6-methoxy-N-propyl-5H-pyrido[2,3-c]azepin-9-amine structure
|
Common Name | 6-methoxy-N-propyl-5H-pyrido[2,3-c]azepin-9-amine | ||
|---|---|---|---|---|
| CAS Number | 88609-31-8 | Molecular Weight | 231.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methoxy-N-propyl-5H-pyrido[2,3-c]azepin-9-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17N3O |
|---|---|
| Molecular Weight | 231.29400 |
| Exact Mass | 231.13700 |
| PSA | 46.51000 |
| LogP | 2.20050 |
| InChIKey | FINDXTJJXJXZCH-UHFFFAOYSA-N |
| SMILES | CCCN=C1NC=C(OC)Cc2cccnc21 |
|
~34%
6-methoxy-N-pro... CAS#:88609-31-8 |
| Literature: Patel, Dalpat I.; Scriven, Eric F. V.; Smalley, Robert K.; Suschitzky, Hans Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1911 - 1916 |
|
~76%
6-methoxy-N-pro... CAS#:88609-31-8 |
| Literature: Khan, Zafar U.; Patel, Dalpat I.; Smalley, Robert K.; Scriven, Eric F.V.; Suschitzky, Hans Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2495 - 2500 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-methoxy-9-propylamino-5H-pyrido<2,3-c>-azepine |
| 5H-Pyrido[2,3-c]azepin-9-amine,6-methoxy-N-propyl |