(NZ)-N-[(2-chloro-5-nitro-phenyl)methylidene]hydroxylamine
Modify Date: 2025-10-16 11:17:55
![(NZ)-N-[(2-chloro-5-nitro-phenyl)methylidene]hydroxylamine Structure](https://image.chemsrc.com/caspic/389/89692-57-9.png)
(NZ)-N-[(2-chloro-5-nitro-phenyl)methylidene]hydroxylamine structure
|
Common Name | (NZ)-N-[(2-chloro-5-nitro-phenyl)methylidene]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 89692-57-9 | Molecular Weight | 200.57900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (NZ)-N-[(2-chloro-5-nitro-phenyl)methylidene]hydroxylamine |
|---|
| Molecular Formula | C7H5ClN2O3 |
|---|---|
| Molecular Weight | 200.57900 |
| Exact Mass | 199.99900 |
| PSA | 78.41000 |
| LogP | 2.57950 |
| InChIKey | BCVYAFHZIZEYLS-RUDMXATFSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C=NO)c1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:16588-02-6
CAS#:39835-09-1| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |