2-(3,4-dichlorophenoxy)-5-methylsulfinylpyridine structure
|
Common Name | 2-(3,4-dichlorophenoxy)-5-methylsulfinylpyridine | ||
|---|---|---|---|---|
| CAS Number | 85330-95-6 | Molecular Weight | 302.17600 | |
| Density | 1.52g/cm3 | Boiling Point | 462.3ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 2-(3,4-dichlorophenoxy)-5-methylsulfinylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760 mmHg |
| Molecular Formula | C12H9Cl2NO2S |
| Molecular Weight | 302.17600 |
| Flash Point | 233.4ºC |
| Exact Mass | 300.97300 |
| PSA | 58.40000 |
| LogP | 4.78380 |
| Index of Refraction | 1.671 |
| InChIKey | IXZOUXZKBAMFFP-UHFFFAOYSA-N |
| SMILES | CS(=O)c1ccc(Oc2ccc(Cl)c(Cl)c2)nc1 |
|
~%
2-(3,4-dichloro... CAS#:85330-95-6 |
| Literature: The Dow Chemical Company Patent: US4371537 A1, 1983 ; |
| Pyridine,2-(3,4-dichlorophenoxy)-5-(methylsulfinyl) |
| 2-(3,4-DICHLOROPHENOXY)-5-(METHYLSULFINYL)PYRIDINE |