5-chloro-N-(4-phenylmethoxycyclohexyl)pentanamide structure
|
Common Name | 5-chloro-N-(4-phenylmethoxycyclohexyl)pentanamide | ||
|---|---|---|---|---|
| CAS Number | 98454-45-6 | Molecular Weight | 323.85800 | |
| Density | 1.111g/cm3 | Boiling Point | 499.313ºC at 760 mmHg | |
| Molecular Formula | C18H26ClNO2 | Melting Point | 108-109.5ºC | |
| MSDS | N/A | Flash Point | 255.776ºC | |
| Name | 5-chloro-N-(4-phenylmethoxycyclohexyl)pentanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 499.313ºC at 760 mmHg |
| Melting Point | 108-109.5ºC |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.85800 |
| Flash Point | 255.776ºC |
| Exact Mass | 323.16500 |
| PSA | 38.33000 |
| LogP | 4.43060 |
| Index of Refraction | 1.534 |
| InChIKey | HJFOCXDRFIKMQK-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCl)NC1CCC(OCc2ccccc2)CC1 |
|
~78%
5-chloro-N-(4-p... CAS#:98454-45-6 |
| Literature: Nishi; Tabusa; Tanaka; Shimizu; Nakagawa Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1140 - 1147 |
|
~%
5-chloro-N-(4-p... CAS#:98454-45-6 |
| Literature: Nishi; Tabusa; Tanaka; Shimizu; Nakagawa Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1140 - 1147 |
|
~%
5-chloro-N-(4-p... CAS#:98454-45-6 |
| Literature: Nishi; Tabusa; Tanaka; Shimizu; Nakagawa Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1140 - 1147 |
|
~%
5-chloro-N-(4-p... CAS#:98454-45-6 |
| Literature: Nishi; Tabusa; Tanaka; Shimizu; Nakagawa Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1140 - 1147 |
| trans-5-Chloro-N-[4-(phenylmethoxy)cyclohexyl]pentanamide |
| N-(trans-4-Benzyloxycyclohexyl)-5-chlorovaleramide |