2-(4-chloroanilino)-1-(4-nitrophenyl)ethanone structure
|
Common Name | 2-(4-chloroanilino)-1-(4-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 74620-65-8 | Molecular Weight | 290.70200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chloroanilino)-1-(4-nitrophenyl)ethanone |
|---|
| Molecular Formula | C14H11ClN2O3 |
|---|---|
| Molecular Weight | 290.70200 |
| Exact Mass | 290.04600 |
| PSA | 74.92000 |
| LogP | 4.13920 |
| InChIKey | CCWZHCBKGWKJOV-UHFFFAOYSA-N |
| SMILES | O=C(CNc1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
|
~75%
2-(4-chloroanil... CAS#:74620-65-8 |
| Literature: Porretta; Chimenti; Biava; Bolasco; Scalzo; Panico; Simonetti; Villa Farmaco, Edizione Scientifica, 1985 , vol. 40, # 8 p. 589 - 607 |
|
~%
2-(4-chloroanil... CAS#:74620-65-8 |
| Literature: Lee, Ikchoon; Shim, Chang Sub; Chung, Soo Young; Lee, Hai Whang Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 975 - 982 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |