6-anilino-2-sulfanylidene-1H-pyrimidin-4-one structure
|
Common Name | 6-anilino-2-sulfanylidene-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 98421-02-4 | Molecular Weight | 219.26300 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-anilino-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.26300 |
| Exact Mass | 219.04700 |
| PSA | 96.84000 |
| LogP | 2.28750 |
| Index of Refraction | 1.712 |
| InChIKey | TUFAZQMRQMDSLB-UHFFFAOYSA-N |
| SMILES | O=c1cc(Nc2ccccc2)[nH]c(=S)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~84%
6-anilino-2-sul... CAS#:98421-02-4 |
| Literature: Ali, Hamed I.; Ashida, Noriyuki; Nagamatsu, Tomohisa Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 2 p. 922 - 940 |
|
~80%
6-anilino-2-sul... CAS#:98421-02-4 |
| Literature: Huebsch, Walter; Pfleiderer, Wolfgang Helvetica Chimica Acta, 1988 , vol. 71, p. 1379 - 1391 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-anilino-4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidine |
| Atu-6,2 |
| 6-(PHENYLAMINO)-2-THIOURACIL |
| 1,2-dihydro-6-(phenylamino)-2-thioxopyrimidin-4(3H)-one |
| 6-(anilino)-2-thiouracil |
| 6-anilino-1,2-dihydro-2-thioxopyrimidin-4(3H)-one |