oxiran-2-ylmethyl 7,7-dimethyloctanoate,prop-2-enoic acid,styrene structure
|
Common Name | oxiran-2-ylmethyl 7,7-dimethyloctanoate,prop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 79070-05-6 | Molecular Weight | 404.54000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H36O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | oxiran-2-ylmethyl 7,7-dimethyloctanoate,prop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H36O5 |
|---|---|
| Molecular Weight | 404.54000 |
| Exact Mass | 404.25600 |
| PSA | 76.13000 |
| LogP | 5.51160 |
| InChIKey | ZSIVDQCDRKQVRB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O.C=Cc1ccccc1.CC(C)(C)CCCCCC(=O)OCC1CO1 |
| Neodecanoic acid,oxiranylmethyl ester,polymer with ethenylbenzene and 2-propenoic acid |
| Acrylic acid,2,3-epoxypropylneodecanoate and styrene polymer |
| Neodecanoic acid,2-oxiranylmethyl ester,polymer with ethenylbenzene and 2-propenoic acid |