2,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-quinoxaline-6-carboxylic acid structure
|
Common Name | 2,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-quinoxaline-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 912763-35-0 | Molecular Weight | 306.35700 | |
| Density | 1.164g/cm3 | Boiling Point | 457.1ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.2ºC | |
| Name | 2,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-quinoxaline-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 457.1ºC at 760 mmHg |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.35700 |
| Flash Point | 230.2ºC |
| Exact Mass | 306.15800 |
| PSA | 78.87000 |
| LogP | 3.53180 |
| Index of Refraction | 1.534 |
| InChIKey | XHGHOGSAJRLVJA-UHFFFAOYSA-N |
| SMILES | CC1Nc2cc(C(=O)O)ccc2N(C(=O)OC(C)(C)C)C1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-DICHLOROBENZOIC-7-13C |
| GL-0852 |
| 2,3-Dimethyl-3,4-dihydro-2H-quinoxaline-1,6-dicarboxylic acid 1-tert-butyl ester |