(4-nitrophenyl)-[2-[(4-nitrophenyl)diazenyl]cyclohexen-1-yl]diazene structure
|
Common Name | (4-nitrophenyl)-[2-[(4-nitrophenyl)diazenyl]cyclohexen-1-yl]diazene | ||
|---|---|---|---|---|
| CAS Number | 87837-70-5 | Molecular Weight | 380.35700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl)-[2-[(4-nitrophenyl)diazenyl]cyclohexen-1-yl]diazene |
|---|
| Molecular Formula | C18H16N6O4 |
|---|---|
| Molecular Weight | 380.35700 |
| Exact Mass | 380.12300 |
| PSA | 141.08000 |
| LogP | 7.20260 |
| InChIKey | NBZQHBVQMWFJRQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=NC2=C(N=Nc3ccc([N+](=O)[O-])cc3)CCCC2)cc1 |
|
~%
(4-nitrophenyl)... CAS#:87837-70-5 |
| Literature: Butler, Richard N.; James, John P. Journal of the Chemical Society, Chemical Communications, 1983 , # 11 p. 627 - 629 |
|
~%
(4-nitrophenyl)... CAS#:87837-70-5 |
| Literature: Butler, Richard N.; James, John P. Journal of the Chemical Society, Chemical Communications, 1983 , # 11 p. 627 - 629 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |