4-Chloro-6,7,8-trifluoro-3-quinolinecarbonitrile structure
|
Common Name | 4-Chloro-6,7,8-trifluoro-3-quinolinecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 947339-99-3 | Molecular Weight | 242.58400 | |
| Density | 1.59g/cm3 | Boiling Point | 354.9ºC at 760 mmHg | |
| Molecular Formula | C10H2ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.4ºC | |
| Name | 4-Chloro-6,7,8-trifluoro-3-quinolinecarbonitrile |
|---|
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 354.9ºC at 760 mmHg |
| Molecular Formula | C10H2ClF3N2 |
| Molecular Weight | 242.58400 |
| Flash Point | 168.4ºC |
| Exact Mass | 241.98600 |
| PSA | 36.68000 |
| LogP | 3.17718 |
| Index of Refraction | 1.595 |
| InChIKey | SRZLLBCSDUNHPX-UHFFFAOYSA-N |
| SMILES | N#Cc1cnc2c(F)c(F)c(F)cc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |