2-acetyl-4,4-dimethyl-1-phenylpyrazolidin-3-one structure
|
Common Name | 2-acetyl-4,4-dimethyl-1-phenylpyrazolidin-3-one | ||
|---|---|---|---|---|
| CAS Number | 86475-37-8 | Molecular Weight | 232.27800 | |
| Density | 1.154g/cm3 | Boiling Point | 323.7ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.3ºC | |
| Name | 2-acetyl-4,4-dimethyl-1-phenylpyrazolidin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 323.7ºC at 760 mmHg |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Flash Point | 130.3ºC |
| Exact Mass | 232.12100 |
| PSA | 40.62000 |
| LogP | 1.82580 |
| Index of Refraction | 1.549 |
| InChIKey | XWKAZXKJYHZGAI-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(=O)C(C)(C)CN1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyrazolidinone,2-acetyl-4,4-dimethyl-1-phenyl |
| EINECS 289-240-7 |
| 1-Phenyl-2-acetyl-4,4-dimethyl-pyrazolidon-(3) |
| 1-Phenyl-2-acetyl-4,4-dimethyl-3-pyrazolidone |
| 2-acetyl-4,4-dimethyl-1-phenyl-pyrazolidin-3-one |