N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide
Modify Date: 2025-09-02 18:59:37
N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide structure
|
Common Name | N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 956251-03-9 | Molecular Weight | 455.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H21N3O4S2 |
|---|---|
| Molecular Weight | 455.6 |
| InChIKey | LNWYYCPDIBIPKW-UHFFFAOYSA-N |
| SMILES | Cc1nn(S(=O)(=O)c2ccc3ccccc3c2)c(C)c1S(=O)(=O)N(C)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide? |
| A: Molecular formula of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide is C22H21N3O4S2. |
| Q: What is the Chinese name of 956251-03-9? |
| A: Chinese name of 956251-03-9 is 956251-03-9. |
| Q: What is the SMILES notation of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide? |
| A: SMILES notation of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide is Cc1nn(S(=O)(=O)c2ccc3ccccc3c2)c(C)c1S(=O)(=O)N(C)c1ccccc1. |
| Q: What is the molecular weight of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide? |
| A: Molecular weight of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide is 455.6. |
| Q: What is the InChIKey of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide? |
| A: InChIKey of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide is LNWYYCPDIBIPKW-UHFFFAOYSA-N. |
| Q: What is the CAS number of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide? |
| A: CAS number of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide is 956251-03-9. |
| Q: What is the English name of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide? |
| A: The English name of N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide is N,3,5-trimethyl-1-(naphthalene-2-sulfonyl)-N-phenyl-1H-pyrazole-4-sulfonamide. |