(2-ethyl-5-nitro-1-benzofuran-3-yl)-(4-methoxyphenyl)methanone
Modify Date: 2025-08-25 12:52:06
(2-ethyl-5-nitro-1-benzofuran-3-yl)-(4-methoxyphenyl)methanone structure
|
Common Name | (2-ethyl-5-nitro-1-benzofuran-3-yl)-(4-methoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 90908-76-2 | Molecular Weight | 325.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-ethyl-5-nitro-1-benzofuran-3-yl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO5 |
|---|---|
| Molecular Weight | 325.31500 |
| Exact Mass | 325.09500 |
| PSA | 85.26000 |
| LogP | 4.66620 |
| InChIKey | FNFGWYWJNOESKJ-UHFFFAOYSA-N |
| SMILES | CCc1oc2ccc([N+](=O)[O-])cc2c1C(=O)c1ccc(OC)cc1 |
|
~%
(2-ethyl-5-nitr... CAS#:90908-76-2 |
| Literature: Ohishi; Kuriyama; Doi; Nakanishi Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 7 p. 2854 - 2861 |
|
~%
(2-ethyl-5-nitr... CAS#:90908-76-2 |
| Literature: Ohishi; Kuriyama; Doi; Nakanishi Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 7 p. 2854 - 2861 |
![2-acetyl-5-nitrobenzo[b]furan structure](https://image.chemsrc.com/caspic/373/23136-39-2.png)
| 3-(4-methoxy benzoyl) 2-ethyl 5-nitro benzofuran |
| 2-ethyl-3-4'-methoxybenzoyl-5-nitrobenzo[b]furan |
| Methanone,(2-ethyl-5-nitro-3-benzofuranyl)(4-methoxyphenyl) |