2-(3,7-dimethylocta-3,6-dien-2-ylsulfanyl)-1,3-benzothiazole structure
|
Common Name | 2-(3,7-dimethylocta-3,6-dien-2-ylsulfanyl)-1,3-benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 89648-99-7 | Molecular Weight | 303.48500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,7-dimethylocta-3,6-dien-2-ylsulfanyl)-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21NS2 |
|---|---|
| Molecular Weight | 303.48500 |
| Exact Mass | 303.11200 |
| PSA | 66.43000 |
| LogP | 6.07950 |
| InChIKey | SZXOMFGLSLUXRQ-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC=C(C)C(C)Sc1nc2ccccc2s1 |
|
~%
2-(3,7-dimethyl... CAS#:89648-99-7 |
| Literature: Morrison, Norman J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 101 - 106 |
| 7-benzothiazol-2-ylthio-2,6-dimethylocta-2,5-diene |