | 97.0208 | 96.7895 | 108.124 | 102.494 | 102.89 | 103.643 | 109.944 | 106.335 | 102.151 | 44.0773 | 8.0981 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 26.3506 | 103.679 | 10 | Single point of activity | -4.5792 | 4.9549 | 0.9811 | -1.9189 | 101.76 | -3 | 1 0 0 0 0 0 0 0 0 0 0 | 4.1751 | 6.3703 | 106.992 | 101.879 | 102.818 | 101.685 | 104.296 | 90.7108 | 103.48 | 100.054 | 95.1253 | 4.1751 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.9792 | 2.5334 | 0.4958 | 110.22 | 114.493 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 109.698 | 111.493 | 112.367 | 116.81 | 116.933 | 113.677 | 115.762 | 113.214 | 111.782 | 107.932 | 112.778 | 109.698 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 3.3173 | 108.071 | 80 | Complete curve; high efficacy | -5.4792 | 2.3332 | 0.9926 | -0.8665 | 107.204 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 1.3296 | 111.132 | 104.656 | 111.282 | 106.67 | 101.163 | 113.541 | 101.431 | 90.0709 | 24.6353 | 2.9091 | 1.3296 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.3792 | 4.9549 | 0.7206 | 87.3453 | 100.288 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 83.0857 | 101.788 | 101.025 | 100.843 | 95.8929 | 94.1551 | 103.88 | 99.413 | 103.84 | 90.9856 | 91.1194 | 83.0857 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 23.485 | 100.465 | 10 | Partial curve; high efficacy; poor fit | -4.6292 | 1.1 | 0.7538 | -10.4084 | 90.0565 | -2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 7.3914 | 96.3907 | 105.734 | 98.6036 | 97.6483 | 86.4323 | 77.1538 | 69.1243 | 70.1964 | 77.2926 | 70.7056 | 7.3914 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.8792 | 4.9549 | 0.4699 | 101.013 | 104.795 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 98.393 | 102.795 | 102.149 | 104.823 | 104.737 | 106.085 | 107.019 | 107.482 | 101.585 | 101.681 | 103.631 | 98.393 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 26.3506 | 112.031 | 40 | Partial curve; high efficacy | -4.5792 | 4.095 | 0.9893 | -5.653 | 106.378 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.4431 | 107.464 | 106.828 | 108.132 | 113.126 | 107.569 | 104.82 | 100.516 | 106.781 | 102.764 | 96.2927 | 4.4431 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -8.4792 | 4.9549 | 0.3254 | 105.011 | 110.672 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 105.918 | 110.172 | 110.982 | 100.455 | 107.597 | 103.885 | 101.019 | 104.824 | 112.319 | 103.719 | 105.539 | 105.918 | QC'd by Microsource | ||||||||||||||||||
| Inactive | 0 | -4.8792 | 0.6 | 0.838 | 93.109 | 109.84 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 97.0641 | 111.84 | 111.287 | 109.037 | 106.641 | 106.427 | 109.712 | 106.233 | 107.465 | 104.09 | 101.747 | 97.0641 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 16.6261 | 114.19 | 40 | Partial curve; high efficacy | -4.7792 | 1.1 | 0.9677 | -11.2483 | 102.941 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.3054 | 105.036 | 96.3351 | 99.5416 | 106.156 | 103.629 | 108.253 | 100.381 | 89.2188 | 74.0557 | 58.245 | 12.3054 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -8.5292 | 4.9549 | 0.3217 | 104.845 | 96.3452 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 102.941 | 96.8452 | 98.109 | 108.225 | 103.862 | 112.562 | 98.7803 | 104.204 | 109.683 | 107.415 | 97.5367 | 102.941 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 0.0042 | 75.0844 | 85 | Complete curve; high efficacy | -8.3792 | 3.6272 | 0.9242 | 26.0286 | 101.113 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 24.6026 | 101.663 | 92.4858 | 36.7868 | 6.1651 | 18.2995 | 35.773 | 32.3087 | 31.585 | 25.0624 | 32.2037 | 24.6026 | QC'd by BIOMOL | |||||||||||||||
| Inhibitor | 0.0037 | 103.451 | 81 | Complete curve; high efficacy | -8.4292 | 4.9549 | 0.9974 | 7.605 | 111.056 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.9147 | 111.584 | 101.473 | 8.46 | 12.4871 | 8.8218 | 7.9055 | 7.9452 | 5.9143 | 6.6889 | 7.5394 | 7.9147 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Activator | 0 | 5 | 96.6652 | 110.077 | 104.404 | 104.234 | 109.705 | 109.251 | 101.473 | 107.396 | 98.5584 | 108.18 | 107.907 | 96.6652 | QC'd by Bosche | ||||||||||||||||||||||||
| Inhibitor | 0.1663 | 107.524 | 80 | Complete curve; high efficacy | -6.7792 | 1.8617 | 0.9953 | 0.1865 | 107.71 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 0.6792 | 106.064 | 110.132 | 106.658 | 108.734 | 86.9112 | 53.8328 | 4.7276 | 2.3546 | 1.3344 | 0.3978 | 0.6792 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003926931 uM | Activity at 0.0007804147 uM | Activity at 0.00118 uM | Activity at 0.00232 uM | Activity at 0.00353 uM | Activity at 0.00468 uM | Activity at 0.00703 uM | Activity at 0.014 uM | Activity at 0.021 uM | Activity at 0.041 uM | Activity at 0.063 uM | Activity at 0.122 uM | Activity at 0.190 uM | Activity at 0.286 uM | Activity at 0.563 uM | Activity at 0.859 uM | Activity at 1.138 uM | Activity at 1.709 uM | Activity at 3.373 uM | Activity at 5.124 uM | Activity at 9.921 uM | Activity at 15.37 uM | Activity at 29.76 uM | Activity at 46.08 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 18.6548 | 34.9169 | 41 | Partial curve; partial efficacy | -4.7292 | 2.3332 | 0.9484 | 68.9928 | 103.91 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 69.5623 | 102.41 | 107.121 | 107.508 | 101.712 | 105.097 | 103.211 | 102.415 | 101.84 | 99.5506 | 92.1244 | 69.5623 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 26.3506 | 107.308 | 40 | Partial curve; high efficacy | -4.5792 | 4.095 | 0.9849 | -9.2991 | 98.0086 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 0.761 | 97.4921 | 101.045 | 97.4768 | 104.07 | 99.7686 | 100.128 | 94.5031 | 95.6776 | 90.2444 | 86.9022 | 0.761 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.8292 | 4.4495 | 0.723 | 85.182 | 100.358 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 85.128 | 102.358 | 99.2268 | 96.3538 | 99.621 | 101.56 | 93.5278 | 102.141 | 101.357 | 104.452 | 91.8965 | 85.128 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -5.8292 | 0.2 | 0.8518 | 78.336 | 102.324 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 82.834 | 100.324 | 96.2274 | 94.6264 | 95.7523 | 94.7947 | 92.4486 | 91.8568 | 89.4676 | 89.1807 | 90.5223 | 82.834 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 11.7704 | 70.5523 | 21 | Partial curve; partial efficacy | -4.9292 | 2.1211 | 0.9851 | 33.5106 | 104.063 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 37.4546 | 102.174 | 101.22 | 99.3429 | 104.489 | 107.049 | 104.383 | 109.687 | 104.355 | 92.867 | 58.5982 | 37.4546 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 23.485 | 96.7735 | 40 | Partial curve; high efficacy | -4.6292 | 4.095 | 0.9811 | 4.0286 | 100.802 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.6836 | 107.371 | 103.504 | 100.41 | 103.92 | 104.128 | 101.131 | 98.9149 | 97.8278 | 93.595 | 84.5787 | 11.6836 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.0292 | 4.9549 | 0.4277 | 104.452 | 99.0908 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 103.136 | 99.9521 | 98.8491 | 92.9843 | 100.48 | 100.681 | 99.1422 | 100.33 | 101.054 | 96.2344 | 105.388 | 103.136 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 0.935 | 90.5778 | 81 | Complete curve; high efficacy | -6.0292 | 2.7868 | 0.9559 | 14.2292 | 104.807 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 1.1738 | 101.6 | 102.599 | 106.228 | 102.075 | 108.076 | 104.772 | 89.3997 | 26.2739 | 38.4859 | 5.4448 | 1.1738 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.6292 | 2.3332 | 0.8166 | 86.1944 | 99.9304 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 86.9838 | 100.93 | 101.329 | 100 | 98.1044 | 96.7189 | 99.227 | 103.202 | 101.649 | 98.6816 | 96.875 | 86.9838 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 4.1763 | 76.3965 | 21 | Partial curve; partial efficacy | -5.3792 | 0.3 | 0.8809 | 27.2197 | 103.616 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 39.2009 | 99.1068 | 98.9696 | 94.0028 | 90.8567 | 81.18 | 79.3111 | 75.0701 | 73.427 | 71.3426 | 67.1057 | 39.2009 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -7.5792 | 4.9549 | 0.3979 | 109.272 | 104.625 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 103.164 | 106.772 | 103.615 | 102.899 | 105.879 | 111.867 | 111.147 | 112.679 | 108.931 | 104.853 | 104.935 | 103.164 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 37.2212 | 130.887 | 10 | Single point of activity | -4.4292 | 4.9549 | 0.992 | -28.1326 | 102.754 | -3 | 0 0 0 0 0 0 0 0 0 0 0 | 3.9708 | 104.294 | 97.8452 | 102.372 | 105.824 | 100.599 | 101.789 | 100.578 | 106.639 | 101.05 | 103.119 | 3.9708 | QC'd by Tocris | |||||||||||||||
| Activator | 0 | 5 | 98.3885 | 98.1969 | 97.4127 | 99.6506 | 98.0142 | 102.868 | 102.651 | 98.8438 | 99.6608 | 100.866 | 96.4947 | 98.3885 | QC'd by Microsource | ||||||||||||||||||||||||
| Activator | 0 | 5 | 100.745 | 98.0962 | 102.151 | 103.531 | 97.3342 | 101.034 | 103.531 | 101.349 | 101.53 | 101.137 | 99.9649 | 100.745 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 2.6351 | 52.0211 | 23 | Complete curve; partial efficacy | -5.5792 | 1.9673 | 0.9731 | 49.7254 | 101.746 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 46.3413 | 97.1692 | 99.8868 | 104.31 | 104.796 | 102.982 | 101.534 | 96.2974 | 90.1133 | 57.0101 | 57.4514 | 46.3413 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.6292 | 4.095 | 0.8932 | 83.7143 | 102.925 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 84.9995 | 101.425 | 103.525 | 100.579 | 103.626 | 102.147 | 103.166 | 105.971 | 106.159 | 100.442 | 100.32 | 84.9995 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 0.0074 | 88.3577 | 83 | Complete curve; high efficacy | -8.1292 | 2.4064 | 0.9885 | 18.6566 | 107.014 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.3894 | 108.293 | 99.6101 | 67.4359 | 15.5017 | 15.916 | 19.2447 | 18.5426 | 20.538 | 21.2596 | 19.8435 | 22.3894 | QC'd by BIOMOL | |||||||||||||||
| Inhibitor | 0.0083 | 84.3415 | 84 | Complete curve; high efficacy | -8.0792 | 2.7202 | 0.9935 | 21.322 | 105.663 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 17.482 | 102.903 | 104.783 | 74.485 | 26.7977 | 25.2394 | 25.7936 | 22.0401 | 21.9685 | 19.9233 | 17.3883 | 17.482 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Inactive | 0 | -4.4292 | 4.9549 | 0.5256 | 95.7681 | 107.951 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 98.7985 | 108.951 | 103.497 | 108.046 | 111.856 | 109.421 | 107.306 | 109.505 | 110.143 | 103.126 | 109.323 | 98.7985 | QC'd by Bosche | ||||||||||||||||||
| Inhibitor | 0.0662 | 80.8597 | 83 | Complete curve; high efficacy | -7.1792 | 1.21 | 0.9633 | 19.5088 | 100.368 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 12.1073 | 96.2154 | 100.576 | 96.7355 | 86.5625 | 56.4873 | 41.8934 | 17.3984 | 37.573 | 21.4196 | 15.7297 | 12.1073 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0003926931 uM | Activity at 0.0007804147 uM | Activity at 0.00118 uM | Activity at 0.00232 uM | Activity at 0.00353 uM | Activity at 0.00468 uM | Activity at 0.00703 uM | Activity at 0.014 uM | Activity at 0.021 uM | Activity at 0.041 uM | Activity at 0.063 uM | Activity at 0.122 uM | Activity at 0.190 uM | Activity at 0.286 uM | Activity at 0.563 uM | Activity at 0.859 uM | Activity at 1.138 uM | Activity at 1.709 uM | Activity at 3.373 uM | Activity at 5.124 uM | Activity at 9.921 uM | Activity at 15.37 uM | Activity at 29.76 uM | Activity at 46.08 uM | Activity at 92.17 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -4.6792 | 0.8 | 0.7121 | 63.5254 | 100.962 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 72.3482 | 96.4619 | 111.234 | 96.4007 | 99.9764 | 100.8 | 107.303 | 91.2102 | 95.0884 | 91.4113 | 89.3052 | 72.3482 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 1.3207 | 99.8972 | 80 | Complete curve; high efficacy | -5.8792 | 2.1876 | 0.9932 | 4.0718 | 103.969 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.3963 | 107.112 | 107.165 | 94.1215 | 106.946 | 102.695 | 102.388 | 92.345 | 42.091 | 7.6786 | 5.6818 | 2.3963 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 16.6261 | 84.7288 | 20 | Partial curve; partial efficacy | -4.7792 | 0.8 | 0.8535 | 27.3969 | 112.126 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 47.3584 | 109.738 | 116.307 | 106.34 | 119.606 | 109.092 | 109.516 | 105.209 | 107.185 | 73.3489 | 86.9921 | 47.3584 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 26.3506 | 117.273 | 40 | Partial curve; high efficacy | -4.5792 | 4.095 | 0.9425 | -3.0879 | 114.185 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.8048 | 118.954 | 115.744 | 127.028 | 121.171 | 120.188 | 113.695 | 109.585 | 100.001 | 103.027 | 100.25 | 7.8048 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 13.2066 | 92.3154 | 40 | Partial curve; high efficacy | -4.8792 | 3.5117 | 0.9782 | 10.8748 | 103.19 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.5979 | 101.991 | 92.6024 | 108.855 | 99.4261 | 105.176 | 109.606 | 105.341 | 101.101 | 100.447 | 45.2008 | 11.5979 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 11.7704 | 128.182 | 41 | Partial curve; high efficacy | -4.9292 | 0.8 | 0.9648 | -27.392 | 100.79 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.8143 | 102.835 | 100.132 | 101.058 | 91.6775 | 105.04 | 101.475 | 81.7015 | 85.4951 | 47.907 | 36.5297 | 2.8143 | QC'd by Tocris | |||||||||||||||
| Activator | 0 | 5 | 119.296 | 109.636 | 111.201 | 121.276 | 128.433 | 104.359 | 115.125 | 123.585 | 116.191 | 111.622 | 103.254 | 119.296 | QC'd by Tocris | ||||||||||||||||||||||||
| Inhibitor | 2.6351 | 124.269 | 80 | Complete curve; high efficacy | -5.5792 | 1.8851 | 0.9892 | -2.3494 | 121.92 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 0.9112 | 126.316 | 115.311 | 126.529 | 111.854 | 119.184 | 122.356 | 123.166 | 86.8796 | 20.6588 | 2.6348 | 0.9112 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 18.6548 | 50.1608 | 20 | Partial curve; partial efficacy | -4.7292 | 1.4787 | 0.9341 | 42.7805 | 92.9414 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 48.5722 | 89.9414 | 95.3841 | 93.9433 | 91.6237 | 94.3679 | 96.6857 | 92.1425 | 91.1254 | 79.8271 | 76.8531 | 48.5722 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 23.485 | 104.449 | 40 | Partial curve; high efficacy | -4.6292 | 1 | 0.8272 | -19.4701 | 84.9785 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.0252 | 94.3921 | 98.1615 | 89.6846 | 90.5832 | 69.9561 | 75.9123 | 70.3511 | 73.6492 | 68.4659 | 59.1775 | 4.0252 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 18.6548 | 45.8245 | 21 | Partial curve; partial efficacy | -4.7292 | 2.7202 | 0.8877 | 54.6383 | 100.463 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 55.5609 | 101.688 | 101.042 | 102.688 | 106.678 | 95.8696 | 107.814 | 89.5183 | 99.3561 | 99.3801 | 82.4436 | 55.5609 | QC'd by Tocris | |||||||||||||||
| Inhibitor | 4.6859 | 105.58 | 80 | Complete curve; high efficacy | -5.3292 | 1.9282 | 0.9867 | 1.0874 | 106.668 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 3.8327 | 109.422 | 102.252 | 113.988 | 105.391 | 97.678 | 113.996 | 103.507 | 92.7341 | 49.2748 | 8.9935 | 3.8327 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -4.9292 | 4.9549 | 0.7085 | 117.791 | 101.847 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 102.875 | 102.791 | 106.973 | 101.46 | 101.179 | 97.0047 | 102.829 | 100.91 | 102.806 | 100.142 | 114.286 | 102.875 | QC'd by Microsource | ||||||||||||||||||
| Inactive | 0 | -4.6292 | 0.8 | 0.7593 | 92.3688 | 120.966 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 99.9684 | 117.966 | 123.438 | 121.17 | 120.991 | 123.142 | 121.968 | 120.893 | 109.485 | 116.901 | 112.903 | 99.9684 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 13.2066 | 125.707 | 40 | Partial curve; high efficacy | -4.8792 | 0.8 | 0.9677 | -23.6359 | 102.071 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.451 | 99.889 | 99.8863 | 98.6362 | 114.543 | 98.1833 | 99.2149 | 86.0967 | 82.8078 | 60.2152 | 43.4864 | 5.451 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.1292 | 3.132 | 0.5868 | 82.3026 | 100.125 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 82.1897 | 99.1252 | 102.102 | 95.8265 | 101.074 | 88.3264 | 98.285 | 111.982 | 103.669 | 95.312 | 84.2065 | 82.1897 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 0.0037 | 76.948 | 85 | Complete curve; high efficacy | -8.4292 | 2.5884 | 0.9193 | 25.4774 | 102.425 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 27.4586 | 101.445 | 83.7205 | 40.1922 | 6.2474 | 18.4695 | 30.0718 | 36.6855 | 25.6891 | 31.2826 | 26.8292 | 27.4586 | QC'd by BIOMOL | |||||||||||||||
| Inhibitor | 0.0033 | 105.204 | 81 | Complete curve; high efficacy | -8.4792 | 4.9549 | 0.9982 | 6.1176 | 111.322 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.6501 | 110.787 | 95.6642 | 7.634 | 9.529 | 7.7722 | 6.677 | 6.9733 | 4.677 | 3.7631 | 5.3888 | 7.6501 | QC'd by Prestwick Chemical; Inc. | |||||||||||||||
| Inhibitor | 23.485 | 89.0443 | 40 | Partial curve; high efficacy | -4.6292 | 4.095 | 0.924 | 15.4644 | 104.509 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 22.0605 | 102.048 | 100.78 | 107.753 | 116.047 | 117.458 | 104.385 | 104.044 | 94.8329 | 95.7441 | 87.9134 | 22.0605 | QC'd by Bosche | |||||||||||||||
| Inhibitor | 0.1482 | 105.933 | 80 | Complete curve; high efficacy | -6.8292 | 1.9887 | 0.9947 | -0.1402 | 105.793 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 0.6465 | 99.5484 | 104.351 | 113 | 107.864 | 86.6426 | 39.5166 | 3.1452 | 2.3479 | 0.8179 | -0.5406 | 0.6465 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis.Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity.at.0.0003926931.uM | Activity.at.0.0007804147.uM | Activity.at.0.00118.uM | Activity.at.0.00232.uM | Activity.at.0.00353.uM | Activity.at.0.00468.uM | Activity.at.0.00703.uM | Activity.at.0.014.uM | Activity.at.0.021.uM | Activity.at.0.041.uM | Activity.at.0.063.uM | Activity.at.0.122.uM | Activity.at.0.190.uM | Activity.at.0.286.uM | Activity.at.0.563.uM | Activity.at.0.859.uM | Activity.at.1.138.uM | Activity.at.1.709.uM | Activity.at.3.373.uM | Activity.at.5.124.uM | Activity.at.9.921.uM | Activity.at.15.37.uM | Activity.at.29.76.uM | Activity.at.46.08.uM | Activity.at.92.17.uM | Compound.QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | -5.0792 | 0.6 | 0.9452 | -78.8907 | 192.747 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -7.6414 | 215.0126 | 163.5356 | 166.6573 | 179.5546 | 177.5324 | 188.9945 | 133.7061 | 130.2861 | 81.7818 | 22.2812 | -7.6414 | QC'd by Tocris | ||||||||||||||||||
| Activator | 23.485 | 102.061 | 0 | Partial curve; high efficacy; poor fit | -4.6292 | 4.095 | 0.7266 | 32.0728 | 134.134 | 2.3 | 1 0 0 0 0 0 0 0 0 0 0 | 38.137 | 77.5797 | 102.4944 | 110.3966 | 124.067 | 143.1355 | 130.7318 | 157.7999 | 159.7584 | 144.4704 | 118.6398 | 38.137 | QC'd by Tocris | |||||||||||||||
| Activator | 0 | -6.1792 | 1.8265 | 0.9121 | -12.5286 | 103.898 | 5 | 0 0 0 0 0 0 0 0 0 0 0 | -31.8328 | 79.4505 | 104.6867 | 87.528 | 100.3215 | 131.1507 | 112.3551 | 43.2525 | 10.2017 | 1.1595 | -5.0473 | -31.8328 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -5.1792 | 0.9 | 0.9722 | -15.1125 | 145.73 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 4.077 | 141.1443 | 156.9188 | 136.6292 | 133.6953 | 152.0798 | 141.2904 | 138.5851 | 96.3358 | 78.1292 | 38.6486 | 4.077 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -5.1292 | 1.3443 | 0.9258 | -14.7886 | 103.455 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -6.6443 | 92.9829 | 83.2448 | 124.2568 | 99.0122 | 111.0707 | 108.5919 | 97.9685 | 96.6918 | 50.2376 | 22.6167 | -6.6443 | QC'd by Tocris | ||||||||||||||||||
| Activator | 14.818 | 150.54 | 0 | Complete curve; high efficacy; poor fit | -4.8292 | 4.4495 | 0.8471 | 30.6915 | 181.232 | 1.3 | 1 0 0 0 0 0 0 0 0 0 0 | 32.3362 | 106.9145 | 131.8237 | 162.1657 | 173.3669 | 190.2432 | 194.474 | 192.1536 | 192.955 | 209.2815 | 97.4187 | 32.3362 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -6.0292 | 1.4641 | 0.9534 | 10.1409 | 132.005 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 18.6419 | 142.1937 | 100.7679 | 141.837 | 134.1093 | 137.7797 | 122.3243 | 88.2271 | 49.7823 | 15.419 | 6.3369 | 18.6419 | QC'd by Tocris | ||||||||||||||||||
| Activator | 37.2212 | 32.4136 | 0 | Partial curve; high efficacy; poor fit | -4.4292 | 4.9549 | 0.5319 | 113.915 | 146.328 | 2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 121.484 | 139.3281 | 148.2314 | 146.7073 | 157.4967 | 150.0794 | 144.1354 | 152.0036 | 140.9729 | 132.7808 | 153.3181 | 121.4835 | QC'd by Tocris | |||||||||||||||
| Activator | 8.3328 | 104.806 | 0 | Complete curve; high efficacy | -5.0792 | 1.3723 | 0.9282 | 33.4333 | 138.239 | 1.1 | 1 0 0 0 0 0 0 0 0 0 0 | 40.7486 | 82.6218 | 115.2981 | 131.8176 | 146.6864 | 144.4915 | 143.9775 | 145.3138 | 127.1798 | 98.3855 | 69.5066 | 40.7486 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.3292 | 2.0937 | 0.9572 | 13.9267 | 96.63 | 4 | 1 0 0 0 0 0 0 0 0 0 0 | 9.2393 | 73.1588 | 93.2217 | 83.7526 | 102.2131 | 94.0984 | 99.5828 | 105.7141 | 90.0048 | 47.0613 | 28.7217 | 9.2393 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -5.1792 | 0.8 | 0.8909 | -14.1069 | 83.8544 | 4 | 1 0 0 0 0 0 0 0 0 0 0 | -2.3824 | 56.2402 | 83.0753 | 71.9132 | 95.6887 | 93.9594 | 77.198 | 50.0484 | 64.6088 | 46.3962 | 16.6949 | -2.3824 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -5.1292 | 1.9673 | 0.8774 | 2.2989 | 173.038 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 12.161 | 169.7885 | 228.7951 | 158.2425 | 166.9835 | 145.2521 | 151.0297 | 188.0253 | 157.7299 | 126.7822 | 29.289 | 12.161 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -5.8292 | 4.4495 | 0.8963 | -0.1413 | 122.369 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -21.0562 | 88.9019 | 100.9354 | 120.4424 | 111.9166 | 137.2016 | 142.5217 | 150.57 | 46.8479 | 10.114 | 7.1422 | -21.0562 | QC'd by Tocris | ||||||||||||||||||
| Activator | 0.0042 | 86.5593 | 0 | Complete curve; high efficacy | -8.3792 | 1.4781 | 0.9154 | 177.209 | 90.65 | 1.1 | 0 0 0 0 0 0 0 1 0 0 0 | 163.968 | 96.5507 | 118.6203 | 145.971 | 175.9719 | 165.9067 | 183.3382 | 184.9557 | 131.4528 | 190.5583 | 167.0856 | 163.9677 | QC'd by Tocris | |||||||||||||||
| Activator | 11.7704 | 151.488 | 0 | Complete curve; high efficacy; poor fit | -4.9292 | 1.1 | 0.8787 | 14.6149 | 166.103 | 1.3 | 0 0 0 0 0 0 0 0 0 0 0 | 44.0127 | 171.5497 | 199.6272 | 154.7666 | 143.0715 | 165.4739 | 152.9214 | 179.0327 | 137.1447 | 129.8295 | 75.0256 | 44.0127 | QC'd by Tocris | |||||||||||||||
| Inactive | 0 | -5.1792 | 1.1 | 0.8526 | -14.2868 | 138.126 | 4 | 1 0 0 0 0 0 0 0 0 0 0 | -4.638 | 88.1906 | 98.9964 | 129.1143 | 150.8916 | 150.9987 | 173.7016 | 125.8112 | 89.3891 | 80.0058 | 36.8118 | -4.638 | QC'd by Tocris | ||||||||||||||||||
| Activator | 0.003 | 37.8789 | 0 | Complete curve; high efficacy; poor fit | -8.5292 | 4.9549 | 0.4483 | 170.255 | 132.376 | 1.3 | 0 0 0 0 0 0 1 0 0 0 1 | 123.213 | 133.734 | 139.4092 | 181.4929 | 177.3926 | 174.7461 | 176.6378 | 222.5981 | 127.6023 | 175.2306 | 178.4922 | 123.2131 | QC'd by Tocris | |||||||||||||||
| Activator | 0.0662 | 162.315 | 0 | Complete curve; high efficacy | -7.1792 | 2.3332 | 0.9375 | 206.319 | 44.0033 | 1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 207.454 | 72.6883 | 58.5404 | 24.3691 | 24.0378 | 129.2702 | 190.0127 | 198.9184 | 205.515 | 236.1493 | 181.8669 | 207.454 | QC'd by BIOMOL | |||||||||||||||
| Inactive | 0 | -8.3292 | 4.9549 | 0.9754 | 13.9344 | 157.302 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 19.6336 | 140.2407 | 171.7499 | 21.2299 | 16.32 | 13.5446 | 16.5135 | 15.032 | 12.9157 | 13.7502 | 9.2575 | 19.6336 | QC'd by Prestwick Chemical; Inc. | ||||||||||||||||||
| Inactive | 0 | -5.3792 | 0.8 | 0.949 | -26.2688 | 194.334 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 8.7224 | 173.0221 | 221.8433 | 197.6983 | 202.7025 | 173.5067 | 153.5085 | 163.0976 | 140.5647 | 64.7843 | 23.6884 | 8.7224 | QC'd by Bosche |
| PEO1_ola_R-Z-AUC | PEO1_ola_R-Phenotype | PEO1_ola_R-Potency | PEO1_ola_R-Efficacy | PEO1_ola_R-Analysis_Comment | PEO1_ola_R-Activity_Score | PEO1_ola_R-Curve_Description | PEO1_ola_R-Fit_LogAC50 | PEO1_ola_R-Fit_HillSlope | PEO1_ola_R-Fit_R2 | PEO1_ola_R-Fit_InfiniteActivity | PEO1_ola_R-Fit_ZeroActivity | PEO1_ola_R-Fit_CurveClass | PEO1_ola_R-Excluded_Points | PEO1_ola_R-Max_Response | PEO1_ola_R-Activity_at_00000256000_uM | PEO1_ola_R-Activity_at_00001280000_uM | PEO1_ola_R-Activity_at_00002560000_uM | PEO1_ola_R-Activity_at_00005639010_uM | PEO1_ola_R-Activity_at_000128_uM | PEO1_ola_R-Activity_at_000256_uM | PEO1_ola_R-Activity_at_000455_uM | PEO1_ola_R-Activity_at_000645_uM | PEO1_ola_R-Activity_at_0013_uM | PEO1_ola_R-Activity_at_0030_uM | PEO1_ola_R-Activity_at_0046_uM | PEO1_ola_R-Activity_at_0064_uM | PEO1_ola_R-Activity_at_0154_uM | PEO1_ola_R-Activity_at_0320_uM | PEO1_ola_R-Activity_at_0569_uM | PEO1_ola_R-Activity_at_0806_uM | PEO1_ola_R-Activity_at_1600_uM | PEO1_ola_R-Activity_at_3768_uM | PEO1_ola_R-Activity_at_5686_uM | PEO1_ola_R-Activity_at_8010_uM | PEO1_ola_R-Activity_at_1913_uM | PEO1_ola_R-Activity_at_3998_uM | PEO1_ola_R-Activity_at_6000_uM | PEO1_ola_R-Activity_at_8000_uM | PEO1-Z-AUC | PEO1-Phenotype | PEO1-Potency | PEO1-Efficacy | PEO1-Analysis_Comment | PEO1-Activity_Score | PEO1-Curve_Description | PEO1-Fit_LogAC50 | PEO1-Fit_HillSlope | PEO1-Fit_R2 | PEO1-Fit_InfiniteActivity |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| -1.748486862 | Cytotoxic | 0.0098 | 75.6681 | 20 | Complete curve; partial efficacy; poor fit | -8.0101 | 0.9 | 0.8187 | 38.0435 | 113.7116 | -1.4 | 0 0 0 0 0 0 0 | 19.7418 | 105.2638 | 60.5657 | 55.7154 | 45.8697 | 51.9121 | 37.0732 | 19.7418 | -2.422056816 | Cytotoxic | 0.0078 | 98.2879 | 85 | Complete curve; high efficacy | -8.1101 | 4.095 | 0.9181 | 28.4691 | |||||||||||||||||||
| -1.396676816 | Cytotoxic | 0.0389 | 72.6285 | 26 | Complete curve; partial efficacy | -7.4101 | 4.095 | 0.9522 | 38.2424 | 110.8708 | -1.2 | 0 0 0 0 0 0 0 | 22.0625 | 112.9607 | 108.4543 | 45.9375 | 44.9123 | 45.1011 | 40.2596 | 22.0625 | -1.682849749 | Cytotoxic | 0.0174 | 61.7663 | 27 | Complete curve; partial efficacy | -7.7601 | 4.5045 | 0.973 | 43.1447 | |||||||||||||||||||
| -1.289810323 | Cytotoxic | 0.4364 | 60.6265 | 23 | Complete curve; partial efficacy | -6.3601 | 1.9673 | 0.998 | 30.574 | 91.2005 | -1.2 | 0 0 0 0 0 0 0 | 32.057 | 92.5588 | 89.4895 | 89.7109 | 69.6749 | 35.7173 | 28.9756 | 32.057 | -1.51409436 | Cytotoxic | 0.1096 | 52.6159 | 25 | Complete curve; partial efficacy | -6.9601 | 4.9549 | 0.9957 | 40.1831 | |||||||||||||||||||
| -2.187197393 | Cytotoxic | 0.0389 | 58.8608 | 24 | Complete curve; partial efficacy | -7.4101 | 4.5045 | 0.9859 | 28.8722 | 87.733 | -1.2 | 0 0 0 0 0 0 0 | 22.6953 | 88.8483 | 86.324 | 34.6159 | 32.4411 | 32.4218 | 27.1791 | 22.6953 | -2.439835072 | Cytotoxic | 0.0174 | 81.7693 | 84 | Complete curve; high efficacy | -7.7601 | 1.1105 | 0.991 | 24.4706 | |||||||||||||||||||
| -1.688999982 | Cytotoxic | 0.0174 | 62.839 | 26 | Complete curve; partial efficacy | -7.7601 | 4.095 | 0.9951 | 39.8686 | 102.7077 | -1.2 | 0 0 0 0 0 0 0 | 37.08 | 102.2219 | 89.1213 | 43.461 | 39.8443 | 38.0398 | 40.2252 | 37.08 | -1.807353451 | Cytotoxic | 0.049 | 59.5903 | 25 | Complete curve; partial efficacy | -7.3101 | 3.132 | 0.9485 | 36.7979 | |||||||||||||||||||
| -2.151467879 | Cytotoxic | 0.2454 | 56.1501 | 22 | Complete curve; partial efficacy | -6.6101 | 2.7202 | 0.9765 | 20.3635 | 76.5137 | -1.2 | 0 0 0 0 0 0 0 | 17.6809 | 69.8108 | 76.8114 | 81.7381 | 38.4595 | 24.6978 | 19.5182 | 17.6809 | -1.94998744 | Cytotoxic | 0.2754 | 55.3655 | 23 | Complete curve; partial efficacy | -6.5601 | 1.6266 | 0.9978 | 26.8149 | |||||||||||||||||||
| -1.688183612 | Cytotoxic | 0.1737 | 89.7804 | 82 | Complete curve; high efficacy | -6.7601 | 3.132 | 0.9984 | 14.8785 | 104.6589 | -1.1 | 0 0 0 0 0 0 0 | 13.5532 | 104.8594 | 102.8313 | 101.7005 | 27.7481 | 17.8238 | 12.8544 | 13.5532 | -2.097073142 | Cytotoxic | 0.1548 | 78.6188 | 22 | Complete curve; partial efficacy | -6.8101 | 1.9282 | 0.9881 | 16.1888 | |||||||||||||||||||
| -2.669259461 | Cytotoxic | 0.0078 | 69.8438 | 25 | Complete curve; partial efficacy | -8.1101 | 2.9523 | 0.9652 | 26.1563 | 96.0001 | -1.2 | 0 0 0 0 0 0 0 | 19.142 | 93.4288 | 39.3765 | 32.8679 | 22.787 | 24.3086 | 31.5398 | 19.142 | -2.741406614 | Cytotoxic | 0.0078 | 70.9309 | 25 | Complete curve; partial efficacy | -8.1101 | 1.8851 | 0.9962 | 27.4103 | |||||||||||||||||||
| -1.534196135 | Cytotoxic | 0.4364 | 92.9966 | 81 | Complete curve; high efficacy | -6.3601 | 1.8617 | 0.986 | 7.884 | 100.8807 | -1.1 | 0 0 0 0 0 0 0 | 6.96 | 99.3571 | 93.7882 | 108.5319 | 64.3648 | 18.0896 | 7.3356 | 6.96 | -2.079878452 | Cytotoxic | 0.1949 | 79.9101 | 22 | Complete curve; partial efficacy | -6.7101 | 3.5117 | 0.9918 | 14.8119 | |||||||||||||||||||
| -2.239224181 | Cytotoxic | 0.0389 | 68.3632 | 24 | Complete curve; partial efficacy | -7.4101 | 4.5045 | 0.9741 | 24.5284 | 92.8916 | -1.2 | 0 0 0 0 0 0 0 | 15.5514 | 91.7014 | 93.6495 | 31.4139 | 33.3032 | 26.9936 | 22.6797 | 15.5514 | -3.384080322 | Cytotoxic | 0.0078 | 76.5663 | 23 | Complete curve; partial efficacy | -8.1101 | 1.6266 | 0.9749 | 14.207 | |||||||||||||||||||
| -1.37962701 | Cytotoxic | 1.23 | 61.1328 | 22 | Complete curve; partial efficacy | -5.9101 | 4.095 | 0.9958 | 23.2938 | 84.4267 | -1.2 | 0 0 0 0 0 0 0 | 23.0409 | 85.394 | 84.3043 | 87.7139 | 81.0599 | 38.4555 | 24.4914 | 23.0409 | -1.505404731 | Cytotoxic | 0.5494 | 73.5571 | 22 | Complete curve; partial efficacy | -6.2601 | 1 | 0.9899 | 21.0413 | |||||||||||||||||||
| -2.710453777 | Cytotoxic | 0.0087 | 55.943 | 25 | Complete curve; partial efficacy | -8.0601 | 3.2975 | 0.9513 | 27.5266 | 83.4696 | -1.2 | 0 0 0 0 0 0 0 | 19.4944 | 82.8002 | 39.3099 | 35.0454 | 30.2057 | 25.6995 | 26.8399 | 19.4944 | -3.575936609 | Cytotoxic | 0.0062 | 42.4322 | 23 | Complete curve; partial efficacy | -8.2101 | 4.9549 | 0.9949 | 18.7974 | |||||||||||||||||||
| -2.114807879 | Cytotoxic | 0.0977 | 59.3487 | 23 | Complete curve; partial efficacy | -7.0101 | 1.6266 | 0.9944 | 24.1568 | 83.5054 | -1.2 | 0 0 0 0 0 0 0 | 21.3191 | 83.1928 | 80.9782 | 64.1885 | 31.3969 | 28.8308 | 23.5181 | 21.3191 | -1.926999729 | Cytotoxic | 0.2454 | 57.7948 | 23 | Complete curve; partial efficacy | -6.6101 | 4.9549 | 0.9763 | 27.6953 | |||||||||||||||||||
| -1.076840187 | Cytotoxic | 0.1737 | 81.0708 | 83 | Complete curve; high efficacy | -6.7601 | 1.6266 | 0.9732 | 29.4412 | 110.5121 | -1.1 | 0 0 0 0 0 0 0 | 22.857 | 116.9182 | 99.3311 | 102.3348 | 49.356 | 33.6997 | 34.5599 | 22.857 | -1.409208042 | Cytotoxic | 0.2187 | 74.3636 | 23 | Complete curve; partial efficacy | -6.6601 | 3.0654 | 0.9859 | 28.7815 | |||||||||||||||||||
| -3.27518711 | Cytotoxic | 0.0062 | 60.8734 | 23 | Complete curve; partial efficacy | -8.2101 | 4.095 | 0.99 | 18.0643 | 78.9377 | -1.2 | 0 0 0 0 0 0 0 | 14.5744 | 77.2003 | 21.165 | 19.6751 | 21.4856 | 16.2478 | 18.1459 | 14.5744 | -3.795041707 | Cytotoxic | 0.0087 | 54.7076 | 22 | Complete curve; partial efficacy | -8.0601 | 3.99 | 0.9671 | 11.1126 | |||||||||||||||||||
| -1.568711037 | Cytotoxic | 0.2454 | 68.5506 | 23 | Complete curve; partial efficacy | -6.6101 | 3.132 | 0.965 | 24.6633 | 93.2139 | -1.2 | 0 0 0 0 0 0 0 | 19.1287 | 92.3968 | 84.2257 | 102.7869 | 43.7293 | 29.7138 | 27.1749 | 19.1287 | -1.752700398 | Cytotoxic | 0.1548 | 83.8006 | 82 | Complete curve; high efficacy | -6.8101 | 1.2876 | 0.9926 | 20.4649 | |||||||||||||||||||
| -2.44866556 | Cytotoxic | 0.0078 | 88.982 | 85 | Complete curve; high efficacy | -8.1101 | 4.095 | 0.9832 | 27.0227 | 116.0048 | -1.1 | 0 0 0 0 0 0 0 | 17.8697 | 115.242 | 37.6666 | 29.5595 | 30.7918 | 27.8718 | 29.3402 | 17.8697 | -3.27247136 | Cytotoxic | 0.0098 | 40.3287 | 24 | Complete curve; partial efficacy | -8.0101 | 1.1 | 0.9392 | 22.1543 | |||||||||||||||||||
| -2.134305386 | Cytotoxic | 0.0078 | 69 | 26 | Complete curve; partial efficacy | -8.1101 | 2.3531 | 0.9431 | 35.613 | 104.613 | -1.2 | 0 0 0 0 0 0 0 | 24.0898 | 99.6712 | 52.0169 | 40.9093 | 33.6763 | 38.373 | 41.9012 | 24.0898 | -2.695362826 | Cytotoxic | 0.0098 | 66.9147 | 25 | Complete curve; partial efficacy | -8.0101 | 1.7137 | 0.9856 | 28.043 | |||||||||||||||||||
| -1.841563598 | Cytotoxic | 0.0399 | 75.396 | 24 | Complete curve; partial efficacy | -7.3989 | 4.9549 | 0.9833 | 24.8484 | 100.2443 | -1.2 | 0 0 0 0 0 0 0 | 17.4504 | 101.5182 | 93.8381 | 105.1889 | 31.8627 | 30.6864 | 25.4562 | 17.4504 | -2.172833667 | Cytotoxic | 0.0089 | 72.1444 | 25 | Complete curve; partial efficacy | -8.0489 | 2.7202 | 0.9845 | 30.2194 | |||||||||||||||||||
| Cytotoxic | 0.0087 | 58.472 | 25 | Complete curve; partial efficacy | -8.0601 | 4.045 | 0.9313 | 27.6378 | 86.1098 | -1.2 | 0 0 0 0 0 0 0 | 23.3872 | 85.8568 | 38.1211 | 24.1036 | 23.449 | 27.0635 | 40.2759 | 23.3872 | -2.647939347 | Cytotoxic | 0.0123 | 59.8721 | 25 | Complete curve; partial efficacy | -7.9101 | 2.4064 | 0.9747 | 29.0347 |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000073700 uM | Activity at 0.0000311978 uM | Activity at 0.0000755538 uM | Activity at 0.0001700784 uM | Activity at 0.0003537877 uM | Activity at 0.0007609388 uM | Activity at 0.00133 uM | Activity at 0.00267 uM | Activity at 0.00634 uM | Activity at 0.00855 uM | Activity at 0.017 uM | Activity at 0.041 uM | Activity at 0.071 uM | Activity at 0.179 uM | Activity at 0.354 uM | Activity at 0.663 uM | Activity at 1.576 uM | Activity at 1.933 uM | Activity at 5.110 uM | Activity at 9.286 uM | Activity at 17.35 uM | Activity at 44.46 uM | Activity at 93.38 uM | Activity at 162.7 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 0 | 6.9422 | 0 | 2.3728 | 0 | 0.4583 | 0 | 5.8022 | 9.8216 | 0 | 0 | 0 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | 0 | 0.7879 | 1.0771 | 0 | 0 | 4.0917 | 0 | 4.9983 | 0 | 0 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | -7.3792 | 4.9549 | 0.4146 | 0.8611 | 5.5 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | 1.8373 | 0 | 9.1117 | 5.5344 | 8.2389 | 0 | 0 | 2.3051 | 0 | 4.4881 | -0.9491 | 1.8373 | QC'd by BIOMOL | |||||||||||||||||
| Inactive | 0 | -5.1792 | 2.7202 | 0.8215 | -20.6639 | 2.5 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | -6.0916 | 0 | -2.7966 | 0.2285 | 8.0815 | 2.583 | 3.7354 | 7.3202 | 1.7166 | -5.5554 | -18.8865 | -6.0916 | QC'd by BIOMOL | |||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 3.7495 | 7.2293 | 6.3714 | 5.6135 | 0 | 7.4829 | 0 | 1.6994 | 8.4113 | 0 | 0 | 3.7495 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 6.3657 | 7.1953 | 7.3079 | 0 | 0 | 1.8794 | 5.9799 | 0 | 7.4799 | 0 | 0 | 6.3657 | QC'd by BIOMOL | |||||||||||||||||||||
| Inhibitor | 14.818 | 35.5149 | 21 | Partial curve; partial efficacy | -4.8292 | 3.0654 | 0.9214 | -31.0149 | 4.5 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | -30.4291 | 5.7772 | 8.8781 | 3.6683 | 4.227 | 4.7222 | 8.0186 | 4.5719 | -4.2187 | 3.6532 | -13.8256 | -30.4291 | QC'd by BIOMOL | ||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 5.7817 | 5.8939 | 0 | 0 | 8.5995 | 0 | 0 | 6.0744 | 0 | 6.585 | 0 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -2.1045 | 0 | 8.2523 | 0 | -2.1724 | 7.2216 | 0 | 7.3601 | -2.8223 | -6.1446 | 4.4899 | -2.1045 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | -4.4292 | 4.9549 | 0.4721 | -18.445 | 1.5 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -13.2875 | 0 | 7.0161 | 4.5375 | 5.0482 | 0 | 0 | 5.2422 | -2.8732 | -8.9018 | 6.1541 | -13.2875 | QC'd by BIOMOL | |||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 9.4385 | 0 | 0 | 0 | 0.9321 | 0.5252 | 0 | 0 | 0 | 9.4894 | 0 | 9.4385 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -1.1894 | 0 | 6.5585 | 0 | 4.486 | 0 | 0.5381 | 0 | 4.8639 | 3.4664 | 2.4738 | -1.1894 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | -6.0792 | 4.9549 | 0.4047 | 5.5 | 0.1553 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | 0 | 1.472 | 4.5108 | 0 | 0 | 0 | -2.7872 | 0 | 8.3864 | 0 | 8.0615 | 0 | QC'd by BIOMOL | |||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 0 | 0.7173 | 0.6679 | 2.5617 | 8.0704 | 0 | 0 | 9.8105 | 0 | 8.9731 | 0 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 1.1339 | -2.3294 | 0 | 8.3935 | 0 | 0 | 9.7826 | 7.5714 | 6.4163 | 0 | 0 | 1.1339 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | -9.0292 | 4.9549 | 0.3898 | 2 | -12.7871 | 4 | 0 0 0 0 0 0 0 0 0 0 1 | -4.0609 | -8.9892 | 3.4212 | -1.7578 | 7.1716 | 0.6137 | 5.2177 | 6.769 | 3.1957 | -7.1191 | -0.2144 | -4.0609 | QC'd by BIOMOL | |||||||||||||||||
| Inhibitor | 20.931 | 101.634 | 41 | Partial curve; high efficacy | -4.6792 | 4.095 | 0.99 | -99.5649 | 2.069 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | -91.6804 | 5.2511 | 0 | 7.6294 | 0 | 3.8746 | 1.2696 | 0 | 0 | 0 | -20.7764 | -91.6804 | QC'd by BIOMOL | ||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 0 | 2.3204 | 0 | 2.2816 | 3.412 | 1.2564 | 1.6162 | 0 | 0 | 0 | 0.2287 | 0 | QC'd by BIOMOL | |||||||||||||||||||||
| Inactive | 0 | -4.5792 | 4.5045 | 0.7778 | -24.8885 | 3.5 | 4 | 0 0 0 0 0 0 0 0 0 0 0 | -22.8238 | 5.7426 | 8.6462 | 6.0217 | 3.7721 | 4.1656 | 9.0629 | 3.0606 | -1.1003 | -6.0335 | 1.2279 | -22.8238 | QC'd by BIOMOL | |||||||||||||||||
| Inhibitor | 33.1734 | 109.8312 | 10 | Single point of activity | -4.4792 | 4.9549 | 0.9783 | -109.3261 | 0.505 | -3 | 0 0 0 0 0 0 0 0 0 0 0 | -91.5629 | -0.0109 | -1.0575 | 1.0949 | 2.2698 | 9.4465 | -3.4594 | 0 | -7.4354 | 0 | 0 | -91.5629 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at 0.0000073700 uM | Activity at 0.0000311978 uM | Activity at 0.0000755538 uM | Activity at 0.0001700784 uM | Activity at 0.0003537877 uM | Activity at 0.0007609388 uM | Activity at 0.00133 uM | Activity at 0.00267 uM | Activity at 0.00634 uM | Activity at 0.00855 uM | Activity at 0.017 uM | Activity at 0.041 uM | Activity at 0.071 uM | Activity at 0.179 uM | Activity at 0.354 uM | Activity at 0.663 uM | Activity at 1.576 uM | Activity at 1.933 uM | Activity at 5.110 uM | Activity at 9.286 uM | Activity at 17.35 uM | Activity at 44.46 uM | Activity at 93.38 uM | Activity at 162.7 uM | Compound QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inhibitor | 4.1095 | 35.9554 | 21 | Complete curve; partial efficacy | -5.3862 | 1.4787 | 0.9847 | -33.4554 | 2.5 | -1.2 | 0 0 0 0 0 0 0 | -32.4628 | 2.1833 | 5.9706 | 0 | 0 | -5.6126 | -25.295 | -32.4628 | QC'd by Axon Medchem | ||||||||||||||||||
| Inhibitor | 14.581 | 34.6571 | 10 | Partial curve; partial efficacy; poor fit | -4.8362 | 2.3332 | 0.9403 | -32.1571 | 2.5 | -2.4 | 0 0 0 0 0 0 0 | -29.7143 | 0 | 0 | 0 | 7.4115 | 5.8195 | -6.9018 | -29.7143 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -4.8362 | 1.8617 | 0.9256 | -16.6594 | 2.5 | 4 | 0 0 0 0 0 0 0 | -14.7161 | 2.6212 | 0.58 | 1.0251 | 6.2829 | 1.7864 | -3.3449 | -14.7161 | QC'd by Glixx | |||||||||||||||||||||
| Inhibitor | 1.636 | 66.1615 | 64 | Complete curve; partial efficacy | -5.7862 | 2.7202 | 0.9997 | -65.8116 | 0.3499 | -1.2 | 0 0 0 0 0 0 0 | -66.5014 | 0 | 0 | 0 | 0 | -37.9408 | -64.7373 | -66.5014 | QC'd by Glixx | ||||||||||||||||||
| Inactive | 0 | -4.6362 | 1.9673 | 0.7584 | -23.667 | -2.4671 | 4 | 0 0 0 0 0 0 0 | -19.3058 | -0.694 | -0.3893 | -3.2758 | -10.1148 | -2.3842 | -5.3061 | -19.3058 | QC'd by SIGMA | |||||||||||||||||||||
| Inactive | 0 | -4.7862 | 3.0654 | 1 | -20.0675 | 0 | 4 | 0 0 0 0 0 0 0 | -19.2229 | 0 | 0 | 0 | 0 | 0 | -2.9492 | -19.2229 | QC'd by Axon Medchem | |||||||||||||||||||||
| Inhibitor | 10.3225 | 47.8362 | 21 | Partial curve; partial efficacy | -4.9862 | 1.8851 | 0.9724 | -41.8362 | 6 | -2.2 | 0 0 0 0 0 0 0 | -38.781 | 9.2093 | 6.0955 | 0 | 7.7141 | 5.1385 | -14.8631 | -38.781 | QC'd by MedChem Express | ||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 6.0178 | 2.4248 | 6.4136 | 1.8969 | 0 | 6.2132 | 0 | 6.0178 | QC'd by Tocris | |||||||||||||||||||||||||
| Inhibitor | 29.0929 | 60.093 | 10 | Single point of activity | -4.5362 | 4.9549 | 1 | -60.0346 | 0.0584 | -3 | 0 0 0 0 0 0 0 | -54.4164 | 0 | 0 | 0 | 0 | 0 | 0 | -54.4164 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | -6.5432 | 0 | 0 | 0 | 0 | 0 | -1.4393 | -6.5432 | QC'd by Tocris | |||||||||||||||||||||||||
| Inhibitor | 16.3601 | 36.8511 | 10 | Partial curve; partial efficacy; poor fit | -4.7862 | 1.01 | 0.8986 | -32.3511 | 4.5 | -2.4 | 0 0 0 0 0 0 0 | -23.6259 | 8.7897 | 0 | 8.6961 | 0 | 0 | -7.2303 | -23.6259 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | 0 | 0 | 4 | 9.2406 | 0 | 0 | 1.7514 | 3.4967 | 0 | 7.926 | 9.2406 | QC'd by Glixx | |||||||||||||||||||||||||
| Inhibitor | 9.2 | 33.7152 | 10 | Partial curve; partial efficacy; poor fit | -5.0362 | 1.4163 | 0.9706 | -30.2152 | 3.5 | -2.4 | 0 0 0 0 0 0 0 | -27.2626 | 5.3147 | 2.6751 | 0 | 6.3042 | 0 | -12.9935 | -27.2626 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 16.3601 | 52.6952 | 21 | Partial curve; partial efficacy | -4.7862 | 1.2876 | 0.9602 | -49.0421 | 3.653 | -2.2 | 0 0 0 0 0 0 0 | -37.7902 | 9.1493 | 0 | 0 | 5.1852 | 0 | -13.7877 | -37.7902 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -4.7862 | 4.4495 | 0.9565 | -27.1196 | 3 | 4 | 0 1 0 0 0 0 0 | -26.7664 | 0 | -80.8549 | 5.9752 | 5.3786 | 0 | 0.9575 | -26.7664 | QC'd by Tocris | |||||||||||||||||||||
| Inhibitor | 0.5805 | 74.8185 | 26 | Complete curve; partial efficacy | -6.2362 | 3.6772 | 0.9839 | -72.7545 | 2.064 | -1.2 | 0 0 0 0 0 0 0 | -64.7375 | 1.5093 | 2.1407 | 2.7381 | -9.5317 | -70.5587 | -81.6221 | -64.7375 | QC'd by MedChem Express | ||||||||||||||||||
| Inhibitor | 18.3564 | 99.3241 | 10 | Single point of activity | -4.7362 | 3.6272 | 0.9917 | -97.7814 | 1.5427 | -3 | 0 0 0 0 0 0 0 | -94.2017 | 0 | 8.6442 | 0 | -1.0446 | 0 | -6.3447 | -94.2017 | QC'd by Tocris | ||||||||||||||||||
| Inhibitor | 29.0929 | 85.8302 | 10 | Single point of activity | -4.5362 | 4.9549 | 0.9979 | -84.331 | 1.4991 | -3 | 0 0 0 0 0 0 0 | -76.6062 | 0.5645 | 0 | 0 | 2.1433 | 2.1495 | 3.4024 | -76.6062 | QC'd by MedChem Express | ||||||||||||||||||
| Inhibitor | 12.9953 | 49.1721 | 21 | Partial curve; partial efficacy | -4.8862 | 2.2526 | 0.9678 | -45.6725 | 3.4996 | -2.2 | 0 0 0 0 0 0 0 | -42.1761 | 7.8315 | 0.285 | 0 | 1.2696 | 6.3138 | -12.2728 | -42.1761 | QC'd by Tocris | ||||||||||||||||||
| Inactive | 0 | -4.6862 | 1.8851 | 0.8683 | -38.0965 | -12.0167 | 4 | 0 0 0 0 0 0 0 | -33.4065 | -7.5139 | -13.5025 | -14.684 | -16.035 | -8.8732 | -16.7676 | -33.4065 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis_Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at Concentration_0 % | Activity at Concentration_1 % | Activity at Concentration_2 % | Activity at Concentration_3 % | Activity at Concentration_4 % | Activity at Concentration_5 % | Activity at Concentration_6 % | Activity at Concentration_7 % | Activity at Concentration_8 % | Activity at Concentration_9 % | Activity at Concentration_10 % | Concentration_0 uM | Concentration_1 uM | Concentration_2 uM | Concentration_3 uM | Concentration_4 uM | Concentration_5 uM | Concentration_6 uM | Concentration_7 uM | Concentration_8 uM | Concentration_9 uM | Concentration_10 uM | Compound_QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 20.91768 | 135.9020498 | 20 | Partial curve; high efficacy; poor fit | -4.6794864767 | 1.4641 | 0.8863980421 | -16.5589936 | 119.3430562 | -2.3 | 0 0 0 0 0 0 0 1 0 0 0 | 8.15047 | 131.697788 | 109.471717 | 99.601696 | 111.432731 | 110.167865 | 107.976429 | 125.741198 | -0.738606 | 94.967604 | 78.154316 | 8.15047 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inactive | 0 | 0 | 0 | 4 | 101.253926 | 127.324571 | 115.767189 | 125.696193 | 113.041352 | 129.390266 | 119.240485 | 122.258886 | 123.363896 | 127.713639 | 124.999902 | 101.253926 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Tocris | ||||||||
| Inconclusive | 0.001662 | 98.9862637701 | 10 | Complete curve; high efficacy | -8.7794864767 | 4.9549173134 | 0.8750837011 | 105.89072187 | 6.9044580999 | 1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 86.657668 | 9.190515 | 91.350045 | 120.000704 | 106.602421 | 91.354789 | 123.49336 | 101.116966 | 114.944989 | 105.541353 | 103.42099 | 86.657668 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 81.748763 | 91.078132 | 97.941934 | 109.017098 | 84.606499 | 82.718241 | 93.330539 | 82.104696 | 90.310441 | 79.427733 | 70.235262 | 81.748763 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Glixx | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 27.479238 | 29.807499 | 23.754826 | 37.550119 | 52.467262 | 49.638778 | 44.971419 | 49.443173 | 41.199989 | 44.191538 | 31.100528 | 27.479238 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by DC Chemicals | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 88.796894 | 88.932483 | 107.805452 | 118.329115 | 115.576179 | 104.531392 | 105.666526 | 28.456989 | 31.995075 | 108.633009 | 116.55604 | 88.796894 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Cytotoxic | 0.066148 | 106.5968118141 | 92 | Complete curve; high efficacy | -7.1794864767 | 2.3331733767 | 0.9856060804 | 10.6438142359 | 117.24062605 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 7.74429 | 111.298727 | 110.14607 | 116.182798 | 126.582271 | 65.374714 | 17.765909 | 13.337758 | 10.270839 | 13.965139 | 10.581737 | 7.74429 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Cayman | |
| Cytotoxic | 0.052543 | 84.93983916 | 92 | Complete curve; high efficacy | -7.2794864767 | 2.3331733767 | 0.9909197741 | 14.87277884 | 99.812618 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 11.386841 | 92.812618 | 99.298943 | 107.331073 | 89.665645 | 50.969665 | 18.132435 | 17.03287 | 14.615665 | 17.164667 | 15.085759 | 11.386841 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Prestwick | |
| Cytotoxic | 20.91768 | 39.02746125 | 20 | Single point of activity | -4.6794864767 | 4.5044702849 | 0.763313211 | 72.8772605 | 111.90472175 | -3 | 0 0 0 0 0 0 0 0 0 0 0 | 74.960448 | 107.674873 | 99.350847 | 115.643094 | 110.012967 | 111.330367 | 117.512906 | 105.286877 | 120.363473 | 118.025882 | 104.431378 | 74.960448 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inactive | 0 | 0 | 0 | 4 | 96.125208 | 106.000805 | 107.980951 | 136.360291 | 123.114488 | 114.464932 | 105.828212 | 124.785229 | 105.721751 | 109.721799 | 110.009117 | 96.125208 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Selleck | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 110.838301 | 118.188736 | 108.142055 | 118.143856 | 124.683861 | 119.252339 | 115.550272 | 104.140519 | 99.571981 | 102.206837 | 100.779485 | 110.838301 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Cytotoxic | 0.026334 | 55.43215625 | 20 | Complete curve; partial efficacy | -7.5794864767 | 4.4494702849 | 0.9488906954 | 49.9672315 | 105.39938775 | -1.2 | 0 0 0 0 0 0 1 0 0 0 0 | 46.220357 | 98.500877 | 99.546935 | 118.250142 | 90.963003 | 49.961845 | 50.487433 | 7.90434 | 58.578227 | 48.293009 | 46.646938 | 46.220357 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | |
| Cytotoxic | 16.615504 | 81.1866300801 | 41 | Partial curve; partial efficacy | -4.7794864767 | 3.0654483358 | 0.9311904775 | 10.1155169199 | 91.302147 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 11.748389 | 93.391993 | 85.520473 | 100.053426 | 91.880897 | 102.646849 | 84.985 | 92.113243 | 78.142173 | 93.007334 | 55.229592 | 11.748389 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by APExBIO | |
| Inactive | 0 | 0 | 0 | 4 | 107.882632 | 102.005025 | 115.270626 | 121.618589 | 129.745949 | 119.314252 | 113.120462 | 119.925832 | 116.630404 | 129.198219 | 118.287154 | 107.882632 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by SIGMA | ||||||||
| Cytotoxic | 0.525428 | 55.4400138501 | 20 | Complete curve; partial efficacy; poor fit | -6.2794864767 | 0.5999999999 | 0.9033965994 | 59.8369305999 | 115.27694445 | -1.4 | 0 0 0 0 0 0 0 1 0 0 0 | 65.952132 | 113.14587 | 111.366916 | 108.039429 | 121.569171 | 96.369545 | 88.541031 | 95.598486 | -3.272222 | 68.190148 | 64.19066 | 65.952132 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inactive | 0 | 0 | 0 | 4 | 116.426606 | 111.728695 | 104.661632 | 102.908207 | 118.66169 | 104.411628 | 131.616847 | 111.339177 | 109.683848 | 122.089515 | 104.570541 | 116.426606 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 111.563029 | 101.245309 | 110.806676 | 89.948055 | 93.03796 | 105.555666 | 98.878441 | 90.744257 | 99.278629 | 93.092724 | 102.478972 | 111.563029 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 94.312646 | 116.364291 | 96.723392 | 93.38067 | 103.194576 | 118.534626 | 35.530657 | 103.978128 | 2.541336 | 104.045452 | 106.423929 | 94.312646 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 107.998615 | 126.055741 | 109.890503 | 106.947021 | 103.860523 | 117.062791 | 125.189833 | 118.834353 | 30.450566 | 90.927945 | 102.053553 | 107.998615 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 92.894063 | 116.016249 | 111.275428 | 116.926942 | 115.585332 | 107.208781 | 122.053665 | 115.772929 | 95.055545 | 109.970305 | 96.255476 | 92.894063 | 0.00156 | 0.0046799999999 | 0.014 | 0.0421 | 0.126 | 0.379 | 1.1399999999 | 3.41 | 10.199999999 | 30.7 | 92.2 | QC'd by Tocris |
| Phenotype | Potency | Efficacy | Analysis_Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at Concentration_0 % | Activity at Concentration_1 % | Activity at Concentration_2 % | Activity at Concentration_3 % | Activity at Concentration_4 % | Activity at Concentration_5 % | Activity at Concentration_6 % | Activity at Concentration_7 % | Activity at Concentration_8 % | Activity at Concentration_9 % | Activity at Concentration_10 % | Concentration_0 uM | Concentration_1 uM | Concentration_2 uM | Concentration_3 uM | Concentration_4 uM | Concentration_5 uM | Concentration_6 uM | Concentration_7 uM | Concentration_8 uM | Concentration_9 uM | Concentration_10 uM | Compound_QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 18.654798 | 76.808559625 | 41 | Partial curve; partial efficacy | -4.7292094394 | 3.0654483358 | 0.9414919608 | 29.442759665 | 106.25131929 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 30.27357275 | 97.75131929 | 110.96398479 | 114.70514757 | 113.90944062 | 104.95218365 | 104.73752962 | 101.81310364 | 97.65908171 | 107.5307316 | 77.55361607 | 30.27357275 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 111.25210048 | 108.08852913 | 103.99505755 | 112.48112328 | 114.42023159 | 118.08354736 | 119.1731834 | 107.26588062 | 108.35780014 | 113.95755775 | 125.34705055 | 111.25210048 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by NCI | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 90.34249751 | 104.09274893 | 105.20263037 | 105.61416409 | 110.5838591 | 106.3916678 | 109.9830898 | 105.51570293 | 106.97760681 | 107.19347443 | 113.62489677 | 90.34249751 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Tocris | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 90.62683631 | 108.20847195 | 110.02552504 | 108.31342383 | 99.57695188 | 102.35810231 | 105.67655278 | 106.46160798 | 93.84066361 | 94.62277902 | 94.49547478 | 90.62683631 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 73.49593626 | 74.56771201 | 67.22319224 | 74.83960354 | 71.96667779 | 71.30708714 | 66.27352895 | 65.81066525 | 70.87800447 | 69.77634766 | 68.35881345 | 73.49593626 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by SIGMA | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 100.80334725 | 107.18696296 | 113.54147863 | 109.88500611 | 108.16535841 | 110.45360204 | 118.68674971 | 111.90131947 | 109.10115523 | 108.69287322 | 101.81464372 | 100.80334725 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Cytotoxic | 18.654798 | 128.3222423405 | 41 | Partial curve; high efficacy | -4.7292094394 | 0.5 | 0.8260445535 | -24.6555320375 | 103.666710303 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.94574858 | 97.44975051 | 104.80699302 | 107.81980289 | 108.56174513 | 99.03781371 | 74.35265517 | 76.49985557 | 67.54882553 | 72.14612004 | 63.17489528 | 4.94574858 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by NCI | |
| Cytotoxic | 8.332792 | 49.5245107862 | 21 | Partial curve; partial efficacy | -5.0792094394 | 1.0999999999 | 0.9340057086 | 63.4615329228 | 112.986043709 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 68.38200883 | 111.88349604 | 110.78480124 | 117.35653214 | 111.44884197 | 114.10667629 | 109.45950549 | 110.63057916 | 112.57592976 | 87.57458275 | 85.19588278 | 68.38200883 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by SIGMA | |
| Cytotoxic | 20.931028 | 52.9277795447 | 20 | Partial curve; partial efficacy | -4.6792094394 | 1.826479391 | 0.8959578831 | 51.0365606063 | 103.964340151 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 57.95409763 | 107.36507637 | 107.17823021 | 104.02235982 | 94.4921874 | 107.49444479 | 111.96145982 | 101.69170518 | 100.82766408 | 96.67737263 | 87.94223064 | 57.95409763 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Tocris | |
| Inactive | 0 | 0 | 0 | 4 | 93.80688079 | 105.91141378 | 109.76666813 | 105.60538992 | 104.35370756 | 105.24631953 | 108.36565168 | 100.03900809 | 100.24922816 | 104.67083317 | 97.341096 | 93.80688079 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 98.70583996 | 126.39124083 | 111.66855536 | 116.29448449 | 114.82242189 | 109.34513444 | 119.78798385 | 112.15214192 | 106.82869368 | 111.55826141 | 103.30913654 | 98.70583996 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Cytotoxic | 16.626107 | 42.7258053011 | 20 | Partial curve; partial efficacy | -4.7792094394 | 2.4063783767 | 0.8933594706 | 70.8520092569 | 113.577814558 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 74.12835756 | 105.20132442 | 116.30007365 | 112.09969138 | 109.39798456 | 114.10565454 | 122.89325894 | 115.37653246 | 114.53022731 | 110.5493031 | 94.86350674 | 74.12835756 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Tocris | |
| Cytotoxic | 4.685874 | 57.4776960986 | 22 | Partial curve; partial efficacy | -5.3292094394 | 1.031 | 0.9558389896 | 46.5742305114 | 104.05192661 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 47.57379318 | 97.55192661 | 104.75001073 | 102.33379056 | 104.27269654 | 106.53564837 | 102.23281122 | 103.05926072 | 88.31527956 | 69.1872601 | 67.17988559 | 47.57379318 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL | |
| Cytotoxic | 11.770382 | 81.6415405989 | 42 | Partial curve; partial efficacy | -4.9292094394 | 1.9673362061 | 0.9489717408 | 19.3757505781 | 101.017291177 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 26.03678554 | 109.34845847 | 103.55281259 | 96.29692439 | 99.49158457 | 104.77927742 | 99.00538595 | 87.49135911 | 104.17858269 | 93.29787868 | 46.11780089 | 26.03678554 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by SigmaAldrich | |
| Cytotoxic | 16.626107 | 60.711685678 | 20 | Partial curve; partial efficacy | -4.7792094394 | 2.7202212143 | 0.9446112083 | 68.4038452055 | 129.1155308835 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 69.54187483 | 126.53578145 | 125.86799693 | 132.01561973 | 137.94688616 | 131.66487601 | 126.96787285 | 120.75545832 | 130.35184884 | 125.51865498 | 104.74744388 | 69.54187483 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 105.51576369 | 117.26650771 | 109.56295975 | 118.94536543 | 117.99469881 | 124.70586193 | 113.69785999 | 123.35194626 | 127.72515739 | 110.2443032 | 106.56227166 | 105.51576369 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL | ||||||||
| Cytotoxic | 16.626107 | 31.798368568 | 20 | Partial curve; partial efficacy; poor fit | -4.7792094394 | 0.9999999999 | 0.8572308578 | 80.055798082 | 111.85416665 | -2.4 | 0 0 0 0 0 0 0 0 0 0 0 | 86.93885951 | 111.35416665 | 106.33121206 | 113.83039806 | 113.47880072 | 112.2279335 | 109.56607308 | 114.5451024 | 111.21795524 | 98.87826 | 99.99078889 | 86.93885951 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 107.26843486 | 94.81610914 | 97.85532364 | 98.43640688 | 108.09969525 | 106.56987259 | 104.00075757 | 108.99553456 | 110.26329675 | 109.82586403 | 109.59758461 | 107.26843486 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Cytotoxic | 33.173444 | 36.824013528 | 20 | Single point of activity | -4.4792094394 | 4.9549173134 | 0.7206002919 | 93.967106552 | 130.79112008 | -3 | 0 0 0 0 0 0 0 0 0 0 0 | 99.85444214 | 129.29112008 | 118.86909356 | 138.62777447 | 136.41063945 | 133.01349789 | 136.94248613 | 132.8609025 | 126.11539145 | 125.22958192 | 130.35553402 | 99.85444214 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | |
| Cytotoxic | 18.654798 | 36.650787941 | 20 | Partial curve; partial efficacy | -4.7292094394 | 2.1210667061 | 0.8930806089 | 77.583548589 | 114.23433653 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 79.65102944 | 110.23433653 | 112.21128139 | 115.61730723 | 109.40827002 | 118.6066903 | 120.14283511 | 112.66406253 | 116.70637962 | 107.74185795 | 100.95338547 | 79.65102944 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis_Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at Concentration_0 % | Activity at Concentration_1 % | Activity at Concentration_2 % | Activity at Concentration_3 % | Activity at Concentration_4 % | Activity at Concentration_5 % | Activity at Concentration_6 % | Activity at Concentration_7 % | Activity at Concentration_8 % | Activity at Concentration_9 % | Activity at Concentration_10 % | Concentration_0 uM | Concentration_1 uM | Concentration_2 uM | Concentration_3 uM | Concentration_4 uM | Concentration_5 uM | Concentration_6 uM | Concentration_7 uM | Concentration_8 uM | Concentration_9 uM | Concentration_10 uM | Compound_QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 80.02148234 | 101.20788139 | 97.84888687 | 105.89636326 | 108.29320283 | 92.87444659 | 100.6145616 | 108.9874745 | 114.18790217 | 110.14735973 | 108.95928436 | 80.02148234 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 90.00912212 | 99.13660484 | 93.65322734 | 102.9308869 | 106.74859084 | 114.00932699 | 91.84607188 | 117.54473285 | 102.12797932 | 101.84760282 | 100.44909944 | 90.00912212 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by NCI | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 104.37229643 | 98.52229925 | 103.20265367 | 106.43349735 | 104.0043821 | 97.91470584 | 110.41676018 | 102.62513663 | 92.20411391 | 104.37546884 | 104.77028463 | 104.37229643 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Tocris | ||||||||
| Cytotoxic | 18.654798 | 37.616278766 | 20 | Partial curve; partial efficacy | -4.7292094394 | 1.4163171 | 0.8211844825 | 56.913443282 | 94.529722048 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 62.94234808 | 93.08687207 | 94.5024496 | 90.18207737 | 96.6648236 | 104.08534852 | 87.38668143 | 92.50686287 | 97.07823082 | 85.10390275 | 80.35836909 | 62.94234808 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 15.17791766 | 28.49617118 | 28.03964463 | 26.8550491 | 27.59274956 | 29.44986357 | 28.00615282 | 23.74535952 | 21.71519271 | 21.61993563 | 17.0702637 | 15.17791766 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by SIGMA | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 91.02564581 | 101.30416909 | 95.64214437 | 102.90155409 | 109.35453841 | 107.75350194 | 105.23077412 | 107.59231016 | 101.85251264 | 94.50915691 | 108.65986619 | 91.02564581 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Cytotoxic | 0.104904 | 73.6851191448 | 91 | Complete curve; high efficacy | -6.9792094394 | 2.1876167061 | 0.9396542585 | 14.1020125492 | 87.787131694 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | -6.6794886 | 87.78188026 | 84.26488908 | 82.86217831 | 93.26799706 | 69.53526432 | 29.17344111 | 24.36875227 | 22.22750511 | 24.88975368 | 9.6824185 | -6.6794886 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by NCI | |
| Cytotoxic | 8.332792 | 98.2330426078 | 42 | Partial curve; partial efficacy | -5.0792094394 | 0.5 | 0.9081850033 | 13.9254127331 | 112.1584553409 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 38.90457145 | 116.96444244 | 106.70964546 | 112.90951135 | 94.00388537 | 114.72592704 | 102.57897056 | 81.01676248 | 86.75494487 | 64.88925627 | 62.49763109 | 38.90457145 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by SIGMA | |
| Cytotoxic | 33.173444 | 81.7661453151 | 20 | Partial curve; partial efficacy; poor fit | -4.4792094394 | 1.0999999999 | 0.7603079021 | 36.1651942679 | 117.931339583 | -2.4 | 0 0 0 0 0 0 0 0 0 0 0 | 57.63813278 | 124.74106563 | 120.83117045 | 106.56557675 | 125.73539325 | 107.84912617 | 109.35480939 | 110.1427275 | 119.0660228 | 111.91276776 | 107.05357281 | 57.63813278 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Tocris | |
| Inactive | 0 | 0 | 0 | 4 | 96.56442579 | 112.64563791 | 106.67851163 | 106.48140286 | 108.07783328 | 109.93220077 | 100.05085456 | 101.24669384 | 104.30515091 | 100.06348297 | 91.19724906 | 96.56442579 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 108.39462009 | 98.25519315 | 96.89040283 | 98.80692087 | 89.47239116 | 116.94004872 | 106.69855458 | 99.52163332 | 105.5970888 | 89.69025639 | 102.01012103 | 108.39462009 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 103.30028257 | 109.88922114 | 114.35202169 | 101.25379107 | 116.73747642 | 116.62274078 | 117.56152923 | 105.75698573 | 104.05591185 | 99.96911504 | 100.64180036 | 103.30028257 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Tocris | ||||||||
| Cytotoxic | 26.350603 | 48.1312982876 | 20 | Single point of activity | -4.5792094394 | 4.5044702849 | 0.9325915091 | 58.5883265004 | 106.719624788 | -3 | 0 0 0 0 0 0 0 0 0 0 0 | 62.43210451 | 105.69391079 | 111.78243894 | 103.30489792 | 109.87335245 | 106.11935257 | 112.17496453 | 106.73843833 | 106.7328653 | 99.60485055 | 102.93427107 | 62.43210451 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL | |
| Cytotoxic | 0.166261 | 29.6931329945 | 20 | Complete curve; partial efficacy; poor fit | -6.7792094394 | 4.9549173134 | 0.7558977655 | 60.5509543685 | 90.244087363 | -1.4 | 0 0 0 0 0 0 0 1 0 0 0 | 56.65038458 | 92.54062704 | 81.75707654 | 94.17358528 | 84.50434865 | 98.72439218 | 70.23453612 | 45.75899541 | 99.55890987 | 74.41028176 | 65.14395292 | 56.65038458 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by SigmaAldrich | |
| Cytotoxic | 2.3485 | 74.0115103846 | 64 | Complete curve; partial efficacy | -5.6292094394 | 2.7202212143 | 0.9611901811 | 36.3146660484 | 110.326176433 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 33.1476328 | 110.52596674 | 95.26474848 | 120.14553587 | 113.36303646 | 106.72195122 | 108.09853152 | 114.62203058 | 90.71252135 | 41.8269676 | 41.45609081 | 33.1476328 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 90.83692284 | 112.78446799 | 97.83367665 | 97.45209098 | 98.67659948 | 93.46526699 | 113.97602208 | 103.17479917 | 101.31547085 | 99.1465157 | 101.95036465 | 90.83692284 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL | ||||||||
| Cytotoxic | 0.742661 | 51.2198390021 | 20 | Complete curve; partial efficacy | -6.1292094394 | 1.6266150999 | 0.9781697494 | 43.9830030109 | 95.202842013 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 47.14595624 | 97.52820683 | 94.6309102 | 89.45778359 | 94.8517101 | 99.60185165 | 87.14982733 | 79.16181168 | 51.6512351 | 46.9378582 | 41.34820348 | 47.14595624 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 111.67980436 | 106.93620156 | 115.92711263 | 103.11534475 | 92.5603588 | 96.07661586 | 102.003388 | 106.90718194 | 113.34671353 | 105.32142381 | 106.75152674 | 111.67980436 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 103.19509112 | 102.63676858 | 106.00743853 | 101.79435645 | 99.59140233 | 102.86428394 | 89.79656864 | 116.70125859 | 110.533025 | 115.4194969 | 105.38959667 | 103.19509112 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Microsource | ||||||||
| Inconclusive | 0.14818 | 26.1118091445 | 10 | Complete curve; partial efficacy; poor fit | -6.8292094394 | 2.5884283767 | 0.6372821245 | 108.842497435 | 82.7306882905 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 113.27238293 | 95.86405699 | 90.87434175 | 68.50616548 | 76.01827819 | 84.25220202 | 100.69171801 | 99.90765787 | 123.29056993 | 109.10568359 | 96.75177301 | 113.27238293 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by BIOMOL |
| Phenotype | Potency | Efficacy | Analysis_Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at Concentration_0 % | Activity at Concentration_1 % | Activity at Concentration_2 % | Activity at Concentration_3 % | Activity at Concentration_4 % | Activity at Concentration_5 % | Activity at Concentration_6 % | Activity at Concentration_7 % | Activity at Concentration_8 % | Activity at Concentration_9 % | Activity at Concentration_10 % | Concentration_0 uM | Concentration_1 uM | Concentration_2 uM | Concentration_3 uM | Concentration_4 uM | Concentration_5 uM | Concentration_6 uM | Concentration_7 uM | Concentration_8 uM | Concentration_9 uM | Concentration_10 uM | Compound_QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Inactive | 0 | 0 | 0 | 4 | 98.77331512 | 123.2845658 | 124.22532023 | 132.42168278 | 122.73550796 | 111.01210255 | 134.98009346 | 115.83579085 | 118.56248511 | 113.35744055 | 129.81428043 | 98.77331512 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 119.44881534 | 109.83018896 | 117.02998293 | 126.45599308 | 127.06811598 | 121.456866 | 131.3683505 | 119.81329395 | 123.80724109 | 123.24838168 | 118.59623701 | 119.44881534 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 110.87881988 | 114.39958966 | 116.66613661 | 109.85360943 | 104.2652387 | 109.37224839 | 115.41815248 | 99.95899055 | 105.60844763 | 93.93813577 | 98.62803566 | 110.87881988 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | ||||||||
| Cytotoxic | 26.350603 | 61.033556681 | 20 | Partial curve; partial efficacy | -4.5792094394 | 2.1210667061 | 0.8450249404 | 50.112350959 | 111.14590764 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 64.16308332 | 104.64590764 | 110.70237079 | 101.98494284 | 118.73590222 | 114.58142154 | 123.70475829 | 109.15274658 | 106.41644137 | 108.94385832 | 96.73436536 | 64.16308332 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Inactive | 0 | 0 | 0 | 4 | 75.47371228 | 91.47572631 | 105.35863444 | 114.38172439 | 91.50636363 | 101.66145564 | 98.50857719 | 103.13317557 | 92.18644923 | 75.37608366 | 105.39962736 | 75.47371228 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | ||||||||
| Cytotoxic | 14.818033 | 163.6706241665 | 42 | Partial curve; high efficacy | -4.8292094394 | 0.6 | 0.9154130691 | -37.8989017252 | 125.7717224413 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.88806183 | 130.34732294 | 125.4007174 | 130.03061643 | 133.61950465 | 106.89093846 | 95.56763364 | 100.84849073 | 106.47531158 | 67.23440779 | 55.81172002 | 2.88806183 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 14.818033 | 189.4732833109 | 42 | Partial curve; high efficacy | -4.8292094394 | 0.7999999999 | 0.9446321131 | -42.1225007104 | 147.3507826005 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 6.1994028 | 157.20535127 | 136.45667282 | 157.80815156 | 128.96996883 | 152.89859536 | 154.05289872 | 127.31618916 | 104.58601948 | 94.79882601 | 61.10141999 | 6.1994028 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 0.525764 | 80.6418778234 | 86 | Complete curve; high efficacy | -6.2792094394 | 1.713743691 | 0.9584109312 | 32.7920890891 | 113.4339669125 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 38.19294078 | 111.12565965 | 98.81444384 | 125.02102314 | 118.72261409 | 116.35460457 | 92.56183302 | 77.39328556 | 36.99575263 | 31.18716839 | 32.47417278 | 38.19294078 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 0.468587 | 87.5556670721 | 20 | Complete curve; partial efficacy | -6.3292094394 | 0.4 | 0.8594122407 | 58.3344169459 | 145.890084018 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 74.78201593 | 152.80423557 | 133.3585485 | 114.85906231 | 126.90640989 | 119.44435453 | 110.00135107 | 119.68794549 | 79.8060996 | 77.72158358 | 73.66272005 | 74.78201593 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 5.257637 | 137.1088747497 | 84 | Complete curve; high efficacy | -5.2792094394 | 1.21 | 0.9787381856 | -12.362775991 | 124.7460987587 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 2.77007793 | 133.22571518 | 118.42893444 | 125.77556798 | 122.09381015 | 122.14067217 | 130.91884055 | 106.25230607 | 96.50564171 | 64.14254587 | 6.17203652 | 2.77007793 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 5.257637 | 111.8493350946 | 84 | Complete curve; high efficacy | -5.2792094394 | 3.1319983358 | 0.9675287911 | 3.4650734974 | 115.314408592 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 4.75384297 | 101.73396708 | 111.53920858 | 118.32100118 | 107.71788088 | 116.03977031 | 134.09138118 | 112.08901549 | 117.9602775 | 58.86591679 | 7.23832945 | 4.75384297 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 0.058992 | 100.1299338576 | 90 | Complete curve; high efficacy | -7.2292094394 | 1.5094870999 | 0.9904928958 | 28.9436150049 | 129.0735488625 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 21.11222353 | 132.9892446 | 127.34565253 | 122.43296166 | 108.67216567 | 81.68532654 | 37.12142429 | 34.23813841 | 34.22135214 | 31.60651481 | 29.13345071 | 21.11222353 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Inactive | 0 | 0 | 0 | 4 | 125.37272407 | 117.28007154 | 131.53955647 | 103.83963696 | 136.94222878 | 120.96241656 | 131.40391678 | 126.71766857 | 115.02203277 | 124.40944647 | 105.0942778 | 125.37272407 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 108.68213057 | 123.61195824 | 119.62845419 | 106.64034866 | 107.89742023 | 118.39177395 | 126.99486665 | 120.03507452 | 114.439606 | 116.47871958 | 107.89158702 | 108.68213057 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | ||||||||
| Cytotoxic | 0.018655 | 69.1979715489 | 76 | Complete curve; partial efficacy | -7.7292094394 | 0.4 | 0.9457119077 | -0.1492707979 | 69.048700751 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 2.47763312 | 63.11215271 | 43.93391493 | 35.78216696 | 31.29027845 | 27.76854987 | 23.44498819 | 19.44312078 | 5.89239342 | 5.21691947 | 4.00258318 | 2.47763312 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Inactive | 0 | 0 | 0 | 4 | 115.39941592 | 126.07389138 | 121.12508889 | 124.50445658 | 126.19784294 | 136.71165674 | 119.16075208 | 139.65618042 | 116.62234199 | 116.08914997 | 115.385127 | 115.39941592 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | ||||||||
| Cytotoxic | 16.626107 | 139.8896516382 | 42 | Partial curve; high efficacy | -4.7792094394 | 1.2221 | 0.9127942118 | -15.4770159039 | 124.4126357343 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.71926492 | 111.70066904 | 118.48462029 | 130.7790893 | 118.7631013 | 129.19731042 | 139.52944065 | 135.34433616 | 96.46848388 | 95.21892189 | 68.31935481 | 5.71926492 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 37.221216 | 41.5090705741 | 20 | Single point of activity | -4.4292094394 | 4.9549173134 | 0.6941475608 | 55.9561315159 | 97.46520209 | -3 | 0 0 0 0 0 1 0 0 0 0 0 | 65.72038092 | 93.46520209 | 107.87323262 | 100.3200816 | 87.5908772 | 98.67787904 | 133.53060946 | 101.5710555 | 97.70474126 | 86.71399898 | 102.45535056 | 65.72038092 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 1.320659 | 88.1680718152 | 85 | Complete curve; high efficacy | -5.8792094394 | 1.34431 | 0.9640008215 | 21.7178594475 | 109.8859312627 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 25.73388482 | 102.82161403 | 122.69812714 | 107.55056252 | 98.12049011 | 118.06684027 | 106.07420647 | 82.12456201 | 61.63702459 | 33.13970912 | 21.77930953 | 25.73388482 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck | |
| Cytotoxic | 13.206586 | 137.1059088786 | 42 | Partial curve; high efficacy | -4.8792094394 | 0.3 | 0.8057851825 | -23.7470494396 | 113.358859439 | -2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 8.36087633 | 108.69814436 | 111.93232253 | 89.9557456 | 102.6480757 | 89.18351753 | 75.49933068 | 60.69736014 | 72.10700236 | 68.83206071 | 61.76143781 | 8.36087633 | 0.00078041474654 | 0.0023412442396 | 0.0070237788018 | 0.021071290322 | 0.06321391705 | 0.18964175115 | 0.56892529953 | 1.7067758986 | 5.1203276958 | 15.360983087 | 46.082949308 | QC'd by Selleck |
| Phenotype | Potency | Efficacy | Analysis_Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at Concentration_0 % | Activity at Concentration_1 % | Activity at Concentration_2 % | Activity at Concentration_3 % | Activity at Concentration_4 % | Activity at Concentration_5 % | Activity at Concentration_6 % | Activity at Concentration_7 % | Activity at Concentration_8 % | Activity at Concentration_9 % | Activity at Concentration_10 % | Concentration_0 uM | Concentration_1 uM | Concentration_2 uM | Concentration_3 uM | Concentration_4 uM | Concentration_5 uM | Concentration_6 uM | Concentration_7 uM | Concentration_8 uM | Concentration_9 uM | Concentration_10 uM | Compound_QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 37.19748 | 91.1342258495 | 20 | Single point of activity | -4.4294864767 | 4.9549173134 | 0.875481372 | 4.342393835 | 95.4766196845 | -3 | 0 0 0 0 0 0 0 0 0 0 0 | 24.57883391 | 83.22279584 | 86.15690317 | 90.29154519 | 95.26274347 | 95.65159486 | 96.59093522 | 92.85441883 | 100.06083793 | 105.84713351 | 109.6553108 | 24.57883391 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inactive | 0 | 0 | 0 | 4 | 93.85099954 | 79.47769062 | 82.20956532 | 93.97758158 | 90.83062276 | 94.89075759 | 90.61244416 | 81.76876926 | 90.87727832 | 84.23366416 | 90.2317818 | 93.85099954 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Tocris | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 86.1344433 | 73.98067854 | 67.23945321 | 82.5357128 | 82.37848669 | 92.21754618 | 92.86715162 | 83.87019067 | 85.26785026 | 74.65001565 | 88.90250275 | 86.1344433 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 89.23645972 | 83.0370568 | 79.61469844 | 87.5254377 | 64.61081799 | 69.99047086 | 101.20265416 | 68.83476347 | 63.62901993 | 53.98793061 | 90.75410464 | 89.23645972 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Glixx | ||||||||
| Cytotoxic | 0.029547 | 21.649337764 | 20 | Complete curve; partial efficacy; poor fit | -7.5294864767 | 1.6604358099 | 0.9561446094 | 23.652041286 | 45.30137905 | -1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 23.41480807 | 46.80137905 | 41.80248582 | 46.94655808 | 34.97008078 | 30.11651125 | 23.51052303 | 23.7348496 | 25.94916909 | 23.04666884 | 22.09359758 | 23.41480807 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by DC Chemicals | |
| Inactive | 0 | 0 | 0 | 4 | 89.69858415 | 87.84336949 | 67.98533977 | 80.23988212 | 82.03837763 | 92.29191727 | 74.97990836 | 85.66983282 | 86.77136153 | 68.12569135 | 93.89564795 | 89.69858415 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Cytotoxic | 0.148086 | 63.397375006 | 67 | Complete curve; partial efficacy | -6.8294864767 | 3.9294729863 | 0.9050293228 | 36.915708489 | 100.313083495 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 21.79048366 | 96.59879082 | 94.43025906 | 103.20673263 | 104.33173473 | 101.41829607 | 52.02437111 | 50.29840128 | 50.96295622 | 43.59671848 | 18.61758823 | 21.79048366 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Cayman | |
| Inconclusive | 20.91768 | 631.6850811818 | 10 | -4.6794864767 | 2.7202212143 | 0.975632818 | 714.6895925159 | 83.0045113341 | 2.1 | 0 0 0 0 0 0 0 0 0 0 0 | 745.08217374 | 84.37388626 | 66.2622422 | 83.05211943 | 83.9284342 | 85.53305172 | 81.27260601 | 75.16641435 | 91.53685189 | 100.75315183 | 261.07217232 | 745.08217374 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Prestwick | ||
| Inactive | 0 | 0 | 0 | 4 | 120.40429347 | 117.23356076 | 115.21849609 | 108.29317671 | 75.48048055 | 106.74453062 | 100.41237385 | 110.86019256 | 105.12953065 | 111.22572436 | 108.89664244 | 120.40429347 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 99.91771699 | 101.98033829 | 91.46550091 | 96.50193217 | 103.61878878 | 103.49397924 | 95.83462625 | 99.06318399 | 91.64823837 | 100.9118831 | 100.78474636 | 99.91771699 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Selleck | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 99.65479254 | 107.41424051 | 104.19606178 | 97.0227829 | 97.64026763 | 101.74012424 | 103.39301871 | 112.88722995 | 111.7787508 | 113.20176801 | 101.15631119 | 99.65479254 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Inconclusive | 9.343585 | 50.7375730341 | 10 | Single point of activity | -5.0294864767 | 4.0949729863 | 0.8148026191 | 141.338922044 | 90.6013490099 | 3 | 0 0 0 0 0 0 0 0 0 0 1 | 113.14744817 | 97.50265321 | 77.46662565 | 86.96133085 | 92.79304848 | 102.63091894 | 88.77452992 | 85.52355991 | 91.86463031 | 94.94244968 | 135.67627001 | 113.14744817 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | |
| Cytotoxic | 20.91768 | 70.460002122 | 20 | Partial curve; partial efficacy; poor fit | -4.6794864767 | 1.21 | 0.8219967057 | 22.732304318 | 93.19230644 | -2.4 | 0 0 0 1 0 0 0 0 0 0 0 | 41.21361635 | 98.96771645 | 94.3474023 | 72.66103908 | 61.9134786 | 96.08606294 | 88.63250681 | 91.16896301 | 86.2686356 | 82.52694031 | 65.40999615 | 41.21361635 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by APExBIO | |
| Inactive | 0 | 0 | 0 | 4 | 98.37191731 | 101.0227377 | 85.5965364 | 91.76796683 | 101.84383168 | 97.81853288 | 100.2541168 | 103.91910324 | 99.51649589 | 104.2833848 | 95.01533917 | 98.37191731 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by SIGMA | ||||||||
| Cytotoxic | 14.808584 | 39.409514256 | 21 | Partial curve; partial efficacy | -4.8294864767 | 1.8079476909 | 0.8861691488 | 60.393805782 | 99.803320038 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 65.1610126 | 99.50750227 | 99.61224833 | 102.00943236 | 98.93012534 | 89.6273854 | 107.20283492 | 101.73821663 | 99.01890986 | 94.92302378 | 79.19302924 | 65.1610126 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inactive | 0 | 0 | 0 | 4 | 95.20220335 | 95.86509309 | 101.256044 | 100.79084239 | 105.65881833 | 102.36332534 | 93.0129541 | 107.79376442 | 109.54367405 | 104.25027189 | 96.91356101 | 95.20220335 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 116.11066365 | 109.55798176 | 104.64236051 | 113.96538634 | 120.25184545 | 112.02474568 | 85.5247867 | 93.94234109 | 92.51697186 | 121.10071117 | 115.38270483 | 116.11066365 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 83.37811478 | 82.90720958 | 68.55163275 | 82.00108591 | 87.26243762 | 89.40873549 | 86.44923201 | 91.62428911 | 85.16844732 | 72.50238696 | 79.54618215 | 83.37811478 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 99.79941552 | 93.61398668 | 86.36094517 | 91.83692551 | 96.62300461 | 108.81108568 | 100.63660756 | 95.55377397 | 107.99400802 | 89.90598463 | 93.86607704 | 99.79941552 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 86.95535696 | 92.83545394 | 98.68657693 | 104.24344275 | 105.4936814 | 97.01412895 | 99.93539265 | 101.27292951 | 96.95032567 | 90.95682675 | 91.61634128 | 86.95535696 | 0.00156 | 0.0046799999999 | 0.014 | 0.0421 | 0.126 | 0.379 | 1.1399999999 | 3.41 | 10.199999999 | 30.7 | 92.2 | QC'd by Tocris |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|---|
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 33.795 | Kd | = | 33795 | nM | Uncertain |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|---|
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|---|
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| Phenotype | Potency | Efficacy | Analysis_Comment | Activity_Score | Curve_Description | Fit_LogAC50 | Fit_HillSlope | Fit_R2 | Fit_InfiniteActivity | Fit_ZeroActivity | Fit_CurveClass | Excluded_Points | Max_Response | Activity at Concentration_0 % | Activity at Concentration_1 % | Activity at Concentration_2 % | Activity at Concentration_3 % | Activity at Concentration_4 % | Activity at Concentration_5 % | Activity at Concentration_6 % | Activity at Concentration_7 % | Activity at Concentration_8 % | Activity at Concentration_9 % | Activity at Concentration_10 % | Concentration_0 uM | Concentration_1 uM | Concentration_2 uM | Concentration_3 uM | Concentration_4 uM | Concentration_5 uM | Concentration_6 uM | Concentration_7 uM | Concentration_8 uM | Concentration_9 uM | Concentration_10 uM | Compound_QC |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Cytotoxic | 33.152289 | 123.4768077299 | 20 | Single point of activity | -4.4794864767 | 4.9549173134 | 0.8843306536 | -11.4750609999 | 112.00174673 | -3 | 0 0 0 0 0 0 0 0 0 0 0 | 8.459464 | 108.132089 | 108.598322 | 93.049264 | 117.935057 | 107.628887 | 137.448055 | 122.654751 | 105.203701 | 107.33169 | 109.282221 | 8.459464 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inconclusive | 2.63338 | 30.729437 | 10 | Complete curve; partial efficacy; poor fit | -5.5794864767 | 4.9549173134 | 0.7048457687 | 138.8756955 | 108.1462585 | 1.4 | 0 0 0 0 0 0 0 0 0 0 1 | 78.880916 | 108.117553 | 115.28756 | 114.0642 | 114.663595 | 102.49763 | 89.762403 | 114.749372 | 108.291252 | 143.278688 | 134.072721 | 78.880916 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Tocris | |
| Inconclusive | 0.001048 | 32.10881536 | 10 | Complete curve; partial efficacy; poor fit | -8.9794864767 | 4.9549173134 | 0.601529813 | 105.30076896 | 73.1919536 | 1.4 | 0 0 0 0 0 1 0 0 0 0 1 | 87.825068 | 77.349581 | 114.342382 | 108.185159 | 99.126883 | 99.25727 | 142.872301 | 97.40628 | 103.633138 | 118.925855 | 100.968915 | 87.825068 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 75.101541 | 85.782548 | 100.283437 | 88.738914 | 91.302639 | 80.45031 | 83.509673 | 99.184414 | 54.590015 | 80.223362 | 78.726706 | 75.101541 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Glixx | ||||||||
| Cytotoxic | 0.033152 | 73.08463505 | 74 | Complete curve; partial efficacy | -7.4794864767 | 0.3 | 0.7857230189 | 6.5481302 | 79.63276525 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 7.009231 | 56.814735 | 72.462766 | 52.824062 | 30.769737 | 34.554888 | 32.359335 | 30.8747 | 36.278492 | 25.405465 | 11.973765 | 7.009231 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by DC Chemicals | |
| Inactive | 0 | 0 | 0 | 4 | 92.91365 | 106.032751 | 114.319381 | 119.332882 | 105.287718 | 104.568624 | 112.009963 | 124.910228 | 111.272175 | 133.216738 | 95.713766 | 92.91365 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Cytotoxic | 0.052543 | 116.532771265 | 91 | Complete curve; high efficacy | -7.2794864767 | 4.9549173134 | 0.967089477 | 17.92036948 | 134.453140745 | -1.1 | 0 0 0 0 0 0 0 0 0 0 0 | 5.730128 | 121.906597 | 125.013539 | 137.710462 | 153.336525 | 46.196634 | 23.305067 | 23.894049 | 20.279072 | 28.180477 | 7.792604 | 5.730128 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Cayman | |
| Cytotoxic | 10.483674 | 35.8502646 | 20 | Complete curve; partial efficacy | -4.9794864767 | 4.9549173134 | 0.8014048658 | 43.6737268 | 79.5239914 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 44.25479 | 82.160106 | 76.012658 | 81.543817 | 75.224388 | 90.615936 | 67.54192 | 85.89188 | 70.838023 | 83.066325 | 47.834815 | 44.25479 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Prestwick | |
| Inactive | 0 | 0 | 0 | 4 | 79.845333 | 93.445863 | 107.785258 | 98.437738 | 99.945198 | 98.194294 | 82.640002 | 134.755302 | 98.114799 | 93.577217 | 76.930847 | 79.845333 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 86.173009 | 114.561497 | 121.545109 | 107.404273 | 129.191194 | 138.742311 | 105.312996 | 96.544704 | 89.081354 | 116.112186 | 114.668583 | 86.173009 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Selleck | ||||||||
| Inactive | 0 | 0 | 0 | 4 | 95.626043 | 93.941926 | 92.973952 | 118.147532 | 97.589991 | 114.197372 | 93.159681 | 126.628318 | 88.810879 | 75.899274 | 116.938256 | 95.626043 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | ||||||||
| Cytotoxic | 0.002347 | 66.9666587 | 20 | Complete curve; partial efficacy | -8.6294864767 | 1.331 | 0.8038170866 | 62.7159468 | 129.6826055 | -1.2 | 0 0 0 0 0 0 0 0 0 0 0 | 61.849141 | 122.50431 | 93.479011 | 67.936385 | 86.403875 | 64.147961 | 49.287265 | 64.655775 | 51.821168 | 64.97006 | 69.943032 | 61.849141 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | |
| Cytotoxic | 16.615504 | 93.5187708 | 41 | Partial curve; partial efficacy | -4.7794864767 | 1.0999999999 | 0.8458125268 | 6.28768235 | 99.80645315 | -2.2 | 0 0 0 0 0 0 0 0 0 0 0 | 25.112804 | 96.795113 | 98.366063 | 88.566966 | 114.886001 | 101.482756 | 86.909341 | 112.440189 | 96.774389 | 66.248071 | 64.183604 | 25.112804 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by APExBIO | |
| Inactive | 0 | 0 | 0 | 4 | 91.473679 | 90.621579 | 109.921672 | 105.565332 | 130.742561 | 115.841089 | 102.213097 | 125.1864 | 116.907867 | 94.492528 | 112.575039 | 91.473679 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by SIGMA | ||||||||
| Cytotoxic | 9.343585 | 107.48774 | 20 | Partial curve; high efficacy; poor fit | -5.0294864767 | 0.3 | 0.7125591242 | 22.4197114 | 129.9074514 | -2.3 | 0 0 0 0 0 0 0 0 0 0 0 | 48.304721 | 129.195376 | 124.692009 | 134.063213 | 93.483614 | 104.238402 | 93.76418 | 94.98283 | 108.718485 | 78.539239 | 88.137797 | 48.304721 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Cytotoxic | 4.682885 | 31.4746017001 | 20 | Complete curve; partial efficacy; poor fit | -5.3294864767 | 3.5117481694 | 0.6558226513 | 86.6034791999 | 118.0780809 | -1.4 | 0 0 0 1 0 0 0 0 0 0 0 | 84.357972 | 122.082612 | 129.403283 | 120.596943 | -0.398636 | 96.965696 | 107.059014 | 127.21666 | 122.214687 | 99.138241 | 89.849426 | 84.357972 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inconclusive | 0.001176 | 37.744698 | 10 | Complete curve; partial efficacy; poor fit | -8.9294864767 | 4.9549173134 | 0.6382635662 | 108.381368 | 70.63667 | 1.4 | 0 0 0 0 0 0 0 0 0 0 0 | 102.870375 | 74.814484 | 107.025103 | 103.350416 | 120.434181 | 111.743559 | 108.603873 | 95.881107 | 106.168475 | 121.592624 | 103.440686 | 102.870375 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by MedChem Express | |
| Inactive | 0 | 0 | 0 | 4 | 82.853446 | 86.53478 | 95.54842 | 97.905373 | 93.248976 | 91.887912 | 86.165292 | 101.237684 | 107.533068 | 91.564376 | 82.171826 | 82.853446 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | ||||||||
| Inconclusive | 0.001048 | 42.8706232 | 10 | Complete curve; partial efficacy; poor fit | -8.9794864767 | 4.9549173134 | 0.4347488409 | 109.3360932 | 66.46547 | 1.4 | 0 0 0 1 0 0 0 0 0 0 0 | 104.063191 | 72.822474 | 136.392514 | 114.717194 | 146.146724 | 93.252574 | 116.095525 | 111.901871 | 93.237295 | 100.661581 | 115.428107 | 104.063191 | 0.00078 | 0.0023399999999 | 0.00702 | 0.0211 | 0.0632 | 0.18999999999 | 0.569 | 1.71 | 5.12 | 15.399999999 | 46.1 | QC'd by Microsource | |
| Inactive | 0 | 0 | 0 | 4 | 95.154144 | 100.359863 | 119.042914 | 91.457487 | 101.841871 | 100.866546 | 99.107206 | 115.317614 | 107.964032 | 132.325945 | 102.727453 | 95.154144 | 0.00156 | 0.0046799999999 | 0.014 | 0.0421 | 0.126 | 0.379 | 1.1399999999 | 3.41 | 10.199999999 | 30.7 | 92.2 | QC'd by Tocris |
| PubChem Standard Value | Standard Type | Standard Relation | Standard Value | Standard Units | Activity Comment |
|---|---|---|---|---|---|
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 0.005 | Kd | = | 5 | nM | Active |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 1.471 | Kd | = | 1471 | nM | Uncertain |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 1.476 | Kd | = | 1476 | nM | Active |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 30 | Kd | > | 30000 | nM | Inactive |
| 4.216 | Kd | = | 4216 | nM | Uncertain |
| 30 | Kd | > | 30000 | nM | Inactive |