2-(2-morpholin-4-ylethyl)-1,3-dithiane 1,1,3,3-tetraoxide structure
|
Common Name | 2-(2-morpholin-4-ylethyl)-1,3-dithiane 1,1,3,3-tetraoxide | ||
|---|---|---|---|---|
| CAS Number | 87551-71-1 | Molecular Weight | 297.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-morpholin-4-ylethyl)-1,3-dithiane 1,1,3,3-tetraoxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H19NO5S2 |
|---|---|
| Molecular Weight | 297.39200 |
| Exact Mass | 297.07000 |
| PSA | 97.51000 |
| LogP | 1.36760 |
| InChIKey | BTULKVWWGJYSDU-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CCCS(=O)(=O)C1CCN1CCOCC1 |
|
~%
2-(2-morpholin-... CAS#:87551-71-1 |
| Literature: Li, Chuen; Sammes, Michael P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1303 - 1310 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-morpholinoethyl)-1,3-dithiane 1,1,3,3-tetraoxide |
| Morpholine,4-[2-(1,1,3,3-tetraoxido-1,3-dithian-2-yl)ethyl] |