2-(3,4-dichlorophenoxy)-5-methylsulfanylpyridine structure
|
Common Name | 2-(3,4-dichlorophenoxy)-5-methylsulfanylpyridine | ||
|---|---|---|---|---|
| CAS Number | 85330-94-5 | Molecular Weight | 286.17700 | |
| Density | 1.41g/cm3 | Boiling Point | 399.8ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl2NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.6ºC | |
| Name | 2-(3,4-dichlorophenoxy)-5-methylsulfanylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 399.8ºC at 760 mmHg |
| Molecular Formula | C12H9Cl2NOS |
| Molecular Weight | 286.17700 |
| Flash Point | 195.6ºC |
| Exact Mass | 284.97800 |
| PSA | 47.42000 |
| LogP | 4.90260 |
| Index of Refraction | 1.646 |
| InChIKey | WZVMWAUGHRPLTI-UHFFFAOYSA-N |
| SMILES | CSc1ccc(Oc2ccc(Cl)c(Cl)c2)nc1 |
|
~%
2-(3,4-dichloro... CAS#:85330-94-5 |
| Literature: The Dow Chemical Company Patent: US4371537 A1, 1983 ; |
| Pyridine,2-(3,4-dichlorophenoxy)-5-(methylthio) |
| 2-(3,4-dichlorophenoxy)-5-(methylthio)pyridine |