N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine
Modify Date: 2025-09-14 07:45:59
![N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine Structure](https://www.chemsrc.com/extcaspic/383/930482-25-0.png)
N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine structure
|
Common Name | N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 930482-25-0 | Molecular Weight | 231.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8F3N5 |
|---|---|
| Molecular Weight | 231.18 |
| InChIKey | FMVFYJMBKDFDPD-UHFFFAOYSA-N |
| SMILES | CCNc1ccc2nnc(C(F)(F)F)n2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine? |
| A: Molecular formula of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is C8H8F3N5. |
| Q: What is the SMILES notation of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine? |
| A: SMILES notation of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is CCNc1ccc2nnc(C(F)(F)F)n2n1. |
| Q: What is the molecular weight of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine? |
| A: Molecular weight of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is 231.18. |
| Q: What is the Chinese name of 930482-25-0? |
| A: Chinese name of 930482-25-0 is 930482-25-0. |
| Q: What is the InChIKey of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine? |
| A: InChIKey of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is FMVFYJMBKDFDPD-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine? |
| A: CAS number of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is 930482-25-0. |
| Q: What is the English name of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine? |
| A: The English name of N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is N-ethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine. |