N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide
Modify Date: 2025-09-13 22:43:02
N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide structure
|
Common Name | N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 930665-50-2 | Molecular Weight | 227.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9N3O2 |
|---|---|
| Molecular Weight | 227.22 |
| InChIKey | WHICWFMNWVUVGY-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Nc2cccc(C#N)c2)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide? |
| A: Molecular formula of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide is C12H9N3O2. |
| Q: What is the SMILES notation of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide? |
| A: SMILES notation of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide is Cc1cc(C(=O)Nc2cccc(C#N)c2)no1. |
| Q: What is the molecular weight of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide? |
| A: Molecular weight of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide is 227.22. |
| Q: What is the InChIKey of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide? |
| A: InChIKey of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide is WHICWFMNWVUVGY-UHFFFAOYSA-N. |
| Q: What is the English name of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide? |
| A: The English name of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide is N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide. |
| Q: What is the CAS number of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide? |
| A: CAS number of N-(3-cyanophenyl)-5-methyl-1,2-oxazole-3-carboxamide is 930665-50-2. |
| Q: What is the Chinese name of 930665-50-2? |
| A: Chinese name of 930665-50-2 is 930665-50-2. |