1-(3-bromopropoxy)-4-chloro-2-nitrobenzene structure
|
Common Name | 1-(3-bromopropoxy)-4-chloro-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 848589-64-0 | Molecular Weight | 294.53000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-bromopropoxy)-4-chloro-2-nitrobenzene |
|---|
| Molecular Formula | C9H9BrClNO3 |
|---|---|
| Molecular Weight | 294.53000 |
| Exact Mass | 292.94500 |
| PSA | 55.05000 |
| LogP | 3.93520 |
| InChIKey | DAAVBACJPVLJIS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1OCCCBr |
|
~58%
1-(3-bromopropo... CAS#:848589-64-0 |
| Literature: KHAMRAI, Uttam; Karak, Sumit Kumar; Ronsheim, Matthew; Saha, Ashis Kumar Patent: US2010/168080 A1, 2010 ; Location in patent: Page/Page column 52 ; |
|
~%
1-(3-bromopropo... CAS#:848589-64-0 |
| Literature: Zeng, Lei; Li, Jiaming; Muller, Michaela; Yan, Sherry; Mujtaba, Shiraz; Pan, Chongfeng; Wang, Zhiyong; Zhou, Ming-Ming Journal of the American Chemical Society, 2005 , vol. 127, # 8 p. 2376 - 2377 |