2-[methyl(phenyl)sulfamoyl]-2-propylpentanoic acid
Modify Date: 2025-09-12 20:58:10
![2-[methyl(phenyl)sulfamoyl]-2-propylpentanoic acid Structure](https://image.chemsrc.com/caspic/117/87712-37-6.png)
2-[methyl(phenyl)sulfamoyl]-2-propylpentanoic acid structure
|
Common Name | 2-[methyl(phenyl)sulfamoyl]-2-propylpentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 87712-37-6 | Molecular Weight | 313.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[methyl(phenyl)sulfamoyl]-2-propylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23NO4S |
|---|---|
| Molecular Weight | 313.41200 |
| Exact Mass | 313.13500 |
| PSA | 83.06000 |
| LogP | 3.95700 |
| InChIKey | FQKNVBBCKUJLIC-UHFFFAOYSA-N |
| SMILES | CCCC(CCC)(C(=O)O)S(=O)(=O)N(C)c1ccccc1 |
|
~%
2-[methyl(pheny... CAS#:87712-37-6 |
| Literature: Jager, Jan; Graafland, Teun; Schenk, Henk; Kirby, Anthony J.; Engberts, Jan B. F. N. Journal of the American Chemical Society, 1984 , vol. 106, p. 139 - 143 |
![ethyl 2-[methyl(phenyl)sulfamoyl]acetate structure](https://image.chemsrc.com/caspic/393/87712-30-9.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-carboxy-N-methyl-N-phenyl-4-heptanesulfonamide |