2-[(E)-dec-1-enyl]butanedioic acid structure
|
Common Name | 2-[(E)-dec-1-enyl]butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 76386-11-3 | Molecular Weight | 256.33800 | |
| Density | 1.055g/cm3 | Boiling Point | 379.4ºC at 760 mmHg | |
| Molecular Formula | C14H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 2-[(E)-dec-1-enyl]butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 379.4ºC at 760 mmHg |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.33800 |
| Flash Point | 197.4ºC |
| Exact Mass | 256.16700 |
| PSA | 74.60000 |
| LogP | 3.46870 |
| Index of Refraction | 1.488 |
| InChIKey | HLOQHECIPXZHSX-MDZDMXLPSA-N |
| SMILES | CCCCCCCCC=CC(CC(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Dec-1-enylsuccinic acid |
| EINECS 278-432-6 |