REA structure
|
Common Name | REA | ||
|---|---|---|---|---|
| CAS Number | 945245-82-9 | Molecular Weight | 993.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H68N16O12S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of REAREA is a peptide. REA recognizes lymphatics of a premalignant stage, but not to the tumor lymphatic vessels[1]. |
| Name | REA |
|---|
| Description | REA is a peptide. REA recognizes lymphatics of a premalignant stage, but not to the tumor lymphatic vessels[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C37H68N16O12S2 |
|---|---|
| Molecular Weight | 993.17 |
| InChIKey | WDUGZGANLNYPJA-PRQSBNOCSA-N |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(C)NC(=O)C(CCC(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CS)C(=O)NC(CS)C(=O)O |