bis(2-furyl)chlorophosphine
Modify Date: 2024-01-06 19:07:11
bis(2-furyl)chlorophosphine structure
|
Common Name | bis(2-furyl)chlorophosphine | ||
|---|---|---|---|---|
| CAS Number | 181257-35-2 | Molecular Weight | 200.55900 | |
| Density | 1.287 g/mL at 25 °C | Boiling Point | 102-104ºC/14mm | |
| Molecular Formula | C8H6ClO2P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 102-104°C/14mm | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | chloro-bis(furan-2-yl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287 g/mL at 25 °C |
|---|---|
| Boiling Point | 102-104ºC/14mm |
| Molecular Formula | C8H6ClO2P |
| Molecular Weight | 200.55900 |
| Flash Point | 102-104°C/14mm |
| Exact Mass | 199.97900 |
| PSA | 39.87000 |
| LogP | 2.45910 |
| Vapour Pressure | 0.0114mmHg at 25°C |
| Index of Refraction | 1.5930 |
| Water Solubility | Reacts with water. |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H261-H314 |
| Precautionary Statements | P231 + P232-P280-P305 + P351 + P338-P310-P422 |
| Hazard Codes | C |
| Risk Phrases | 14-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN3265 |
| Packaging Group | II |
| Hazard Class | 8 |
|
~51%
bis(2-furyl)chl... CAS#:181257-35-2 |
| Literature: Andersen, Neil G.; McDonald, Robert; Keay, Brian A. Tetrahedron Asymmetry, 2001 , vol. 12, # 2 p. 263 - 269 |
|
~14%
bis(2-furyl)chl... CAS#:181257-35-2 |
| Literature: Maerkl, Gottfried; Amrhein, Juergen; Stoiber, Thomas; Striebl, Ulrich; Kreitmeier, Peter Tetrahedron, 2002 , vol. 58, # 13 p. 2551 - 2567 |
|
~%
bis(2-furyl)chl... CAS#:181257-35-2 |
| Literature: Journal of the American Chemical Society, , vol. 134, # 1 p. 111 - 114 |
| Chlorodi(2-furyl)phosphine |
| chlorodi-2-furylphosphane |
| Di-2-furanylphosphinous chloride |