2-pentyl-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione structure
|
Common Name | 2-pentyl-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 7247-81-6 | Molecular Weight | 237.29500 | |
| Density | 1.176g/cm3 | Boiling Point | 388.5ºC at 760 mmHg | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.7ºC | |
| Name | 2-pentyl-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 388.5ºC at 760 mmHg |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29500 |
| Flash Point | 188.7ºC |
| Exact Mass | 237.13600 |
| PSA | 46.61000 |
| LogP | 1.27690 |
| Index of Refraction | 1.523 |
| InChIKey | SHCKCMTWLHAGJR-UHFFFAOYSA-N |
| SMILES | CCCCCN1C(=O)C2C3CCC(O3)C2C1=O |
|
~%
2-pentyl-3a,4,5... CAS#:7247-81-6 |
| Literature: Grogan,C.H.; Rice,L.M. Journal of Medicinal Chemistry, 1963 , vol. 6, p. 802 - 805 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| exo-cis-7-Oxa-bicyclo<2.2.1>heptan-dicarbonsaeure-(2,3)-<pyridyl-(2)-imid> |
| 2-pyridin-2-yl-(3at,7at)-hexahydro-4r,7c-epioxido-isoindole-1,3-dione |
| 2-pentyl-(3at,7at)-hexahydro-4r,7c-epioxido-isoindole-1,3-dione |
| exo-cis-7-Oxa-bicyclo<2.2.1>heptan-dicarbonsaeure-(2,3)-pentylimid |