3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one
Modify Date: 2026-08-14 19:29:57
![3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one Structure](https://www.chemsrc.com/extcaspic/312/946292-69-9.png)
3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one structure
|
Common Name | 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one | ||
|---|---|---|---|---|
| CAS Number | 946292-69-9 | Molecular Weight | 411.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H25NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H25NO6 |
|---|---|
| Molecular Weight | 411.4 |
| InChIKey | HZJYBZFKEUZPSV-UHFFFAOYSA-N |
| SMILES | COCCCN1COc2ccc3cc(-c4cc(OC)ccc4OC)c(=O)oc3c2C1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one? |
| A: The English name of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one is 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one. |
| Q: What is the molecular formula of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one? |
| A: Molecular formula of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one is C23H25NO6. |
| Q: What is the molecular weight of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one? |
| A: Molecular weight of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one is 411.4. |
| Q: What is the Chinese name of 946292-69-9? |
| A: Chinese name of 946292-69-9 is 946292-69-9. |
| Q: What is the InChIKey of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one? |
| A: InChIKey of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one is HZJYBZFKEUZPSV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one? |
| A: CAS number of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one is 946292-69-9. |
| Q: What is the SMILES notation of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one? |
| A: SMILES notation of 3-(2,5-dimethoxyphenyl)-9-(3-methoxypropyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one is COCCCN1COc2ccc3cc(-c4cc(OC)ccc4OC)c(=O)oc3c2C1. |