(4,4-dimethylcyclohexen-1-yl)oxy-trimethylsilane structure
|
Common Name | (4,4-dimethylcyclohexen-1-yl)oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 77172-48-6 | Molecular Weight | 198.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4,4-dimethylcyclohexen-1-yl)oxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H22OSi |
|---|---|
| Molecular Weight | 198.37700 |
| Exact Mass | 198.14400 |
| PSA | 9.23000 |
| LogP | 3.93190 |
| InChIKey | WLFLXRYIROTBEY-UHFFFAOYSA-N |
| SMILES | CC1(C)CC=C(O[Si](C)(C)C)CC1 |
|
~88%
(4,4-dimethylcy... CAS#:77172-48-6 |
| Literature: Paquette,L.A.; Ham,W.H. Journal of the American Chemical Society, 1987 , vol. 109, p. 3025 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4-dimethylcyclohexanone trimethylsilyl enol ether |