3-(2-methylidene-3H-furan-3-yl)-4,5-diphenyl-1,3-oxazol-2-one structure
|
Common Name | 3-(2-methylidene-3H-furan-3-yl)-4,5-diphenyl-1,3-oxazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 82238-51-5 | Molecular Weight | 317.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-methylidene-3H-furan-3-yl)-4,5-diphenyl-1,3-oxazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H15NO3 |
|---|---|
| Molecular Weight | 317.33800 |
| Exact Mass | 317.10500 |
| PSA | 44.37000 |
| LogP | 4.37400 |
| InChIKey | FARHXCLRBFVJPV-UHFFFAOYSA-N |
| SMILES | C=C1OC=CC1n1c(-c2ccccc2)c(-c2ccccc2)oc1=O |
|
~73%
3-(2-methyliden... CAS#:82238-51-5 |
| Literature: Padwa, Albert; Cohen, Leslie A. Journal of Organic Chemistry, 1984 , vol. 49, # 3 p. 399 - 406 |
|
~%
3-(2-methyliden... CAS#:82238-51-5 |
| Literature: Padwa, Albert; Cohen, Leslie A. Journal of Organic Chemistry, 1984 , vol. 49, # 3 p. 399 - 406 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2(3H)-Oxazolone,3-(2,3-dihydro-2-methylene-3-furanyl)-4,5-diphenyl |
| 3-(4,5-diphenyl-2-oxooxazolyl)-2-methylene-3H-furan |