acetic acid,3-(4-methoxyphenyl)-5-phenylcyclohexan-1-ol structure
|
Common Name | acetic acid,3-(4-methoxyphenyl)-5-phenylcyclohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 88387-81-9 | Molecular Weight | 342.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,3-(4-methoxyphenyl)-5-phenylcyclohexan-1-ol |
|---|
| Molecular Formula | C21H26O4 |
|---|---|
| Molecular Weight | 342.42900 |
| Exact Mass | 342.18300 |
| PSA | 66.76000 |
| LogP | 4.19830 |
| InChIKey | RXCORXXCCABARW-UHFFFAOYSA-N |
| SMILES | CC(=O)O.COc1ccc(C2CC(O)CC(c3ccccc3)C2)cc1 |
|
~%
acetic acid,3-(... CAS#:88387-81-9 |
| Literature: Prasad, Mohan; Rastogi, Shri Nivas Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 7 p. 669 - 672 |
|
~78%
acetic acid,3-(... CAS#:88387-81-9 |
| Literature: Prasad, Mohan; Rastogi, Shri Nivas Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 7 p. 669 - 672 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |