(NZ)-N-butan-2-ylidenehydroxylamine,1,3-diisocyanato-2-methylbenzene,oxepan-2-one
Modify Date: 2025-09-19 12:05:05
(NZ)-N-butan-2-ylidenehydroxylamine,1,3-diisocyanato-2-methylbenzene,oxepan-2-one structure
|
Common Name | (NZ)-N-butan-2-ylidenehydroxylamine,1,3-diisocyanato-2-methylbenzene,oxepan-2-one | ||
|---|---|---|---|---|
| CAS Number | 73003-56-2 | Molecular Weight | 375.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (NZ)-N-butan-2-ylidenehydroxylamine,1,3-diisocyanato-2-methylbenzene,oxepan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H25N3O5 |
|---|---|
| Molecular Weight | 375.41900 |
| Exact Mass | 375.17900 |
| PSA | 117.75000 |
| LogP | 4.27970 |
| InChIKey | MKLCIQDLOIJUDY-XMOYFUIDSA-N |
| SMILES | CCC(C)=NO.Cc1c(N=C=O)cccc1N=C=O.O=C1CCCCCO1 |
| 2-Oxepanone,polymer with 2-butanone oxime and 1,3-diisocyanatomethylbenzene |
| 1,3-Diisocyanatomethylbenzene,2-oxepanone,2-butanone oxime polymer |