3-[(2,6-difluorophenyl)methyl]-2-methyl-1H-pyridin-4-one
Modify Date: 2025-08-26 12:51:34
![3-[(2,6-difluorophenyl)methyl]-2-methyl-1H-pyridin-4-one Structure](https://image.chemsrc.com/caspic/067/919366-53-3.png)
3-[(2,6-difluorophenyl)methyl]-2-methyl-1H-pyridin-4-one structure
|
Common Name | 3-[(2,6-difluorophenyl)methyl]-2-methyl-1H-pyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 919366-53-3 | Molecular Weight | 235.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(2,6-difluorophenyl)methyl]-2-methyl-1H-pyridin-4-one |
|---|
| Molecular Formula | C13H11F2NO |
|---|---|
| Molecular Weight | 235.22900 |
| Exact Mass | 235.08100 |
| PSA | 32.86000 |
| LogP | 2.55230 |
| InChIKey | KEILCFUXKNUMHO-UHFFFAOYSA-N |
| SMILES | Cc1[nH]ccc(=O)c1Cc1c(F)cccc1F |
|
~%
3-[(2,6-difluor... CAS#:919366-53-3 |
| Literature: Kitagawa, Hideo; Kumura, Ko; Takahata, Sho; Iida, Maiko; Atsumi, Kunio Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 2 p. 1106 - 1116 |
|
~%
3-[(2,6-difluor... CAS#:919366-53-3 |
| Literature: Kitagawa, Hideo; Kumura, Ko; Takahata, Sho; Iida, Maiko; Atsumi, Kunio Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 2 p. 1106 - 1116 |
