4-[2-(diethylamino)ethoxy]-N-[(3,4,5-trimethoxyphenyl)methyl]aniline,dihydrochloride
Modify Date: 2025-10-10 03:30:40
![4-[2-(diethylamino)ethoxy]-N-[(3,4,5-trimethoxyphenyl)methyl]aniline,dihydrochloride Structure](https://image.chemsrc.com/caspic/072/98795-95-0.png)
4-[2-(diethylamino)ethoxy]-N-[(3,4,5-trimethoxyphenyl)methyl]aniline,dihydrochloride structure
|
Common Name | 4-[2-(diethylamino)ethoxy]-N-[(3,4,5-trimethoxyphenyl)methyl]aniline,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 98795-95-0 | Molecular Weight | 461.42200 | |
| Density | N/A | Boiling Point | 513.3ºC at 760mmHg | |
| Molecular Formula | C22H34Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.2ºC | |
| Name | 4-[2-(diethylamino)ethoxy]-N-[(3,4,5-trimethoxyphenyl)methyl]aniline,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 513.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H34Cl2N2O4 |
| Molecular Weight | 461.42200 |
| Flash Point | 264.2ºC |
| Exact Mass | 460.19000 |
| PSA | 52.19000 |
| LogP | 5.72210 |
| InChIKey | XRIKIBLFBDEXPE-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc(NCc2cc(OC)c(OC)c(OC)c2)cc1.Cl.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-(2-(Diethylamino)ethoxy)phenyl)-3,4,5-trimethoxybenzenemethanamine dihydrochloride |
| Benzenemethanamine,N-(4-(2-(diethylamino)ethoxy)phenyl)-3,4,5-trimethoxy-,dihydrochloride |
| N-(3,4,5-Trimethoxybenzyl)-4-(2-diethylaminoethoxy)aniline dihydrochloride |
| 4-(2-diethylaminoethyloxy)-N-[(3,4,5-trimethoxyphenyl)methyl]aniline dihydrochloride |