3-methyl-3-(4-nitrophenyl)oxolan-2-one structure
|
Common Name | 3-methyl-3-(4-nitrophenyl)oxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 88426-93-1 | Molecular Weight | 221.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-3-(4-nitrophenyl)oxolan-2-one |
|---|
| Molecular Formula | C11H11NO4 |
|---|---|
| Molecular Weight | 221.20900 |
| Exact Mass | 221.06900 |
| PSA | 72.12000 |
| LogP | 2.32260 |
| InChIKey | VBUUDEKIBCPYGS-UHFFFAOYSA-N |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)CCOC1=O |
|
~48%
3-methyl-3-(4-n... CAS#:88426-93-1 |
| Literature: Nozoye, Toshikazu; Shibanuma, Yoshihisa; Nakai, Tatsuya Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 9 p. 2986 - 2992 |
|
~%
3-methyl-3-(4-n... CAS#:88426-93-1 |
| Literature: Nozoye, Toshikazu; Shibanuma, Yoshihisa; Nakai, Tatsuya Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 9 p. 2986 - 2992 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |