N-acetyl-N-[4-[(4-hexyl-2,3-dioxopiperazin-1-yl)methyl]phenyl]acetamide structure
|
Common Name | N-acetyl-N-[4-[(4-hexyl-2,3-dioxopiperazin-1-yl)methyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 77917-69-2 | Molecular Weight | 387.47300 | |
| Density | 1.178g/cm3 | Boiling Point | 594.4ºC at 760 mmHg | |
| Molecular Formula | C21H29N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263ºC | |
| Name | N-acetyl-N-[4-[(4-hexyl-2,3-dioxopiperazin-1-yl)methyl]phenyl]acetamide |
|---|
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 594.4ºC at 760 mmHg |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.47300 |
| Flash Point | 263ºC |
| Exact Mass | 387.21600 |
| PSA | 78.00000 |
| LogP | 2.21290 |
| Index of Refraction | 1.561 |
| InChIKey | VKRFFQFUQUAIST-UHFFFAOYSA-N |
| SMILES | CCCCCCN1CCN(Cc2ccc(N(C(C)=O)C(C)=O)cc2)C(=O)C1=O |
|
~99%
N-acetyl-N-[4-[... CAS#:77917-69-2 |
| Literature: Hori; Yoshida; Murakami; Kiba; Takeno; Nakano; Nitta; Tsuda; Saikawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 5 p. 1253 - 1266 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |