N,N-diethyl-2-[2-[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]ethoxy]ethoxy]ethanamine structure
|
Common Name | N,N-diethyl-2-[2-[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]ethoxy]ethoxy]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 859-20-1 | Molecular Weight | 381.54900 | |
| Density | 0.984g/cm3 | Boiling Point | 461.8ºC at 760 mmHg | |
| Molecular Formula | C22H39NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.5ºC | |
| Name | N,N-diethyl-2-[2-[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.984g/cm3 |
|---|---|
| Boiling Point | 461.8ºC at 760 mmHg |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.54900 |
| Flash Point | 119.5ºC |
| Exact Mass | 381.28800 |
| PSA | 40.16000 |
| LogP | 3.88880 |
| Index of Refraction | 1.488 |
| InChIKey | WJCSTYNOBZHEQN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOCCOCCOCCOc1cc(C)ccc1C(C)C |
|
~%
N,N-diethyl-2-[... CAS#:859-20-1 |
| Literature: Carissimi,M. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 542 - 545 |
| 1-Diethylamino-11-<6-isopropyl-3-methyl-phenoxy>-3,6,9-trioxa-undecan |
| 12-Ethyl-1-(thymyloxy)-3,6,9-trioxa-12-azatetradecane |
| 3,6,9-Trioxa-12-azatetradecane,12-ethyl-1-(thymyloxy) |
| n,n-diethyl-2-[2-(2-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethoxy}ethoxy)ethoxy]ethanamine |