Ethyl 2-methoxy-6-nitrobenzoate
Modify Date: 2025-11-27 18:41:46
Ethyl 2-methoxy-6-nitrobenzoate structure
|
Common Name | Ethyl 2-methoxy-6-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 99060-89-6 | Molecular Weight | 225.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-methoxy-6-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO5 |
|---|---|
| Molecular Weight | 225.19800 |
| Exact Mass | 225.06400 |
| PSA | 81.35000 |
| LogP | 2.30330 |
| InChIKey | CTSQQXACOLENTJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(OC)cccc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~%
Ethyl 2-methoxy... CAS#:99060-89-6 |
| Literature: Shirai; Oda Bl. Nagoya City Univ. pharm. SchoolChem.Abstr., 1956 , vol. 4, p. 30,33 Bl. Nagoya City Univ. pharm. SchoolChem.Abstr., 1957 , p. 9522 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzaldehyde,2-methoxy-6-nitro |
| 2-Methoxy-6-nitro-benzoesaeure-aethylester |
| 2-Methoxy-6-nitro-benzaldehyd |
| 2-methoxy-6-nitro-benzoic acid ethyl ester |
| 2-methoxy-6-nitro-benzaldehyde |
| 2-Nitro-6-methoxy-benzaldehyd |