2,4-diamino-N-methyl-N-phenylquinazoline-6-sulfonamide structure
|
Common Name | 2,4-diamino-N-methyl-N-phenylquinazoline-6-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 92144-30-4 | Molecular Weight | 329.37700 | |
| Density | 1.482g/cm3 | Boiling Point | 635.1ºC at 760 mmHg | |
| Molecular Formula | C15H15N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.9ºC | |
| Name | 2,4-diamino-N-methyl-N-phenylquinazoline-6-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 635.1ºC at 760 mmHg |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.37700 |
| Flash Point | 337.9ºC |
| Exact Mass | 329.09500 |
| PSA | 125.04000 |
| LogP | 2.56030 |
| Index of Refraction | 1.735 |
| InChIKey | SGFWVPMENQKZGT-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc2nc(N)nc(N)c2c1 |
|
~60%
2,4-diamino-N-m... CAS#:92144-30-4 |
| Literature: Elslager; Colbry; Davoll; Hutt; Johnson; Werbel Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1740 - 1743 |
|
~%
2,4-diamino-N-m... CAS#:92144-30-4 |
| Literature: Elslager; Colbry; Davoll; Hutt; Johnson; Werbel Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1740 - 1743 |
| 2,4-Diamino-quinazoline-6-sulfonic acid methyl-phenyl-amide |