4-(5-Isopropyl-2-methylphenoxy)-3-methylaniline
Modify Date: 2025-08-25 11:33:41
4-(5-Isopropyl-2-methylphenoxy)-3-methylaniline structure
|
Common Name | 4-(5-Isopropyl-2-methylphenoxy)-3-methylaniline | ||
|---|---|---|---|---|
| CAS Number | 946785-09-7 | Molecular Weight | 255.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(5-Isopropyl-2-methylphenoxy)-3-methylaniline |
|---|
| Molecular Formula | C17H21NO |
|---|---|
| Molecular Weight | 255.35500 |
| Exact Mass | 255.16200 |
| PSA | 35.25000 |
| LogP | 5.38250 |
| InChIKey | RDORHWWIVNGKJV-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)ccc1Oc1cc(C(C)C)ccc1C |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |