zinc,bis(trimethylsilyl)methyl-trimethylsilane structure
|
Common Name | zinc,bis(trimethylsilyl)methyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 74357-48-5 | Molecular Weight | 528.53600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H54Si6Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | zinc,bis(trimethylsilyl)methyl-trimethylsilane |
|---|
| Molecular Formula | C20H54Si6Zn |
|---|---|
| Molecular Weight | 528.53600 |
| Exact Mass | 526.21300 |
| LogP | 7.66450 |
| InChIKey | BDGRRZWMPVJXMP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.[Zn+2] |
|
~60%
zinc,bis(trimet... CAS#:74357-48-5 |
| Literature: Westerhausen, Matthias; Rademacher, Bernd; Poll, Wolfgang Journal of Organometallic Chemistry, 1991 , vol. 421, # 2-3 p. 175 - 188 |
|
~41%
zinc,bis(trimet... CAS#:74357-48-5 |
| Literature: Eaborn, Colin; Retta, Negussie; Smith, J. David Journal of Organometallic Chemistry, 1980 , vol. 190, # 1 p. 101 - 106 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |