399-35-9
399-35-9 structure
- Name: N-(2-Chloro-4-fluorophenyl)acetamide
- Chemical Name: 2'-chloro-4'-fluoroacetanilide
- CAS Number: 399-35-9
- Molecular Formula: C8H7ClFNO
- Molecular Weight: 187.599
- Create Date: 2018-06-13 10:18:53
- Modify Date: 2024-01-02 16:00:49
| Name | 2'-chloro-4'-fluoroacetanilide |
|---|---|
| Synonyms |
MFCD00042594
Acetamide, N-(2-chloro-4-fluorophenyl)- 2-Chloro-4-Fluoroacetanilide N-(2-Chloro-4-fluorophenyl)acetamide 2'-Chloro-4'-fluoroacetanilide |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.3±32.0 °C at 760 mmHg |
| Melting Point | 117-119 °C(lit.) |
| Molecular Formula | C8H7ClFNO |
| Molecular Weight | 187.599 |
| Flash Point | 143.9±25.1 °C |
| Exact Mass | 187.020020 |
| PSA | 29.10000 |
| LogP | 1.23 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.569 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |