Benzenamine, 3-(2,2-difluoroethoxy)-5-nitro structure
|
Common Name | Benzenamine, 3-(2,2-difluoroethoxy)-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 832738-23-5 | Molecular Weight | 218.15800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzenamine, 3-(2,2-difluoroethoxy)-5-nitro |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8F2N2O3 |
|---|---|
| Molecular Weight | 218.15800 |
| Exact Mass | 218.05000 |
| PSA | 81.07000 |
| LogP | 2.92530 |
| InChIKey | NKVLRUWGBCMVPU-UHFFFAOYSA-N |
| SMILES | Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(2,2-difluoroethoxy)-5-nitroaniline |