2-(2,4-dichlorophenoxy)-N-(4-methylphenyl)acetamide
Modify Date: 2025-08-26 11:42:10
2-(2,4-dichlorophenoxy)-N-(4-methylphenyl)acetamide structure
|
Common Name | 2-(2,4-dichlorophenoxy)-N-(4-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 92435-95-5 | Molecular Weight | 310.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4-dichlorophenoxy)-N-(4-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13Cl2NO2 |
|---|---|
| Molecular Weight | 310.17500 |
| Exact Mass | 309.03200 |
| PSA | 38.33000 |
| LogP | 4.39230 |
| InChIKey | QXZANJZDOXEGLQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Cl)cc2Cl)cc1 |
|
~%
2-(2,4-dichloro... CAS#:92435-95-5 |
| Literature: Johnston,A.M. Journal of the Chemical Society, 1961 , p. 2335 - 2337 |
| N-p-Tolyl-2,4-dichlor-phenoxy-acetamid |